mirror of
https://github.com/onyx-and-iris/gobs-cli.git
synced 2026-01-02 20:17:51 +00:00
Compare commits
No commits in common. "main" and "v0.1.0" have entirely different histories.
9
.gitignore
vendored
9
.gitignore
vendored
@ -26,12 +26,5 @@ go.work
|
||||
|
||||
# End of gignore: github.com/onyx-and-iris/gignore
|
||||
|
||||
# Environment
|
||||
.env
|
||||
.envrc
|
||||
|
||||
# Man pages
|
||||
gobs-cli.1
|
||||
|
||||
# Config files
|
||||
config.yaml
|
||||
*_test.go
|
||||
@ -50,6 +50,3 @@ issues:
|
||||
exclude:
|
||||
# gosec: Duplicated errcheck checks
|
||||
- G104
|
||||
exclude-files:
|
||||
# Exclude vendor directory
|
||||
- main_test.go
|
||||
|
||||
151
CHANGELOG.md
151
CHANGELOG.md
@ -5,157 +5,6 @@ All notable changes to this project will be documented in this file.
|
||||
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
||||
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
||||
|
||||
# [0.14.1] - 2025-07-14
|
||||
|
||||
### Added
|
||||
|
||||
- text command group, see [TextCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#textcmd)
|
||||
|
||||
# [0.13.3] - 2025-06-27
|
||||
|
||||
### Changed
|
||||
|
||||
- usage is now printed on errors.
|
||||
- help is printed in compact mode. This should make it easier to page through help on the root command.
|
||||
|
||||
### Fixed
|
||||
|
||||
- Item ID alignment in sceneitem list table.
|
||||
|
||||
# [0.13.0] - 2025-06-23
|
||||
|
||||
### Added
|
||||
|
||||
- record split and record chapter commands, see [RecordCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#recordcmd)
|
||||
- As of OBS 30.2.0, the only file format supporting *record chapter* is Hybrid MP4.
|
||||
|
||||
# [0.12.1] - 2025-06-21
|
||||
|
||||
### Added
|
||||
|
||||
- Various colouring styles, see [Style](https://github.com/onyx-and-iris/gobs-cli/tree/main?tab=readme-ov-file#style)
|
||||
- colouring is applied to list tables as well as highlighted information in stdout/stderr output.
|
||||
- table border styling may be optionally disabled with the --no-border flag.
|
||||
|
||||
### Changed
|
||||
|
||||
- if an itemName is passed to a sceneitem command that's in a group, without the --group flag, a friendlier error message is displayed.
|
||||
- it will suggest using *gobs-cli si ls* to list sources in the scene.
|
||||
- if an invalid --monitor-index is passed to projector open a friendlier error message is displayed.
|
||||
- it will suggest using *gobs-cli prj ls-m* to list available monitors.
|
||||
|
||||
|
||||
# [0.11.0] - 2025-06-20
|
||||
|
||||
### Added
|
||||
|
||||
- input list, scene list and sceneitem list now accept --uuid flag.
|
||||
- Active column added to scene list table.
|
||||
|
||||
### Changed
|
||||
|
||||
- scene list no longer prints the UUIDs by default, enable it with the --uuid flag.
|
||||
|
||||
# [0.10.3] - 2025-06-07
|
||||
|
||||
### Added
|
||||
|
||||
- filter list:
|
||||
- --ffmpeg, --vlc flags
|
||||
- Muted column to list table
|
||||
|
||||
# [0.10.2] - 2025-06-04
|
||||
|
||||
### Added
|
||||
|
||||
- screenshot save command, see [ScreenshotCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#screenshotcmd)
|
||||
|
||||
### Fixed
|
||||
|
||||
- filter list:
|
||||
- sourceName arg now defaults to current scene.
|
||||
- defaults are printed for any unmodified values.
|
||||
- sceneitem list:
|
||||
- prints enabled mark instead of true/false
|
||||
|
||||
# [0.9.0] - 2025-06-02
|
||||
|
||||
### Added
|
||||
|
||||
- --version/-v option. See [Flags](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#flags)
|
||||
|
||||
### Changed
|
||||
|
||||
- version command renamed to obs-version
|
||||
|
||||
# [0.8.2] - 2025-05-29
|
||||
|
||||
### Added
|
||||
|
||||
- record start/stop and stream start/stop commands check outputActive states first.
|
||||
- Errors are returned if the command cannot be performed.
|
||||
|
||||
### Changed
|
||||
|
||||
- The --parent flag for the sceneitem commands has been renamed to --group, see [SceneItemCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#sceneitemcmd)
|
||||
|
||||
# [0.8.0] - 2025-05-27
|
||||
|
||||
### Added
|
||||
|
||||
- record directory command, see [directory under RecordCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#recordcmd)
|
||||
|
||||
### Changed
|
||||
|
||||
- record stop now prints the output path of the recording.
|
||||
|
||||
|
||||
# [0.7.0] - 2025-05-26
|
||||
|
||||
### Added
|
||||
|
||||
- projector commands, see [ProjectorCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#projectorcmd)
|
||||
|
||||
|
||||
# [0.6.1] - 2025-05-25
|
||||
|
||||
### Added
|
||||
|
||||
- filter commands, see [FilterCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#filtercmd)
|
||||
|
||||
### Changed
|
||||
|
||||
- list commands are now printed as tables.
|
||||
- This affects group, hotkey, input, profile, scene, scenecollection and sceneitem command groups.
|
||||
|
||||
# [0.5.0] - 2025-05-22
|
||||
|
||||
### Added
|
||||
|
||||
- hotkey commands, see [HotkeyCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#hotkeycmd)
|
||||
|
||||
# [0.4.2] - 2025-05-08
|
||||
|
||||
### Added
|
||||
|
||||
- replaybuffer toggle command
|
||||
- studiomode enable/disable now print output to console
|
||||
- stream start/stop now print output to console
|
||||
- Unit tests
|
||||
|
||||
# [0.3.1] - 2025-05-02
|
||||
|
||||
### Added
|
||||
|
||||
- --man flag for generating/viewing a man page.
|
||||
- Ability to load env vars from env files, see the [README](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#environment-variables)
|
||||
|
||||
# [0.2.0] - 2025-04-27
|
||||
|
||||
### Added
|
||||
|
||||
- sceneitem transform, see *transform* under [SceneItemCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#sceneitemcmd)
|
||||
|
||||
# [0.1.0] - 2025-04-24
|
||||
|
||||
### Added
|
||||
|
||||
21
LICENSE
21
LICENSE
@ -1,21 +0,0 @@
|
||||
MIT License
|
||||
|
||||
Copyright (c) 2025 Onyx and Iris
|
||||
|
||||
Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||
of this software and associated documentation files (the "Software"), to deal
|
||||
in the Software without restriction, including without limitation the rights
|
||||
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
|
||||
copies of the Software, and to permit persons to whom the Software is
|
||||
furnished to do so, subject to the following conditions:
|
||||
|
||||
The above copyright notice and this permission notice shall be included in all
|
||||
copies or substantial portions of the Software.
|
||||
|
||||
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
||||
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
|
||||
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
|
||||
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
|
||||
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
|
||||
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
|
||||
SOFTWARE.
|
||||
328
README.md
328
README.md
@ -4,100 +4,40 @@ A command line interface for OBS Websocket v5
|
||||
|
||||
For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)
|
||||
|
||||
-----
|
||||
|
||||
## Table of Contents
|
||||
|
||||
- [Installation](#installation)
|
||||
- [Configuration](#configuration)
|
||||
- [Style](#style)
|
||||
- [Commands](#commands)
|
||||
- [License](#license)
|
||||
|
||||
## Installation
|
||||
|
||||
```console
|
||||
go install github.com/onyx-and-iris/gobs-cli@latest
|
||||
```
|
||||
|
||||
## Configuration
|
||||
|
||||
#### Flags
|
||||
|
||||
- --host/-H: Websocket host
|
||||
- --port/-P Websocket port
|
||||
- --password/-p: Websocket password
|
||||
- --timeout/-T: Websocket timeout
|
||||
- --version/-v: Print the gobs-cli version
|
||||
|
||||
Pass `--host`, `--port` and `--password` as flags on the root command, for example:
|
||||
Pass `--host`, `--port` and `--password` as flags to the root command, for example:
|
||||
|
||||
```console
|
||||
gobs-cli --host localhost --port 4455 --password 'websocket password' --help
|
||||
gobs-cli --host=localhost --port=4455 --password=<websocket password> --help
|
||||
```
|
||||
|
||||
#### Environment Variables
|
||||
|
||||
Store and load environment variables from:
|
||||
Load connection details from your environment:
|
||||
|
||||
- A `.env` file in the cwd
|
||||
- $XDG_CONFIG_HOME / gobs-cli / config.env (see [os.UserConfigDir][userconfigdir])
|
||||
```bash
|
||||
#!/usr/bin/env bash
|
||||
|
||||
```env
|
||||
OBS_HOST=localhost
|
||||
OBS_PORT=4455
|
||||
OBS_PASSWORD=<websocket password>
|
||||
OBS_TIMEOUT=5
|
||||
```
|
||||
|
||||
## Style
|
||||
|
||||
Styling is opt-in, by default you will get a colourless output:
|
||||
|
||||
|
||||
|
||||
You may enable styling with the --style/-s flag:
|
||||
|
||||
```console
|
||||
gobs-cli --style="red" sceneitem list
|
||||
```
|
||||
|
||||
Available styles: _red, magenta, purple, blue, cyan, green, yellow, orange, white, grey, navy, black_
|
||||
|
||||
|
||||
|
||||
Optionally you may disable border colouring with the --no-border flag:
|
||||
|
||||
|
||||
|
||||
```console
|
||||
gobs-cli --style="red" --no-border sceneitem list
|
||||
```
|
||||
|
||||
Or with environment variables:
|
||||
|
||||
```env
|
||||
GOBS_STYLE=red
|
||||
GOBS_STYLE_NO_BORDER=true
|
||||
export OBS_HOST=localhost
|
||||
export OBS_PORT=4455
|
||||
export OBS_PASSWORD=<websocket password>
|
||||
export OBS_TIMEOUT=5
|
||||
```
|
||||
|
||||
## Commands
|
||||
|
||||
### ObsVersionCmd
|
||||
|
||||
- Print OBS client and websocket version.
|
||||
### VersionCmd
|
||||
|
||||
```console
|
||||
gobs-cli obs-version
|
||||
gobs-cli version
|
||||
```
|
||||
|
||||
### SceneCmd
|
||||
|
||||
- list: List all scenes.
|
||||
- flags:
|
||||
|
||||
*optional*
|
||||
- --UUID: Display UUIDs of scenes.
|
||||
|
||||
```console
|
||||
gobs-cli scene list
|
||||
@ -131,18 +71,9 @@ gobs-cli scene switch --preview LIVE
|
||||
### SceneItemCmd
|
||||
|
||||
- list: List all scene items.
|
||||
- flags:
|
||||
|
||||
*optional*
|
||||
- --UUID: Display UUIDs of scene items.
|
||||
|
||||
*optional*
|
||||
- args: SceneName
|
||||
- defaults to current scene
|
||||
|
||||
```console
|
||||
gobs-cli sceneitem list
|
||||
|
||||
gobs-cli sceneitem list LIVE
|
||||
```
|
||||
|
||||
@ -150,7 +81,7 @@ gobs-cli sceneitem list LIVE
|
||||
- flags:
|
||||
|
||||
*optional*
|
||||
- --group: Parent group name.
|
||||
- --parent: Parent group name.
|
||||
- args: SceneName ItemName
|
||||
|
||||
```console
|
||||
@ -161,7 +92,7 @@ gobs-cli sceneitem show START "Colour Source"
|
||||
- flags:
|
||||
|
||||
*optional*
|
||||
- --group: Parent group name.
|
||||
- --parent: Parent group name.
|
||||
- args: SceneName ItemName
|
||||
|
||||
```console
|
||||
@ -172,65 +103,30 @@ gobs-cli sceneitem hide START "Colour Source"
|
||||
- flags:
|
||||
|
||||
*optional*
|
||||
- --group: Parent group name.
|
||||
- --parent: Parent group name.
|
||||
- args: SceneName ItemName
|
||||
|
||||
```console
|
||||
gobs-cli sceneitem toggle --group=test_group START "Colour Source 3"
|
||||
gobs-cli sceneitem toggle --parent=test_group START "Colour Source 3"
|
||||
```
|
||||
|
||||
- visible: Get scene item visibility.
|
||||
- flags:
|
||||
|
||||
*optional*
|
||||
- --group: Parent group name.
|
||||
- --parent: Parent group name.
|
||||
- args: SceneName ItemName
|
||||
|
||||
```console
|
||||
gobs-cli sceneitem visible --group=test_group START "Colour Source 4"
|
||||
```
|
||||
|
||||
- transform: Transform scene item.
|
||||
- flags:
|
||||
|
||||
*optional*
|
||||
- --group: Parent group name.
|
||||
|
||||
- --alignment: Alignment of the scene item.
|
||||
- --bounds-alignment: Bounds alignment of the scene item.
|
||||
- --bounds-height: Bounds height of the scene item.
|
||||
- --bounds-type: Bounds type of the scene item.
|
||||
- --bounds-width: Bounds width of the scene item.
|
||||
- --crop-to-bounds: Whether to crop the scene item to bounds.
|
||||
- --crop-bottom: Crop bottom value of the scene item.
|
||||
- --crop-left: Crop left value of the scene item.
|
||||
- --crop-right: Crop right value of the scene item.
|
||||
- --crop-top: Crop top value of the scene item.
|
||||
- --position-x: X position of the scene item.
|
||||
- --position-y: Y position of the scene item.
|
||||
- --rotation: Rotation of the scene item.
|
||||
- --scale-x: X scale of the scene item.
|
||||
- --scale-y: Y scale of the scene item.
|
||||
- args: SceneName ItemName
|
||||
|
||||
```console
|
||||
gobs-cli sceneitem transform \
|
||||
--rotation=5 \
|
||||
--position-x=250.8 \
|
||||
Scene "Colour Source 3"
|
||||
gobs-cli sceneitem visible --parent=test_group START "Colour Source 4"
|
||||
```
|
||||
|
||||
### GroupCmd
|
||||
|
||||
- list: List all groups.
