mirror of
https://github.com/onyx-and-iris/gobs-cli.git
synced 2026-01-02 20:17:51 +00:00
first commit
This commit is contained in:
commit
b0d2d9386f
29
.github/workflows/golang-ci.yml
vendored
Normal file
29
.github/workflows/golang-ci.yml
vendored
Normal file
@ -0,0 +1,29 @@
|
|||||||
|
name: CI
|
||||||
|
|
||||||
|
on:
|
||||||
|
push:
|
||||||
|
branches: [ "main" ]
|
||||||
|
paths:
|
||||||
|
- '**.go'
|
||||||
|
pull_request:
|
||||||
|
branches: [ "main" ]
|
||||||
|
paths:
|
||||||
|
- '**.go'
|
||||||
|
jobs:
|
||||||
|
lint:
|
||||||
|
name: Lint
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
if: github.event_name == 'pull_request'
|
||||||
|
timeout-minutes: 3
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@v4
|
||||||
|
with:
|
||||||
|
fetch-depth: 1
|
||||||
|
- name: Setup Go
|
||||||
|
uses: actions/setup-go@v5
|
||||||
|
with:
|
||||||
|
go-version: '1.24'
|
||||||
|
- name: Install golangci-lint
|
||||||
|
run: go install github.com/golangci/golangci-lint/cmd/golangci-lint@latest
|
||||||
|
- name: Run golangci-lint
|
||||||
|
run: golangci-lint run ./...
|
||||||
31
.github/workflows/release.yml
vendored
Normal file
31
.github/workflows/release.yml
vendored
Normal file
@ -0,0 +1,31 @@
|
|||||||
|
name: goreleaser
|
||||||
|
|
||||||
|
on:
|
||||||
|
push:
|
||||||
|
tags:
|
||||||
|
- 'v*' # Push events to matching v*, i.e. v1.0, v20.15.10
|
||||||
|
|
||||||
|
permissions:
|
||||||
|
contents: write
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
goreleaser:
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
steps:
|
||||||
|
-
|
||||||
|
name: Checkout
|
||||||
|
uses: actions/checkout@v4
|
||||||
|
with:
|
||||||
|
fetch-depth: 0
|
||||||
|
-
|
||||||
|
name: Set up Go
|
||||||
|
uses: actions/setup-go@v5
|
||||||
|
-
|
||||||
|
name: Run GoReleaser
|
||||||
|
uses: goreleaser/goreleaser-action@v6
|
||||||
|
with:
|
||||||
|
distribution: goreleaser
|
||||||
|
version: '~> v2'
|
||||||
|
args: release --clean
|
||||||
|
env:
|
||||||
|
GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
|
||||||
30
.gitignore
vendored
Normal file
30
.gitignore
vendored
Normal file
@ -0,0 +1,30 @@
|
|||||||
|
# Auto-generated .gitignore by gignore: github.com/onyx-and-iris/gignore
|
||||||
|
|
||||||
|
### Go ###
|
||||||
|
# If you prefer the allow list template instead of the deny list, see community template:
|
||||||
|
# https://github.com/github/gitignore/blob/main/community/Golang/Go.AllowList.gitignore
|
||||||
|
#
|
||||||
|
# Binaries for programs and plugins
|
||||||
|
*.exe
|
||||||
|
*.exe~
|
||||||
|
*.dll
|
||||||
|
*.so
|
||||||
|
*.dylib
|
||||||
|
bin/
|
||||||
|
|
||||||
|
# Test binary, built with `go test -c`
|
||||||
|
*.test
|
||||||
|
|
||||||
|
# Output of the go coverage tool, specifically when used with LiteIDE
|
||||||
|
*.out
|
||||||
|
|
||||||
|
# Dependency directories (remove the comment below to include it)
|
||||||
|
# vendor/
|
||||||
|
|
||||||
|
# Go workspace file
|
||||||
|
go.work
|
||||||
|
|
||||||
|
# End of gignore: github.com/onyx-and-iris/gignore
|
||||||
|
|
||||||
|
.envrc
|
||||||
|
*_test.go
|
||||||
52
.golangci.yml
Normal file
52
.golangci.yml
Normal file
@ -0,0 +1,52 @@
|
|||||||
|
run:
|
||||||
|
# timeout for analysis, e.g. 30s, 3m, default is 1m
|
||||||
|
timeout: 3m
|
||||||
|
# exclude test files
|
||||||
|
tests: true
|
||||||
|
|
||||||
|
linters:
|
||||||
|
# Set to true runs only fast linters.
|
||||||
|
# Good option for 'lint on save', pre-commit hook or CI.
|
||||||
|
fast: true
|
||||||
|
|
||||||
|
disable-all: true
|
||||||
|
|
||||||
|
enable:
|
||||||
|
- gosimple
|
||||||
|
- govet
|
||||||
|
- ineffassign
|
||||||
|
- staticcheck
|
||||||
|
- unused
|
||||||
|
- gofmt
|
||||||
|
- gofumpt
|
||||||
|
- misspell
|
||||||
|
- unparam
|
||||||
|
- gosec
|
||||||
|
- asciicheck
|
||||||
|
- errname
|
||||||
|
- gci
|
||||||
|
- godot
|
||||||
|
- goimports
|
||||||
|
- revive
|
||||||
|
|
||||||
|
linters-settings:
|
||||||
|
gofmt:
|
||||||
|
rewrite-rules:
|
||||||
|
- pattern: 'interface{}'
|
||||||
|
replacement: 'any'
|
||||||
|
- pattern: 'a[b:len(a)]'
|
||||||
|
replacement: 'a[b:]'
|
||||||
|
|
||||||
|
misspell:
|
||||||
|
locale: UK
|
||||||
|
|
||||||
|
errcheck:
|
||||||
|
check-type-assertions: true
|
||||||
|
|
||||||
|
issues:
|
||||||
|
max-same-issues: 0
|
||||||
|
max-issues-per-linter: 0
|
||||||
|
exclude-use-default: false
|
||||||
|
exclude:
|
||||||
|
# gosec: Duplicated errcheck checks
|
||||||
|
- G104
|
||||||
48
.goreleaser.yaml
Normal file
48
.goreleaser.yaml
Normal file
@ -0,0 +1,48 @@
|
|||||||
|
version: 2
|
||||||
|
|
||||||
|
before:
|
||||||
|
hooks:
|
||||||
|
# You may remove this if you don't use go modules.
|
||||||
|
- go mod tidy
|
||||||
|
# you may remove this if you don't need go generate
|
||||||
|
- go generate ./...
|
||||||
|
|
||||||
|
builds:
|
||||||
|
- env:
|
||||||
|
- CGO_ENABLED=0
|
||||||
|
goos:
|
||||||
|
- linux
|
||||||
|
- darwin
|
||||||
|
- windows
|
||||||
|
goarch:
|
||||||
|
- amd64
|
||||||
|
- arm64
|
||||||
|
|
||||||
|
archives:
|
||||||
|
- formats: ['tar.gz']
|
||||||
|
# this name template makes the OS and Arch compatible with the results of `uname`.
|
||||||
|
name_template: >-
|
||||||
|
{{ .ProjectName }}_
|
||||||
|
{{- title .Os }}_
|
||||||
|
{{- if eq .Arch "amd64" }}x86_64
|
||||||
|
{{- else if eq .Arch "386" }}i386
|
||||||
|
{{- else }}{{ .Arch }}{{ end }}
|
||||||
|
{{- if .Arm }}v{{ .Arm }}{{ end }}
|
||||||
|
# use zip for windows archives
|
||||||
|
format_overrides:
|
||||||
|
- goos: windows
|
||||||
|
formats: ['zip']
|
||||||
|
|
||||||
|
changelog:
|
||||||
|
sort: asc
|
||||||
|
filters:
|
||||||
|
exclude:
|
||||||
|
- '^docs:'
|
||||||
|
- '^test:'
|
||||||
|
|
||||||
|
release:
|
||||||
|
footer: >-
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
Released by [GoReleaser](https://github.com/goreleaser/goreleaser).
|
||||||
12
CHANGELOG.md
Normal file
12
CHANGELOG.md
Normal file
@ -0,0 +1,12 @@
|
|||||||
|
# Changelog
|
||||||
|
|
||||||
|
All notable changes to this project will be documented in this file.
|
||||||
|
|
||||||
|
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
||||||
|
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
||||||
|
|
||||||
|
# [0.1.0] - 2025-04-24
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Initial release.
