mirror of
https://github.com/onyx-and-iris/gobs-cli.git
synced 2026-04-21 00:23:41 +00:00
Compare commits
23 Commits
4fa32bfb42
...
v0.6.0
| Author | SHA1 | Date | |
|---|---|---|---|
| 90aa5d4423 | |||
| da010d67a0 | |||
| 0c695298fd | |||
| 2f77fa1c54 | |||
| eafc3312a5 | |||
| 02541f9915 | |||
| 7fa43eb35c | |||
| 8aeb7cb183 | |||
| 6e25927bc1 | |||
| dd0bbfc0da | |||
| c04324d173 | |||
| 36d0753bd9 | |||
| 3095c0c49d | |||
| 53bbb58cfb | |||
| 5f2fe05caa | |||
| c653047c66 | |||
| 30fabe8cfc | |||
| 8cf969c906 | |||
| 3540c60c4b | |||
| b2c5980b4a | |||
| da1ef9f993 | |||
| 0a2c622645 | |||
| cb973c09f5 |
9
.gitignore
vendored
9
.gitignore
vendored
@@ -26,5 +26,12 @@ go.work
|
|||||||
|
|
||||||
# End of gignore: github.com/onyx-and-iris/gignore
|
# End of gignore: github.com/onyx-and-iris/gignore
|
||||||
|
|
||||||
|
# Environment
|
||||||
|
.env
|
||||||
.envrc
|
.envrc
|
||||||
*_test.go
|
|
||||||
|
# Man pages
|
||||||
|
gobs-cli.1
|
||||||
|
|
||||||
|
# Config files
|
||||||
|
config.yaml
|
||||||
|
|||||||
@@ -50,3 +50,6 @@ issues:
|
|||||||
exclude:
|
exclude:
|
||||||
# gosec: Duplicated errcheck checks
|
# gosec: Duplicated errcheck checks
|
||||||
- G104
|
- G104
|
||||||
|
exclude-files:
|
||||||
|
# Exclude vendor directory
|
||||||
|
- main_test.go
|
||||||
|
|||||||
30
CHANGELOG.md
30
CHANGELOG.md
@@ -5,6 +5,34 @@ All notable changes to this project will be documented in this file.
|
|||||||
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
||||||
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
||||||
|
|
||||||
|
# [0.6.0] - 2025-05-25
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- filter commands, see [Filter](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#filter)
|
||||||
|
|
||||||
|
# [0.5.0] - 2025-05-22
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- hotkey commands, see [Hotkey](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#hotkeycmd)
|
||||||
|
|
||||||
|
# [0.4.2] - 2025-05-08
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- replaybuffer toggle command
|
||||||
|
- studiomode enable/disable now print output to console
|
||||||
|
- stream start/stop now print output to console
|
||||||
|
- Unit tests
|
||||||
|
|
||||||
|
# [0.3.1] - 2025-05-02
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- --man flag for generating/viewing a man page.
|
||||||
|
- Ability to load env vars from env files, see the [README](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#environment-variables)
|
||||||
|
|
||||||
# [0.2.0] - 2025-04-27
|
# [0.2.0] - 2025-04-27
|
||||||
|
|
||||||
### Added
|
### Added
|
||||||
@@ -15,4 +43,4 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
|
|||||||
|
|
||||||
### Added
|
### Added
|
||||||
|
|
||||||
- Initial release.
|
- Initial release.
|
||||||
|
|||||||
104
README.md
104
README.md
@@ -4,6 +4,12 @@ A command line interface for OBS Websocket v5
|
|||||||
|
|
||||||
For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)
|
For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)
|
||||||
|
|
||||||
|
## Installation
|
||||||
|
|
||||||
|
```console
|
||||||
|
go install github.com/onyx-and-iris/gobs-cli@latest
|
||||||
|
```
|
||||||
|
|
||||||
## Configuration
|
## Configuration
|
||||||
|
|
||||||
#### Flags
|
#### Flags
|
||||||
@@ -16,17 +22,19 @@ gobs-cli --host=localhost --port=4455 --password=<websocket password> --help
|
|||||||
|
|
||||||
#### Environment Variables
|
#### Environment Variables
|
||||||
|
|
||||||
Load connection details from your environment:
|
Store and load environment variables from:
|
||||||
|
|
||||||
```bash
|
- A `.env` file in the cwd
|
||||||
#!/usr/bin/env bash
|
- $XDG_CONFIG_HOME / gobs-cli / config.env (see [os.UserConfigDir][userconfigdir])
|
||||||
|
|
||||||
export OBS_HOST=localhost
|
```env
|
||||||
export OBS_PORT=4455
|
OBS_HOST=localhost
|
||||||
export OBS_PASSWORD=<websocket password>
|
OBS_PORT=4455
|
||||||
export OBS_TIMEOUT=5
|
OBS_PASSWORD=<websocket password>
|
||||||
|
OBS_TIMEOUT=5
|
||||||
```
|
```
|
||||||
|
|
||||||
|
|
||||||
## Commands
|
## Commands
|
||||||
|
|
||||||
### VersionCmd
|
### VersionCmd
|
||||||
@@ -365,6 +373,12 @@ gobs-cli replaybuffer start
|
|||||||
gobs-cli replaybuffer stop
|
gobs-cli replaybuffer stop
|
||||||
```
|
```
|
||||||
|
|
||||||
|
- toggle: Toggle replay buffer.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli replaybuffer toggle
|
||||||
|
```
|
||||||
|
|
||||||
- status: Get replay buffer status.
|
- status: Get replay buffer status.
|
||||||
|
|
||||||
```console
|
```console
|
||||||
@@ -427,4 +441,78 @@ gobs-cli virtualcam toggle
|
|||||||
|
|
||||||
```console
|
```console
|
||||||
gobs-cli virtualcam status
|
gobs-cli virtualcam status
|
||||||
```
|
```
|
||||||
|
|
||||||
|
### HotkeyCmd
|
||||||
|
|
||||||
|
- list: List all hotkeys.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli hotkey list
|
||||||
|
```
|
||||||
|
|
||||||
|
- trigger: Trigger a hotkey by name.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli hotkey trigger OBSBasic.StartStreaming
|
||||||
|
|
||||||
|
gobs-cli hotkey trigger OBSBasic.StopStreaming
|
||||||
|
```
|
||||||
|
|
||||||
|
- trigger-sequence: Trigger a hotkey by sequence.
|
||||||
|
- flags:
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- --shift: Press shift.
|
||||||
|
- --ctrl: Press control.
|
||||||
|
- --alt: Press alt.
|
||||||
|
- --cmd: Press command (mac).
|
||||||
|
|
||||||
|
- args: keyID
|
||||||
|
- Check [obs-hotkeys.h][obs-keyids] for a full list of OBS key ids.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli hotkey trigger-sequence OBS_KEY_F1 --ctrl
|
||||||
|
|
||||||
|
gobs-cli hotkey trigger-sequence OBS_KEY_F1 --shift --ctrl
|
||||||
|
```
|
||||||
|
|
||||||
|
### FilterCmd
|
||||||
|
|
||||||
|
- list: List all filters.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli filter list
|
||||||
|
```
|
||||||
|
|
||||||
|
- enable: Enable filter.
|
||||||
|
- args: SourceName FilterName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli enable 'Mic/Aux' 'Gain'
|
||||||
|
```
|
||||||
|
|
||||||
|
- disable: Disable filter.
|
||||||
|
- args: SourceName FilterName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli disable 'Mic/Aux' 'Gain'
|
||||||
|
```
|
||||||
|
|
||||||
|
- toggle: Toggle filter.
|
||||||
|
- args: SourceName FilterName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli toggle 'Mic/Aux' 'Gain'
|
||||||
|
```
|
||||||
|
|
||||||
|
- status: Get filter status.