|
||||
|
||||
*optional*
|
||||
- args: SceneName
|
||||
- defaults to current scene
|
||||
|
||||
```console
|
||||
gobs-cli group list
|
||||
|
||||
gobs-cli group list START
|
||||
```
|
||||
|
||||
@ -271,9 +167,6 @@ gobs-cli group status START "test_group"
|
||||
- --input: List all inputs.
|
||||
- --output: List all outputs.
|
||||
- --colour: List all colour sources.
|
||||
- --ffmpeg: List all ffmpeg sources.
|
||||
- --vlc: List all VLC sources.
|
||||
- --uuid: Display UUIDs of inputs.
|
||||
|
||||
```console
|
||||
gobs-cli input list
|
||||
@ -302,22 +195,6 @@ gobs-cli input unmute "Mic/Aux"
|
||||
gobs-cli input toggle "Mic/Aux"
|
||||
```
|
||||
|
||||
### TextCmd
|
||||
|
||||
- current: Display current text for a text input.
|
||||
- args: InputName
|
||||
|
||||
```console
|
||||
gobs-cli text current "My Text Input"
|
||||
```
|
||||
|
||||
- update: Update the text of a text input.
|
||||
- args: InputName NewText
|
||||
|
||||
```console
|
||||
gobs-cli text update "My Text Input" "hi OBS!"
|
||||
```
|
||||
|
||||
### RecordCmd
|
||||
|
||||
- start: Start recording.
|
||||
@ -356,34 +233,6 @@ gobs-cli record pause
|
||||
gobs-cli record resume
|
||||
```
|
||||
|
||||
- directory: Get/Set recording directory.
|
||||
|
||||
*optional*
|
||||
- args: RecordDirectory
|
||||
- if not passed the current record directory will be printed.
|
||||
|
||||
```console
|
||||
gobs-cli record directory
|
||||
|
||||
gobs-cli record directory "/home/me/obs-vids/"
|
||||
gobs-cli record directory "C:/Users/me/Videos"
|
||||
```
|
||||
|
||||
- split: Split recording.
|
||||
|
||||
```console
|
||||
gobs-cli record split
|
||||
```
|
||||
|
||||
- chapter: Create a chapter in the recording.
|
||||
|
||||
*optional*
|
||||
- arg: ChapterName
|
||||
|
||||
```console
|
||||
gobs-cli record chapter "Chapter Name"
|
||||
```
|
||||
|
||||
### StreamCmd
|
||||
|
||||
- start: Start streaming.
|
||||
@ -424,7 +273,7 @@ gobs-cli scenecollection list
|
||||
gobs-cli scenecollection current
|
||||
```
|
||||
|
||||
- switch: Switch scene collection.
|
||||
- switch: "Switch scene collection.
|
||||
- args: Name
|
||||
|
||||
```console
|
||||
@ -456,21 +305,21 @@ gobs-cli profile current
|
||||
- args: Name
|
||||
|
||||
```console
|
||||
gobs-cli profile switch test-profile
|
||||
gobs-cli profile switch test-collection
|
||||
```
|
||||
|
||||
- create: Create profile.
|
||||
- args: Name
|
||||
|
||||
```console
|
||||
gobs-cli profile create test-profile
|
||||
gobs-cli profile create test-collection
|
||||
```
|
||||
|
||||
- remove: Remove profile.
|
||||
- args: Name
|
||||
|
||||
```console
|
||||
gobs-cli profile remove test-profile
|
||||
gobs-cli profile create test-collection
|
||||
```
|
||||
|
||||
### ReplayBufferCmd
|
||||
@ -487,12 +336,6 @@ gobs-cli replaybuffer start
|
||||
gobs-cli replaybuffer stop
|
||||
```
|
||||
|
||||
- toggle: Toggle replay buffer.
|
||||
|
||||
```console
|
||||
gobs-cli replaybuffer toggle
|
||||
```
|
||||
|
||||
- status: Get replay buffer status.
|
||||
|
||||
```console
|
||||
@ -556,132 +399,3 @@ gobs-cli virtualcam toggle
|
||||
```console
|
||||
gobs-cli virtualcam status
|
||||
```
|
||||
|
||||
### HotkeyCmd
|
||||
|
||||
- list: List all hotkeys.
|
||||
|
||||
```console
|
||||
gobs-cli hotkey list
|
||||
```
|
||||
|
||||
- trigger: Trigger a hotkey by name.
|
||||
|
||||
```console
|
||||
gobs-cli hotkey trigger OBSBasic.StartStreaming
|
||||
|
||||
gobs-cli hotkey trigger OBSBasic.StopStreaming
|
||||
```
|
||||
|
||||
- trigger-sequence: Trigger a hotkey by sequence.
|
||||
- flags:
|
||||
|
||||
*optional*
|
||||
- --shift: Press shift.
|
||||
- --ctrl: Press control.
|
||||
- --alt: Press alt.
|
||||
- --cmd: Press command (mac).
|
||||
|
||||
- args: keyID
|
||||
- Check [obs-hotkeys.h][obs-keyids] for a full list of OBS key ids.
|
||||
|
||||
```console
|
||||
gobs-cli hotkey trigger-sequence OBS_KEY_F1 --ctrl
|
||||
|
||||
gobs-cli hotkey trigger-sequence OBS_KEY_F1 --shift --ctrl
|
||||
```
|
||||
|
||||
### FilterCmd
|
||||
|
||||
- list: List all filters.
|
||||
|
||||
*optional*
|
||||
- args: SourceName
|
||||
- defaults to current scene
|
||||
|
||||
```console
|
||||
gobs-cli filter list
|
||||
```
|
||||
|
||||
- enable: Enable filter.
|
||||
- args: SourceName FilterName
|
||||
|
||||
```console
|
||||
gobs-cli enable 'Mic/Aux' 'Gain'
|
||||
```
|
||||
|
||||
- disable: Disable filter.
|
||||
- args: SourceName FilterName
|
||||
|
||||
```console
|
||||
gobs-cli disable 'Mic/Aux' 'Gain'
|
||||
```
|
||||
|
||||
- toggle: Toggle filter.
|
||||
- args: SourceName FilterName
|
||||
|
||||
```console
|
||||
gobs-cli toggle 'Mic/Aux' 'Gain'
|
||||
```
|
||||
|
||||
- status: Get filter status.
|
||||
- args: SourceName FilterName
|
||||
|
||||
```console
|
||||
gobs-cli status 'Mic/Aux' 'Gain'
|
||||
```
|
||||
|
||||
### ProjectorCmd
|
||||
|
||||
- list-monitors: List available monitors.
|
||||
|
||||
```console
|
||||
gobs-cli projector list-monitors
|
||||
```
|
||||
|
||||
- open: Open a fullscreen projector for a source on a specific monitor.
|
||||
- flags:
|
||||
|
||||
*optional*
|
||||
- --monitor-index: Index of the monitor to open the projector on.
|
||||
- defaults to 0
|
||||
|
||||
*optional*
|
||||
- args: SourceName
|
||||
- defaults to current scene
|
||||
|
||||
```console
|
||||
gobs-cli projector open
|
||||
|
||||
gobs-cli projector open --monitor-index=1 "test_scene"
|
||||
|
||||
gobs-cli projector open --monitor-index=1 "test_group"
|
||||
```
|
||||
|
||||
### ScreenshotCmd
|
||||
|
||||
- save: Take a screenshot and save it to a file.
|
||||
- flags:
|
||||
|
||||
*optional*
|
||||
- --width:
|
||||
- defaults to 1920
|
||||
- --height:
|
||||
- defaults to 1080
|
||||
- --quality:
|
||||
- defaults to -1
|
||||
|
||||
- args: SourceName FilePath
|
||||
|
||||
```console
|
||||
gobs-cli screenshot save --width=2560 --height=1440 "Scene" "C:\Users\me\Videos\screenshot.png"
|
||||
```
|
||||
|
||||
## License
|
||||
|
||||
`gobs-cli` is distributed under the terms of the [MIT](https://spdx.org/licenses/MIT.html) license.
|
||||
|
||||
|
||||
[userconfigdir]: https://pkg.go.dev/os#UserConfigDir
|
||||
[obs-keyids]: https://github.com/obsproject/obs-studio/blob/master/libobs/obs-hotkeys.h
|
||||
[no-colour]: https://no-color.org/
|
||||
|
||||
@ -1,17 +0,0 @@
|
||||
version: '3'
|
||||
|
||||
tasks:
|
||||
default:
|
||||
desc: View man page
|
||||
cmds:
|
||||
- task: view
|
||||
|
||||
view:
|
||||
desc: View man page
|
||||
cmds:
|
||||
- go run . --man | man -l -
|
||||
|
||||
generate:
|
||||
desc: Generate man page
|
||||
cmds:
|
||||
- go run . --man > {{.PROGRAM}}.1
|
||||
@ -1,14 +1,9 @@
|
||||
version: '3'
|
||||
|
||||
includes:
|
||||
man: Taskfile.man.yaml
|
||||
|
||||
vars:
|
||||
PROGRAM: gobs-cli
|
||||
SHELL: '{{if eq .OS "Windows_NT"}}powershell{{end}}'
|
||||
BIN_DIR: bin
|
||||
VERSION:
|
||||
sh: 'git describe --tags $(git rev-list --tags --max-count=1)'
|
||||
|
||||
tasks:
|
||||
default:
|
||||
@ -22,7 +17,6 @@ tasks:
|
||||
cmds:
|
||||
- task: build-windows
|
||||
- task: build-linux
|
||||
- task: build-macos
|
||||
|
||||
vet:
|
||||
desc: Vet the code
|
||||
@ -38,19 +32,13 @@ tasks:
|
||||
build-windows:
|
||||
desc: Build the gobs-cli project for Windows
|
||||
cmds:
|
||||
- GOOS=windows GOARCH=amd64 go build -ldflags "-X 'main.version={{.VERSION}}'" -o {{.BIN_DIR}}/{{.PROGRAM}}_windows_amd64.exe
|
||||
- GOOS=windows GOARCH=amd64 go build -o {{.BIN_DIR}}/{{.PROGRAM}}_windows_amd64.exe
|
||||
internal: true
|
||||
|
||||
build-linux:
|
||||
desc: Build the gobs-cli project for Linux
|
||||
cmds:
|
||||
- GOOS=linux GOARCH=amd64 go build -ldflags "-X 'main.version={{.VERSION}}'" -o {{.BIN_DIR}}/{{.PROGRAM}}_linux_amd64
|
||||
internal: true
|
||||
|
||||
build-macos:
|
||||
desc: Build the gobs-cli project for macOS
|
||||
cmds:
|
||||
- GOOS=darwin GOARCH=amd64 go build -ldflags "-X 'main.version={{.VERSION}}'" -o {{.BIN_DIR}}/{{.PROGRAM}}_darwin_amd64
|
||||
- GOOS=linux GOARCH=amd64 go build -o {{.BIN_DIR}}/{{.PROGRAM}}_linux_amd64
|
||||
internal: true
|
||||
|
||||
test:
|
||||
|
||||
218
filter.go
218
filter.go
@ -1,218 +0,0 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"maps"
|
||||
"sort"
|
||||
"strings"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/filters"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// FilterCmd provides commands to manage filters in OBS Studio.
|
||||
type FilterCmd struct {
|
||||
List FilterListCmd `cmd:"" help:"List all filters." aliases:"ls"`
|
||||
Enable FilterEnableCmd `cmd:"" help:"Enable filter." aliases:"on"`
|
||||
Disable FilterDisableCmd `cmd:"" help:"Disable filter." aliases:"off"`
|
||||
Toggle FilterToggleCmd `cmd:"" help:"Toggle filter." aliases:"tg"`
|
||||
Status FilterStatusCmd `cmd:"" help:"Get filter status." aliases:"ss"`
|
||||
}
|
||||
|
||||
// FilterListCmd provides a command to list all filters in a scene.
|
||||
type FilterListCmd struct {
|
||||
SourceName string `arg:"" help:"Name of the source to list filters from." default:""`
|
||||
}
|
||||
|
||||
// Run executes the command to list all filters in a scene.
|
||||
// nolint: misspell
|
||||
func (cmd *FilterListCmd) Run(ctx *context) error {
|
||||
if cmd.SourceName == "" {
|
||||
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get current program scene: %w", err)
|
||||
}
|
||||
cmd.SourceName = currentScene.SceneName
|
||||
}
|
||||
|
||||
sourceFilters, err := ctx.Client.Filters.GetSourceFilterList(
|
||||
filters.NewGetSourceFilterListParams().WithSourceName(cmd.SourceName),
|
||||
)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if len(sourceFilters.Filters) == 0 {
|
||||
fmt.Fprintf(ctx.Out, "No filters found for source %s.\n", ctx.Style.Highlight(cmd.SourceName))
|
||||
return nil
|
||||
}
|
||||
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||
Headers("Filter Name", "Kind", "Enabled", "Settings").
|
||||
StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 1:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 2:
|
||||
style = style.Align(lipgloss.Center)
|
||||
case 3:
|
||||
style = style.Align(lipgloss.Left)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
for _, filter := range sourceFilters.Filters {
|
||||
defaultSettings, err := ctx.Client.Filters.GetSourceFilterDefaultSettings(
|
||||
filters.NewGetSourceFilterDefaultSettingsParams().
|
||||
WithFilterKind(filter.FilterKind),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get default settings for filter %s: %w",
|
||||
ctx.Style.Error(filter.FilterName), err)
|
||||
}
|
||||
maps.Insert(defaultSettings.DefaultFilterSettings, maps.All(filter.FilterSettings))
|
||||
|
||||
var lines []string
|
||||
for k, v := range defaultSettings.DefaultFilterSettings {
|
||||
lines = append(lines, fmt.Sprintf("%s: %v", snakeCaseToTitleCase(k), v))
|
||||
}
|
||||
sort.Slice(lines, func(i, j int) bool {
|
||||
return strings.ToLower(lines[i]) < strings.ToLower(lines[j])
|
||||
})
|
||||
|
||||
t.Row(
|
||||
filter.FilterName,
|
||||
snakeCaseToTitleCase(filter.FilterKind),
|
||||
getEnabledMark(filter.FilterEnabled),
|
||||
strings.Join(lines, "\n"),
|
||||
)
|
||||
}
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
// FilterEnableCmd provides a command to enable a filter in a scene.
|
||||
type FilterEnableCmd struct {
|
||||
SourceName string `arg:"" help:"Name of the source to enable filter from."`
|
||||
FilterName string `arg:"" help:"Name of the filter to enable."`
|
||||
}
|
||||
|
||||
// Run executes the command to enable a filter in a scene.