|
||||||
401
README.md
Normal file
401
README.md
Normal file
@ -0,0 +1,401 @@
|
|||||||
|
# gobs-cli
|
||||||
|
|
||||||
|
A command line interface for OBS Websocket v5
|
||||||
|
|
||||||
|
For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)
|
||||||
|
|
||||||
|
## Configuration
|
||||||
|
|
||||||
|
#### Flags
|
||||||
|
|
||||||
|
Pass `--host`, `--port` and `--password` as flags to the root command, for example:
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli --host=localhost --port=4455 --password=<websocket password> --help
|
||||||
|
```
|
||||||
|
|
||||||
|
#### Environment Variables
|
||||||
|
|
||||||
|
Load connection details from your environment:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
#!/usr/bin/env bash
|
||||||
|
|
||||||
|
export OBS_HOST=localhost
|
||||||
|
export OBS_PORT=4455
|
||||||
|
export OBS_PASSWORD=<websocket password>
|
||||||
|
export OBS_TIMEOUT=5
|
||||||
|
```
|
||||||
|
|
||||||
|
## Commands
|
||||||
|
|
||||||
|
### VersionCmd
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli version
|
||||||
|
```
|
||||||
|
|
||||||
|
### SceneCmd
|
||||||
|
|
||||||
|
- list: List all scenes.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli scene list
|
||||||
|
```
|
||||||
|
|
||||||
|
- current: Get the current scene.
|
||||||
|
- flags:
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- --preview: Preview scene.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli scene current
|
||||||
|
|
||||||
|
gobs-cli scene current --preview
|
||||||
|
```
|
||||||
|
|
||||||
|
- switch: Switch to a scene.
|
||||||
|
- flags:
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- --preview: Preview scene.
|
||||||
|
- args: SceneName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli scene switch LIVE
|
||||||
|
|
||||||
|
gobs-cli scene switch --preview LIVE
|
||||||
|
```
|
||||||
|
|
||||||
|
### SceneItemCmd
|
||||||
|
|
||||||
|
- list: List all scene items.
|
||||||
|
- args: SceneName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli sceneitem list LIVE
|
||||||
|
```
|
||||||
|
|
||||||
|
- show: Show scene item.
|
||||||
|
- flags:
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- --parent: Parent group name.
|
||||||
|
- args: SceneName ItemName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli sceneitem show START "Colour Source"
|
||||||
|
```
|
||||||
|
|
||||||
|
- hide: Hide scene item.
|
||||||
|
- flags:
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- --parent: Parent group name.
|
||||||
|
- args: SceneName ItemName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli sceneitem hide START "Colour Source"
|
||||||
|
```
|
||||||
|
|
||||||
|
- toggle: Toggle scene item.
|
||||||
|
- flags:
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- --parent: Parent group name.
|
||||||
|
- args: SceneName ItemName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli sceneitem toggle --parent=test_group START "Colour Source 3"
|
||||||
|
```
|
||||||
|
|
||||||
|
- visible: Get scene item visibility.
|
||||||
|
- flags:
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- --parent: Parent group name.
|
||||||
|
- args: SceneName ItemName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli sceneitem visible --parent=test_group START "Colour Source 4"
|
||||||
|
```
|
||||||
|
|
||||||
|
### GroupCmd
|
||||||
|
|
||||||
|
- list: List all groups.
|
||||||
|
- args: SceneName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli group list START
|
||||||
|
```
|
||||||
|
|
||||||
|
- show: Show group details.
|
||||||
|
- args: SceneName GroupName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli group show START "test_group"
|
||||||
|
```
|
||||||
|
|
||||||
|
- hide: Hide group.
|
||||||
|
- args: SceneName GroupName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli group hide START "test_group"
|
||||||
|
```
|
||||||
|
|
||||||
|
- toggle: Toggle group.
|
||||||
|
- args: SceneName GroupName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli group toggle START "test_group"
|
||||||
|
```
|
||||||
|
|
||||||
|
- status: Get group status.
|
||||||
|
- args: SceneName GroupName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli group status START "test_group"
|
||||||
|
```
|
||||||
|
|
||||||
|
### InputCmd
|
||||||
|
|
||||||
|
- list: List all inputs.
|
||||||
|
- flags:
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- --input: List all inputs.
|
||||||
|
- --output: List all outputs.
|
||||||
|
- --colour: List all colour sources.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli input list
|
||||||
|
|
||||||
|
gobs-cli input list --input --colour
|
||||||
|
```
|
||||||
|
|
||||||
|
- mute: Mute input.
|
||||||
|
- args: InputName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli input mute "Mic/Aux"
|
||||||
|
```
|
||||||
|
|
||||||
|
- unmute: Unmute input.
|
||||||
|
- args: InputName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli input unmute "Mic/Aux"
|
||||||
|
```
|
||||||
|
|
||||||
|
- toggle: Toggle input.
|
||||||
|
- args: InputName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli input toggle "Mic/Aux"
|
||||||
|
```
|
||||||
|
|
||||||
|
### RecordCmd
|
||||||
|
|
||||||
|
- start: Start recording.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli record start
|
||||||
|
```
|
||||||
|
|
||||||
|
- stop: Stop recording.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli record stop
|
||||||
|
```
|
||||||
|
|
||||||
|
- status: Get recording status.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli record status
|
||||||
|
```
|
||||||
|
|
||||||
|
- toggle: Toggle recording.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli record toggle
|
||||||
|
```
|
||||||
|
|
||||||
|
- pause: Pause recording.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli record pause
|
||||||
|
```
|
||||||
|
|
||||||
|
- resume: Resume recording.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli record resume
|
||||||
|
```
|
||||||
|
|
||||||
|
### StreamCmd
|
||||||
|
|
||||||
|
- start: Start streaming.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli stream start
|
||||||
|
```
|
||||||
|
|
||||||
|
- stop: Stop streaming.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli stream stop
|
||||||
|
```
|
||||||
|
|
||||||
|
- status: Get streaming status.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli stream status
|
||||||
|
```
|
||||||
|
|
||||||
|
- toggle: Toggle streaming.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli stream toggle
|
||||||
|
```
|
||||||
|
|
||||||
|
### SceneCollectionCmd
|
||||||
|
|
||||||
|
- list: List scene collections.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli scenecollection list
|
||||||
|
```
|
||||||
|
|
||||||
|
- current: Get current scene collection.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli scenecollection current
|
||||||
|
```
|
||||||
|
|
||||||
|
- switch: "Switch scene collection.
|
||||||
|
- args: Name
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli scenecollection switch test-collection
|
||||||
|
```
|
||||||
|
|
||||||
|
- create: Create scene collection.
|
||||||
|
- args: Name
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli scenecollection create test-collection
|
||||||
|
```
|
||||||
|
|
||||||
|
### ProfileCmd
|
||||||
|
|
||||||
|
- list: List profiles.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli profile list
|
||||||
|
```
|
||||||
|
|
||||||
|
- current: Get current profile.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli profile current
|
||||||
|
```
|
||||||
|
|
||||||
|
- switch: Switch profile.
|
||||||
|
- args: Name
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli profile switch test-collection
|
||||||
|
```
|
||||||
|
|
||||||
|
- create: Create profile.
|
||||||
|
- args: Name
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli profile create test-collection
|
||||||
|
```
|
||||||
|
|
||||||
|
- remove: Remove profile.
|
||||||
|
- args: Name
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli profile create test-collection
|
||||||
|
```
|
||||||
|
|
||||||
|
### ReplayBufferCmd
|
||||||
|
|
||||||
|
- start: Start replay buffer.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli replaybuffer start
|
||||||
|
```
|
||||||
|
|
||||||
|
- stop: Stop replay buffer.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli replaybuffer stop
|
||||||
|
```
|
||||||
|
|
||||||
|
- status: Get replay buffer status.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli replaybuffer status
|
||||||
|
```
|
||||||
|
|
||||||
|
- save: Save replay buffer.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli replaybuffer save
|
||||||
|
```
|
||||||
|
|
||||||
|
### StudioModeCmd
|
||||||
|
|
||||||
|
- enable: Enable studio mode.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli studiomode enable
|
||||||
|
```
|
||||||
|
|
||||||
|
- disable: Disable studio mode.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli studiomode disable
|
||||||
|
```
|
||||||
|
|
||||||
|
- toggle: Toggle studio mode.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli studiomode toggle
|
||||||
|
```
|
||||||
|
|
||||||
|
- status: Get studio mode status.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli studiomode status
|
||||||
|
```
|
||||||
|
|
||||||
|
### VirtualCamCmd
|
||||||
|
|
||||||
|
- start: Start virtual camera.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli virtualcam start
|
||||||
|
```
|
||||||
|
|
||||||
|
- stop: Stop virtual camera.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli virtualcam stop
|
||||||
|
```
|
||||||
|
|
||||||
|
- toggle: Toggle virtual camera.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli virtualcam toggle
|
||||||
|
```
|
||||||
|
|
||||||
|
- status: Get virtual camera status.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli virtualcam status
|
||||||
|
```
|
||||||
52
Taskfile.yaml
Normal file
52
Taskfile.yaml
Normal file
@ -0,0 +1,52 @@
|
|||||||
|
version: '3'
|
||||||
|
|
||||||
|
vars:
|
||||||
|
PROGRAM: gobs-cli
|
||||||
|
SHELL: '{{if eq .OS "Windows_NT"}}powershell{{end}}'
|
||||||
|
BIN_DIR: bin
|
||||||
|
|
||||||
|
tasks:
|
||||||
|
default:
|
||||||
|
desc: Build the gobs-cli project
|
||||||
|
cmds:
|
||||||
|
- task: build
|
||||||
|
|
||||||
|
build:
|
||||||
|
desc: Build the gobs-cli project
|
||||||
|
deps: [vet]
|
||||||
|
cmds:
|
||||||
|
- task: build-windows
|
||||||
|
- task: build-linux
|
||||||
|
|
||||||
|
vet:
|
||||||
|
desc: Vet the code
|
||||||
|
deps: [fmt]
|
||||||
|
cmds:
|
||||||
|
- go vet ./...