|
||||||
|
- args: SourceName FilterName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli status 'Mic/Aux' 'Gain'
|
||||||
|
```
|
||||||
|
|
||||||
|
|
||||||
|
[userconfigdir]: https://pkg.go.dev/os#UserConfigDir
|
||||||
|
[obs-keyids]: https://github.com/obsproject/obs-studio/blob/master/libobs/obs-hotkeys.h
|
||||||
17
Taskfile.man.yaml
Normal file
17
Taskfile.man.yaml
Normal file
@@ -0,0 +1,17 @@
|
|||||||
|
version: '3'
|
||||||
|
|
||||||
|
tasks:
|
||||||
|
default:
|
||||||
|
desc: View man page
|
||||||
|
cmds:
|
||||||
|
- task: view
|
||||||
|
|
||||||
|
view:
|
||||||
|
desc: View man page
|
||||||
|
cmds:
|
||||||
|
- go run . --man | man -l -
|
||||||
|
|
||||||
|
generate:
|
||||||
|
desc: Generate man page
|
||||||
|
cmds:
|
||||||
|
- go run . --man > {{.PROGRAM}}.1
|
||||||
@@ -1,5 +1,8 @@
|
|||||||
version: '3'
|
version: '3'
|
||||||
|
|
||||||
|
includes:
|
||||||
|
man: Taskfile.man.yaml
|
||||||
|
|
||||||
vars:
|
vars:
|
||||||
PROGRAM: gobs-cli
|
PROGRAM: gobs-cli
|
||||||
SHELL: '{{if eq .OS "Windows_NT"}}powershell{{end}}'
|
SHELL: '{{if eq .OS "Windows_NT"}}powershell{{end}}'
|
||||||
|
|||||||
149
filter.go
Normal file
149
filter.go
Normal file
@@ -0,0 +1,149 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/filters"
|
||||||
|
)
|
||||||
|
|
||||||
|
// FilterCmd provides commands to manage filters in OBS Studio.
|
||||||
|
type FilterCmd struct {
|
||||||
|
List FilterListCmd `cmd:"" help:"List all filters." aliases:"ls"`
|
||||||
|
Enable FilterEnableCmd `cmd:"" help:"Enable filter." aliases:"on"`
|
||||||
|
Disable FilterDisableCmd `cmd:"" help:"Disable filter." aliases:"off"`
|
||||||
|
Toggle FilterToggleCmd `cmd:"" help:"Toggle filter." aliases:"tg"`
|
||||||
|
Status FilterStatusCmd `cmd:"" help:"Get filter status." aliases:"ss"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// FilterListCmd provides a command to list all filters in a scene.
|
||||||
|
type FilterListCmd struct {
|
||||||
|
SourceName string `arg:"" help:"Name of the source to list filters from."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to list all filters in a scene.
|
||||||
|
func (cmd *FilterListCmd) Run(ctx *context) error {
|
||||||
|
filters, err := ctx.Client.Filters.GetSourceFilterList(
|
||||||
|
filters.NewGetSourceFilterListParams().WithSourceName(cmd.SourceName),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
for _, filter := range filters.Filters {
|
||||||
|
fmt.Fprintf(ctx.Out, "Name: %s\n Kind: %s\n Enabled: %t\n Settings: %+v\n",
|
||||||
|
filter.FilterName, filter.FilterKind, filter.FilterEnabled, filter.FilterSettings)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// FilterEnableCmd provides a command to enable a filter in a scene.
|
||||||
|
type FilterEnableCmd struct {
|
||||||
|
SourceName string `arg:"" help:"Name of the source to enable filter from."`
|
||||||
|
FilterName string `arg:"" help:"Name of the filter to enable."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to enable a filter in a scene.
|
||||||
|
func (cmd *FilterEnableCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Filters.SetSourceFilterEnabled(
|
||||||
|
filters.NewSetSourceFilterEnabledParams().
|
||||||
|
WithSourceName(cmd.SourceName).
|
||||||
|
WithFilterName(cmd.FilterName).
|
||||||
|
WithFilterEnabled(true),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to enable filter %s on source %s: %w",
|
||||||
|
cmd.FilterName, cmd.SourceName, err)
|
||||||
|
}
|
||||||
|
fmt.Fprintf(ctx.Out, "Filter %s enabled on source %s.\n",
|
||||||
|
cmd.FilterName, cmd.SourceName)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// FilterDisableCmd provides a command to disable a filter in a scene.
|
||||||
|
type FilterDisableCmd struct {
|
||||||
|
SourceName string `arg:"" help:"Name of the source to disable filter from."`
|
||||||
|
FilterName string `arg:"" help:"Name of the filter to disable."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to disable a filter in a scene.
|
||||||
|
func (cmd *FilterDisableCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Filters.SetSourceFilterEnabled(
|
||||||
|
filters.NewSetSourceFilterEnabledParams().
|
||||||
|
WithSourceName(cmd.SourceName).
|
||||||
|
WithFilterName(cmd.FilterName).
|
||||||
|
WithFilterEnabled(false),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to disable filter %s on source %s: %w",
|
||||||
|
cmd.FilterName, cmd.SourceName, err)
|
||||||
|
}
|
||||||
|
fmt.Fprintf(ctx.Out, "Filter %s disabled on source %s.\n",
|
||||||
|
cmd.FilterName, cmd.SourceName)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// FilterToggleCmd provides a command to toggle a filter in a scene.
|
||||||
|
type FilterToggleCmd struct {
|
||||||
|
SourceName string `arg:"" help:"Name of the source to toggle filter from."`
|
||||||
|
FilterName string `arg:"" help:"Name of the filter to toggle."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to toggle a filter in a scene.
|
||||||
|
func (cmd *FilterToggleCmd) Run(ctx *context) error {
|
||||||
|
filter, err := ctx.Client.Filters.GetSourceFilter(
|
||||||
|
filters.NewGetSourceFilterParams().
|
||||||
|
WithSourceName(cmd.SourceName).
|
||||||
|
WithFilterName(cmd.FilterName),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get filter %s on source %s: %w",
|
||||||
|
cmd.FilterName, cmd.SourceName, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
newStatus := !filter.FilterEnabled
|
||||||
|
_, err = ctx.Client.Filters.SetSourceFilterEnabled(
|
||||||
|
filters.NewSetSourceFilterEnabledParams().
|
||||||
|
WithSourceName(cmd.SourceName).
|
||||||
|
WithFilterName(cmd.FilterName).
|
||||||
|
WithFilterEnabled(newStatus),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to toggle filter %s on source %s: %w",
|
||||||
|
cmd.FilterName, cmd.SourceName, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
if newStatus {
|
||||||
|
fmt.Fprintf(ctx.Out, "Filter %s on source %s is now enabled.\n",
|
||||||
|
cmd.FilterName, cmd.SourceName)
|
||||||
|
} else {
|
||||||
|
fmt.Fprintf(ctx.Out, "Filter %s on source %s is now disabled.\n",
|
||||||
|
cmd.FilterName, cmd.SourceName)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// FilterStatusCmd provides a command to get the status of a filter in a scene.
|
||||||
|
type FilterStatusCmd struct {
|
||||||
|
SourceName string `arg:"" help:"Name of the source to get filter status from."`
|
||||||
|
FilterName string `arg:"" help:"Name of the filter to get status."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to get the status of a filter in a scene.
|
||||||
|
func (cmd *FilterStatusCmd) Run(ctx *context) error {
|
||||||
|
filter, err := ctx.Client.Filters.GetSourceFilter(
|
||||||
|
filters.NewGetSourceFilterParams().
|
||||||
|
WithSourceName(cmd.SourceName).