|
||||
func (cmd *FilterEnableCmd) Run(ctx *context) error {
|
||||
_, err := ctx.Client.Filters.SetSourceFilterEnabled(
|
||||
filters.NewSetSourceFilterEnabledParams().
|
||||
WithSourceName(cmd.SourceName).
|
||||
WithFilterName(cmd.FilterName).
|
||||
WithFilterEnabled(true),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to enable filter %s on source %s: %w",
|
||||
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||
}
|
||||
fmt.Fprintf(ctx.Out, "Filter %s enabled on source %s.\n",
|
||||
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||
return nil
|
||||
}
|
||||
|
||||
// FilterDisableCmd provides a command to disable a filter in a scene.
|
||||
type FilterDisableCmd struct {
|
||||
SourceName string `arg:"" help:"Name of the source to disable filter from."`
|
||||
FilterName string `arg:"" help:"Name of the filter to disable."`
|
||||
}
|
||||
|
||||
// Run executes the command to disable a filter in a scene.
|
||||
func (cmd *FilterDisableCmd) Run(ctx *context) error {
|
||||
_, err := ctx.Client.Filters.SetSourceFilterEnabled(
|
||||
filters.NewSetSourceFilterEnabledParams().
|
||||
WithSourceName(cmd.SourceName).
|
||||
WithFilterName(cmd.FilterName).
|
||||
WithFilterEnabled(false),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to disable filter %s on source %s: %w",
|
||||
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||
}
|
||||
fmt.Fprintf(ctx.Out, "Filter %s disabled on source %s.\n",
|
||||
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||
return nil
|
||||
}
|
||||
|
||||
// FilterToggleCmd provides a command to toggle a filter in a scene.
|
||||
type FilterToggleCmd struct {
|
||||
SourceName string `arg:"" help:"Name of the source to toggle filter from."`
|
||||
FilterName string `arg:"" help:"Name of the filter to toggle."`
|
||||
}
|
||||
|
||||
// Run executes the command to toggle a filter in a scene.
|
||||
func (cmd *FilterToggleCmd) Run(ctx *context) error {
|
||||
filter, err := ctx.Client.Filters.GetSourceFilter(
|
||||
filters.NewGetSourceFilterParams().
|
||||
WithSourceName(cmd.SourceName).
|
||||
WithFilterName(cmd.FilterName),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get filter %s on source %s: %w",
|
||||
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||
}
|
||||
|
||||
newStatus := !filter.FilterEnabled
|
||||
_, err = ctx.Client.Filters.SetSourceFilterEnabled(
|
||||
filters.NewSetSourceFilterEnabledParams().
|
||||
WithSourceName(cmd.SourceName).
|
||||
WithFilterName(cmd.FilterName).
|
||||
WithFilterEnabled(newStatus),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to toggle filter %s on source %s: %w",
|
||||
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||
}
|
||||
|
||||
if newStatus {
|
||||
fmt.Fprintf(ctx.Out, "Filter %s on source %s is now enabled.\n",
|
||||
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Filter %s on source %s is now disabled.\n",
|
||||
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// FilterStatusCmd provides a command to get the status of a filter in a scene.
|
||||
type FilterStatusCmd struct {
|
||||
SourceName string `arg:"" help:"Name of the source to get filter status from."`
|
||||
FilterName string `arg:"" help:"Name of the filter to get status."`
|
||||
}
|
||||
|
||||
// Run executes the command to get the status of a filter in a scene.
|
||||
func (cmd *FilterStatusCmd) Run(ctx *context) error {
|
||||
filter, err := ctx.Client.Filters.GetSourceFilter(
|
||||
filters.NewGetSourceFilterParams().
|
||||
WithSourceName(cmd.SourceName).
|
||||
WithFilterName(cmd.FilterName),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get status of filter %s on source %s: %w",
|
||||
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||
}
|
||||
if filter.FilterEnabled {
|
||||
fmt.Fprintf(ctx.Out, "Filter %s on source %s is enabled.\n",
|
||||
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Filter %s on source %s is disabled.\n",
|
||||
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||
}
|
||||
return nil
|
||||
}
|
||||
@ -1,67 +0,0 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"strings"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestFilterList(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &FilterListCmd{
|
||||
SourceName: "Mic/Aux",
|
||||
}
|
||||
err := cmd.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to list filters: %v", err)
|
||||
}
|
||||
if !strings.Contains(out.String(), "test_filter") {
|
||||
t.Fatalf("Expected output to contain 'test_filter', got '%s'", out.String())
|
||||
}
|
||||
}
|
||||
|
||||
func TestFilterListScene(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &FilterListCmd{
|
||||
SourceName: "gobs-test-scene",
|
||||
}
|
||||
err := cmd.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to list filters in scene: %v", err)
|
||||
}
|
||||
if !strings.Contains(out.String(), "test_filter") {
|
||||
t.Fatalf("Expected output to contain 'test_filter', got '%s'", out.String())
|
||||
}
|
||||
}
|
||||
|
||||
func TestFilterListEmpty(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &FilterListCmd{
|
||||
SourceName: "NonExistentSource",
|
||||
}
|
||||
err := cmd.Run(context)
|
||||
if err == nil {
|
||||
t.Fatal("Expected error for non-existent source, but got none")
|
||||
}
|
||||
if !strings.Contains(err.Error(), "No source was found by the name of `NonExistentSource`.") {
|
||||
t.Fatalf(
|
||||
"Expected error to contain 'No source was found by the name of `NonExistentSource`.', got '%s'",
|
||||
err.Error(),
|
||||
)
|
||||
}
|
||||
}
|
||||
18
go.mod
18
go.mod
@ -4,32 +4,14 @@ go 1.24.0
|
||||
|
||||
require (
|
||||
github.com/alecthomas/kong v1.10.0
|
||||
github.com/alecthomas/mango-kong v0.1.0
|
||||
github.com/andreykaipov/goobs v1.5.6
|
||||
github.com/charmbracelet/lipgloss v1.1.0
|
||||
github.com/titusjaka/kong-dotenv-go v0.1.0
|
||||
)
|
||||
|
||||
require (
|
||||
github.com/aymanbagabas/go-osc52/v2 v2.0.1 // indirect
|
||||
github.com/buger/jsonparser v1.1.1 // indirect
|
||||
github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc // indirect
|
||||
github.com/charmbracelet/x/ansi v0.8.0 // indirect
|
||||
github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd // indirect
|
||||
github.com/charmbracelet/x/term v0.2.1 // indirect
|
||||
github.com/gorilla/websocket v1.5.3 // indirect
|
||||
github.com/hashicorp/logutils v1.0.0 // indirect
|
||||
github.com/joho/godotenv v1.5.1 // indirect
|
||||
github.com/lucasb-eyer/go-colorful v1.2.0 // indirect
|
||||
github.com/mattn/go-isatty v0.0.20 // indirect
|
||||
github.com/mattn/go-runewidth v0.0.16 // indirect
|
||||
github.com/mitchellh/mapstructure v1.5.0 // indirect
|
||||
github.com/mmcloughlin/profile v0.1.1 // indirect
|
||||
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab // indirect
|
||||
github.com/muesli/roff v0.1.0 // indirect
|
||||
github.com/muesli/termenv v0.16.0 // indirect
|
||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d // indirect
|
||||
github.com/rivo/uniseg v0.4.7 // indirect
|
||||
github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e // indirect
|
||||
golang.org/x/sys v0.30.0 // indirect
|
||||
)
|
||||
|
||||
44
go.sum
44
go.sum
@ -2,30 +2,12 @@ github.com/alecthomas/assert/v2 v2.11.0 h1:2Q9r3ki8+JYXvGsDyBXwH3LcJ+WK5D0gc5E8v
|
||||
github.com/alecthomas/assert/v2 v2.11.0/go.mod h1:Bze95FyfUr7x34QZrjL+XP+0qgp/zg8yS+TtBj1WA3k=
|
||||
github.com/alecthomas/kong v1.10.0 h1:8K4rGDpT7Iu+jEXCIJUeKqvpwZHbsFRoebLbnzlmrpw=
|
||||
github.com/alecthomas/kong v1.10.0/go.mod h1:p2vqieVMeTAnaC83txKtXe8FLke2X07aruPWXyMPQrU=
|
||||
github.com/alecthomas/mango-kong v0.1.0 h1:iFVfP1k1K4qpml3JUQmD5I8MCQYfIvsD9mRdrw7jJC4=
|
||||
github.com/alecthomas/mango-kong v0.1.0/go.mod h1:t+TYVdsONUolf/BwVcm+15eqcdAj15h4Qe9MMFAwwT4=
|
||||
github.com/alecthomas/repr v0.4.0 h1:GhI2A8MACjfegCPVq9f1FLvIBS+DrQ2KQBFZP1iFzXc=
|
||||
github.com/alecthomas/repr v0.4.0/go.mod h1:Fr0507jx4eOXV7AlPV6AVZLYrLIuIeSOWtW57eE/O/4=
|
||||
github.com/andreykaipov/goobs v1.5.6 h1:eIkEqYN99+2VJvmlY/56Ah60nkRKS6efMQvpM3oUgPQ=
|
||||
github.com/andreykaipov/goobs v1.5.6/go.mod h1:iSZP93FJ4d9X/U1x4DD4IyILLtig+vViqZWBGjLywcY=
|
||||
github.com/aymanbagabas/go-osc52/v2 v2.0.1 h1:HwpRHbFMcZLEVr42D4p7XBqjyuxQH5SMiErDT4WkJ2k=
|
||||
github.com/aymanbagabas/go-osc52/v2 v2.0.1/go.mod h1:uYgXzlJ7ZpABp8OJ+exZzJJhRNQ2ASbcXHWsFqH8hp8=
|
||||
github.com/aymanbagabas/go-udiff v0.2.0 h1:TK0fH4MteXUDspT88n8CKzvK0X9O2xu9yQjWpi6yML8=
|
||||
github.com/aymanbagabas/go-udiff v0.2.0/go.mod h1:RE4Ex0qsGkTAJoQdQQCA0uG+nAzJO/pI/QwceO5fgrA=
|
||||
github.com/buger/jsonparser v1.1.1 h1:2PnMjfWD7wBILjqQbt530v576A/cAbQvEW9gGIpYMUs=
|
||||
github.com/buger/jsonparser v1.1.1/go.mod h1:6RYKKt7H4d4+iWqouImQ9R2FZql3VbhNgx27UK13J/0=
|
||||
github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc h1:4pZI35227imm7yK2bGPcfpFEmuY1gc2YSTShr4iJBfs=
|
||||
github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc/go.mod h1:X4/0JoqgTIPSFcRA/P6INZzIuyqdFY5rm8tb41s9okk=
|
||||
github.com/charmbracelet/lipgloss v1.1.0 h1:vYXsiLHVkK7fp74RkV7b2kq9+zDLoEU4MZoFqR/noCY=
|
||||
github.com/charmbracelet/lipgloss v1.1.0/go.mod h1:/6Q8FR2o+kj8rz4Dq0zQc3vYf7X+B0binUUBwA0aL30=
|
||||
github.com/charmbracelet/x/ansi v0.8.0 h1:9GTq3xq9caJW8ZrBTe0LIe2fvfLR/bYXKTx2llXn7xE=
|
||||
github.com/charmbracelet/x/ansi v0.8.0/go.mod h1:wdYl/ONOLHLIVmQaxbIYEC/cRKOQyjTkowiI4blgS9Q=
|
||||
github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd h1:vy0GVL4jeHEwG5YOXDmi86oYw2yuYUGqz6a8sLwg0X8=
|
||||
github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd/go.mod h1:xe0nKWGd3eJgtqZRaN9RjMtK7xUYchjzPr7q6kcvCCs=
|
||||
github.com/charmbracelet/x/exp/golden v0.0.0-20240806155701-69247e0abc2a h1:G99klV19u0QnhiizODirwVksQB91TJKV/UaTnACcG30=
|
||||
github.com/charmbracelet/x/exp/golden v0.0.0-20240806155701-69247e0abc2a/go.mod h1:wDlXFlCrmJ8J+swcL/MnGUuYnqgQdW9rhSD61oNMb6U=
|
||||
github.com/charmbracelet/x/term v0.2.1 h1:AQeHeLZ1OqSXhrAWpYUtZyX1T3zVxfpZuEQMIQaGIAQ=
|
||||
github.com/charmbracelet/x/term v0.2.1/go.mod h1:oQ4enTYFV7QN4m0i9mzHrViD7TQKvNEEkHUMCmsxdUg=
|
||||
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/gorilla/websocket v1.5.3 h1:saDtZ6Pbx/0u+bgYQ3q96pZgCzfhKXGPqt7kZ72aNNg=
|
||||
@ -34,41 +16,15 @@ github.com/hashicorp/logutils v1.0.0 h1:dLEQVugN8vlakKOUE3ihGLTZJRB4j+M2cdTm/ORI
|
||||
github.com/hashicorp/logutils v1.0.0/go.mod h1:QIAnNjmIWmVIIkWDTG1z5v++HQmx9WQRO+LraFDTW64=
|
||||
github.com/hexops/gotextdiff v1.0.3 h1:gitA9+qJrrTCsiCl7+kh75nPqQt1cx4ZkudSTLoUqJM=
|
||||
github.com/hexops/gotextdiff v1.0.3/go.mod h1:pSWU5MAI3yDq+fZBTazCSJysOMbxWL1BSow5/V2vxeg=
|
||||
github.com/joho/godotenv v1.5.1 h1:7eLL/+HRGLY0ldzfGMeQkb7vMd0as4CfYvUVzLqw0N0=
|
||||
github.com/joho/godotenv v1.5.1/go.mod h1:f4LDr5Voq0i2e/R5DDNOoa2zzDfwtkZa6DnEwAbqwq4=
|
||||
github.com/lucasb-eyer/go-colorful v1.2.0 h1:1nnpGOrhyZZuNyfu1QjKiUICQ74+3FNCN69Aj6K7nkY=
|
||||
github.com/lucasb-eyer/go-colorful v1.2.0/go.mod h1:R4dSotOR9KMtayYi1e77YzuveK+i7ruzyGqttikkLy0=
|
||||
github.com/mattn/go-isatty v0.0.20 h1:xfD0iDuEKnDkl03q4limB+vH+GxLEtL/jb4xVJSWWEY=
|
||||
github.com/mattn/go-isatty v0.0.20/go.mod h1:W+V8PltTTMOvKvAeJH7IuucS94S2C6jfK/D7dTCTo3Y=
|
||||
github.com/mattn/go-runewidth v0.0.16 h1:E5ScNMtiwvlvB5paMFdw9p4kSQzbXFikJ5SQO6TULQc=
|
||||
github.com/mattn/go-runewidth v0.0.16/go.mod h1:Jdepj2loyihRzMpdS35Xk/zdY8IAYHsh153qUoGf23w=
|
||||
github.com/mitchellh/mapstructure v1.5.0 h1:jeMsZIYE/09sWLaz43PL7Gy6RuMjD2eJVyuac5Z2hdY=
|
||||
github.com/mitchellh/mapstructure v1.5.0/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo=
|
||||
github.com/mmcloughlin/profile v0.1.1 h1:jhDmAqPyebOsVDOCICJoINoLb/AnLBaUw58nFzxWS2w=
|
||||
github.com/mmcloughlin/profile v0.1.1/go.mod h1:IhHD7q1ooxgwTgjxQYkACGA77oFTDdFVejUS1/tS/qU=
|
||||
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab h1:m7QFONkzLK0fVXCjwX5tANcnj1yXxTnYQtnfJiY3tcA=
|
||||
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab/go.mod h1:5XFpbC8jY5UUv89YQciiXNlbi+iJgt29VDC5xbzrLL4=
|
||||