|
||||||
|
|
||||||
|
fmt:
|
||||||
|
desc: Fmt the code
|
||||||
|
cmds:
|
||||||
|
- go fmt ./...
|
||||||
|
|
||||||
|
build-windows:
|
||||||
|
desc: Build the gobs-cli project for Windows
|
||||||
|
cmds:
|
||||||
|
- GOOS=windows GOARCH=amd64 go build -o {{.BIN_DIR}}/{{.PROGRAM}}_windows_amd64.exe
|
||||||
|
internal: true
|
||||||
|
|
||||||
|
build-linux:
|
||||||
|
desc: Build the gobs-cli project for Linux
|
||||||
|
cmds:
|
||||||
|
- GOOS=linux GOARCH=amd64 go build -o {{.BIN_DIR}}/{{.PROGRAM}}_linux_amd64
|
||||||
|
internal: true
|
||||||
|
|
||||||
|
test:
|
||||||
|
desc: Run tests
|
||||||
|
cmds:
|
||||||
|
- go test ./...
|
||||||
|
|
||||||
|
clean:
|
||||||
|
desc: Clean the build artifacts
|
||||||
|
cmds:
|
||||||
|
- '{{.SHELL}} rm -r {{.BIN_DIR}}'
|
||||||
17
go.mod
Normal file
17
go.mod
Normal file
@ -0,0 +1,17 @@
|
|||||||
|
module github.com/onyx-and-iris/gobs-cli
|
||||||
|
|
||||||
|
go 1.24.0
|
||||||
|
|
||||||
|
require (
|
||||||
|
github.com/alecthomas/kong v1.10.0
|
||||||
|
github.com/andreykaipov/goobs v1.5.6
|
||||||
|
)
|
||||||
|
|
||||||
|
require (
|
||||||
|
github.com/buger/jsonparser v1.1.1 // indirect
|
||||||
|
github.com/gorilla/websocket v1.5.3 // indirect
|
||||||
|
github.com/hashicorp/logutils v1.0.0 // indirect
|
||||||
|
github.com/mitchellh/mapstructure v1.5.0 // indirect
|
||||||
|
github.com/mmcloughlin/profile v0.1.1 // indirect
|
||||||
|
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d // indirect
|
||||||
|
)
|
||||||
30
go.sum
Normal file
30
go.sum
Normal file
@ -0,0 +1,30 @@
|
|||||||
|
github.com/alecthomas/assert/v2 v2.11.0 h1:2Q9r3ki8+JYXvGsDyBXwH3LcJ+WK5D0gc5E8vS6K3D0=
|
||||||
|
github.com/alecthomas/assert/v2 v2.11.0/go.mod h1:Bze95FyfUr7x34QZrjL+XP+0qgp/zg8yS+TtBj1WA3k=
|
||||||
|
github.com/alecthomas/kong v1.10.0 h1:8K4rGDpT7Iu+jEXCIJUeKqvpwZHbsFRoebLbnzlmrpw=
|
||||||
|
github.com/alecthomas/kong v1.10.0/go.mod h1:p2vqieVMeTAnaC83txKtXe8FLke2X07aruPWXyMPQrU=
|
||||||
|
github.com/alecthomas/repr v0.4.0 h1:GhI2A8MACjfegCPVq9f1FLvIBS+DrQ2KQBFZP1iFzXc=
|
||||||
|
github.com/alecthomas/repr v0.4.0/go.mod h1:Fr0507jx4eOXV7AlPV6AVZLYrLIuIeSOWtW57eE/O/4=
|
||||||
|
github.com/andreykaipov/goobs v1.5.6 h1:eIkEqYN99+2VJvmlY/56Ah60nkRKS6efMQvpM3oUgPQ=
|
||||||
|
github.com/andreykaipov/goobs v1.5.6/go.mod h1:iSZP93FJ4d9X/U1x4DD4IyILLtig+vViqZWBGjLywcY=
|
||||||
|
github.com/buger/jsonparser v1.1.1 h1:2PnMjfWD7wBILjqQbt530v576A/cAbQvEW9gGIpYMUs=
|
||||||
|
github.com/buger/jsonparser v1.1.1/go.mod h1:6RYKKt7H4d4+iWqouImQ9R2FZql3VbhNgx27UK13J/0=
|
||||||
|
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||||
|
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||||
|
github.com/gorilla/websocket v1.5.3 h1:saDtZ6Pbx/0u+bgYQ3q96pZgCzfhKXGPqt7kZ72aNNg=
|
||||||
|
github.com/gorilla/websocket v1.5.3/go.mod h1:YR8l580nyteQvAITg2hZ9XVh4b55+EU/adAjf1fMHhE=
|
||||||
|
github.com/hashicorp/logutils v1.0.0 h1:dLEQVugN8vlakKOUE3ihGLTZJRB4j+M2cdTm/ORI65Y=
|
||||||
|
github.com/hashicorp/logutils v1.0.0/go.mod h1:QIAnNjmIWmVIIkWDTG1z5v++HQmx9WQRO+LraFDTW64=
|
||||||
|
github.com/hexops/gotextdiff v1.0.3 h1:gitA9+qJrrTCsiCl7+kh75nPqQt1cx4ZkudSTLoUqJM=
|
||||||
|
github.com/hexops/gotextdiff v1.0.3/go.mod h1:pSWU5MAI3yDq+fZBTazCSJysOMbxWL1BSow5/V2vxeg=
|
||||||
|
github.com/mitchellh/mapstructure v1.5.0 h1:jeMsZIYE/09sWLaz43PL7Gy6RuMjD2eJVyuac5Z2hdY=
|
||||||
|
github.com/mitchellh/mapstructure v1.5.0/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo=
|
||||||
|
github.com/mmcloughlin/profile v0.1.1 h1:jhDmAqPyebOsVDOCICJoINoLb/AnLBaUw58nFzxWS2w=
|
||||||
|
github.com/mmcloughlin/profile v0.1.1/go.mod h1:IhHD7q1ooxgwTgjxQYkACGA77oFTDdFVejUS1/tS/qU=
|
||||||
|
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d h1:VhgPp6v9qf9Agr/56bj7Y/xa04UccTW04VP0Qed4vnQ=
|
||||||
|
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d/go.mod h1:YUTz3bUH2ZwIWBy3CJBeOBEugqcmXREj14T+iG/4k4U=
|
||||||
|
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||||
|
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||||
|
github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA=
|
||||||
|
github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
|
||||||
|
gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
|
||||||
|
gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
||||||
173
group.go
Normal file
173
group.go
Normal file
@ -0,0 +1,173 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
||||||
|
)
|
||||||
|
|
||||||
|
// GroupCmd provides commands to manage groups in OBS Studio.
|
||||||
|
type GroupCmd struct {
|
||||||
|
List GroupListCmd `cmd:"" help:"List all groups." aliases:"ls"`
|
||||||
|
Show GroupShowCmd `cmd:"" help:"Show group details." aliases:"sh"`
|
||||||
|
Hide GroupHideCmd `cmd:"" help:"Hide group." aliases:"h"`
|
||||||
|
Toggle GroupToggleCmd `cmd:"" help:"Toggle group." aliases:"tg"`
|
||||||
|
Status GroupStatusCmd `cmd:"" help:"Get group status." aliases:"ss"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// GroupListCmd provides a command to list all groups in a scene.
|
||||||
|
type GroupListCmd struct {
|
||||||
|
SceneName string `arg:"" help:"Name of the scene to list groups from."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to list all groups in a scene.
|
||||||
|
func (cmd *GroupListCmd) Run(ctx *context) error {
|
||||||
|
resp, err := ctx.Client.SceneItems.GetSceneItemList(sceneitems.NewGetSceneItemListParams().
|
||||||
|
WithSceneName(cmd.SceneName))
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get scene item list: %w", err)
|
||||||
|
}
|
||||||
|
for _, item := range resp.SceneItems {
|
||||||
|
if item.IsGroup {
|
||||||
|
fmt.Fprintf(ctx.Out, "Group ID: %d, Source Name: %s\n", item.SceneItemID, item.SourceName)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// GroupShowCmd provides a command to show a group in a scene.
|
||||||
|
type GroupShowCmd struct {
|
||||||
|
SceneName string `arg:"" help:"Name of the scene to show group from."`
|
||||||
|
GroupName string `arg:"" help:"Name of the group to show."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to show a group in a scene.