|
||||||
|
WithFilterName(cmd.FilterName),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get status of filter %s on source %s: %w",
|
||||||
|
cmd.FilterName, cmd.SourceName, err)
|
||||||
|
}
|
||||||
|
if filter.FilterEnabled {
|
||||||
|
fmt.Fprintf(ctx.Out, "Filter %s on source %s is enabled.\n",
|
||||||
|
cmd.FilterName, cmd.SourceName)
|
||||||
|
} else {
|
||||||
|
fmt.Fprintf(ctx.Out, "Filter %s on source %s is disabled.\n",
|
||||||
|
cmd.FilterName, cmd.SourceName)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
5
go.mod
5
go.mod
@@ -4,14 +4,19 @@ go 1.24.0
|
|||||||
|
|
||||||
require (
|
require (
|
||||||
github.com/alecthomas/kong v1.10.0
|
github.com/alecthomas/kong v1.10.0
|
||||||
|
github.com/alecthomas/mango-kong v0.1.0
|
||||||
github.com/andreykaipov/goobs v1.5.6
|
github.com/andreykaipov/goobs v1.5.6
|
||||||
|
github.com/titusjaka/kong-dotenv-go v0.1.0
|
||||||
)
|
)
|
||||||
|
|
||||||
require (
|
require (
|
||||||
github.com/buger/jsonparser v1.1.1 // indirect
|
github.com/buger/jsonparser v1.1.1 // indirect
|
||||||
github.com/gorilla/websocket v1.5.3 // indirect
|
github.com/gorilla/websocket v1.5.3 // indirect
|
||||||
github.com/hashicorp/logutils v1.0.0 // indirect
|
github.com/hashicorp/logutils v1.0.0 // indirect
|
||||||
|
github.com/joho/godotenv v1.5.1 // indirect
|
||||||
github.com/mitchellh/mapstructure v1.5.0 // indirect
|
github.com/mitchellh/mapstructure v1.5.0 // indirect
|
||||||
github.com/mmcloughlin/profile v0.1.1 // indirect
|
github.com/mmcloughlin/profile v0.1.1 // indirect
|
||||||
|
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab // indirect
|
||||||
|
github.com/muesli/roff v0.1.0 // indirect
|
||||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d // indirect
|
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d // indirect
|
||||||
)
|
)
|
||||||
|
|||||||
10
go.sum
10
go.sum
@@ -2,6 +2,8 @@ github.com/alecthomas/assert/v2 v2.11.0 h1:2Q9r3ki8+JYXvGsDyBXwH3LcJ+WK5D0gc5E8v
|
|||||||
github.com/alecthomas/assert/v2 v2.11.0/go.mod h1:Bze95FyfUr7x34QZrjL+XP+0qgp/zg8yS+TtBj1WA3k=
|
github.com/alecthomas/assert/v2 v2.11.0/go.mod h1:Bze95FyfUr7x34QZrjL+XP+0qgp/zg8yS+TtBj1WA3k=
|
||||||
github.com/alecthomas/kong v1.10.0 h1:8K4rGDpT7Iu+jEXCIJUeKqvpwZHbsFRoebLbnzlmrpw=
|
github.com/alecthomas/kong v1.10.0 h1:8K4rGDpT7Iu+jEXCIJUeKqvpwZHbsFRoebLbnzlmrpw=
|
||||||
github.com/alecthomas/kong v1.10.0/go.mod h1:p2vqieVMeTAnaC83txKtXe8FLke2X07aruPWXyMPQrU=
|
github.com/alecthomas/kong v1.10.0/go.mod h1:p2vqieVMeTAnaC83txKtXe8FLke2X07aruPWXyMPQrU=
|
||||||
|
github.com/alecthomas/mango-kong v0.1.0 h1:iFVfP1k1K4qpml3JUQmD5I8MCQYfIvsD9mRdrw7jJC4=
|
||||||
|
github.com/alecthomas/mango-kong v0.1.0/go.mod h1:t+TYVdsONUolf/BwVcm+15eqcdAj15h4Qe9MMFAwwT4=
|
||||||
github.com/alecthomas/repr v0.4.0 h1:GhI2A8MACjfegCPVq9f1FLvIBS+DrQ2KQBFZP1iFzXc=
|
github.com/alecthomas/repr v0.4.0 h1:GhI2A8MACjfegCPVq9f1FLvIBS+DrQ2KQBFZP1iFzXc=
|
||||||
github.com/alecthomas/repr v0.4.0/go.mod h1:Fr0507jx4eOXV7AlPV6AVZLYrLIuIeSOWtW57eE/O/4=
|
github.com/alecthomas/repr v0.4.0/go.mod h1:Fr0507jx4eOXV7AlPV6AVZLYrLIuIeSOWtW57eE/O/4=
|
||||||
github.com/andreykaipov/goobs v1.5.6 h1:eIkEqYN99+2VJvmlY/56Ah60nkRKS6efMQvpM3oUgPQ=
|
github.com/andreykaipov/goobs v1.5.6 h1:eIkEqYN99+2VJvmlY/56Ah60nkRKS6efMQvpM3oUgPQ=
|
||||||
@@ -16,15 +18,23 @@ github.com/hashicorp/logutils v1.0.0 h1:dLEQVugN8vlakKOUE3ihGLTZJRB4j+M2cdTm/ORI
|
|||||||
github.com/hashicorp/logutils v1.0.0/go.mod h1:QIAnNjmIWmVIIkWDTG1z5v++HQmx9WQRO+LraFDTW64=
|
github.com/hashicorp/logutils v1.0.0/go.mod h1:QIAnNjmIWmVIIkWDTG1z5v++HQmx9WQRO+LraFDTW64=
|
||||||
github.com/hexops/gotextdiff v1.0.3 h1:gitA9+qJrrTCsiCl7+kh75nPqQt1cx4ZkudSTLoUqJM=
|
github.com/hexops/gotextdiff v1.0.3 h1:gitA9+qJrrTCsiCl7+kh75nPqQt1cx4ZkudSTLoUqJM=
|
||||||
github.com/hexops/gotextdiff v1.0.3/go.mod h1:pSWU5MAI3yDq+fZBTazCSJysOMbxWL1BSow5/V2vxeg=
|
github.com/hexops/gotextdiff v1.0.3/go.mod h1:pSWU5MAI3yDq+fZBTazCSJysOMbxWL1BSow5/V2vxeg=
|
||||||
|
github.com/joho/godotenv v1.5.1 h1:7eLL/+HRGLY0ldzfGMeQkb7vMd0as4CfYvUVzLqw0N0=
|
||||||
|
github.com/joho/godotenv v1.5.1/go.mod h1:f4LDr5Voq0i2e/R5DDNOoa2zzDfwtkZa6DnEwAbqwq4=
|
||||||
github.com/mitchellh/mapstructure v1.5.0 h1:jeMsZIYE/09sWLaz43PL7Gy6RuMjD2eJVyuac5Z2hdY=
|
github.com/mitchellh/mapstructure v1.5.0 h1:jeMsZIYE/09sWLaz43PL7Gy6RuMjD2eJVyuac5Z2hdY=
|
||||||
github.com/mitchellh/mapstructure v1.5.0/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo=
|
github.com/mitchellh/mapstructure v1.5.0/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo=
|
||||||
github.com/mmcloughlin/profile v0.1.1 h1:jhDmAqPyebOsVDOCICJoINoLb/AnLBaUw58nFzxWS2w=
|
github.com/mmcloughlin/profile v0.1.1 h1:jhDmAqPyebOsVDOCICJoINoLb/AnLBaUw58nFzxWS2w=
|
||||||
github.com/mmcloughlin/profile v0.1.1/go.mod h1:IhHD7q1ooxgwTgjxQYkACGA77oFTDdFVejUS1/tS/qU=
|
github.com/mmcloughlin/profile v0.1.1/go.mod h1:IhHD7q1ooxgwTgjxQYkACGA77oFTDdFVejUS1/tS/qU=
|
||||||
|
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab h1:m7QFONkzLK0fVXCjwX5tANcnj1yXxTnYQtnfJiY3tcA=
|
||||||
|
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab/go.mod h1:5XFpbC8jY5UUv89YQciiXNlbi+iJgt29VDC5xbzrLL4=
|
||||||
|
github.com/muesli/roff v0.1.0 h1:YD0lalCotmYuF5HhZliKWlIx7IEhiXeSfq7hNjFqGF8=
|
||||||
|
github.com/muesli/roff v0.1.0/go.mod h1:pjAHQM9hdUUwm/krAfrLGgJkXJ+YuhtsfZ42kieB2Ig=
|
||||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d h1:VhgPp6v9qf9Agr/56bj7Y/xa04UccTW04VP0Qed4vnQ=
|
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d h1:VhgPp6v9qf9Agr/56bj7Y/xa04UccTW04VP0Qed4vnQ=
|
||||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d/go.mod h1:YUTz3bUH2ZwIWBy3CJBeOBEugqcmXREj14T+iG/4k4U=
|
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d/go.mod h1:YUTz3bUH2ZwIWBy3CJBeOBEugqcmXREj14T+iG/4k4U=
|
||||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||||
github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA=
|
github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA=
|
||||||
github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
|
github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
|
||||||
|
github.com/titusjaka/kong-dotenv-go v0.1.0 h1:TmUjP/sXoNiKLr6oR7n9xrB5XyXi/Ssuebzfz5nxZj4=
|
||||||
|
github.com/titusjaka/kong-dotenv-go v0.1.0/go.mod h1:pBgLjcu82oqUgb7+bngK9+Ch7jg49E0YADP8Wnj2MXU=
|
||||||
gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
|
gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
|
||||||
gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
||||||
|
|||||||
130
group_test.go
Normal file
130
group_test.go
Normal file
@@ -0,0 +1,130 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestGroupList(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &GroupListCmd{
|
||||||
|
SceneName: "Scene",
|
||||||
|
}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list groups: %v", err)
|
||||||
|
}
|
||||||
|
if !strings.Contains(out.String(), "test_group") {
|
||||||
|
t.Fatalf("Expected output to contain 'test_group', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestGroupShow(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &GroupShowCmd{
|
||||||
|
SceneName: "Scene",
|
||||||
|
GroupName: "test_group",
|
||||||
|
}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to show group: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Group test_group is now shown.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Group test_group is now shown.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestGroupToggle(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdStatus := &GroupStatusCmd{
|
||||||
|
SceneName: "Scene",
|
||||||
|
GroupName: "test_group",
|
||||||
|
}
|
||||||
|
err := cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get group status: %v", err)
|
||||||
|
}
|
||||||
|
var enabled bool
|
||||||
|
if strings.Contains(out.String(), "Group test_group is shown.") {
|
||||||
|
enabled = true
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdToggle := &GroupToggleCmd{
|
||||||
|
SceneName: "Scene",
|
||||||
|
GroupName: "test_group",
|
||||||
|
}
|
||||||
|
err = cmdToggle.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to toggle group: %v", err)
|
||||||
|
}
|
||||||
|
if enabled {
|
||||||
|
if out.String() != "Group test_group is now hidden.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Group test_group is now hidden.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
if out.String() != "Group test_group is now shown.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Group test_group is now shown.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestGroupStatus(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdShow := &GroupShowCmd{
|
||||||
|
SceneName: "Scene",
|
||||||
|
GroupName: "test_group",
|
||||||
|
}
|
||||||
|
err := cmdShow.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to show group: %v", err)
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdStatus := &GroupStatusCmd{
|
||||||
|
SceneName: "Scene",
|
||||||
|
GroupName: "test_group",
|
||||||
|
}
|
||||||
|
err = cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get group status: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Group test_group is shown.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Group test_group is shown.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
74
hotkey.go
Normal file
74
hotkey.go
Normal file
@@ -0,0 +1,74 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/general"
|
||||||
|
"github.com/andreykaipov/goobs/api/typedefs"
|
||||||
|
)
|
||||||
|
|
||||||
|
// HotkeyCmd provides commands to manage hotkeys in OBS Studio.