github.com/muesli/roff v0.1.0 h1:YD0lalCotmYuF5HhZliKWlIx7IEhiXeSfq7hNjFqGF8=
|
||||
github.com/muesli/roff v0.1.0/go.mod h1:pjAHQM9hdUUwm/krAfrLGgJkXJ+YuhtsfZ42kieB2Ig=
|
||||
github.com/muesli/termenv v0.16.0 h1:S5AlUN9dENB57rsbnkPyfdGuWIlkmzJjbFf0Tf5FWUc=
|
||||
github.com/muesli/termenv v0.16.0/go.mod h1:ZRfOIKPFDYQoDFF4Olj7/QJbW60Ol/kL1pU3VfY/Cnk=
|
||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d h1:VhgPp6v9qf9Agr/56bj7Y/xa04UccTW04VP0Qed4vnQ=
|
||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d/go.mod h1:YUTz3bUH2ZwIWBy3CJBeOBEugqcmXREj14T+iG/4k4U=
|
||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||
github.com/rivo/uniseg v0.2.0/go.mod h1:J6wj4VEh+S6ZtnVlnTBMWIodfgj8LQOQFoIToxlJtxc=
|
||||
github.com/rivo/uniseg v0.4.7 h1:WUdvkW8uEhrYfLC4ZzdpI2ztxP1I582+49Oc5Mq64VQ=
|
||||
github.com/rivo/uniseg v0.4.7/go.mod h1:FN3SvrM+Zdj16jyLfmOkMNblXMcoc8DfTHruCPUcx88=
|
||||
github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA=
|
||||
github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
|
||||
github.com/titusjaka/kong-dotenv-go v0.1.0 h1:TmUjP/sXoNiKLr6oR7n9xrB5XyXi/Ssuebzfz5nxZj4=
|
||||
github.com/titusjaka/kong-dotenv-go v0.1.0/go.mod h1:pBgLjcu82oqUgb7+bngK9+Ch7jg49E0YADP8Wnj2MXU=
|
||||
github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e h1:JVG44RsyaB9T2KIHavMF/ppJZNG9ZpyihvCd0w101no=
|
||||
github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e/go.mod h1:RbqR21r5mrJuqunuUZ/Dhy/avygyECGrLceyNeo4LiM=
|
||||
golang.org/x/exp v0.0.0-20220909182711-5c715a9e8561 h1:MDc5xs78ZrZr3HMQugiXOAkSZtfTpbJLDr/lwfgO53E=
|
||||
golang.org/x/exp v0.0.0-20220909182711-5c715a9e8561/go.mod h1:cyybsKvd6eL0RnXn6p/Grxp8F5bW7iYuBgsNCOHpMYE=
|
||||
golang.org/x/sys v0.6.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||
golang.org/x/sys v0.30.0 h1:QjkSwP/36a20jFYWkSue1YwXzLmsV5Gfq7Eiy72C1uc=
|
||||
golang.org/x/sys v0.30.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA=
|
||||
gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
|
||||
gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
||||
|
||||
81
group.go
81
group.go
@ -4,8 +4,6 @@ import (
|
||||
"fmt"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// GroupCmd provides commands to manage groups in OBS Studio.
|
||||
@ -19,64 +17,21 @@ type GroupCmd struct {
|
||||
|
||||
// GroupListCmd provides a command to list all groups in a scene.
|
||||
type GroupListCmd struct {
|
||||
SceneName string `arg:"" help:"Name of the scene to list groups from." default:""`
|
||||
SceneName string `arg:"" help:"Name of the scene to list groups from."`
|
||||
}
|
||||
|
||||
// Run executes the command to list all groups in a scene.
|
||||
// nolint: misspell
|
||||
func (cmd *GroupListCmd) Run(ctx *context) error {
|
||||
if cmd.SceneName == "" {
|
||||
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get current program scene: %w", err)
|
||||
}
|
||||
cmd.SceneName = currentScene.SceneName
|
||||
}
|
||||
|
||||
resp, err := ctx.Client.SceneItems.GetSceneItemList(sceneitems.NewGetSceneItemListParams().
|
||||
WithSceneName(cmd.SceneName))
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get scene item list: %w", err)
|
||||
}
|
||||
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||
Headers("ID", "Group Name", "Enabled").
|
||||
StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Center)
|
||||
case 1:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 2:
|
||||
style = style.Align(lipgloss.Center)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
var found bool
|
||||
for _, item := range resp.SceneItems {
|
||||
if item.IsGroup {
|
||||
t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, getEnabledMark(item.SceneItemEnabled))
|
||||
found = true
|
||||
fmt.Fprintf(ctx.Out, "Group ID: %d, Source Name: %s\n", item.SceneItemID, item.SourceName)
|
||||
}
|
||||
}
|
||||
|
||||
if !found {
|
||||
fmt.Fprintf(ctx.Out, "No groups found in scene %s.\n", ctx.Style.Highlight(cmd.SceneName))
|
||||
return nil
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
@ -104,17 +59,13 @@ func (cmd *GroupShowCmd) Run(ctx *context) error {
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
||||
}
|
||||
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", cmd.GroupName)
|
||||
found = true
|
||||
break
|
||||
}
|
||||
}
|
||||
if !found {
|
||||
return fmt.Errorf(
|
||||
"group %s not found in scene %s",
|
||||
ctx.Style.Error(cmd.GroupName),
|
||||
ctx.Style.Error(cmd.SceneName),
|
||||
)
|
||||
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
@ -143,17 +94,13 @@ func (cmd *GroupHideCmd) Run(ctx *context) error {
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
||||
}
|
||||
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", cmd.GroupName)
|
||||
found = true
|
||||
break
|
||||
}
|
||||
}
|
||||
if !found {
|
||||
return fmt.Errorf(
|
||||
"group %s not found in scene %s",
|
||||
ctx.Style.Error(cmd.GroupName),
|
||||
ctx.Style.Error(cmd.SceneName),
|
||||
)
|
||||
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
@ -184,20 +131,16 @@ func (cmd *GroupToggleCmd) Run(ctx *context) error {
|
||||
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
||||
}
|
||||
if newState {
|
||||
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", cmd.GroupName)
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", cmd.GroupName)
|
||||
}
|
||||
found = true
|
||||
break
|
||||
}
|
||||
}
|
||||
if !found {
|
||||
return fmt.Errorf(
|
||||
"group %s not found in scene %s",
|
||||
ctx.Style.Error(cmd.GroupName),
|
||||
ctx.Style.Error(cmd.SceneName),
|
||||
)
|
||||
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
||||
}
|
||||
|
||||
return nil
|
||||
@ -219,12 +162,12 @@ func (cmd *GroupStatusCmd) Run(ctx *context) error {
|
||||
for _, item := range resp.SceneItems {
|
||||
if item.IsGroup && item.SourceName == cmd.GroupName {
|
||||
if item.SceneItemEnabled {
|
||||
fmt.Fprintf(ctx.Out, "Group %s is shown.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||
fmt.Fprintf(ctx.Out, "Group %s is shown.\n", cmd.GroupName)
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Group %s is hidden.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||
fmt.Fprintf(ctx.Out, "Group %s is hidden.\n", cmd.GroupName)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
}
|
||||
return fmt.Errorf("group %s not found in scene %s", ctx.Style.Error(cmd.GroupName), ctx.Style.Error(cmd.SceneName))
|
||||
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
||||
}
|
||||
|
||||
133
group_test.go
133
group_test.go
@ -1,133 +0,0 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"os"
|
||||
"strings"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func skipIfSkipGroupTests(t *testing.T) {
|
||||
if os.Getenv("GOBS_TEST_SKIP_GROUP_TESTS") != "" {
|
||||
t.Skip("Skipping group tests due to GOBS_TEST_SKIP_GROUP_TESTS environment variable")
|
||||
}
|
||||
}
|
||||
|
||||
func TestGroupList(t *testing.T) {
|
||||
skipIfSkipGroupTests(t)
|
||||
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &GroupListCmd{
|
||||
SceneName: "Scene",
|
||||
}
|
||||
err := cmd.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to list groups: %v", err)
|
||||
}
|
||||
if !strings.Contains(out.String(), "test_group") {
|
||||
t.Fatalf("Expected output to contain 'test_group', got '%s'", out.String())
|
||||
}
|
||||
}
|
||||
|
||||
func TestGroupShow(t *testing.T) {
|
||||
skipIfSkipGroupTests(t)
|
||||
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &GroupShowCmd{
|
||||
SceneName: "Scene",
|
||||
GroupName: "test_group",
|
||||
}
|
||||
err := cmd.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to show group: %v", err)
|
||||
}
|
||||
if out.String() != "Group test_group is now shown.\n" {
|
||||
t.Fatalf("Expected output to be 'Group test_group is now shown.', got '%s'", out.String())
|
||||
}
|
||||
}
|
||||
|
||||
func TestGroupToggle(t *testing.T) {
|
||||
skipIfSkipGroupTests(t)
|
||||
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdStatus := &GroupStatusCmd{
|
||||
SceneName: "Scene",
|
||||
GroupName: "test_group",
|
||||
}
|
||||
err := cmdStatus.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to get group status: %v", err)
|
||||
}
|
||||
var enabled bool
|
||||
if strings.Contains(out.String(), "Group test_group is shown.") {
|
||||
enabled = true
|
||||
}
|
||||
// Reset output buffer for the next command
|
||||
out.Reset()
|
||||
|
||||
cmdToggle := &GroupToggleCmd{
|
||||
SceneName: "Scene",
|
||||
GroupName: "test_group",
|
||||
}
|
||||
err = cmdToggle.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to toggle group: %v", err)
|
||||
}
|
||||
if enabled {
|
||||
if out.String() != "Group test_group is now hidden.\n" {
|
||||
t.Fatalf("Expected output to be 'Group test_group is now hidden.', got '%s'", out.String())
|
||||
}
|
||||
} else {
|
||||
if out.String() != "Group test_group is now shown.\n" {
|
||||
t.Fatalf("Expected output to be 'Group test_group is now shown.', got '%s'", out.String())
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func TestGroupStatus(t *testing.T) {
|
||||
skipIfSkipGroupTests(t)
|
||||
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdShow := &GroupShowCmd{
|
||||
SceneName: "Scene",
|
||||
GroupName: "test_group",
|
||||
}
|
||||
err := cmdShow.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to show group: %v", err)
|
||||
}
|
||||
// Reset output buffer for the next command
|
||||
out.Reset()
|
||||
|
||||
cmdStatus := &GroupStatusCmd{
|
||||
SceneName: "Scene",
|
||||
GroupName: "test_group",
|
||||
}
|
||||
err = cmdStatus.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to get group status: %v", err)
|
||||
}
|
||||
if out.String() != "Group test_group is shown.\n" {
|
||||
t.Fatalf("Expected output to be 'Group test_group is shown.', got '%s'", out.String())
|
||||
}
|
||||
}
|
||||
93
hotkey.go
93
hotkey.go
@ -1,93 +0,0 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/general"
|
||||
"github.com/andreykaipov/goobs/api/typedefs"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// HotkeyCmd provides commands to manage hotkeys in OBS Studio.
|
||||
type HotkeyCmd struct {
|
||||
List HotkeyListCmd `cmd:"" help:"List all hotkeys." aliases:"ls"`
|
||||
Trigger HotkeyTriggerCmd `cmd:"" help:"Trigger a hotkey by name." aliases:"tr"`
|
||||
TriggerSequence HotkeyTriggerSequenceCmd `cmd:"" help:"Trigger a hotkey by sequence." aliases:"trs"`
|
||||
}
|
||||
|
||||
// HotkeyListCmd provides a command to list all hotkeys.
|
||||
type HotkeyListCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to list all hotkeys.
|
||||
func (cmd *HotkeyListCmd) Run(ctx *context) error {
|
||||
resp, err := ctx.Client.General.GetHotkeyList()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||
Headers("Hotkey Name").
|
||||
StyleFunc(func(row, _ int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center) // nolint: misspell
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
for _, hotkey := range resp.Hotkeys {
|
||||
t.Row(hotkey)
|
||||
}
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
// HotkeyTriggerCmd provides a command to trigger a hotkey.
|
||||
type HotkeyTriggerCmd struct {
|
||||
Hotkey string `help:"Hotkey name to trigger." arg:""`
|
||||
}
|
||||
|
||||
// Run executes the command to trigger a hotkey.
|
||||
func (cmd *HotkeyTriggerCmd) Run(ctx *context) error {
|
||||
_, err := ctx.Client.General.TriggerHotkeyByName(
|
||||
general.NewTriggerHotkeyByNameParams().WithHotkeyName(cmd.Hotkey),
|
||||
)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// HotkeyTriggerSequenceCmd provides a command to trigger a hotkey sequence.
|
||||
type HotkeyTriggerSequenceCmd struct {
|
||||
Shift bool `flag:"" help:"Shift modifier."`
|
||||
Ctrl bool `flag:"" help:"Control modifier."`
|
||||
Alt bool `flag:"" help:"Alt modifier."`
|
||||
Cmd bool `flag:"" help:"Command modifier."`
|
||||
KeyID string ` help:"Key ID to trigger." arg:""`
|
||||
}
|
||||
|
||||
// Run executes the command to trigger a hotkey sequence.