|
||||||
|
func (cmd *GroupShowCmd) Run(ctx *context) error {
|
||||||
|
resp, err := ctx.Client.SceneItems.GetSceneItemList(sceneitems.NewGetSceneItemListParams().
|
||||||
|
WithSceneName(cmd.SceneName))
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get scene item list: %w", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
var found bool
|
||||||
|
for _, item := range resp.SceneItems {
|
||||||
|
if item.IsGroup && item.SourceName == cmd.GroupName {
|
||||||
|
_, err := ctx.Client.SceneItems.SetSceneItemEnabled(sceneitems.NewSetSceneItemEnabledParams().
|
||||||
|
WithSceneName(cmd.SceneName).
|
||||||
|
WithSceneItemId(item.SceneItemID).
|
||||||
|
WithSceneItemEnabled(true))
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
||||||
|
}
|
||||||
|
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", cmd.GroupName)
|
||||||
|
found = true
|
||||||
|
break
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if !found {
|
||||||
|
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// GroupHideCmd provides a command to hide a group in a scene.
|
||||||
|
type GroupHideCmd struct {
|
||||||
|
SceneName string `arg:"" help:"Name of the scene to hide group from."`
|
||||||
|
GroupName string `arg:"" help:"Name of the group to hide."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to hide a group in a scene.
|
||||||
|
func (cmd *GroupHideCmd) Run(ctx *context) error {
|
||||||
|
resp, err := ctx.Client.SceneItems.GetSceneItemList(sceneitems.NewGetSceneItemListParams().
|
||||||
|
WithSceneName(cmd.SceneName))
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get scene item list: %w", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
var found bool
|
||||||
|
for _, item := range resp.SceneItems {
|
||||||
|
if item.IsGroup && item.SourceName == cmd.GroupName {
|
||||||
|
_, err := ctx.Client.SceneItems.SetSceneItemEnabled(sceneitems.NewSetSceneItemEnabledParams().
|
||||||
|
WithSceneName(cmd.SceneName).
|
||||||
|
WithSceneItemId(item.SceneItemID).
|
||||||
|
WithSceneItemEnabled(false))
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
||||||
|
}
|
||||||
|
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", cmd.GroupName)
|
||||||
|
found = true
|
||||||
|
break
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if !found {
|
||||||
|
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// GroupToggleCmd provides a command to toggle a group in a scene.
|
||||||
|
type GroupToggleCmd struct {
|
||||||
|
SceneName string `arg:"" help:"Name of the scene to toggle group from."`
|
||||||
|
GroupName string `arg:"" help:"Name of the group to toggle."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to toggle a group in a scene.
|
||||||
|
func (cmd *GroupToggleCmd) Run(ctx *context) error {
|
||||||
|
resp, err := ctx.Client.SceneItems.GetSceneItemList(sceneitems.NewGetSceneItemListParams().
|
||||||
|
WithSceneName(cmd.SceneName))
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get scene item list: %w", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
var found bool
|
||||||
|
for _, item := range resp.SceneItems {
|
||||||
|
if item.IsGroup && item.SourceName == cmd.GroupName {
|
||||||
|
newState := !item.SceneItemEnabled
|
||||||
|
_, err := ctx.Client.SceneItems.SetSceneItemEnabled(sceneitems.NewSetSceneItemEnabledParams().
|
||||||
|
WithSceneName(cmd.SceneName).
|
||||||
|
WithSceneItemId(item.SceneItemID).
|
||||||
|
WithSceneItemEnabled(newState))
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
||||||
|
}
|
||||||
|
if newState {
|
||||||
|
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", cmd.GroupName)
|
||||||
|
} else {
|
||||||
|
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", cmd.GroupName)
|
||||||
|
}
|
||||||
|
found = true
|
||||||
|
break
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if !found {
|
||||||
|
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// GroupStatusCmd provides a command to get the status of a group in a scene.
|
||||||
|
type GroupStatusCmd struct {
|
||||||
|
SceneName string `arg:"" help:"Name of the scene to get group status from."`
|
||||||
|
GroupName string `arg:"" help:"Name of the group to get status."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to get the status of a group in a scene.
|
||||||
|
func (cmd *GroupStatusCmd) Run(ctx *context) error {
|
||||||
|
resp, err := ctx.Client.SceneItems.GetSceneItemList(sceneitems.NewGetSceneItemListParams().
|
||||||
|
WithSceneName(cmd.SceneName))
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get scene item list: %w", err)
|
||||||
|
}
|
||||||
|
for _, item := range resp.SceneItems {
|
||||||
|
if item.IsGroup && item.SourceName == cmd.GroupName {
|
||||||
|
if item.SceneItemEnabled {
|
||||||
|
fmt.Fprintf(ctx.Out, "Group %s is shown.\n", cmd.GroupName)
|
||||||
|
} else {
|
||||||
|
fmt.Fprintf(ctx.Out, "Group %s is hidden.\n", cmd.GroupName)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
||||||
|
}
|
||||||
114
input.go
Normal file
114
input.go
Normal file
@ -0,0 +1,114 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
"strings"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/inputs"
|
||||||
|
)
|
||||||
|
|
||||||
|
// InputCmd provides commands to manage inputs in OBS Studio.
|
||||||
|
type InputCmd struct {
|
||||||
|
List InputListCmd `cmd:"" help:"List all inputs." aliases:"ls"`
|
||||||
|
Mute InputMuteCmd `cmd:"" help:"Mute input." aliases:"m"`
|
||||||
|
Unmute InputUnmuteCmd `cmd:"" help:"Unmute input." aliases:"um"`
|
||||||
|
Toggle InputToggleCmd `cmd:"" help:"Toggle input." aliases:"tg"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// InputListCmd provides a command to list all inputs.
|
||||||
|
type InputListCmd struct {
|
||||||
|
Input bool `flag:"" help:"List all inputs." aliases:"i"`
|
||||||
|
Output bool `flag:"" help:"List all outputs." aliases:"o"`
|
||||||
|
Colour bool `flag:"" help:"List all colour sources." aliases:"c"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to list all inputs.
|
||||||
|
func (cmd *InputListCmd) Run(ctx *context) error {
|
||||||
|
resp, err := ctx.Client.Inputs.GetInputList(inputs.NewGetInputListParams())
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
for _, input := range resp.Inputs {
|
||||||
|
if cmd.Input && strings.Contains(input.InputKind, "input") {
|
||||||
|
fmt.Fprintln(ctx.Out, "Input:", input.InputName)
|
||||||
|
}
|
||||||
|
if cmd.Output && strings.Contains(input.InputKind, "output") {
|
||||||
|
fmt.Fprintln(ctx.Out, "Output:", input.InputName)
|
||||||
|
}
|
||||||
|
if cmd.Colour && strings.Contains(input.InputKind, "color") { // nolint
|
||||||
|
fmt.Fprintln(ctx.Out, "Colour Source:", input.InputName)
|
||||||
|
}
|
||||||
|
|
||||||
|
if !cmd.Input && !cmd.Output && !cmd.Colour {
|
||||||
|
fmt.Fprintln(ctx.Out, "Source:", input.InputName)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// InputMuteCmd provides a command to mute an input.
|
||||||
|
type InputMuteCmd struct {
|
||||||
|
InputName string `arg:"" help:"Name of the input to mute."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to mute an input.
|
||||||
|
func (cmd *InputMuteCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Inputs.SetInputMute(
|
||||||
|
inputs.NewSetInputMuteParams().WithInputName(cmd.InputName).WithInputMuted(true),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to mute input: %w", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintf(ctx.Out, "Muted input: %s\n", cmd.InputName)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// InputUnmuteCmd provides a command to unmute an input.
|
||||||
|
type InputUnmuteCmd struct {
|
||||||
|
InputName string `arg:"" help:"Name of the input to unmute."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to unmute an input.
|
||||||
|
func (cmd *InputUnmuteCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Inputs.SetInputMute(
|
||||||
|
inputs.NewSetInputMuteParams().WithInputName(cmd.InputName).WithInputMuted(false),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to unmute input: %w", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", cmd.InputName)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// InputToggleCmd provides a command to toggle the mute state of an input.
|
||||||
|
type InputToggleCmd struct {
|
||||||
|
InputName string `arg:"" help:"Name of the input to toggle."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to toggle the mute state of an input.
|
||||||
|
func (cmd *InputToggleCmd) Run(ctx *context) error {
|
||||||
|
// Get the current mute state of the input
|
||||||
|
resp, err := ctx.Client.Inputs.GetInputMute(
|
||||||
|
inputs.NewGetInputMuteParams().WithInputName(cmd.InputName),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get input mute state: %w", err)
|
||||||
|
}
|
||||||
|
// Toggle the mute state
|
||||||
|
newMuteState := !resp.InputMuted
|
||||||
|
_, err = ctx.Client.Inputs.SetInputMute(
|
||||||
|
inputs.NewSetInputMuteParams().WithInputName(cmd.InputName).WithInputMuted(newMuteState),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to toggle input mute state: %w", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
if newMuteState {
|
||||||
|
fmt.Fprintf(ctx.Out, "Muted input: %s\n", cmd.InputName)
|
||||||
|
} else {
|
||||||
|
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", cmd.InputName)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
94
main.go
Normal file
94
main.go
Normal file
@ -0,0 +1,94 @@
|
|||||||
|
// Package main provides a command-line interface (CLI) tool for interacting with OBS WebSocket.