|
||||||
|
type HotkeyCmd struct {
|
||||||
|
List HotkeyListCmd `cmd:"" help:"List all hotkeys." aliases:"ls"`
|
||||||
|
Trigger HotkeyTriggerCmd `cmd:"" help:"Trigger a hotkey by name." aliases:"tr"`
|
||||||
|
TriggerSequence HotkeyTriggerSequenceCmd `cmd:"" help:"Trigger a hotkey by sequence." aliases:"trs"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// HotkeyListCmd provides a command to list all hotkeys.
|
||||||
|
type HotkeyListCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to list all hotkeys.
|
||||||
|
func (cmd *HotkeyListCmd) Run(ctx *context) error {
|
||||||
|
resp, err := ctx.Client.General.GetHotkeyList()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
for _, hotkey := range resp.Hotkeys {
|
||||||
|
fmt.Fprintln(ctx.Out, hotkey)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// HotkeyTriggerCmd provides a command to trigger a hotkey.
|
||||||
|
type HotkeyTriggerCmd struct {
|
||||||
|
Hotkey string `help:"Hotkey name to trigger." arg:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to trigger a hotkey.
|
||||||
|
func (cmd *HotkeyTriggerCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.General.TriggerHotkeyByName(
|
||||||
|
general.NewTriggerHotkeyByNameParams().WithHotkeyName(cmd.Hotkey),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// HotkeyTriggerSequenceCmd provides a command to trigger a hotkey sequence.
|
||||||
|
type HotkeyTriggerSequenceCmd struct {
|
||||||
|
Shift bool `flag:"" help:"Shift modifier."`
|
||||||
|
Ctrl bool `flag:"" help:"Control modifier."`
|
||||||
|
Alt bool `flag:"" help:"Alt modifier."`
|
||||||
|
Cmd bool `flag:"" help:"Command modifier."`
|
||||||
|
KeyID string ` help:"Key ID to trigger." arg:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to trigger a hotkey sequence.
|
||||||
|
func (cmd *HotkeyTriggerSequenceCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.General.TriggerHotkeyByKeySequence(
|
||||||
|
general.NewTriggerHotkeyByKeySequenceParams().
|
||||||
|
WithKeyId(cmd.KeyID).
|
||||||
|
WithKeyModifiers(&typedefs.KeyModifiers{
|
||||||
|
Shift: cmd.Shift,
|
||||||
|
Control: cmd.Ctrl,
|
||||||
|
Alt: cmd.Alt,
|
||||||
|
Command: cmd.Cmd,
|
||||||
|
}),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
20
main.go
20
main.go
@@ -7,10 +7,13 @@ import (
|
|||||||
"fmt"
|
"fmt"
|
||||||
"io"
|
"io"
|
||||||
"os"
|
"os"
|
||||||
|
"path/filepath"
|
||||||
"time"
|
"time"
|
||||||
|
|
||||||
"github.com/alecthomas/kong"
|
"github.com/alecthomas/kong"
|
||||||
|
mangokong "github.com/alecthomas/mango-kong"
|
||||||
"github.com/andreykaipov/goobs"
|
"github.com/andreykaipov/goobs"
|
||||||
|
kongdotenv "github.com/titusjaka/kong-dotenv-go"
|
||||||
)
|
)
|
||||||
|
|
||||||
// ObsConfig holds the configuration for connecting to the OBS WebSocket server.
|
// ObsConfig holds the configuration for connecting to the OBS WebSocket server.
|
||||||
@@ -21,11 +24,13 @@ type ObsConfig struct {
|
|||||||
Timeout int `flag:"timeout" help:"Timeout in seconds." default:"5" env:"OBS_TIMEOUT"`
|
Timeout int `flag:"timeout" help:"Timeout in seconds." default:"5" env:"OBS_TIMEOUT"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// cli is the main command line interface structure.
|
// CLI is the main command line interface structure.
|
||||||
// It embeds the ObsConfig struct to inherit its fields and flags.
|
// It embeds the ObsConfig struct to inherit its fields and flags.
|
||||||
type cli struct {
|
type CLI struct {
|
||||||
ObsConfig `embed:"" help:"OBS WebSocket configuration."`
|
ObsConfig `embed:"" help:"OBS WebSocket configuration."`
|
||||||
|
|
||||||
|
Man mangokong.ManFlag `help:"Print man page."`
|
||||||
|
|
||||||
Version VersionCmd `help:"Show version." cmd:"" aliases:"v"`
|
Version VersionCmd `help:"Show version." cmd:"" aliases:"v"`
|
||||||
Scene SceneCmd `help:"Manage scenes." cmd:"" aliases:"sc"`
|
Scene SceneCmd `help:"Manage scenes." cmd:"" aliases:"sc"`
|
||||||
Sceneitem SceneItemCmd `help:"Manage scene items." cmd:"" aliases:"si"`
|
Sceneitem SceneItemCmd `help:"Manage scene items." cmd:"" aliases:"si"`
|
||||||
@@ -38,6 +43,8 @@ type cli struct {
|
|||||||
Replaybuffer ReplayBufferCmd `help:"Manage replay buffer." cmd:"" aliases:"rb"`
|
Replaybuffer ReplayBufferCmd `help:"Manage replay buffer." cmd:"" aliases:"rb"`
|
||||||
Studiomode StudioModeCmd `help:"Manage studio mode." cmd:"" aliases:"sm"`
|
Studiomode StudioModeCmd `help:"Manage studio mode." cmd:"" aliases:"sm"`
|
||||||
Virtualcam VirtualCamCmd `help:"Manage virtual camera." cmd:"" aliases:"vc"`
|
Virtualcam VirtualCamCmd `help:"Manage virtual camera." cmd:"" aliases:"vc"`
|
||||||
|
Hotkey HotkeyCmd `help:"Manage hotkeys." cmd:"" aliases:"hk"`
|
||||||
|
Filter FilterCmd `help:"Manage filters." cmd:"" aliases:"f"`
|
||||||
}
|
}
|
||||||
|
|
||||||
type context struct {
|
type context struct {
|
||||||
@@ -46,11 +53,18 @@ type context struct {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func main() {
|
func main() {
|
||||||
cli := cli{}
|
userConfigDir, err := os.UserConfigDir()
|
||||||
|
if err != nil {
|
||||||
|
fmt.Fprintf(os.Stderr, "Error getting user config directory: %v\n", err)
|
||||||
|
os.Exit(1)
|
||||||
|
}
|
||||||
|
|
||||||
|
var cli CLI
|
||||||
ctx := kong.Parse(
|
ctx := kong.Parse(
|
||||||
&cli,
|
&cli,
|
||||||
kong.Name("GOBS-CLI"),
|
kong.Name("GOBS-CLI"),
|
||||||
kong.Description("A command line tool to interact with OBS Websocket."),
|
kong.Description("A command line tool to interact with OBS Websocket."),
|
||||||
|
kong.Configuration(kongdotenv.ENVFileReader, ".env", filepath.Join(userConfigDir, "gobs-cli", "config.env")),
|
||||||
)
|
)
|
||||||
|
|
||||||
client, err := connectObs(cli.ObsConfig)
|
client, err := connectObs(cli.ObsConfig)
|
||||||
|
|||||||
101
main_test.go
Normal file
101
main_test.go
Normal file
@@ -0,0 +1,101 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"os"
|
||||||
|
"testing"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs"
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/config"
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/inputs"
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/scenes"
|
||||||
|
typedefs "github.com/andreykaipov/goobs/api/typedefs"
|
||||||
|
)
|
||||||
|
|
||||||
|
func getClient(t *testing.T) (*goobs.Client, func()) {
|
||||||
|
t.Helper()
|
||||||
|
client, err := connectObs(ObsConfig{
|
||||||
|
Host: os.Getenv("OBS_HOST"),
|
||||||
|
Port: 4455,
|
||||||
|
Password: os.Getenv("OBS_PASSWORD"),
|
||||||
|
Timeout: 5,
|
||||||
|
})
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to connect to OBS: %v", err)
|
||||||
|
}
|
||||||
|
return client, func() {
|
||||||
|
if err := client.Disconnect(); err != nil {
|
||||||
|
t.Fatalf("Failed to disconnect from OBS: %v", err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestMain(m *testing.M) {
|
||||||
|
client, err := connectObs(ObsConfig{
|
||||||
|
Host: os.Getenv("OBS_HOST"),
|
||||||
|
Port: 4455,
|
||||||
|
Password: os.Getenv("OBS_PASSWORD"),
|
||||||
|
Timeout: 5,
|
||||||
|
})
|
||||||
|
if err != nil {
|
||||||
|
os.Exit(1)
|
||||||
|
}
|
||||||
|
defer client.Disconnect()
|
||||||
|
|
||||||
|
setup(client)
|
||||||
|
|
||||||
|
// Run the tests
|
||||||
|
exitCode := m.Run()
|
||||||
|
|
||||||
|
teardown(client)
|
||||||
|
|
||||||
|
// Exit with the appropriate code
|
||||||
|
os.Exit(exitCode)
|
||||||
|
}
|
||||||
|
|
||||||
|
func setup(client *goobs.Client) {
|
||||||
|
client.Config.SetStreamServiceSettings(config.NewSetStreamServiceSettingsParams().