|
||||
func (cmd *HotkeyTriggerSequenceCmd) Run(ctx *context) error {
|
||||
_, err := ctx.Client.General.TriggerHotkeyByKeySequence(
|
||||
general.NewTriggerHotkeyByKeySequenceParams().
|
||||
WithKeyId(cmd.KeyID).
|
||||
WithKeyModifiers(&typedefs.KeyModifiers{
|
||||
Shift: cmd.Shift,
|
||||
Control: cmd.Ctrl,
|
||||
Alt: cmd.Alt,
|
||||
Command: cmd.Cmd,
|
||||
}),
|
||||
)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
Binary file not shown.
|
Before Width: | Height: | Size: 6.1 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 6.1 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 4.6 KiB |
102
input.go
102
input.go
@ -1,14 +1,10 @@
|
||||
// nolint: misspell
|
||||
package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"sort"
|
||||
"strings"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/inputs"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// InputCmd provides commands to manage inputs in OBS Studio.
|
||||
@ -24,9 +20,6 @@ type InputListCmd struct {
|
||||
Input bool `flag:"" help:"List all inputs." aliases:"i"`
|
||||
Output bool `flag:"" help:"List all outputs." aliases:"o"`
|
||||
Colour bool `flag:"" help:"List all colour sources." aliases:"c"`
|
||||
Ffmpeg bool `flag:"" help:"List all ffmpeg sources." aliases:"f"`
|
||||
Vlc bool `flag:"" help:"List all VLC sources." aliases:"v"`
|
||||
UUID bool `flag:"" help:"Display UUIDs of inputs." aliases:"u"`
|
||||
}
|
||||
|
||||
// Run executes the command to list all inputs.
|
||||
@ -35,90 +28,21 @@ func (cmd *InputListCmd) Run(ctx *context) error {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
|
||||
if cmd.UUID {
|
||||
t.Headers("Input Name", "Kind", "Muted", "UUID")
|
||||
} else {
|
||||
t.Headers("Input Name", "Kind", "Muted")
|
||||
}
|
||||
t.StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 1:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 2:
|
||||
style = style.Align(lipgloss.Center)
|
||||
case 3:
|
||||
style = style.Align(lipgloss.Left)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
sort.Slice(resp.Inputs, func(i, j int) bool {
|
||||
return resp.Inputs[i].InputName < resp.Inputs[j].InputName
|
||||
})
|
||||
|
||||
for _, input := range resp.Inputs {
|
||||
var muteMark string
|
||||
resp, err := ctx.Client.Inputs.GetInputMute(
|
||||
inputs.NewGetInputMuteParams().WithInputName(input.InputName),
|
||||
)
|
||||
if err != nil {
|
||||
if err.Error() == "request GetInputMute: InvalidResourceState (604): The specified input does not support audio." {
|
||||
muteMark = "N/A"
|
||||
} else {
|
||||
return fmt.Errorf("failed to get input mute state: %w", err)
|
||||
if cmd.Input && strings.Contains(input.InputKind, "input") {
|
||||
fmt.Fprintln(ctx.Out, "Input:", input.InputName)
|
||||
}
|
||||
} else {
|
||||
muteMark = getEnabledMark(resp.InputMuted)
|
||||
if cmd.Output && strings.Contains(input.InputKind, "output") {
|
||||
fmt.Fprintln(ctx.Out, "Output:", input.InputName)
|
||||
}
|
||||
if cmd.Colour && strings.Contains(input.InputKind, "color") { // nolint
|
||||
fmt.Fprintln(ctx.Out, "Colour Source:", input.InputName)
|
||||
}
|
||||
|
||||
type filter struct {
|
||||
enabled bool
|
||||
keyword string
|
||||
}
|
||||
filters := []filter{
|
||||
{cmd.Input, "input"},
|
||||
{cmd.Output, "output"},
|
||||
{cmd.Colour, "color"}, // nolint: misspell
|
||||
{cmd.Ffmpeg, "ffmpeg"},
|
||||
{cmd.Vlc, "vlc"},
|
||||
}
|
||||
|
||||
var added bool
|
||||
for _, f := range filters {
|
||||
if f.enabled && strings.Contains(input.InputKind, f.keyword) {
|
||||
if cmd.UUID {
|
||||
t.Row(input.InputName, input.InputKind, muteMark, input.InputUuid)
|
||||
} else {
|
||||
t.Row(input.InputName, input.InputKind, muteMark)
|
||||
}
|
||||
added = true
|
||||
break
|
||||
if !cmd.Input && !cmd.Output && !cmd.Colour {
|
||||
fmt.Fprintln(ctx.Out, "Source:", input.InputName)
|
||||
}
|
||||
}
|
||||
|
||||
if !added && (!cmd.Input && !cmd.Output && !cmd.Colour && !cmd.Ffmpeg && !cmd.Vlc) {
|
||||
if cmd.UUID {
|
||||
t.Row(input.InputName, snakeCaseToTitleCase(input.InputKind), muteMark, input.InputUuid)
|
||||
} else {
|
||||
t.Row(input.InputName, snakeCaseToTitleCase(input.InputKind), muteMark)
|
||||
}
|
||||
}
|
||||
}
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
@ -136,7 +60,7 @@ func (cmd *InputMuteCmd) Run(ctx *context) error {
|
||||
return fmt.Errorf("failed to mute input: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Muted input: %s\n", ctx.Style.Highlight(cmd.InputName))
|
||||
fmt.Fprintf(ctx.Out, "Muted input: %s\n", cmd.InputName)
|
||||
return nil
|
||||
}
|
||||
|
||||
@ -154,7 +78,7 @@ func (cmd *InputUnmuteCmd) Run(ctx *context) error {
|
||||
return fmt.Errorf("failed to unmute input: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", ctx.Style.Highlight(cmd.InputName))
|
||||
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", cmd.InputName)
|
||||
return nil
|
||||
}
|
||||
|
||||
@ -182,9 +106,9 @@ func (cmd *InputToggleCmd) Run(ctx *context) error {
|
||||
}
|
||||
|
||||
if newMuteState {
|
||||
fmt.Fprintf(ctx.Out, "Muted input: %s\n", ctx.Style.Highlight(cmd.InputName))
|
||||
fmt.Fprintf(ctx.Out, "Muted input: %s\n", cmd.InputName)
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", ctx.Style.Highlight(cmd.InputName))
|
||||
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", cmd.InputName)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
124
input_test.go
124
input_test.go
@ -1,124 +0,0 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"strings"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestInputList(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &InputListCmd{}
|
||||
err := cmd.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to list inputs: %v", err)
|
||||
}
|
||||
|
||||
expectedInputs := []string{
|
||||
"Desktop Audio",
|
||||
"Mic/Aux",
|
||||
"gobs-test-input",
|
||||
"gobs-test-input-2",
|
||||
}
|
||||
output := out.String()
|
||||
for _, input := range expectedInputs {
|
||||
if !strings.Contains(output, input) {
|
||||
t.Fatalf("Expected output to contain '%s', got '%s'", input, output)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func TestInputListFilterInput(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &InputListCmd{Input: true}
|
||||
err := cmd.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to list inputs with filter: %v", err)
|
||||
}
|
||||
|
||||
expectedInputs := []string{
|
||||
"Mic/Aux",
|
||||
}
|
||||
expectedFilteredOut := []string{
|
||||
"Desktop Audio",
|
||||
"gobs-test-input",
|
||||
"gobs-test-input-2",
|
||||
}
|
||||
for _, input := range expectedInputs {
|
||||
if !strings.Contains(out.String(), input) {
|
||||
t.Fatalf("Expected output to contain '%s', got '%s'", input, out.String())
|
||||
}
|
||||
}
|
||||
for _, filteredOut := range expectedFilteredOut {
|
||||
if strings.Contains(out.String(), filteredOut) {
|
||||
t.Fatalf("Expected output to NOT contain '%s', got '%s'", filteredOut, out.String())
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func TestInputListFilterOutput(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &InputListCmd{Output: true}
|
||||
err := cmd.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to list outputs with filter: %v", err)
|
||||
}
|
||||
|
||||
expectedInputs := []string{
|
||||
"Desktop Audio",
|
||||
}
|
||||
expectedFilteredOut := []string{
|
||||
"Mic/Aux",
|
||||
"gobs-test-input",
|
||||
"gobs-test-input-2",
|
||||
}
|
||||
for _, input := range expectedInputs {
|
||||
if !strings.Contains(out.String(), input) {
|
||||
t.Fatalf("Expected output to contain '%s', got '%s'", input, out.String())
|
||||
}
|
||||
}
|
||||
for _, filteredOut := range expectedFilteredOut {
|
||||
if strings.Contains(out.String(), filteredOut) {
|
||||
t.Fatalf("Expected output to NOT contain '%s', got '%s'", filteredOut, out.String())
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func TestInputListFilterColour(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &InputListCmd{Colour: true}
|
||||
err := cmd.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to list colour inputs with filter: %v", err)
|
||||
}
|
||||
|
||||
expectedInputs := []string{
|
||||
"gobs-test-input",
|
||||
"gobs-test-input-2",
|
||||
}
|
||||
for _, input := range expectedInputs {
|
||||
if !strings.Contains(out.String(), input) {
|
||||
t.Fatalf("Expected output to contain '%s', got '%s'", input, out.String())
|
||||
}
|
||||
}
|
||||
}
|
||||
116
main.go
116
main.go
@ -7,120 +7,62 @@ import (
|
||||
"fmt"
|
||||
"io"
|
||||
"os"
|
||||
"path/filepath"
|
||||
"runtime/debug"
|
||||
"strings"
|
||||
"time"
|
||||
|
||||
"github.com/alecthomas/kong"
|
||||
mangokong "github.com/alecthomas/mango-kong"
|
||||
"github.com/andreykaipov/goobs"
|
||||
kongdotenv "github.com/titusjaka/kong-dotenv-go"
|
||||
)
|
||||
|
||||
var version string // Version of the CLI, set at build time.
|
||||
|
||||
// VersionFlag is a custom flag type that prints the version and exits.
|
||||
type VersionFlag string
|
||||
|
||||
func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil } // nolint: revive
|
||||
func (v VersionFlag) IsBool() bool { return true } // nolint: revive
|
||||
func (v VersionFlag) BeforeApply(app *kong.Kong, vars kong.Vars) error { // nolint: revive, unparam
|
||||
fmt.Printf("gobs-cli version: %s\n", vars["version"])
|
||||
app.Exit(0)
|
||||
return nil
|
||||
}
|
||||
|
||||
// ObsConfig holds the configuration for connecting to the OBS WebSocket server.
|
||||
type ObsConfig struct {
|
||||
Host string `flag:"host" help:"Host to connect to." default:"localhost" env:"OBS_HOST" short:"H"`
|
||||
Port int `flag:"port" help:"Port to connect to." default:"4455" env:"OBS_PORT" short:"P"`
|
||||
Password string `flag:"password" help:"Password for authentication." default:"" env:"OBS_PASSWORD" short:"p"`
|
||||
Timeout int `flag:"timeout" help:"Timeout in seconds." default:"5" env:"OBS_TIMEOUT" short:"T"`
|
||||
Host string `flag:"host" help:"Host to connect to." default:"localhost" env:"OBS_HOST"`
|
||||
Port int `flag:"port" help:"Port to connect to." default:"4455" env:"OBS_PORT"`
|
||||
Password string `flag:"password" help:"Password for authentication." default:"" env:"OBS_PASSWORD"`
|
||||
Timeout int `flag:"timeout" help:"Timeout in seconds." default:"5" env:"OBS_TIMEOUT"`
|
||||
}
|
||||
|
||||
// StyleConfig holds the configuration for styling the CLI output.
|
||||
type StyleConfig struct {
|
||||
Style string `help:"Style used in output." flag:"style" default:"" env:"GOBS_STYLE" short:"s" enum:",red,magenta,purple,blue,cyan,green,yellow,orange,white,grey,navy,black"`
|
||||
NoBorder bool `help:"Disable table border styling in output." flag:"no-border" default:"false" env:"GOBS_STYLE_NO_BORDER" short:"b"`
|
||||
}
|
||||
|
||||
// CLI is the main command line interface structure.
|
||||
// It embeds ObsConfig and StyleConfig to provide configuration options.
|
||||
type CLI struct {
|
||||
// cli is the main command line interface structure.
|
||||
// It embeds the ObsConfig struct to inherit its fields and flags.