|
||||||
|
// It allows users to manage various aspects of OBS, such as scenes, inputs, recording, streaming,
|
||||||
|
// and more, by leveraging the goobs library for communication with the OBS WebSocket server.
|
||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
"io"
|
||||||
|
"os"
|
||||||
|
"time"
|
||||||
|
|
||||||
|
"github.com/alecthomas/kong"
|
||||||
|
"github.com/andreykaipov/goobs"
|
||||||
|
)
|
||||||
|
|
||||||
|
// ObsConfig holds the configuration for connecting to the OBS WebSocket server.
|
||||||
|
type ObsConfig struct {
|
||||||
|
Host string `flag:"host" help:"Host to connect to." default:"localhost" env:"OBS_HOST"`
|
||||||
|
Port int `flag:"port" help:"Port to connect to." default:"4455" env:"OBS_PORT"`
|
||||||
|
Password string `flag:"password" help:"Password for authentication." default:"" env:"OBS_PASSWORD"`
|
||||||
|
Timeout int `flag:"timeout" help:"Timeout in seconds." default:"5" env:"OBS_TIMEOUT"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// cli is the main command line interface structure.
|
||||||
|
// It embeds the ObsConfig struct to inherit its fields and flags.
|
||||||
|
type cli struct {
|
||||||
|
ObsConfig `embed:"" help:"OBS WebSocket configuration."`
|
||||||
|
|
||||||
|
Version VersionCmd `help:"Show version." cmd:"" aliases:"v"`
|
||||||
|
Scene SceneCmd `help:"Manage scenes." cmd:"" aliases:"sc"`
|
||||||
|
Sceneitem SceneItemCmd `help:"Manage scene items." cmd:"" aliases:"si"`
|
||||||
|
Group GroupCmd `help:"Manage groups." cmd:"" aliases:"g"`
|
||||||
|
Input InputCmd `help:"Manage inputs." cmd:"" aliases:"i"`
|
||||||
|
Record RecordCmd `help:"Manage recording." cmd:"" aliases:"rec"`
|
||||||
|
Stream StreamCmd `help:"Manage streaming." cmd:"" aliases:"st"`
|
||||||
|
Scenecollection SceneCollectionCmd `help:"Manage scene collections." cmd:"" aliases:"scn"`
|
||||||
|
Profile ProfileCmd `help:"Manage profiles." cmd:"" aliases:"p"`
|
||||||
|
Replaybuffer ReplayBufferCmd `help:"Manage replay buffer." cmd:"" aliases:"rb"`
|
||||||
|
Studiomode StudioModeCmd `help:"Manage studio mode." cmd:"" aliases:"sm"`
|
||||||
|
Virtualcam VirtualCamCmd `help:"Manage virtual camera." cmd:"" aliases:"vc"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type context struct {
|
||||||
|
Client *goobs.Client
|
||||||
|
Out io.Writer
|
||||||
|
}
|
||||||
|
|
||||||
|
func main() {
|
||||||
|
var client *goobs.Client
|
||||||
|
cli := cli{}
|
||||||
|
ctx := kong.Parse(
|
||||||
|
&cli,
|
||||||
|
kong.Name("GOBS-CLI"),
|
||||||
|
kong.Description("A command line tool to interact with OBS Websocket."),
|
||||||
|
)
|
||||||
|
|
||||||
|
client, err := connectObs(cli.ObsConfig)
|
||||||
|
if err != nil {
|
||||||
|
ctx.FatalIfErrorf(err)
|
||||||
|
}
|
||||||
|
|
||||||
|
ctx.Bind(&context{
|
||||||
|
Client: client,
|
||||||
|
Out: os.Stdout,
|
||||||
|
})
|
||||||
|
|
||||||
|
ctx.FatalIfErrorf(run(ctx, client))
|
||||||
|
}
|
||||||
|
|
||||||
|
// connectObs creates a new OBS client and connects to the OBS WebSocket server.
|
||||||
|
func connectObs(cfg ObsConfig) (*goobs.Client, error) {
|
||||||
|
client, err := goobs.New(
|
||||||
|
fmt.Sprintf("%s:%d", cfg.Host, cfg.Port),
|
||||||
|
goobs.WithPassword(cfg.Password),
|
||||||
|
goobs.WithResponseTimeout(time.Duration(cfg.Timeout)*time.Second),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
return client, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// run executes the command line interface.
|
||||||
|
// It disconnects the OBS client after the command is executed.
|
||||||
|
func run(ctx *kong.Context, client *goobs.Client) error {
|
||||||
|
defer func() error {
|
||||||
|
if err := client.Disconnect(); err != nil {
|
||||||
|
return fmt.Errorf("failed to disconnect from OBS: %w", err)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}()
|
||||||
|
|
||||||
|
return ctx.Run()
|
||||||
|
}
|
||||||
131
profile.go
Normal file
131
profile.go
Normal file
@ -0,0 +1,131 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
"slices"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/config"
|
||||||
|
)
|
||||||
|
|
||||||
|
// ProfileCmd provides commands to manage profiles in OBS Studio.
|
||||||
|
type ProfileCmd struct {
|
||||||
|
List ListProfileCmd `help:"List profiles." cmd:"" aliases:"ls"`
|
||||||
|
Current CurrentProfileCmd `help:"Get current profile." cmd:"" aliases:"c"`
|
||||||
|
Switch SwitchProfileCmd `help:"Switch profile." cmd:"" aliases:"sw"`
|
||||||
|
Create CreateProfileCmd `help:"Create profile." cmd:"" aliases:"cr"`
|
||||||
|
Remove RemoveProfileCmd `help:"Remove profile." cmd:"" aliases:"rm"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// ListProfileCmd provides a command to list all profiles.
|
||||||
|
type ListProfileCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to list all profiles.
|
||||||
|
func (cmd *ListProfileCmd) Run(ctx *context) error {
|
||||||
|
profiles, err := ctx.Client.Config.GetProfileList()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
for _, profile := range profiles.Profiles {
|
||||||
|
fmt.Fprintln(ctx.Out, profile)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// CurrentProfileCmd provides a command to get the current profile.
|
||||||
|
type CurrentProfileCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to get the current profile.
|
||||||
|
func (cmd *CurrentProfileCmd) Run(ctx *context) error {
|
||||||
|
profiles, err := ctx.Client.Config.GetProfileList()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
fmt.Fprintf(ctx.Out, "Current profile: %s\n", profiles.CurrentProfileName)
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// SwitchProfileCmd provides a command to switch to a different profile.
|
||||||
|
type SwitchProfileCmd struct {
|
||||||
|
Name string `arg:"" help:"Name of the profile to switch to." required:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to switch to a different profile.
|
||||||
|
func (cmd *SwitchProfileCmd) Run(ctx *context) error {
|
||||||
|
profiles, err := ctx.Client.Config.GetProfileList()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
current := profiles.CurrentProfileName
|
||||||
|
|
||||||
|
if current == cmd.Name {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Config.SetCurrentProfile(config.NewSetCurrentProfileParams().WithProfileName(cmd.Name))
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintf(ctx.Out, "Switched from profile %s to %s\n", current, cmd.Name)
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// CreateProfileCmd provides a command to create a new profile.
|
||||||
|
type CreateProfileCmd struct {
|
||||||
|
Name string `arg:"" help:"Name of the profile to create." required:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to create a new profile.
|
||||||
|
func (cmd *CreateProfileCmd) Run(ctx *context) error {
|
||||||
|
profiles, err := ctx.Client.Config.GetProfileList()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if slices.Contains(profiles.Profiles, cmd.Name) {
|
||||||
|
return fmt.Errorf("profile %s already exists", cmd.Name)
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Config.CreateProfile(config.NewCreateProfileParams().WithProfileName(cmd.Name))
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintf(ctx.Out, "Created profile: %s\n", cmd.Name)
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// RemoveProfileCmd provides a command to remove an existing profile.
|
||||||
|
type RemoveProfileCmd struct {
|
||||||
|
Name string `arg:"" help:"Name of the profile to delete." required:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to remove an existing profile.