|
||||||
|
WithStreamServiceType("rtmp_common").
|
||||||
|
WithStreamServiceSettings(&typedefs.StreamServiceSettings{
|
||||||
|
Server: "auto",
|
||||||
|
Key: os.Getenv("OBS_STREAM_KEY"),
|
||||||
|
}))
|
||||||
|
|
||||||
|
client.Config.SetCurrentSceneCollection(config.NewSetCurrentSceneCollectionParams().
|
||||||
|
WithSceneCollectionName("test-collection"))
|
||||||
|
|
||||||
|
client.Scenes.CreateScene(scenes.NewCreateSceneParams().
|
||||||
|
WithSceneName("gobs-test"))
|
||||||
|
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
||||||
|
WithSceneName("gobs-test").
|
||||||
|
WithInputName("gobs-test-input").
|
||||||
|
WithInputKind("color_source_v3").
|
||||||
|
WithInputSettings(map[string]any{
|
||||||
|
"color": 3279460728,
|
||||||
|
"width": 1920,
|
||||||
|
"height": 1080,
|
||||||
|
"visible": true,
|
||||||
|
}).
|
||||||
|
WithSceneItemEnabled(true))
|
||||||
|
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
||||||
|
WithSceneName("gobs-test").
|
||||||
|
WithInputName("gobs-test-input-2").
|
||||||
|
WithInputKind("color_source_v3").
|
||||||
|
WithInputSettings(map[string]any{
|
||||||
|
"color": 1789347616,
|
||||||
|
"width": 720,
|
||||||
|
"height": 480,
|
||||||
|
"visible": true,
|
||||||
|
}).
|
||||||
|
WithSceneItemEnabled(true))
|
||||||
|
}
|
||||||
|
|
||||||
|
func teardown(client *goobs.Client) {
|
||||||
|
client.Scenes.RemoveScene(scenes.NewRemoveSceneParams().
|
||||||
|
WithSceneName("gobs-test"))
|
||||||
|
|
||||||
|
client.Config.SetCurrentSceneCollection(config.NewSetCurrentSceneCollectionParams().
|
||||||
|
WithSceneCollectionName("default"))
|
||||||
|
|
||||||
|
client.Stream.StopStream()
|
||||||
|
client.Record.StopRecord()
|
||||||
|
}
|
||||||
40
profile.go
40
profile.go
@@ -9,18 +9,18 @@ import (
|
|||||||
|
|
||||||
// ProfileCmd provides commands to manage profiles in OBS Studio.
|
// ProfileCmd provides commands to manage profiles in OBS Studio.
|
||||||
type ProfileCmd struct {
|
type ProfileCmd struct {
|
||||||
List ListProfileCmd `help:"List profiles." cmd:"" aliases:"ls"`
|
List ProfileListCmd `help:"List profiles." cmd:"" aliases:"ls"`
|
||||||
Current CurrentProfileCmd `help:"Get current profile." cmd:"" aliases:"c"`
|
Current ProfileCurrentCmd `help:"Get current profile." cmd:"" aliases:"c"`
|
||||||
Switch SwitchProfileCmd `help:"Switch profile." cmd:"" aliases:"sw"`
|
Switch ProfileSwitchCmd `help:"Switch profile." cmd:"" aliases:"sw"`
|
||||||
Create CreateProfileCmd `help:"Create profile." cmd:"" aliases:"new"`
|
Create ProfileCreateCmd `help:"Create profile." cmd:"" aliases:"new"`
|
||||||
Remove RemoveProfileCmd `help:"Remove profile." cmd:"" aliases:"rm"`
|
Remove ProfileRemoveCmd `help:"Remove profile." cmd:"" aliases:"rm"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// ListProfileCmd provides a command to list all profiles.
|
// ProfileListCmd provides a command to list all profiles.
|
||||||
type ListProfileCmd struct{} // size = 0x0
|
type ProfileListCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to list all profiles.
|
// Run executes the command to list all profiles.
|
||||||
func (cmd *ListProfileCmd) Run(ctx *context) error {
|
func (cmd *ProfileListCmd) Run(ctx *context) error {
|
||||||
profiles, err := ctx.Client.Config.GetProfileList()
|
profiles, err := ctx.Client.Config.GetProfileList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
@@ -33,11 +33,11 @@ func (cmd *ListProfileCmd) Run(ctx *context) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// CurrentProfileCmd provides a command to get the current profile.
|
// ProfileCurrentCmd provides a command to get the current profile.
|
||||||
type CurrentProfileCmd struct{} // size = 0x0
|
type ProfileCurrentCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to get the current profile.
|
// Run executes the command to get the current profile.
|
||||||
func (cmd *CurrentProfileCmd) Run(ctx *context) error {
|
func (cmd *ProfileCurrentCmd) Run(ctx *context) error {
|
||||||
profiles, err := ctx.Client.Config.GetProfileList()
|
profiles, err := ctx.Client.Config.GetProfileList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
@@ -47,13 +47,13 @@ func (cmd *CurrentProfileCmd) Run(ctx *context) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// SwitchProfileCmd provides a command to switch to a different profile.
|
// ProfileSwitchCmd provides a command to switch to a different profile.
|
||||||
type SwitchProfileCmd struct {
|
type ProfileSwitchCmd struct {
|
||||||
Name string `arg:"" help:"Name of the profile to switch to." required:""`
|
Name string `arg:"" help:"Name of the profile to switch to." required:""`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to switch to a different profile.
|
// Run executes the command to switch to a different profile.
|
||||||
func (cmd *SwitchProfileCmd) Run(ctx *context) error {
|
func (cmd *ProfileSwitchCmd) Run(ctx *context) error {
|
||||||
profiles, err := ctx.Client.Config.GetProfileList()
|
profiles, err := ctx.Client.Config.GetProfileList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
@@ -74,13 +74,13 @@ func (cmd *SwitchProfileCmd) Run(ctx *context) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// CreateProfileCmd provides a command to create a new profile.
|
// ProfileCreateCmd provides a command to create a new profile.
|
||||||
type CreateProfileCmd struct {
|
type ProfileCreateCmd struct {
|
||||||
Name string `arg:"" help:"Name of the profile to create." required:""`
|
Name string `arg:"" help:"Name of the profile to create." required:""`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to create a new profile.