|
||||
type cli struct {
|
||||
ObsConfig `embed:"" help:"OBS WebSocket configuration."`
|
||||
StyleConfig `embed:"" help:"Style configuration."`
|
||||
|
||||
Man mangokong.ManFlag `help:"Print man page."`
|
||||
Version VersionFlag `help:"Print gobs-cli version information and quit" name:"version" short:"v"`
|
||||
|
||||
ObsVersion ObsVersionCmd `help:"Print OBS client and websocket version." cmd:"" aliases:"v"`
|
||||
Scene SceneCmd `help:"Manage scenes." cmd:"" aliases:"sc" group:"Scene"`
|
||||
Sceneitem SceneItemCmd `help:"Manage scene items." cmd:"" aliases:"si" group:"Scene Item"`
|
||||
Group GroupCmd `help:"Manage groups." cmd:"" aliases:"g" group:"Group"`
|
||||
Input InputCmd `help:"Manage inputs." cmd:"" aliases:"i" group:"Input"`
|
||||
Text TextCmd `help:"Manage text inputs." cmd:"" aliases:"t" group:"Text Input"`
|
||||
Record RecordCmd `help:"Manage recording." cmd:"" aliases:"rec" group:"Recording"`
|
||||
Stream StreamCmd `help:"Manage streaming." cmd:"" aliases:"st" group:"Streaming"`
|
||||
Scenecollection SceneCollectionCmd `help:"Manage scene collections." cmd:"" aliases:"scn" group:"Scene Collection"`
|
||||
Profile ProfileCmd `help:"Manage profiles." cmd:"" aliases:"p" group:"Profile"`
|
||||
Replaybuffer ReplayBufferCmd `help:"Manage replay buffer." cmd:"" aliases:"rb" group:"Replay Buffer"`
|
||||
Studiomode StudioModeCmd `help:"Manage studio mode." cmd:"" aliases:"sm" group:"Studio Mode"`
|
||||
Virtualcam VirtualCamCmd `help:"Manage virtual camera." cmd:"" aliases:"vc" group:"Virtual Camera"`
|
||||
Hotkey HotkeyCmd `help:"Manage hotkeys." cmd:"" aliases:"hk" group:"Hotkey"`
|
||||
Filter FilterCmd `help:"Manage filters." cmd:"" aliases:"f" group:"Filter"`
|
||||
Projector ProjectorCmd `help:"Manage projectors." cmd:"" aliases:"prj" group:"Projector"`
|
||||
Screenshot ScreenshotCmd `help:"Take screenshots." cmd:"" aliases:"ss" group:"Screenshot"`
|
||||
Version VersionCmd `help:"Show version." cmd:"" aliases:"v"`
|
||||
Scene SceneCmd `help:"Manage scenes." cmd:"" aliases:"sc"`
|
||||
Sceneitem SceneItemCmd `help:"Manage scene items." cmd:"" aliases:"si"`
|
||||
Group GroupCmd `help:"Manage groups." cmd:"" aliases:"g"`
|
||||
Input InputCmd `help:"Manage inputs." cmd:"" aliases:"i"`
|
||||
Record RecordCmd `help:"Manage recording." cmd:"" aliases:"rec"`
|
||||
Stream StreamCmd `help:"Manage streaming." cmd:"" aliases:"st"`
|
||||
Scenecollection SceneCollectionCmd `help:"Manage scene collections." cmd:"" aliases:"scn"`
|
||||
Profile ProfileCmd `help:"Manage profiles." cmd:"" aliases:"p"`
|
||||
Replaybuffer ReplayBufferCmd `help:"Manage replay buffer." cmd:"" aliases:"rb"`
|
||||
Studiomode StudioModeCmd `help:"Manage studio mode." cmd:"" aliases:"sm"`
|
||||
Virtualcam VirtualCamCmd `help:"Manage virtual camera." cmd:"" aliases:"vc"`
|
||||
}
|
||||
|
||||
type context struct {
|
||||
Client *goobs.Client
|
||||
Out io.Writer
|
||||
Style *Style
|
||||
}
|
||||
|
||||
func newContext(client *goobs.Client, out io.Writer, styleCfg StyleConfig) *context {
|
||||
return &context{
|
||||
Client: client,
|
||||
Out: out,
|
||||
Style: styleFromFlag(styleCfg),
|
||||
}
|
||||
}
|
||||
|
||||
func main() {
|
||||
userConfigDir, err := os.UserConfigDir()
|
||||
if err != nil {
|
||||
fmt.Fprintf(os.Stderr, "Error getting user config directory: %v\n", err)
|
||||
os.Exit(1)
|
||||
}
|
||||
|
||||
var cli CLI
|
||||
var client *goobs.Client
|
||||
cli := cli{}
|
||||
ctx := kong.Parse(
|
||||
&cli,
|
||||
kong.Name("gobs-cli"),
|
||||
kong.Name("GOBS-CLI"),
|
||||
kong.Description("A command line tool to interact with OBS Websocket."),
|
||||
kong.Configuration(kongdotenv.ENVFileReader, ".env", filepath.Join(userConfigDir, "gobs-cli", "config.env")),
|
||||
kong.UsageOnError(),
|
||||
kong.ConfigureHelp(kong.HelpOptions{
|
||||
Compact: true,
|
||||
}),
|
||||
kong.Vars{
|
||||
"version": func() string {
|
||||
if version == "" {
|
||||
info, ok := debug.ReadBuildInfo()
|
||||
if !ok {
|
||||
return "(unable to read build info)"
|
||||
}
|
||||
version = strings.Split(info.Main.Version, "-")[0]
|
||||
}
|
||||
return version
|
||||
}(),
|
||||
})
|
||||
)
|
||||
|
||||
client, err := connectObs(cli.ObsConfig)
|
||||
if err != nil {
|
||||
ctx.FatalIfErrorf(err)
|
||||
}
|
||||
|
||||
ctx.Bind(newContext(client, os.Stdout, cli.StyleConfig))
|
||||
ctx.Bind(&context{
|
||||
Client: client,
|
||||
Out: os.Stdout,
|
||||
})
|
||||
|
||||
ctx.FatalIfErrorf(run(ctx, client))
|
||||
}
|
||||
|
||||
182
main_test.go
182
main_test.go
@ -1,182 +0,0 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"os"
|
||||
"runtime"
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
"github.com/andreykaipov/goobs"
|
||||
"github.com/andreykaipov/goobs/api/requests/config"
|
||||
"github.com/andreykaipov/goobs/api/requests/filters"
|
||||
"github.com/andreykaipov/goobs/api/requests/inputs"
|
||||
"github.com/andreykaipov/goobs/api/requests/scenes"
|
||||
"github.com/andreykaipov/goobs/api/requests/ui"
|
||||
typedefs "github.com/andreykaipov/goobs/api/typedefs"
|
||||
)
|
||||
|
||||
func getClient(t *testing.T) (*goobs.Client, func()) {
|
||||
t.Helper()
|
||||
client, err := connectObs(ObsConfig{
|
||||
Host: os.Getenv("OBS_HOST"),
|
||||
Port: 4455,
|
||||
Password: os.Getenv("OBS_PASSWORD"),
|
||||
Timeout: 5,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to connect to OBS: %v", err)
|
||||
}
|
||||
return client, func() {
|
||||
if err := client.Disconnect(); err != nil {
|
||||
t.Fatalf("Failed to disconnect from OBS: %v", err)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func TestMain(m *testing.M) {
|
||||
client, err := connectObs(ObsConfig{
|
||||
Host: os.Getenv("OBS_HOST"),
|
||||
Port: 4455,
|
||||
Password: os.Getenv("OBS_PASSWORD"),
|
||||
Timeout: 5,
|
||||
})
|
||||
if err != nil {
|
||||
os.Exit(1)
|
||||
}
|
||||
defer client.Disconnect()
|
||||
|
||||
setup(client)
|
||||
|
||||
// Run the tests
|
||||
exitCode := m.Run()
|
||||
|
||||
teardown(client)
|
||||
|
||||
// Exit with the appropriate code
|
||||
os.Exit(exitCode)
|
||||
}
|
||||
|
||||
func setup(client *goobs.Client) {
|
||||
client.Config.SetStreamServiceSettings(config.NewSetStreamServiceSettingsParams().
|
||||
WithStreamServiceType("rtmp_common").
|
||||
WithStreamServiceSettings(&typedefs.StreamServiceSettings{
|
||||
Server: "auto",
|
||||
Key: os.Getenv("OBS_STREAM_KEY"),
|
||||
}))
|
||||
|
||||
client.Config.CreateProfile(config.NewCreateProfileParams().
|
||||
WithProfileName("gobs-test-profile"))
|
||||
time.Sleep(100 * time.Millisecond) // Wait for the profile to be created
|
||||
client.Config.SetProfileParameter(config.NewSetProfileParameterParams().
|
||||
WithParameterCategory("SimpleOutput").
|
||||
WithParameterName("RecRB").
|
||||
WithParameterValue("true"))
|
||||
// hack to ensure the Replay Buffer setting is applied
|
||||
client.Config.SetCurrentProfile(config.NewSetCurrentProfileParams().
|
||||
WithProfileName("Untitled"))
|
||||
client.Config.SetCurrentProfile(config.NewSetCurrentProfileParams().
|
||||
WithProfileName("gobs-test-profile"))
|
||||
|
||||
client.Scenes.CreateScene(scenes.NewCreateSceneParams().
|
||||
WithSceneName("gobs-test-scene"))
|
||||
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
||||
WithSceneName("gobs-test-scene").
|
||||
WithInputName("gobs-test-input").
|
||||
WithInputKind("color_source_v3").
|
||||
WithInputSettings(map[string]any{
|
||||
"color": 3279460728,
|
||||
"width": 1920,
|
||||
"height": 1080,
|
||||
"visible": true,
|
||||
}).
|
||||
WithSceneItemEnabled(true))
|
||||
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
||||
WithSceneName("gobs-test-scene").
|
||||
WithInputName("gobs-test-input-2").
|
||||
WithInputKind("color_source_v3").
|
||||
WithInputSettings(map[string]any{
|
||||
"color": 1789347616,
|
||||
"width": 720,
|
||||
"height": 480,
|
||||
"visible": true,
|
||||
}).
|
||||
WithSceneItemEnabled(true))
|
||||
|
||||
// ensure Desktop Audio input is created
|
||||
desktopAudioKinds := map[string]string{
|
||||
"windows": "wasapi_output_capture",
|
||||
"linux": "pulse_output_capture",
|
||||
"darwin": "coreaudio_output_capture",
|
||||
}
|
||||
platform := os.Getenv("GOBS_TEST_PLATFORM")
|
||||
if platform == "" {
|
||||
platform = runtime.GOOS
|
||||
}
|
||||
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
||||
WithSceneName("gobs-test-scene").
|
||||
WithInputName("Desktop Audio").
|
||||
WithInputKind(desktopAudioKinds[platform]).
|
||||
WithInputSettings(map[string]any{
|
||||
"device_id": "default",
|
||||
}))
|
||||
// ensure Mic/Aux input is created
|
||||
micKinds := map[string]string{
|
||||
"windows": "wasapi_input_capture",
|
||||
"linux": "pulse_input_capture",
|
||||
"darwin": "coreaudio_input_capture",
|
||||
}
|
||||
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
||||
WithSceneName("gobs-test-scene").
|
||||
WithInputName("Mic/Aux").
|
||||
WithInputKind(micKinds[platform]).
|
||||
WithInputSettings(map[string]any{
|
||||
"device_id": "default",
|
||||
}))
|
||||
|
||||
// Create source filter on an audio input
|
||||
client.Filters.CreateSourceFilter(filters.NewCreateSourceFilterParams().
|
||||
WithSourceName("Mic/Aux").
|
||||
WithFilterName("test_filter").
|
||||
WithFilterKind("compressor_filter").
|
||||
WithFilterSettings(map[string]any{
|
||||
"threshold": -20,
|
||||
"ratio": 4,
|
||||
"attack_time": 10,
|
||||
"release_time": 100,
|
||||
"output_gain": -3.6,
|
||||
"sidechain_source": nil,
|
||||
}))
|
||||
|
||||
// Create source filter on a scene
|
||||
client.Filters.CreateSourceFilter(filters.NewCreateSourceFilterParams().
|
||||
WithSourceName("gobs-test-scene").
|
||||
WithFilterName("test_filter").
|
||||
WithFilterKind("luma_key_filter_v2").
|
||||
WithFilterSettings(map[string]any{
|
||||
"luma": 0.5,
|
||||
}))
|
||||
}
|
||||
|
||||
func teardown(client *goobs.Client) {
|
||||
client.Config.RemoveProfile(config.NewRemoveProfileParams().
|
||||
WithProfileName("gobs-test-profile"))
|
||||
|
||||
client.Filters.RemoveSourceFilter(filters.NewRemoveSourceFilterParams().
|
||||
WithSourceName("Mic/Aux").
|
||||
WithFilterName("test_filter"))
|
||||
client.Filters.RemoveSourceFilter(filters.NewRemoveSourceFilterParams().
|
||||
WithSourceName("gobs-test-scene").
|
||||
WithFilterName("test_filter"))
|
||||
|
||||
client.Scenes.RemoveScene(scenes.NewRemoveSceneParams().
|
||||
WithSceneName("gobs-test-scene"))
|
||||
|
||||
client.Config.SetCurrentSceneCollection(config.NewSetCurrentSceneCollectionParams().
|
||||
WithSceneCollectionName("Untitled"))
|
||||
|
||||
client.Stream.StopStream()
|
||||
client.Record.StopRecord()
|
||||
client.Outputs.StopReplayBuffer()
|
||||
client.Ui.SetStudioModeEnabled(ui.NewSetStudioModeEnabledParams().
|
||||
WithStudioModeEnabled(false))
|
||||
}
|
||||
101
profile.go
101
profile.go
@ -5,85 +5,55 @@ import (
|
||||
"slices"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/config"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// ProfileCmd provides commands to manage profiles in OBS Studio.
|
||||
type ProfileCmd struct {
|
||||
List ProfileListCmd `help:"List profiles." cmd:"" aliases:"ls"`
|
||||
Current ProfileCurrentCmd `help:"Get current profile." cmd:"" aliases:"c"`
|
||||
Switch ProfileSwitchCmd `help:"Switch profile." cmd:"" aliases:"sw"`
|
||||
Create ProfileCreateCmd `help:"Create profile." cmd:"" aliases:"new"`
|
||||
Remove ProfileRemoveCmd `help:"Remove profile." cmd:"" aliases:"rm"`
|
||||
List ListProfileCmd `help:"List profiles." cmd:"" aliases:"ls"`
|
||||
Current CurrentProfileCmd `help:"Get current profile." cmd:"" aliases:"c"`
|
||||
Switch SwitchProfileCmd `help:"Switch profile." cmd:"" aliases:"sw"`
|
||||
Create CreateProfileCmd `help:"Create profile." cmd:"" aliases:"cr"`
|
||||
Remove RemoveProfileCmd `help:"Remove profile." cmd:"" aliases:"rm"`
|
||||
}
|
||||
|
||||
// ProfileListCmd provides a command to list all profiles.
|
||||
type ProfileListCmd struct{} // size = 0x0
|
||||
// ListProfileCmd provides a command to list all profiles.
|
||||
type ListProfileCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to list all profiles.
|
||||
// nolint: misspell
|
||||
func (cmd *ProfileListCmd) Run(ctx *context) error {
|
||||
func (cmd *ListProfileCmd) Run(ctx *context) error {
|
||||
profiles, err := ctx.Client.Config.GetProfileList()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||
Headers("Profile Name", "Current").
|
||||
StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 1:
|
||||
style = style.Align(lipgloss.Center)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
for _, profile := range profiles.Profiles {
|
||||
var enabledMark string
|
||||
if profile == profiles.CurrentProfileName {
|
||||
enabledMark = getEnabledMark(true)
|
||||
fmt.Fprintln(ctx.Out, profile)
|
||||
}
|
||||
|
||||
t.Row(profile, enabledMark)
|
||||
}
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
// ProfileCurrentCmd provides a command to get the current profile.
|
||||
type ProfileCurrentCmd struct{} // size = 0x0
|
||||
// CurrentProfileCmd provides a command to get the current profile.
|
||||
type CurrentProfileCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to get the current profile.