|
||||||
|
func (cmd *RemoveProfileCmd) Run(ctx *context) error {
|
||||||
|
profiles, err := ctx.Client.Config.GetProfileList()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if !slices.Contains(profiles.Profiles, cmd.Name) {
|
||||||
|
return fmt.Errorf("profile %s does not exist", cmd.Name)
|
||||||
|
}
|
||||||
|
|
||||||
|
if profiles.CurrentProfileName == cmd.Name {
|
||||||
|
return fmt.Errorf("cannot delete current profile %s", cmd.Name)
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Config.RemoveProfile(config.NewRemoveProfileParams().WithProfileName(cmd.Name))
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintf(ctx.Out, "Deleted profile: %s\n", cmd.Name)
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
119
record.go
Normal file
119
record.go
Normal file
@ -0,0 +1,119 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
)
|
||||||
|
|
||||||
|
// RecordCmd handles the recording commands.
|
||||||
|
type RecordCmd struct {
|
||||||
|
Start RecordStartCmd `cmd:"" help:"Start recording." aliases:"s"`
|
||||||
|
Stop RecordStopCmd `cmd:"" help:"Stop recording." aliases:"st"`
|
||||||
|
Toggle RecordToggleCmd `cmd:"" help:"Toggle recording." aliases:"tg"`
|
||||||
|
Pause RecordPauseCmd `cmd:"" help:"Pause recording." aliases:"p"`
|
||||||
|
Resume RecordResumeCmd `cmd:"" help:"Resume recording." aliases:"r"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// RecordStartCmd starts the recording.
|
||||||
|
type RecordStartCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to start recording.
|
||||||
|
func (cmd *RecordStartCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Record.StartRecord()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
fmt.Fprintln(ctx.Out, "Recording started successfully.")
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// RecordStopCmd stops the recording.
|
||||||
|
type RecordStopCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to stop recording.
|
||||||
|
func (cmd *RecordStopCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Record.StopRecord()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
fmt.Fprintln(ctx.Out, "Recording stopped successfully.")
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// RecordToggleCmd toggles the recording state.
|
||||||
|
type RecordToggleCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to toggle recording.
|
||||||
|
func (cmd *RecordToggleCmd) Run(ctx *context) error {
|
||||||
|
// Check if recording is in progress
|
||||||
|
status, err := ctx.Client.Record.GetRecordStatus()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if status.OutputActive {
|
||||||
|
_, err = ctx.Client.Record.StopRecord()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
fmt.Fprintln(ctx.Out, "Recording stopped successfully.")
|
||||||
|
} else {
|
||||||
|
_, err = ctx.Client.Record.StartRecord()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
fmt.Fprintln(ctx.Out, "Recording started successfully.")
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// RecordPauseCmd pauses the recording.
|
||||||
|
type RecordPauseCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to pause recording.
|
||||||
|
func (cmd *RecordPauseCmd) Run(ctx *context) error {
|
||||||
|
// Check if recording in progress and not already paused
|
||||||
|
status, err := ctx.Client.Record.GetRecordStatus()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
if !status.OutputActive {
|
||||||
|
return fmt.Errorf("recording is not in progress")
|
||||||
|
}
|
||||||
|
if status.OutputPaused {
|
||||||
|
return fmt.Errorf("recording is already paused")
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Record.PauseRecord()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, "Recording paused successfully.")
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// RecordResumeCmd resumes the recording.
|
||||||
|
type RecordResumeCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to resume recording.
|
||||||
|
func (cmd *RecordResumeCmd) Run(ctx *context) error {
|
||||||
|
// Check if recording in progress and not already resumed
|
||||||
|
status, err := ctx.Client.Record.GetRecordStatus()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
if !status.OutputActive {
|
||||||
|
return fmt.Errorf("recording is not in progress")
|
||||||
|
}
|
||||||
|
if !status.OutputPaused {
|
||||||
|
return fmt.Errorf("recording is not paused")
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Record.ResumeRecord()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, "Recording resumed successfully.")
|
||||||
|
return nil
|
||||||
|
}
|
||||||
63
replaybuffer.go
Normal file
63
replaybuffer.go
Normal file
@ -0,0 +1,63 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
)
|
||||||
|
|
||||||
|
// ReplayBufferCmd handles the recording commands.
|
||||||
|
type ReplayBufferCmd struct {
|
||||||
|
Start ReplayBufferStartCmd `help:"Start replay buffer." cmd:"" aliases:"s"`
|
||||||
|
Stop ReplayBufferStopCmd `help:"Stop replay buffer." cmd:"" aliases:"st"`
|
||||||
|
Status ReplayBufferStatusCmd `help:"Get replay buffer status." cmd:"" aliases:"ss"`
|
||||||
|
Save ReplayBufferSaveCmd `help:"Save replay buffer." cmd:"" aliases:"sv"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// ReplayBufferStartCmd starts the replay buffer.
|
||||||
|
type ReplayBufferStartCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to start the replay buffer.
|
||||||
|
func (cmd *ReplayBufferStartCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Outputs.StartReplayBuffer()
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
// ReplayBufferStopCmd stops the replay buffer.
|
||||||
|
type ReplayBufferStopCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to stop the replay buffer.
|
||||||
|
func (cmd *ReplayBufferStopCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Outputs.StopReplayBuffer()
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
// ReplayBufferStatusCmd retrieves the status of the replay buffer.
|
||||||
|
type ReplayBufferStatusCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to get the replay buffer status.
|
||||||
|
func (cmd *ReplayBufferStatusCmd) Run(ctx *context) error {
|
||||||
|
status, err := ctx.Client.Outputs.GetReplayBufferStatus()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if status.OutputActive {
|
||||||
|
fmt.Fprintln(ctx.Out, "Replay buffer is active.")
|
||||||
|
} else {
|
||||||
|
fmt.Fprintln(ctx.Out, "Replay buffer is not active.")
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// ReplayBufferSaveCmd saves the replay buffer.
|
||||||
|
type ReplayBufferSaveCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to save the replay buffer.
|
||||||
|
func (cmd *ReplayBufferSaveCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Outputs.SaveReplayBuffer()
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to save replay buffer: %w", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, "Replay buffer saved")
|
||||||
|
return nil
|
||||||
|
}
|
||||||
83
scene.go
Normal file
83
scene.go
Normal file
@ -0,0 +1,83 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
"slices"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/scenes"
|
||||||
|
)
|
||||||
|
|
||||||
|
// SceneCmd provides commands to manage scenes in OBS Studio.
|
||||||
|
type SceneCmd struct {
|
||||||
|
List SceneListCmd `cmd:"" help:"List all scenes." aliases:"ls"`
|
||||||
|
Current SceneCurrentCmd `cmd:"" help:"Get the current scene." aliases:"c"`
|
||||||
|
Switch SceneSwitchCmd `cmd:"" help:"Switch to a scene." aliases:"sw"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// SceneListCmd provides a command to list all scenes.
|
||||||
|
type SceneListCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to list all scenes.
|
||||||
|
func (cmd *SceneListCmd) Run(ctx *context) error {
|
||||||
|
scenes, err := ctx.Client.Scenes.GetSceneList()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
slices.Reverse(scenes.Scenes)
|
||||||
|
for _, scene := range scenes.Scenes {
|
||||||
|
fmt.Fprintln(ctx.Out, scene.SceneName)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// SceneCurrentCmd provides a command to get the current scene.
|
||||||
|
type SceneCurrentCmd struct {
|
||||||
|
Preview bool `flag:"" help:"Preview scene."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to get the current scene.
|
||||||
|
func (cmd *SceneCurrentCmd) Run(ctx *context) error {
|
||||||
|
if cmd.Preview {
|
||||||
|
scene, err := ctx.Client.Scenes.GetCurrentPreviewScene()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
fmt.Fprintln(ctx.Out, scene.SceneName)
|
||||||
|
} else {
|
||||||
|
scene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
fmt.Fprintln(ctx.Out, scene.SceneName)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// SceneSwitchCmd provides a command to switch to a different scene.
|
||||||
|
type SceneSwitchCmd struct {
|
||||||
|
Preview bool `flag:"" help:"Preview scene."`
|
||||||
|
NewScene string ` help:"Scene name to switch to." arg:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to switch to a different scene.
|
||||||
|
func (cmd *SceneSwitchCmd) Run(ctx *context) error {
|
||||||
|
if cmd.Preview {
|
||||||
|
_, err := ctx.Client.Scenes.SetCurrentPreviewScene(scenes.NewSetCurrentPreviewSceneParams().
|
||||||
|
WithSceneName(cmd.NewScene))
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, "Switched to preview scene:", cmd.NewScene)
|
||||||
|
} else {
|
||||||
|
_, err := ctx.Client.Scenes.SetCurrentProgramScene(scenes.NewSetCurrentProgramSceneParams().
|
||||||
|
WithSceneName(cmd.NewScene))
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, "Switched to program scene:", cmd.NewScene)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
93
scenecollection.go
Normal file
93
scenecollection.go
Normal file
@ -0,0 +1,93 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/config"
|
||||||
|
)
|
||||||
|
|
||||||
|
// SceneCollectionCmd provides commands to manage scene collections in OBS Studio.