|
// Run executes the command to create a new profile.
|
||||||
func (cmd *CreateProfileCmd) Run(ctx *context) error {
|
func (cmd *ProfileCreateCmd) Run(ctx *context) error {
|
||||||
profiles, err := ctx.Client.Config.GetProfileList()
|
profiles, err := ctx.Client.Config.GetProfileList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
@@ -100,13 +100,13 @@ func (cmd *CreateProfileCmd) Run(ctx *context) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// RemoveProfileCmd provides a command to remove an existing profile.
|
// ProfileRemoveCmd provides a command to remove an existing profile.
|
||||||
type RemoveProfileCmd struct {
|
type ProfileRemoveCmd struct {
|
||||||
Name string `arg:"" help:"Name of the profile to delete." required:""`
|
Name string `arg:"" help:"Name of the profile to delete." required:""`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to remove an existing profile.
|
// Run executes the command to remove an existing profile.
|
||||||
func (cmd *RemoveProfileCmd) Run(ctx *context) error {
|
func (cmd *ProfileRemoveCmd) Run(ctx *context) error {
|
||||||
profiles, err := ctx.Client.Config.GetProfileList()
|
profiles, err := ctx.Client.Config.GetProfileList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
|
|||||||
45
record.go
45
record.go
@@ -6,11 +6,12 @@ import (
|
|||||||
|
|
||||||
// RecordCmd handles the recording commands.
|
// RecordCmd handles the recording commands.
|
||||||
type RecordCmd struct {
|
type RecordCmd struct {
|
||||||
Start RecordStartCmd `cmd:"" help:"Start recording." aliases:"s"`
|
Start RecordStartCmd `cmd:"" help:"Start recording." aliases:"s"`
|
||||||
Stop RecordStopCmd `cmd:"" help:"Stop recording." aliases:"st"`
|
Stop RecordStopCmd `cmd:"" help:"Stop recording." aliases:"st"`
|
||||||
Toggle RecordToggleCmd `cmd:"" help:"Toggle recording." aliases:"tg"`
|
Toggle RecordToggleCmd `cmd:"" help:"Toggle recording." aliases:"tg"`
|
||||||
Pause RecordPauseCmd `cmd:"" help:"Pause recording." aliases:"p"`
|
Status RecordStatusCmd `cmd:"" help:"Show recording status." aliases:"ss"`
|
||||||
Resume RecordResumeCmd `cmd:"" help:"Resume recording." aliases:"r"`
|
Pause RecordPauseCmd `cmd:"" help:"Pause recording." aliases:"p"`
|
||||||
|
Resume RecordResumeCmd `cmd:"" help:"Resume recording." aliases:"r"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// RecordStartCmd starts the recording.
|
// RecordStartCmd starts the recording.
|
||||||
@@ -44,25 +45,39 @@ type RecordToggleCmd struct{} // size = 0x0
|
|||||||
|
|
||||||
// Run executes the command to toggle recording.
|
// Run executes the command to toggle recording.
|
||||||
func (cmd *RecordToggleCmd) Run(ctx *context) error {
|
func (cmd *RecordToggleCmd) Run(ctx *context) error {
|
||||||
// Check if recording is in progress
|
status, err := ctx.Client.Record.ToggleRecord()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if status.OutputActive {
|
||||||
|
fmt.Fprintln(ctx.Out, "Recording started successfully.")
|
||||||
|
} else {
|
||||||
|
fmt.Fprintln(ctx.Out, "Recording stopped successfully.")
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// RecordStatusCmd shows the recording status.
|
||||||
|
type RecordStatusCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to show recording status.
|
||||||
|
func (cmd *RecordStatusCmd) Run(ctx *context) error {
|
||||||
status, err := ctx.Client.Record.GetRecordStatus()
|
status, err := ctx.Client.Record.GetRecordStatus()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
if status.OutputActive {
|
if status.OutputActive {
|
||||||
_, err = ctx.Client.Record.StopRecord()
|
if status.OutputPaused {
|
||||||
if err != nil {
|
fmt.Fprintln(ctx.Out, "Recording is paused.")
|
||||||
return err
|
} else {
|
||||||
|
fmt.Fprintln(ctx.Out, "Recording is in progress.")
|
||||||
}
|
}
|
||||||
fmt.Fprintln(ctx.Out, "Recording stopped successfully.")
|
|
||||||
} else {
|
} else {
|
||||||
_, err = ctx.Client.Record.StartRecord()
|
fmt.Fprintln(ctx.Out, "Recording is not in progress.")
|
||||||
if err != nil {
|
|
||||||
return err
|
|
||||||
}
|
|
||||||
fmt.Fprintln(ctx.Out, "Recording started successfully.")
|
|
||||||
}
|
}
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
105
record_test.go
Normal file
105
record_test.go
Normal file
@@ -0,0 +1,105 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"testing"
|
||||||
|
"time"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestRecordStartStatusStop(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdStart := &RecordStartCmd{}
|
||||||
|
err := cmdStart.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to start recording: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Recording started successfully.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Recording started successfully.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
time.Sleep(1 * time.Second) // Wait for a second to ensure recording has started
|
||||||
|
|
||||||
|
cmdStatus := &RecordStatusCmd{}
|
||||||
|
err = cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get recording status: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Recording is in progress.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Recording is in progress.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdStop := &RecordStopCmd{}
|
||||||
|
err = cmdStop.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to stop recording: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Recording stopped successfully.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Recording stopped successfully.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
time.Sleep(1 * time.Second) // Wait for a second to ensure recording has stopped
|
||||||
|
|
||||||
|
cmdStatus = &RecordStatusCmd{}
|
||||||
|
err = cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get recording status: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Recording is not in progress.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Recording is not in progress.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestRecordToggle(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdStatus := &RecordStatusCmd{}
|
||||||
|
err := cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get recording status: %v", err)
|
||||||
|
}
|
||||||
|
var active bool
|
||||||
|
if out.String() == "Recording is in progress.\n" {
|
||||||
|
active = true
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdToggle := &RecordToggleCmd{}
|
||||||
|
err = cmdToggle.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to toggle recording: %v", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
time.Sleep(1 * time.Second) // Wait for a second to ensure toggle has taken effect
|
||||||
|
|
||||||
|
if active {
|
||||||
|
if out.String() != "Recording stopped successfully.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Recording stopped successfully.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
if out.String() != "Recording started successfully.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Recording started successfully.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -8,6 +8,7 @@ import (
|
|||||||
type ReplayBufferCmd struct {
|
type ReplayBufferCmd struct {
|
||||||
Start ReplayBufferStartCmd `help:"Start replay buffer." cmd:"" aliases:"s"`
|
Start ReplayBufferStartCmd `help:"Start replay buffer." cmd:"" aliases:"s"`
|
||||||
Stop ReplayBufferStopCmd `help:"Stop replay buffer." cmd:"" aliases:"st"`
|
Stop ReplayBufferStopCmd `help:"Stop replay buffer." cmd:"" aliases:"st"`
|
||||||
|
Toggle ReplayBufferToggleCmd `help:"Toggle replay buffer." cmd:"" aliases:"tg"`
|
||||||
Status ReplayBufferStatusCmd `help:"Get replay buffer status." cmd:"" aliases:"ss"`
|
Status ReplayBufferStatusCmd `help:"Get replay buffer status." cmd:"" aliases:"ss"`
|
||||||
Save ReplayBufferSaveCmd `help:"Save replay buffer." cmd:"" aliases:"sv"`
|
Save ReplayBufferSaveCmd `help:"Save replay buffer." cmd:"" aliases:"sv"`
|
||||||
}
|
}
|
||||||
@@ -30,6 +31,24 @@ func (cmd *ReplayBufferStopCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// ReplayBufferToggleCmd toggles the replay buffer state.
|
||||||
|
type ReplayBufferToggleCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to toggle the replay buffer.
|
||||||
|
func (cmd *ReplayBufferToggleCmd) Run(ctx *context) error {
|
||||||
|
status, err := ctx.Client.Outputs.ToggleReplayBuffer()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if status.OutputActive {
|
||||||
|
fmt.Fprintln(ctx.Out, "Replay buffer started successfully.")
|
||||||
|
} else {
|
||||||
|
fmt.Fprintln(ctx.Out, "Replay buffer stopped successfully.")