|
||||
func (cmd *ProfileCurrentCmd) Run(ctx *context) error {
|
||||
func (cmd *CurrentProfileCmd) Run(ctx *context) error {
|
||||
profiles, err := ctx.Client.Config.GetProfileList()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
fmt.Fprintf(ctx.Out, "Current profile: %s\n", ctx.Style.Highlight(profiles.CurrentProfileName))
|
||||
fmt.Fprintf(ctx.Out, "Current profile: %s\n", profiles.CurrentProfileName)
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// ProfileSwitchCmd provides a command to switch to a different profile.
|
||||
type ProfileSwitchCmd struct {
|
||||
// SwitchProfileCmd provides a command to switch to a different profile.
|
||||
type SwitchProfileCmd struct {
|
||||
Name string `arg:"" help:"Name of the profile to switch to." required:""`
|
||||
}
|
||||
|
||||
// Run executes the command to switch to a different profile.
|
||||
func (cmd *ProfileSwitchCmd) Run(ctx *context) error {
|
||||
func (cmd *SwitchProfileCmd) Run(ctx *context) error {
|
||||
profiles, err := ctx.Client.Config.GetProfileList()
|
||||
if err != nil {
|
||||
return err
|
||||
@ -91,78 +61,71 @@ func (cmd *ProfileSwitchCmd) Run(ctx *context) error {
|
||||
current := profiles.CurrentProfileName
|
||||
|
||||
if current == cmd.Name {
|
||||
return fmt.Errorf("already using profile %s", ctx.Style.Error(cmd.Name))
|
||||
return nil
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Config.SetCurrentProfile(config.NewSetCurrentProfileParams().WithProfileName(cmd.Name))
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to switch to profile %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||
return err
|
||||
}
|
||||
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"Switched from profile %s to %s\n",
|
||||
ctx.Style.Highlight(current),
|
||||
ctx.Style.Highlight(cmd.Name),
|
||||
)
|
||||
fmt.Fprintf(ctx.Out, "Switched from profile %s to %s\n", current, cmd.Name)
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// ProfileCreateCmd provides a command to create a new profile.
|
||||
type ProfileCreateCmd struct {
|
||||
// CreateProfileCmd provides a command to create a new profile.
|
||||
type CreateProfileCmd struct {
|
||||
Name string `arg:"" help:"Name of the profile to create." required:""`
|
||||
}
|
||||
|
||||
// Run executes the command to create a new profile.
|
||||
func (cmd *ProfileCreateCmd) Run(ctx *context) error {
|
||||
func (cmd *CreateProfileCmd) Run(ctx *context) error {
|
||||
profiles, err := ctx.Client.Config.GetProfileList()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if slices.Contains(profiles.Profiles, cmd.Name) {
|
||||
return fmt.Errorf("profile %s already exists", ctx.Style.Error(cmd.Name))
|
||||
return fmt.Errorf("profile %s already exists", cmd.Name)
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Config.CreateProfile(config.NewCreateProfileParams().WithProfileName(cmd.Name))
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to create profile %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||
return err
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Created profile: %s\n", ctx.Style.Highlight(cmd.Name))
|
||||
fmt.Fprintf(ctx.Out, "Created profile: %s\n", cmd.Name)
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// ProfileRemoveCmd provides a command to remove an existing profile.
|
||||
type ProfileRemoveCmd struct {
|
||||
// RemoveProfileCmd provides a command to remove an existing profile.
|
||||
type RemoveProfileCmd struct {
|
||||
Name string `arg:"" help:"Name of the profile to delete." required:""`
|
||||
}
|
||||
|
||||
// Run executes the command to remove an existing profile.
|
||||
func (cmd *ProfileRemoveCmd) Run(ctx *context) error {
|
||||
func (cmd *RemoveProfileCmd) Run(ctx *context) error {
|
||||
profiles, err := ctx.Client.Config.GetProfileList()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if !slices.Contains(profiles.Profiles, cmd.Name) {
|
||||
return fmt.Errorf("profile %s does not exist", ctx.Style.Error(cmd.Name))
|
||||
return fmt.Errorf("profile %s does not exist", cmd.Name)
|
||||
}
|
||||
|
||||
// Prevent deletion of the current profile
|
||||
// This is allowed in OBS Studio (with a confirmation prompt), but we want to prevent it here
|
||||
if profiles.CurrentProfileName == cmd.Name {
|
||||
return fmt.Errorf("cannot delete current profile %s", ctx.Style.Error(cmd.Name))
|
||||
return fmt.Errorf("cannot delete current profile %s", cmd.Name)
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Config.RemoveProfile(config.NewRemoveProfileParams().WithProfileName(cmd.Name))
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to delete profile %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||
return err
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Deleted profile: %s\n", ctx.Style.Highlight(cmd.Name))
|
||||
fmt.Fprintf(ctx.Out, "Deleted profile: %s\n", cmd.Name)
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
111
projector.go
111
projector.go
@ -1,111 +0,0 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/ui"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// ProjectorCmd provides a command to manage projectors in OBS.
|
||||
type ProjectorCmd struct {
|
||||
ListMonitors ProjectorListMonitorsCmd `cmd:"" help:"List available monitors." aliases:"ls-m"`
|
||||
Open ProjectorOpenCmd `cmd:"" help:"Open a fullscreen projector for a source on a specific monitor." aliases:"o"`
|
||||
}
|
||||
|
||||
// ProjectorListMonitorsCmd provides a command to list all monitors available for projectors.
|
||||
type ProjectorListMonitorsCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to list all monitors available for projectors.
|
||||
// nolint: misspell
|
||||
func (cmd *ProjectorListMonitorsCmd) Run(ctx *context) error {
|
||||
monitors, err := ctx.Client.Ui.GetMonitorList()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if len(monitors.Monitors) == 0 {
|
||||
fmt.Fprintf(ctx.Out, "No monitors found.\n")
|
||||
return nil
|
||||
}
|
||||
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||
Headers("Monitor ID", "Monitor Name").
|
||||
StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Center)
|
||||
case 1:
|
||||
style = style.Align(lipgloss.Left)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
for _, monitor := range monitors.Monitors {
|
||||
t.Row(fmt.Sprintf("%d", monitor.MonitorIndex), monitor.MonitorName)
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
// ProjectorOpenCmd provides a command to open a fullscreen projector for a specific source.
|
||||
type ProjectorOpenCmd struct {
|
||||
MonitorIndex int `flag:"" help:"Index of the monitor to open the projector on." default:"0"`
|
||||
SourceName string ` help:"Name of the source to project." default:"" arg:""`
|
||||
}
|
||||
|
||||
// Run executes the command to show details of a specific projector.
|
||||
func (cmd *ProjectorOpenCmd) Run(ctx *context) error {
|
||||
if cmd.SourceName == "" {
|
||||
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get current program scene: %w", err)
|
||||
}
|
||||
cmd.SourceName = currentScene.SceneName
|
||||
}
|
||||
|
||||
monitors, err := ctx.Client.Ui.GetMonitorList()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
var monitorName string
|
||||
for _, monitor := range monitors.Monitors {
|
||||
if monitor.MonitorIndex == cmd.MonitorIndex {
|
||||
monitorName = monitor.MonitorName
|
||||
break
|
||||
}
|
||||
}
|
||||
|
||||
if monitorName == "" {
|
||||
return fmt.Errorf(
|
||||
"monitor with index %s not found. use %s to list available monitors",
|
||||
ctx.Style.Error(fmt.Sprintf("%d", cmd.MonitorIndex)),
|
||||
ctx.Style.Error("gobs-cli prj ls-m"),
|
||||
)
|
||||
}
|
||||
|
||||
ctx.Client.Ui.OpenSourceProjector(ui.NewOpenSourceProjectorParams().
|
||||
WithSourceName(cmd.SourceName).
|
||||
WithMonitorIndex(cmd.MonitorIndex))
|
||||
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"Opened projector for source %s on monitor %s.\n",
|
||||
ctx.Style.Highlight(cmd.SourceName),
|
||||
ctx.Style.Highlight(monitorName),
|
||||
)
|
||||
return nil
|
||||
}
|
||||
164
record.go
164
record.go
@ -2,9 +2,6 @@ package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/config"
|
||||
"github.com/andreykaipov/goobs/api/requests/record"
|
||||
)
|
||||
|
||||
// RecordCmd handles the recording commands.
|
||||
@ -12,12 +9,8 @@ type RecordCmd struct {
|
||||
Start RecordStartCmd `cmd:"" help:"Start recording." aliases:"s"`
|
||||
Stop RecordStopCmd `cmd:"" help:"Stop recording." aliases:"st"`
|
||||
Toggle RecordToggleCmd `cmd:"" help:"Toggle recording." aliases:"tg"`
|
||||
Status RecordStatusCmd `cmd:"" help:"Show recording status." aliases:"ss"`
|
||||
Pause RecordPauseCmd `cmd:"" help:"Pause recording." aliases:"p"`
|
||||
Resume RecordResumeCmd `cmd:"" help:"Resume recording." aliases:"r"`
|
||||
Directory RecordDirectoryCmd `cmd:"" help:"Get/Set recording directory." aliases:"d"`
|
||||
Split RecordSplitCmd `cmd:"" help:"Split recording." aliases:"sp"`
|
||||
Chapter RecordChapterCmd `cmd:"" help:"Create a chapter in the recording." aliases:"c"`
|
||||
}
|
||||
|
||||
// RecordStartCmd starts the recording.
|
||||
@ -25,19 +18,7 @@ type RecordStartCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to start recording.
|
||||
func (cmd *RecordStartCmd) Run(ctx *context) error {
|
||||
status, err := ctx.Client.Record.GetRecordStatus()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if status.OutputActive {
|
||||
if status.OutputPaused {
|
||||
return fmt.Errorf("recording is already in progress and paused")
|
||||
}
|
||||
return fmt.Errorf("recording is already in progress")
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Record.StartRecord()
|
||||
_, err := ctx.Client.Record.StartRecord()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
@ -50,24 +31,11 @@ type RecordStopCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to stop recording.
|
||||
func (cmd *RecordStopCmd) Run(ctx *context) error {
|
||||
status, err := ctx.Client.Record.GetRecordStatus()
|
||||
_, err := ctx.Client.Record.StopRecord()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if !status.OutputActive {
|
||||
return fmt.Errorf("recording is not in progress")
|
||||
}
|
||||
|
||||
resp, err := ctx.Client.Record.StopRecord()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"%s",
|
||||
fmt.Sprintf("Recording stopped successfully. Output file: %s\n", ctx.Style.Highlight(resp.OutputPath)),
|
||||
)
|
||||
fmt.Fprintln(ctx.Out, "Recording stopped successfully.")
|
||||
return nil
|
||||
}
|
||||
|
||||
@ -76,39 +44,25 @@ type RecordToggleCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to toggle recording.
|
||||
func (cmd *RecordToggleCmd) Run(ctx *context) error {
|
||||
status, err := ctx.Client.Record.ToggleRecord()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if status.OutputActive {
|
||||
fmt.Fprintln(ctx.Out, "Recording started successfully.")
|
||||
} else {
|
||||
fmt.Fprintln(ctx.Out, "Recording stopped successfully.")
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// RecordStatusCmd shows the recording status.
|
||||
type RecordStatusCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to show recording status.
|
||||
func (cmd *RecordStatusCmd) Run(ctx *context) error {
|
||||
// Check if recording is in progress
|
||||
status, err := ctx.Client.Record.GetRecordStatus()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if status.OutputActive {
|
||||
if status.OutputPaused {
|
||||
fmt.Fprintln(ctx.Out, "Recording is paused.")
|
||||
} else {
|
||||
fmt.Fprintln(ctx.Out, "Recording is in progress.")
|
||||
_, err = ctx.Client.Record.StopRecord()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
fmt.Fprintln(ctx.Out, "Recording stopped successfully.")
|
||||
} else {
|
||||
fmt.Fprintln(ctx.Out, "Recording is not in progress.")
|
||||
_, err = ctx.Client.Record.StartRecord()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
fmt.Fprintln(ctx.Out, "Recording started successfully.")
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
@ -163,95 +117,3 @@ func (cmd *RecordResumeCmd) Run(ctx *context) error {
|
||||
fmt.Fprintln(ctx.Out, "Recording resumed successfully.")
|
||||
return nil
|
||||
}
|
||||
|
||||
// RecordDirectoryCmd sets the recording directory.
|
||||
type RecordDirectoryCmd struct {
|
||||
RecordDirectory string `arg:"" help:"Directory to save recordings." default:""`
|
||||
}
|
||||
|
||||
// Run executes the command to set the recording directory.
|
||||
func (cmd *RecordDirectoryCmd) Run(ctx *context) error {
|
||||
if cmd.RecordDirectory == "" {
|
||||
resp, err := ctx.Client.Config.GetRecordDirectory()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
fmt.Fprintf(ctx.Out, "Current recording directory: %s\n", ctx.Style.Highlight(resp.RecordDirectory))
|
||||
return nil
|
||||
}
|
||||
|
||||
_, err := ctx.Client.Config.SetRecordDirectory(
|
||||
config.NewSetRecordDirectoryParams().WithRecordDirectory(cmd.RecordDirectory),
|
||||
)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Recording directory set to: %s\n", ctx.Style.Highlight(cmd.RecordDirectory))
|
||||
return nil
|
||||
}
|
||||
|
||||
// RecordSplitCmd splits the current recording.
|
||||
type RecordSplitCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to split the recording.
|
||||
func (cmd *RecordSplitCmd) Run(ctx *context) error {
|
||||
status, err := ctx.Client.Record.GetRecordStatus()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if !status.OutputActive {
|
||||
return fmt.Errorf("recording is not in progress")
|
||||
}
|
||||
if status.OutputPaused {
|
||||
return fmt.Errorf("recording is paused, cannot split")
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Record.SplitRecordFile()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, "Recording split successfully.")
|
||||
return nil
|
||||
}
|
||||
|
||||
// RecordChapterCmd creates a chapter in the recording.
|
||||
type RecordChapterCmd struct {
|
||||
ChapterName string `arg:"" help:"Name of the chapter to create." default:""`
|
||||
}
|
||||
|
||||
// Run executes the command to create a chapter in the recording.