|
||||||
|
type SceneCollectionCmd struct {
|
||||||
|
List ListSceneCollectionCmd `help:"List scene collections." cmd:"" aliases:"ls"`
|
||||||
|
Current CurrentSceneCollectionCmd `help:"Get current scene collection." cmd:"" aliases:"c"`
|
||||||
|
Switch SwitchSceneCollectionCmd `help:"Switch scene collection." cmd:"" aliases:"sw"`
|
||||||
|
Create CreateSceneCollectionCmd `help:"Create scene collection." cmd:"" aliases:"cr"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// ListSceneCollectionCmd provides a command to list all scene collections.
|
||||||
|
type ListSceneCollectionCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to list all scene collections.
|
||||||
|
func (cmd *ListSceneCollectionCmd) Run(ctx *context) error {
|
||||||
|
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get scene collection list: %w", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
for _, collection := range collections.SceneCollections {
|
||||||
|
fmt.Fprintln(ctx.Out, collection)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// CurrentSceneCollectionCmd provides a command to get the current scene collection.
|
||||||
|
type CurrentSceneCollectionCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to get the current scene collection.
|
||||||
|
func (cmd *CurrentSceneCollectionCmd) Run(ctx *context) error {
|
||||||
|
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get scene collection list: %w", err)
|
||||||
|
}
|
||||||
|
fmt.Fprintln(ctx.Out, collections.CurrentSceneCollectionName)
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// SwitchSceneCollectionCmd provides a command to switch to a different scene collection.
|
||||||
|
type SwitchSceneCollectionCmd struct {
|
||||||
|
Name string `arg:"" help:"Name of the scene collection to switch to." required:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to switch to a different scene collection.
|
||||||
|
func (cmd *SwitchSceneCollectionCmd) Run(ctx *context) error {
|
||||||
|
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
current := collections.CurrentSceneCollectionName
|
||||||
|
|
||||||
|
if current == cmd.Name {
|
||||||
|
return fmt.Errorf("scene collection %s is already active", cmd.Name)
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Config.SetCurrentSceneCollection(
|
||||||
|
config.NewSetCurrentSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to switch scene collection: %w", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintf(ctx.Out, "Switched to scene collection: %s\n", cmd.Name)
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// CreateSceneCollectionCmd provides a command to create a new scene collection.
|
||||||
|
type CreateSceneCollectionCmd struct {
|
||||||
|
Name string `arg:"" help:"Name of the scene collection to create." required:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to create a new scene collection.
|
||||||
|
func (cmd *CreateSceneCollectionCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Config.CreateSceneCollection(
|
||||||
|
config.NewCreateSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to create scene collection: %w", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintf(ctx.Out, "Created scene collection: %s\n", cmd.Name)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
183
sceneitem.go
Normal file
183
sceneitem.go
Normal file
@ -0,0 +1,183 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs"
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
||||||
|
)
|
||||||
|
|
||||||
|
// SceneItemCmd provides commands to manage scene items in OBS Studio.
|
||||||
|
type SceneItemCmd struct {
|
||||||
|
List SceneItemListCmd `cmd:"" help:"List all scene items." aliases:"ls"`
|
||||||
|
Show SceneItemShowCmd `cmd:"" help:"Show scene item." aliases:"sh"`
|
||||||
|
Hide SceneItemHideCmd `cmd:"" help:"Hide scene item." aliases:"h"`
|
||||||
|
Toggle SceneItemToggleCmd `cmd:"" help:"Toggle scene item." aliases:"tg"`
|
||||||
|
Visible SceneItemVisibleCmd `cmd:"" help:"Get scene item visibility." aliases:"v"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// SceneItemListCmd provides a command to list all scene items in a scene.
|
||||||
|
type SceneItemListCmd struct {
|
||||||
|
SceneName string `arg:"" help:"Scene name."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to list all scene items in a scene.
|
||||||
|
func (cmd *SceneItemListCmd) Run(ctx *context) error {
|
||||||
|
resp, err := ctx.Client.SceneItems.GetSceneItemList(sceneitems.NewGetSceneItemListParams().
|
||||||
|
WithSceneName(cmd.SceneName))
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get scene item list: %w", err)
|
||||||
|
}
|
||||||
|
for _, item := range resp.SceneItems {
|
||||||
|
fmt.Fprintf(ctx.Out, "Item ID: %d, Source Name: %s\n", item.SceneItemID, item.SourceName)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func getSceneNameAndItemID(
|
||||||
|
client *goobs.Client,
|
||||||
|
sceneName string,
|
||||||
|
itemName string,
|
||||||
|
parent string,
|
||||||
|
) (string, int, error) {
|
||||||
|
if parent != "" {
|
||||||
|
resp, err := client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
|
||||||
|
WithSceneName(parent))
|
||||||
|
if err != nil {
|
||||||
|
return "", 0, err
|
||||||
|
}
|
||||||
|
for _, item := range resp.SceneItems {
|
||||||
|
if item.SourceName == itemName {
|
||||||
|
return parent, int(item.SceneItemID), nil
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return "", 0, fmt.Errorf("item '%s' not found in scene '%s'", itemName, sceneName)
|
||||||
|
}
|
||||||
|
|
||||||
|
itemID, err := client.SceneItems.GetSceneItemId(sceneitems.NewGetSceneItemIdParams().
|
||||||
|
WithSceneName(sceneName).
|
||||||
|
WithSourceName(itemName))
|
||||||
|
if err != nil {
|
||||||
|
return "", 0, err
|
||||||
|
}
|
||||||
|
return sceneName, int(itemID.SceneItemId), nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// SceneItemShowCmd provides a command to show a scene item.
|
||||||
|
type SceneItemShowCmd struct {
|
||||||
|
Parent string `flag:"" help:"Parent group name."`
|
||||||
|
|
||||||
|
SceneName string `arg:"" help:"Scene name."`
|
||||||
|
ItemName string `arg:"" help:"Item name."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to show a scene item.
|
||||||
|
func (cmd *SceneItemShowCmd) Run(ctx *context) error {
|
||||||
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.SceneItems.SetSceneItemEnabled(sceneitems.NewSetSceneItemEnabledParams().
|
||||||
|
WithSceneName(sceneName).
|
||||||
|
WithSceneItemId(sceneItemID).
|
||||||
|
WithSceneItemEnabled(true))
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// SceneItemHideCmd provides a command to hide a scene item.
|
||||||
|
type SceneItemHideCmd struct {
|
||||||
|
Parent string `flag:"" help:"Parent group name."`
|
||||||
|
|
||||||
|
SceneName string `arg:"" help:"Scene name."`
|
||||||
|
ItemName string `arg:"" help:"Item name."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to hide a scene item.
|
||||||
|
func (cmd *SceneItemHideCmd) Run(ctx *context) error {
|
||||||
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.SceneItems.SetSceneItemEnabled(sceneitems.NewSetSceneItemEnabledParams().
|
||||||
|
WithSceneName(sceneName).
|
||||||
|
WithSceneItemId(sceneItemID).
|
||||||
|
WithSceneItemEnabled(false))
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// getItemEnabled retrieves the enabled status of a scene item.
|
||||||
|
func getItemEnabled(client *goobs.Client, sceneName string, itemID int) (bool, error) {
|
||||||
|
item, err := client.SceneItems.GetSceneItemEnabled(sceneitems.NewGetSceneItemEnabledParams().
|
||||||
|
WithSceneName(sceneName).
|
||||||
|
WithSceneItemId(itemID))
|
||||||
|
if err != nil {
|
||||||
|
return false, err
|
||||||
|
}
|
||||||
|
return item.SceneItemEnabled, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// SceneItemToggleCmd provides a command to toggle the visibility of a scene item.
|
||||||
|
type SceneItemToggleCmd struct {
|
||||||
|
Parent string `flag:"" help:"Parent group name."`
|
||||||
|
|
||||||
|
SceneName string `arg:"" help:"Scene name."`
|
||||||
|
ItemName string `arg:"" help:"Item name."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to toggle the visibility of a scene item.
|
||||||
|
func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
|
||||||
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
itemEnabled, err := getItemEnabled(ctx.Client, sceneName, sceneItemID)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.SceneItems.SetSceneItemEnabled(sceneitems.NewSetSceneItemEnabledParams().
|
||||||
|
WithSceneName(sceneName).
|
||||||
|
WithSceneItemId(sceneItemID).
|
||||||
|
WithSceneItemEnabled(!itemEnabled))
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// SceneItemVisibleCmd provides a command to check the visibility of a scene item.
|
||||||
|
type SceneItemVisibleCmd struct {
|
||||||
|
Parent string `flag:"" help:"Parent group name."`
|
||||||
|
|
||||||
|
SceneName string `arg:"" help:"Scene name."`
|
||||||
|
ItemName string `arg:"" help:"Item name."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to check the visibility of a scene item.