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
// ReplayBufferStatusCmd retrieves the status of the replay buffer.
|
// ReplayBufferStatusCmd retrieves the status of the replay buffer.
|
||||||
type ReplayBufferStatusCmd struct{} // size = 0x0
|
type ReplayBufferStatusCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
|||||||
58
scene_test.go
Normal file
58
scene_test.go
Normal file
@@ -0,0 +1,58 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestSceneList(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &SceneListCmd{}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list scenes: %v", err)
|
||||||
|
}
|
||||||
|
if !strings.Contains(out.String(), "gobs-test") {
|
||||||
|
t.Fatalf("Expected output to contain 'gobs-test', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestSceneCurrent(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
// Set the current scene to "gobs-test"
|
||||||
|
cmdSwitch := &SceneSwitchCmd{
|
||||||
|
NewScene: "gobs-test",
|
||||||
|
}
|
||||||
|
err := cmdSwitch.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to switch to scene: %v", err)
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdCurrent := &SceneCurrentCmd{}
|
||||||
|
err = cmdCurrent.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get current scene: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "gobs-test\n" {
|
||||||
|
t.Fatalf("Expected output to contain 'gobs-test', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -8,17 +8,17 @@ import (
|
|||||||
|
|
||||||
// SceneCollectionCmd provides commands to manage scene collections in OBS Studio.
|
// SceneCollectionCmd provides commands to manage scene collections in OBS Studio.
|
||||||
type SceneCollectionCmd struct {
|
type SceneCollectionCmd struct {
|
||||||
List ListSceneCollectionCmd `help:"List scene collections." cmd:"" aliases:"ls"`
|
List SceneCollectionListCmd `help:"List scene collections." cmd:"" aliases:"ls"`
|
||||||
Current CurrentSceneCollectionCmd `help:"Get current scene collection." cmd:"" aliases:"c"`
|
Current SceneCollectionCurrentCmd `help:"Get current scene collection." cmd:"" aliases:"c"`
|
||||||
Switch SwitchSceneCollectionCmd `help:"Switch scene collection." cmd:"" aliases:"sw"`
|
Switch SceneCollectionSwitchCmd `help:"Switch scene collection." cmd:"" aliases:"sw"`
|
||||||
Create CreateSceneCollectionCmd `help:"Create scene collection." cmd:"" aliases:"new"`
|
Create SceneCollectionCreateCmd `help:"Create scene collection." cmd:"" aliases:"new"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// ListSceneCollectionCmd provides a command to list all scene collections.
|
// SceneCollectionListCmd provides a command to list all scene collections.
|
||||||
type ListSceneCollectionCmd struct{} // size = 0x0
|
type SceneCollectionListCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to list all scene collections.
|
// Run executes the command to list all scene collections.
|
||||||
func (cmd *ListSceneCollectionCmd) Run(ctx *context) error {
|
func (cmd *SceneCollectionListCmd) Run(ctx *context) error {
|
||||||
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to get scene collection list: %w", err)
|
return fmt.Errorf("failed to get scene collection list: %w", err)
|
||||||
@@ -31,11 +31,11 @@ func (cmd *ListSceneCollectionCmd) Run(ctx *context) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// CurrentSceneCollectionCmd provides a command to get the current scene collection.
|
// SceneCollectionCurrentCmd provides a command to get the current scene collection.
|
||||||
type CurrentSceneCollectionCmd struct{} // size = 0x0
|
type SceneCollectionCurrentCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to get the current scene collection.
|
// Run executes the command to get the current scene collection.
|
||||||
func (cmd *CurrentSceneCollectionCmd) Run(ctx *context) error {
|
func (cmd *SceneCollectionCurrentCmd) Run(ctx *context) error {
|
||||||
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to get scene collection list: %w", err)
|
return fmt.Errorf("failed to get scene collection list: %w", err)
|
||||||
@@ -45,13 +45,13 @@ func (cmd *CurrentSceneCollectionCmd) Run(ctx *context) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// SwitchSceneCollectionCmd provides a command to switch to a different scene collection.
|
// SceneCollectionSwitchCmd provides a command to switch to a different scene collection.
|
||||||
type SwitchSceneCollectionCmd struct {
|
type SceneCollectionSwitchCmd struct {
|
||||||
Name string `arg:"" help:"Name of the scene collection to switch to." required:""`
|
Name string `arg:"" help:"Name of the scene collection to switch to." required:""`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to switch to a different scene collection.
|
// Run executes the command to switch to a different scene collection.
|
||||||
func (cmd *SwitchSceneCollectionCmd) Run(ctx *context) error {
|
func (cmd *SceneCollectionSwitchCmd) Run(ctx *context) error {
|
||||||
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
@@ -74,13 +74,13 @@ func (cmd *SwitchSceneCollectionCmd) Run(ctx *context) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// CreateSceneCollectionCmd provides a command to create a new scene collection.
|
// SceneCollectionCreateCmd provides a command to create a new scene collection.
|
||||||
type CreateSceneCollectionCmd struct {
|
type SceneCollectionCreateCmd struct {
|
||||||
Name string `arg:"" help:"Name of the scene collection to create." required:""`
|
Name string `arg:"" help:"Name of the scene collection to create." required:""`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to create a new scene collection.
|
// Run executes the command to create a new scene collection.
|
||||||
func (cmd *CreateSceneCollectionCmd) Run(ctx *context) error {
|
func (cmd *SceneCollectionCreateCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Config.CreateSceneCollection(
|
_, err := ctx.Client.Config.CreateSceneCollection(
|
||||||
config.NewCreateSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
config.NewCreateSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
||||||
)
|
)
|
||||||
|
|||||||
32
sceneitem_test.go
Normal file
32
sceneitem_test.go
Normal file
@@ -0,0 +1,32 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestSceneItemList(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmd := &SceneItemListCmd{
|
||||||
|
SceneName: "gobs-test",
|
||||||
|
}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list scene items: %v", err)
|
||||||
|
}
|
||||||
|
if !strings.Contains(out.String(), "gobs-test-input") {
|
||||||
|
t.Fatalf("Expected output to contain 'gobs-test-input', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
if !strings.Contains(out.String(), "gobs-test-input-2") {
|
||||||
|
t.Fatalf("Expected output to contain 'gobs-test-input-2', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
40
stream.go
40
stream.go
@@ -17,10 +17,22 @@ type StreamStartCmd struct{} // size = 0x0
|
|||||||
|
|
||||||
// Run executes the command to start streaming.
|
// Run executes the command to start streaming.
|
||||||
func (cmd *StreamStartCmd) Run(ctx *context) error {
|
func (cmd *StreamStartCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Stream.StartStream()
|
// Check if the stream is already active
|
||||||
|
status, err := ctx.Client.Stream.GetStreamStatus()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
if status.OutputActive {
|
||||||
|
fmt.Fprintln(ctx.Out, "Stream is already active.")
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Stream.StartStream()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, "Streaming started successfully.")
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -29,10 +41,22 @@ type StreamStopCmd struct{} // size = 0x0
|
|||||||
|
|
||||||
// Run executes the command to stop streaming.
|
// Run executes the command to stop streaming.
|
||||||
func (cmd *StreamStopCmd) Run(ctx *context) error {
|
func (cmd *StreamStopCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Stream.StopStream()
|
// Check if the stream is already inactive
|
||||||
|
status, err := ctx.Client.Stream.GetStreamStatus()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
if !status.OutputActive {
|
||||||
|
fmt.Fprintln(ctx.Out, "Stream is already inactive.")
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Stream.StopStream()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, "Streaming stopped successfully.")
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -41,19 +65,15 @@ type StreamToggleCmd struct{} // size = 0x0
|
|||||||
|
|
||||||
// Run executes the command to toggle streaming.
|
// Run executes the command to toggle streaming.
|
||||||
func (cmd *StreamToggleCmd) Run(ctx *context) error {
|
func (cmd *StreamToggleCmd) Run(ctx *context) error {
|
||||||
status, err := ctx.Client.Stream.GetStreamStatus()
|
status, err := ctx.Client.Stream.ToggleStream()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
if status.OutputActive {
|
if status.OutputActive {
|
||||||
_, err = ctx.Client.Stream.StopStream()
|
fmt.Fprintln(ctx.Out, "Streaming started successfully.")
|
||||||
fmt.Fprintf(ctx.Out, "Stopping stream...\n")
|
|
||||||
} else {
|
} else {
|
||||||
_, err = ctx.Client.Stream.StartStream()
|
fmt.Fprintln(ctx.Out, "Streaming stopped successfully.")