|
||||||
|
func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
|
||||||
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
itemEnabled, err := getItemEnabled(ctx.Client, sceneName, sceneItemID)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if itemEnabled {
|
||||||
|
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is visible.\n", cmd.ItemName, cmd.SceneName)
|
||||||
|
} else {
|
||||||
|
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is hidden.\n", cmd.ItemName, cmd.SceneName)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
82
stream.go
Normal file
82
stream.go
Normal file
@ -0,0 +1,82 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
)
|
||||||
|
|
||||||
|
// StreamCmd handles the streaming commands.
|
||||||
|
type StreamCmd struct {
|
||||||
|
Start StreamStartCmd `cmd:"" help:"Start streaming." aliases:"s"`
|
||||||
|
Stop StreamStopCmd `cmd:"" help:"Stop streaming." aliases:"st"`
|
||||||
|
Toggle StreamToggleCmd `cmd:"" help:"Toggle streaming." aliases:"tg"`
|
||||||
|
Status StreamStatusCmd `cmd:"" help:"Get streaming status." aliases:"ss"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// StreamStartCmd starts the stream.
|
||||||
|
type StreamStartCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to start streaming.
|
||||||
|
func (cmd *StreamStartCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Stream.StartStream()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// StreamStopCmd stops the stream.
|
||||||
|
type StreamStopCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to stop streaming.
|
||||||
|
func (cmd *StreamStopCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Stream.StopStream()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// StreamToggleCmd toggles the stream status.
|
||||||
|
type StreamToggleCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to toggle streaming.
|
||||||
|
func (cmd *StreamToggleCmd) Run(ctx *context) error {
|
||||||
|
status, err := ctx.Client.Stream.GetStreamStatus()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
if status.OutputActive {
|
||||||
|
_, err = ctx.Client.Stream.StopStream()
|
||||||
|
fmt.Fprintf(ctx.Out, "Stopping stream...\n")
|
||||||
|
} else {
|
||||||
|
_, err = ctx.Client.Stream.StartStream()
|
||||||
|
fmt.Fprintf(ctx.Out, "Starting stream...\n")
|
||||||
|
}
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// StreamStatusCmd retrieves the status of the stream.
|
||||||
|
type StreamStatusCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to get the stream status.
|
||||||
|
func (cmd *StreamStatusCmd) Run(ctx *context) error {
|
||||||
|
status, err := ctx.Client.Stream.GetStreamStatus()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
fmt.Fprintf(ctx.Out, "Output active: %v\n", status.OutputActive)
|
||||||
|
if status.OutputActive {
|
||||||
|
seconds := status.OutputDuration / 1000
|
||||||
|
minutes := int(seconds / 60)
|
||||||
|
secondsInt := int(seconds) % 60
|
||||||
|
if minutes > 0 {
|
||||||
|
fmt.Fprintf(ctx.Out, "Output duration: %d minutes and %d seconds\n", minutes, secondsInt)
|
||||||
|
} else {
|
||||||
|
fmt.Fprintf(ctx.Out, "Output duration: %d seconds\n", secondsInt)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
81
studiomode.go
Normal file
81
studiomode.go
Normal file
@ -0,0 +1,81 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/ui"
|
||||||
|
)
|
||||||
|
|
||||||
|
// StudioModeCmd provides commands to manage studio mode in OBS Studio.
|
||||||
|
type StudioModeCmd struct {
|
||||||
|
Enable StudioModeEnableCmd `cmd:"enable" help:"Enable studio mode." aliases:"on"`
|
||||||
|
Disable StudioModeDisableCmd `cmd:"disable" help:"Disable studio mode." aliases:"off"`
|
||||||
|
Toggle StudioModeToggleCmd `cmd:"toggle" help:"Toggle studio mode." aliases:"tg"`
|
||||||
|
Status StudioModeStatusCmd `cmd:"status" help:"Get studio mode status." aliases:"ss"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// StudioModeEnableCmd provides a command to enable studio mode.
|
||||||
|
type StudioModeEnableCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to enable studio mode.
|
||||||
|
func (cmd *StudioModeEnableCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Ui.SetStudioModeEnabled(ui.NewSetStudioModeEnabledParams().WithStudioModeEnabled(true))
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to enable studio mode: %w", err)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// StudioModeDisableCmd provides a command to disable studio mode.
|
||||||
|
type StudioModeDisableCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to disable studio mode.
|
||||||
|
func (cmd *StudioModeDisableCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Ui.SetStudioModeEnabled(ui.NewSetStudioModeEnabledParams().WithStudioModeEnabled(false))
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to disable studio mode: %w", err)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// StudioModeToggleCmd provides a command to toggle studio mode.
|
||||||
|
type StudioModeToggleCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to toggle studio mode.
|
||||||
|
func (cmd *StudioModeToggleCmd) Run(ctx *context) error {
|
||||||
|
status, err := ctx.Client.Ui.GetStudioModeEnabled(&ui.GetStudioModeEnabledParams{})
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get studio mode status: %w", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
newStatus := !status.StudioModeEnabled
|
||||||
|
_, err = ctx.Client.Ui.SetStudioModeEnabled(ui.NewSetStudioModeEnabledParams().WithStudioModeEnabled(newStatus))
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to toggle studio mode: %w", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
if newStatus {
|
||||||
|
fmt.Fprintln(ctx.Out, "Studio mode is now enabled")
|
||||||
|
} else {
|
||||||
|
fmt.Fprintln(ctx.Out, "Studio mode is now disabled")
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// StudioModeStatusCmd provides a command to get the status of studio mode.
|
||||||
|
type StudioModeStatusCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to get the status of studio mode.
|
||||||
|
func (cmd *StudioModeStatusCmd) Run(ctx *context) error {
|
||||||
|
status, err := ctx.Client.Ui.GetStudioModeEnabled(&ui.GetStudioModeEnabledParams{})
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get studio mode status: %w", err)
|
||||||
|
}
|
||||||
|
if status.StudioModeEnabled {
|
||||||
|
fmt.Fprintln(ctx.Out, "Studio mode is enabled")
|
||||||
|
} else {
|
||||||
|
fmt.Fprintln(ctx.Out, "Studio mode is disabled")
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
24
version.go
Normal file
24
version.go
Normal file
@ -0,0 +1,24 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
)
|
||||||
|
|
||||||
|
// VersionCmd handles the version command.
|
||||||
|
type VersionCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to get the OBS client version.
|
||||||
|
func (cmd *VersionCmd) Run(ctx *context) error {
|
||||||
|
version, err := ctx.Client.General.GetVersion()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"OBS Client Version: %s with Websocket Version: %s\n",
|
||||||
|
version.ObsVersion,
|
||||||
|
version.ObsWebSocketVersion,
|
||||||
|
)
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
69
virtualcam.go
Normal file
69
virtualcam.go
Normal file
@ -0,0 +1,69 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
)
|
||||||
|
|
||||||
|
// VirtualCamCmd handles the virtual camera commands.
|
||||||
|
type VirtualCamCmd struct {
|
||||||
|
Start StartVirtualCamCmd `help:"Start virtual camera." cmd:"" aliases:"s"`
|
||||||
|
Stop StopVirtualCamCmd `help:"Stop virtual camera." cmd:"" aliases:"st"`
|
||||||
|
Toggle ToggleVirtualCamCmd `help:"Toggle virtual camera." cmd:"" aliases:"tg"`
|
||||||
|
Status StatusVirtualCamCmd `help:"Get virtual camera status." cmd:"" aliases:"ss"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// StartVirtualCamCmd starts the virtual camera.
|
||||||
|
type StartVirtualCamCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to start the virtual camera.
|
||||||
|
func (c *StartVirtualCamCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Outputs.StartVirtualCam()
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to start virtual camera: %w", err)
|
||||||
|
}
|
||||||
|
fmt.Fprintln(ctx.Out, "Virtual camera started.")
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// StopVirtualCamCmd stops the virtual camera.
|
||||||
|
type StopVirtualCamCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to stop the virtual camera.
|
||||||
|
func (c *StopVirtualCamCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Outputs.StopVirtualCam()
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to stop virtual camera: %w", err)
|
||||||
|
}
|
||||||
|
fmt.Fprintln(ctx.Out, "Virtual camera stopped.")
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// ToggleVirtualCamCmd toggles the virtual camera.
|
||||||
|
type ToggleVirtualCamCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to toggle the virtual camera.
|
||||||
|
func (c *ToggleVirtualCamCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Outputs.ToggleVirtualCam()
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to toggle virtual camera: %w", err)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// StatusVirtualCamCmd retrieves the status of the virtual camera.
|
||||||
|
type StatusVirtualCamCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to get the status of the virtual camera.
|
||||||
|
func (c *StatusVirtualCamCmd) Run(ctx *context) error {
|
||||||
|
status, err := ctx.Client.Outputs.GetVirtualCamStatus()
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get virtual camera status: %w", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
if status.OutputActive {
|
||||||
|
fmt.Fprintln(ctx.Out, "Virtual camera is active.")
|
||||||
|
} else {
|
||||||
|
fmt.Fprintln(ctx.Out, "Virtual camera is inactive.")
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
Loading…
x
Reference in New Issue
Block a user