|
||||||
fmt.Fprintf(ctx.Out, "Starting stream...\n")
|
|
||||||
}
|
|
||||||
if err != nil {
|
|
||||||
return err
|
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
131
stream_test.go
Normal file
131
stream_test.go
Normal file
@@ -0,0 +1,131 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
"time"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestStreamStart(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdStatus := &StreamStatusCmd{}
|
||||||
|
err := cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get stream status: %v", err)
|
||||||
|
}
|
||||||
|
var active bool
|
||||||
|
if strings.Contains(out.String(), "Output active: true") {
|
||||||
|
active = true
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdStart := &StreamStartCmd{}
|
||||||
|
err = cmdStart.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to start stream: %v", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
time.Sleep(1 * time.Second) // Wait for the stream to start
|
||||||
|
|
||||||
|
if active {
|
||||||
|
if out.String() != "Stream is already active.\n" {
|
||||||
|
t.Fatalf("Expected 'Stream is already active.', got: %s", out.String())
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
if out.String() != "Streaming started successfully.\n" {
|
||||||
|
t.Fatalf("Expected 'Streaming started successfully.', got: %s", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestStreamStop(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdStatus := &StreamStatusCmd{}
|
||||||
|
err := cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get stream status: %v", err)
|
||||||
|
}
|
||||||
|
var active bool
|
||||||
|
if strings.Contains(out.String(), "Output active: true") {
|
||||||
|
active = true
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdStop := &StreamStopCmd{}
|
||||||
|
err = cmdStop.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to stop stream: %v", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
time.Sleep(1 * time.Second) // Wait for the stream to stop
|
||||||
|
|
||||||
|
if active {
|
||||||
|
if out.String() != "Streaming stopped successfully.\n" {
|
||||||
|
t.Fatalf("Expected 'Streaming stopped successfully.', got: %s", out.String())
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
if out.String() != "Stream is already inactive.\n" {
|
||||||
|
t.Fatalf("Expected 'Stream is already inactive.', got: %s", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestStreamToggle(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdStatus := &StreamStatusCmd{}
|
||||||
|
err := cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get stream status: %v", err)
|
||||||
|
}
|
||||||
|
var active bool
|
||||||
|
if strings.Contains(out.String(), "Output active: true") {
|
||||||
|
active = true
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdToggle := &StreamToggleCmd{}
|
||||||
|
err = cmdToggle.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to toggle stream: %v", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
time.Sleep(1 * time.Second) // Wait for the stream to toggle
|
||||||
|
|
||||||
|
if active {
|
||||||
|
if out.String() != "Streaming stopped successfully.\n" {
|
||||||
|
t.Fatalf("Expected 'Streaming stopped successfully.', got: %s", out.String())
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
if out.String() != "Streaming started successfully.\n" {
|
||||||
|
t.Fatalf("Expected 'Streaming started successfully.', got: %s", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -23,6 +23,8 @@ func (cmd *StudioModeEnableCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to enable studio mode: %w", err)
|
return fmt.Errorf("failed to enable studio mode: %w", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, "Studio mode is now enabled")
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -35,6 +37,8 @@ func (cmd *StudioModeDisableCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to disable studio mode: %w", err)
|
return fmt.Errorf("failed to disable studio mode: %w", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, "Studio mode is now disabled")
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
68
studiomode_test.go
Normal file
68
studiomode_test.go
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"testing"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestStudioModeEnable(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdEnable := &StudioModeEnableCmd{}
|
||||||
|
err := cmdEnable.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("failed to enable studio mode: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Studio mode is now enabled\n" {
|
||||||
|
t.Fatalf("expected 'Studio mode is now enabled', got: %s", out.String())
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdStatus := &StudioModeStatusCmd{}
|
||||||
|
err = cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("failed to get studio mode status: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Studio mode is enabled\n" {
|
||||||
|
t.Fatalf("expected 'Studio mode is enabled', got: %s", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestStudioModeDisable(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := &context{
|
||||||
|
Client: client,
|
||||||
|
Out: &out,
|
||||||
|
}
|
||||||
|
|
||||||
|
cmdDisable := &StudioModeDisableCmd{}
|
||||||
|
err := cmdDisable.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("failed to disable studio mode: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Studio mode is now disabled\n" {
|
||||||
|
t.Fatalf("expected 'Studio mode is now disabled', got: %s", out.String())
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdStatus := &StudioModeStatusCmd{}
|
||||||
|
err = cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("failed to get studio mode status: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Studio mode is disabled\n" {
|
||||||
|
t.Fatalf("expected 'Studio mode is disabled', got: %s", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -6,17 +6,17 @@ import (
|
|||||||
|
|
||||||
// VirtualCamCmd handles the virtual camera commands.
|
// VirtualCamCmd handles the virtual camera commands.
|
||||||
type VirtualCamCmd struct {
|
type VirtualCamCmd struct {
|
||||||
Start StartVirtualCamCmd `help:"Start virtual camera." cmd:"" aliases:"s"`
|
Start VirtualCamStartCmd `help:"Start virtual camera." cmd:"" aliases:"s"`
|
||||||
Stop StopVirtualCamCmd `help:"Stop virtual camera." cmd:"" aliases:"st"`
|
Stop VirtualCamStopCmd `help:"Stop virtual camera." cmd:"" aliases:"st"`
|
||||||
Toggle ToggleVirtualCamCmd `help:"Toggle virtual camera." cmd:"" aliases:"tg"`
|
Toggle VirtualCamToggleCmd `help:"Toggle virtual camera." cmd:"" aliases:"tg"`
|
||||||
Status StatusVirtualCamCmd `help:"Get virtual camera status." cmd:"" aliases:"ss"`
|
Status VirtualCamStatusCmd `help:"Get virtual camera status." cmd:"" aliases:"ss"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// StartVirtualCamCmd starts the virtual camera.
|
// VirtualCamStartCmd starts the virtual camera.
|
||||||
type StartVirtualCamCmd struct{} // size = 0x0
|
type VirtualCamStartCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to start the virtual camera.
|
// Run executes the command to start the virtual camera.
|
||||||
func (c *StartVirtualCamCmd) Run(ctx *context) error {
|
func (c *VirtualCamStartCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Outputs.StartVirtualCam()
|
_, err := ctx.Client.Outputs.StartVirtualCam()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to start virtual camera: %w", err)
|
return fmt.Errorf("failed to start virtual camera: %w", err)
|
||||||
@@ -25,11 +25,11 @@ func (c *StartVirtualCamCmd) Run(ctx *context) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// StopVirtualCamCmd stops the virtual camera.
|
// VirtualCamStopCmd stops the virtual camera.
|
||||||
type StopVirtualCamCmd struct{} // size = 0x0
|
type VirtualCamStopCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to stop the virtual camera.
|
// Run executes the command to stop the virtual camera.
|
||||||
func (c *StopVirtualCamCmd) Run(ctx *context) error {
|
func (c *VirtualCamStopCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Outputs.StopVirtualCam()
|
_, err := ctx.Client.Outputs.StopVirtualCam()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to stop virtual camera: %w", err)
|
return fmt.Errorf("failed to stop virtual camera: %w", err)
|
||||||
@@ -38,11 +38,11 @@ func (c *StopVirtualCamCmd) Run(ctx *context) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// ToggleVirtualCamCmd toggles the virtual camera.
|
// VirtualCamToggleCmd toggles the virtual camera.
|
||||||
type ToggleVirtualCamCmd struct{} // size = 0x0
|
type VirtualCamToggleCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to toggle the virtual camera.
|
// Run executes the command to toggle the virtual camera.
|
||||||
func (c *ToggleVirtualCamCmd) Run(ctx *context) error {
|
func (c *VirtualCamToggleCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Outputs.ToggleVirtualCam()
|
_, err := ctx.Client.Outputs.ToggleVirtualCam()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to toggle virtual camera: %w", err)
|
return fmt.Errorf("failed to toggle virtual camera: %w", err)
|
||||||
@@ -50,11 +50,11 @@ func (c *ToggleVirtualCamCmd) Run(ctx *context) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// StatusVirtualCamCmd retrieves the status of the virtual camera.
|
// VirtualCamStatusCmd retrieves the status of the virtual camera.
|
||||||
type StatusVirtualCamCmd struct{} // size = 0x0
|
type VirtualCamStatusCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to get the status of the virtual camera.
|
// Run executes the command to get the status of the virtual camera.
|
||||||
func (c *StatusVirtualCamCmd) Run(ctx *context) error {
|
func (c *VirtualCamStatusCmd) Run(ctx *context) error {
|
||||||
status, err := ctx.Client.Outputs.GetVirtualCamStatus()
|
status, err := ctx.Client.Outputs.GetVirtualCamStatus()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to get virtual camera status: %w", err)
|
return fmt.Errorf("failed to get virtual camera status: %w", err)
|
||||||
|
|||||||
Reference in New Issue
Block a user