|
||||
func (cmd *RecordChapterCmd) Run(ctx *context) error {
|
||||
status, err := ctx.Client.Record.GetRecordStatus()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if !status.OutputActive {
|
||||
return fmt.Errorf("recording is not in progress")
|
||||
}
|
||||
if status.OutputPaused {
|
||||
return fmt.Errorf("recording is paused, cannot create chapter")
|
||||
}
|
||||
|
||||
var params *record.CreateRecordChapterParams
|
||||
if cmd.ChapterName == "" {
|
||||
params = record.NewCreateRecordChapterParams()
|
||||
} else {
|
||||
params = record.NewCreateRecordChapterParams().WithChapterName(cmd.ChapterName)
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Record.CreateRecordChapter(params)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if cmd.ChapterName == "" {
|
||||
cmd.ChapterName = "unnamed"
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Chapter %s created successfully.\n", ctx.Style.Highlight(cmd.ChapterName))
|
||||
return nil
|
||||
}
|
||||
|
||||
125
record_test.go
125
record_test.go
@ -1,125 +0,0 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"strings"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
func TestRecordStart(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdStatus := &RecordStatusCmd{}
|
||||
err := cmdStatus.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to get recording status: %v", err)
|
||||
}
|
||||
var active bool
|
||||
if out.String() == "Recording is in progress.\n" {
|
||||
active = true
|
||||
}
|
||||
// Reset output buffer for the next command
|
||||
out.Reset()
|
||||
|
||||
cmdStart := &RecordStartCmd{}
|
||||
err = cmdStart.Run(context)
|
||||
if active {
|
||||
if err == nil {
|
||||
t.Fatalf("Expected error when starting recording while active, got nil")
|
||||
}
|
||||
if !strings.Contains(err.Error(), "recording is already in progress") {
|
||||
t.Fatalf("Expected error message to contain 'recording is already in progress', got '%s'", err.Error())
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to start recording: %v", err)
|
||||
}
|
||||
if out.String() != "Recording started successfully.\n" {
|
||||
t.Fatalf("Expected output to contain 'Recording started successfully.', got '%s'", out.String())
|
||||
}
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the recording to start
|
||||
}
|
||||
|
||||
func TestRecordStop(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdStatus := &RecordStatusCmd{}
|
||||
err := cmdStatus.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to get recording status: %v", err)
|
||||
}
|
||||
var active bool
|
||||
if out.String() == "Recording is in progress.\n" {
|
||||
active = true
|
||||
}
|
||||
// Reset output buffer for the next command
|
||||
out.Reset()
|
||||
|
||||
cmdStop := &RecordStopCmd{}
|
||||
err = cmdStop.Run(context)
|
||||
if !active {
|
||||
if err == nil {
|
||||
t.Fatalf("Expected error when stopping recording while inactive, got nil")
|
||||
}
|
||||
if !strings.Contains(err.Error(), "recording is not in progress") {
|
||||
t.Fatalf("Expected error message to contain 'recording is not in progress', got '%s'", err.Error())
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to stop recording: %v", err)
|
||||
}
|
||||
if !strings.Contains(out.String(), "Recording stopped successfully. Output file: ") {
|
||||
t.Fatalf("Expected output to contain 'Recording stopped successfully. Output file: ', got '%s'", out.String())
|
||||
}
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the recording to stop
|
||||
}
|
||||
|
||||
func TestRecordToggle(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdStatus := &RecordStatusCmd{}
|
||||
err := cmdStatus.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to get recording status: %v", err)
|
||||
}
|
||||
var active bool
|
||||
if out.String() == "Recording is in progress.\n" {
|
||||
active = true
|
||||
}
|
||||
// Reset output buffer for the next command
|
||||
out.Reset()
|
||||
|
||||
cmdToggle := &RecordToggleCmd{}
|
||||
err = cmdToggle.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to toggle recording: %v", err)
|
||||
}
|
||||
|
||||
if active {
|
||||
if out.String() != "Recording stopped successfully.\n" {
|
||||
t.Fatalf("Expected output to be 'Recording stopped successfully.', got '%s'", out.String())
|
||||
}
|
||||
} else {
|
||||
if out.String() != "Recording started successfully.\n" {
|
||||
t.Fatalf("Expected output to be 'Recording started successfully.', got '%s'", out.String())
|
||||
}
|
||||
}
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the toggle to take effect
|
||||
}
|
||||
@ -8,7 +8,6 @@ import (
|
||||
type ReplayBufferCmd struct {
|
||||
Start ReplayBufferStartCmd `help:"Start replay buffer." cmd:"" aliases:"s"`
|
||||
Stop ReplayBufferStopCmd `help:"Stop replay buffer." cmd:"" aliases:"st"`
|
||||
Toggle ReplayBufferToggleCmd `help:"Toggle replay buffer." cmd:"" aliases:"tg"`
|
||||
Status ReplayBufferStatusCmd `help:"Get replay buffer status." cmd:"" aliases:"ss"`
|
||||
Save ReplayBufferSaveCmd `help:"Save replay buffer." cmd:"" aliases:"sv"`
|
||||
}
|
||||
@ -19,11 +18,7 @@ type ReplayBufferStartCmd struct{} // size = 0x0
|
||||
// Run executes the command to start the replay buffer.
|
||||
func (cmd *ReplayBufferStartCmd) Run(ctx *context) error {
|
||||
_, err := ctx.Client.Outputs.StartReplayBuffer()
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to start replay buffer: %w", err)
|
||||
}
|
||||
fmt.Fprintln(ctx.Out, "Replay buffer started.")
|
||||
return nil
|
||||
return err
|
||||
}
|
||||
|
||||
// ReplayBufferStopCmd stops the replay buffer.
|
||||
@ -32,29 +27,7 @@ type ReplayBufferStopCmd struct{} // size = 0x0
|
||||
// Run executes the command to stop the replay buffer.
|
||||
func (cmd *ReplayBufferStopCmd) Run(ctx *context) error {
|
||||
_, err := ctx.Client.Outputs.StopReplayBuffer()
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to stop replay buffer: %w", err)
|
||||
}
|
||||
fmt.Fprintln(ctx.Out, "Replay buffer stopped.")
|
||||
return nil
|
||||
}
|
||||
|
||||
// ReplayBufferToggleCmd toggles the replay buffer state.
|
||||
type ReplayBufferToggleCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to toggle the replay buffer.
|
||||
func (cmd *ReplayBufferToggleCmd) Run(ctx *context) error {
|
||||
status, err := ctx.Client.Outputs.ToggleReplayBuffer()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if status.OutputActive {
|
||||
fmt.Fprintln(ctx.Out, "Replay buffer started.")
|
||||
} else {
|
||||
fmt.Fprintln(ctx.Out, "Replay buffer stopped.")
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// ReplayBufferStatusCmd retrieves the status of the replay buffer.
|
||||
|
||||
@ -1,93 +0,0 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"os"
|
||||
"strings"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
func skipIfSkipReplayBufferTests(t *testing.T) {
|
||||
if os.Getenv("GOBS_TEST_SKIP_REPLAYBUFFER_TESTS") != "" {
|
||||
t.Skip("Skipping replay buffer tests due to GOBS_TEST_SKIP_REPLAYBUFFER_TESTS environment variable")
|
||||
}
|
||||
}
|
||||
|
||||
func TestReplayBufferStart(t *testing.T) {
|
||||
skipIfSkipReplayBufferTests(t)
|
||||
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &ReplayBufferStartCmd{}
|
||||
err := cmd.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to start replay buffer: %v", err)
|
||||
}
|
||||
if out.String() != "Replay buffer started.\n" {
|
||||
t.Fatalf("Expected output to be 'Replay buffer started', got '%s'", out.String())
|
||||
}
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the replay buffer to start
|
||||
}
|
||||
|
||||
func TestReplayBufferStop(t *testing.T) {
|
||||
skipIfSkipReplayBufferTests(t)
|
||||
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &ReplayBufferStopCmd{}
|
||||
err := cmd.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to stop replay buffer: %v", err)
|
||||
}
|
||||
if out.String() != "Replay buffer stopped.\n" {
|
||||
t.Fatalf("Expected output to be 'Replay buffer stopped.', got '%s'", out.String())
|
||||
}
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the replay buffer to stop
|
||||
}
|
||||
|
||||
func TestReplayBufferToggle(t *testing.T) {
|
||||
skipIfSkipReplayBufferTests(t)
|
||||
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdStatus := &ReplayBufferStatusCmd{}
|
||||
err := cmdStatus.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to get replay buffer status: %v", err)
|
||||
}
|
||||
var active bool
|
||||
if strings.Contains(out.String(), "Replay buffer is active") {
|
||||
active = true
|
||||
}
|
||||
// Reset output buffer for the next command
|
||||
out.Reset()
|
||||
|
||||
cmdToggle := &ReplayBufferToggleCmd{}
|
||||
err = cmdToggle.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to toggle replay buffer: %v", err)
|
||||
}
|
||||
if active {
|
||||
if out.String() != "Replay buffer stopped.\n" {
|
||||
t.Fatalf("Expected output to be 'Replay buffer stopped.', got '%s'", out.String())
|
||||
}
|
||||
} else {
|
||||
if out.String() != "Replay buffer started.\n" {
|
||||
t.Fatalf("Expected output to be 'Replay buffer started.', got '%s'", out.String())
|
||||
}
|
||||
}
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the toggle to take effect
|
||||
}
|
||||
59
scene.go
59
scene.go
@ -5,8 +5,6 @@ import (
|
||||
"slices"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/scenes"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// SceneCmd provides commands to manage scenes in OBS Studio.
|
||||
@ -17,64 +15,19 @@ type SceneCmd struct {
|
||||
}
|
||||
|
||||
// SceneListCmd provides a command to list all scenes.
|
||||
type SceneListCmd struct {
|
||||
UUID bool `flag:"" help:"Display UUIDs of scenes."`
|
||||
}
|
||||
type SceneListCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to list all scenes.
|
||||
// nolint: misspell
|
||||
func (cmd *SceneListCmd) Run(ctx *context) error {
|
||||
scenes, err := ctx.Client.Scenes.GetSceneList()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
|
||||
if cmd.UUID {
|
||||
t.Headers("Scene Name", "Active", "UUID")
|
||||
} else {
|
||||
t.Headers("Scene Name", "Active")
|
||||
}
|
||||
t.StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 1:
|
||||
style = style.Align(lipgloss.Center)
|
||||
case 2:
|
||||
style = style.Align(lipgloss.Left)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
slices.Reverse(scenes.Scenes)
|
||||
for _, scene := range scenes.Scenes {
|
||||
var activeMark string
|
||||
if scene.SceneName == currentScene.SceneName {
|
||||
activeMark = getEnabledMark(true)
|
||||
fmt.Fprintln(ctx.Out, scene.SceneName)
|
||||
}
|
||||
if cmd.UUID {
|
||||
t.Row(scene.SceneName, activeMark, scene.SceneUuid)
|
||||
} else {
|
||||
t.Row(scene.SceneName, activeMark)
|
||||
}
|
||||
}
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
@ -90,13 +43,13 @@ func (cmd *SceneCurrentCmd) Run(ctx *context) error {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
fmt.Fprintf(ctx.Out, "Current preview scene: %s\n", ctx.Style.Highlight(scene.SceneName))
|
||||
fmt.Fprintln(ctx.Out, scene.SceneName)
|
||||
} else {
|
||||
scene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
fmt.Fprintf(ctx.Out, "Current program scene: %s\n", ctx.Style.Highlight(scene.SceneName))
|
||||
fmt.Fprintln(ctx.Out, scene.SceneName)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
@ -116,7 +69,7 @@ func (cmd *SceneSwitchCmd) Run(ctx *context) error {
|
||||
return err
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Switched to preview scene: %s\n", ctx.Style.Highlight(cmd.NewScene))
|
||||
fmt.Fprintln(ctx.Out, "Switched to preview scene:", cmd.NewScene)
|
||||
} else {
|
||||
_, err := ctx.Client.Scenes.SetCurrentProgramScene(scenes.NewSetCurrentProgramSceneParams().
|
||||
WithSceneName(cmd.NewScene))
|
||||
@ -124,7 +77,7 @@ func (cmd *SceneSwitchCmd) Run(ctx *context) error {
|
||||
return err
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Switched to program scene: %s\n", ctx.Style.Highlight(cmd.NewScene))
|
||||
fmt.Fprintln(ctx.Out, "Switched to program scene:", cmd.NewScene)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
@ -1,51 +0,0 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestSceneList(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &SceneListCmd{}
|
||||
err := cmd.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to list scenes: %v", err)
|
||||
}
|
||||
if out.String() == "Current program scene: gobs-test-scene\n" {
|
||||
t.Fatalf("Expected output to be 'Current program scene: gobs-test-scene', got '%s'", out.String())
|
||||
}
|
||||
}
|
||||
|
||||
func TestSceneCurrent(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
// Set the current scene to "gobs-test-scene"
|
||||
cmdSwitch := &SceneSwitchCmd{
|
||||
NewScene: "gobs-test-scene",
|
||||
}
|
||||
err := cmdSwitch.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to switch to scene: %v", err)
|
||||
}
|
||||
// Reset output buffer for the next command
|
||||
out.Reset()
|
||||
|
||||
cmdCurrent := &SceneCurrentCmd{}
|
||||
err = cmdCurrent.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to get current scene: %v", err)
|
||||
}
|
||||
if out.String() != "Current program scene: gobs-test-scene\n" {
|
||||
t.Fatalf("Expected output to be 'Current program scene: gobs-test-scene', got '%s'", out.String())
|
||||
}
|
||||
}
|
||||
@ -4,61 +4,38 @@ import (
|
||||
"fmt"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/config"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// SceneCollectionCmd provides commands to manage scene collections in OBS Studio.
|
||||
type SceneCollectionCmd struct {
|
||||
List SceneCollectionListCmd `help:"List scene collections." cmd:"" aliases:"ls"`
|
||||
Current SceneCollectionCurrentCmd `help:"Get current scene collection." cmd:"" aliases:"c"`
|
||||
Switch SceneCollectionSwitchCmd `help:"Switch scene collection." cmd:"" aliases:"sw"`
|
||||
Create SceneCollectionCreateCmd `help:"Create scene collection." cmd:"" aliases:"new"`
|
||||
List ListSceneCollectionCmd `help:"List scene collections." cmd:"" aliases:"ls"`
|
||||
Current CurrentSceneCollectionCmd `help:"Get current scene collection." cmd:"" aliases:"c"`
|
||||
Switch SwitchSceneCollectionCmd `help:"Switch scene collection." cmd:"" aliases:"sw"`
|
||||
Create CreateSceneCollectionCmd `help:"Create scene collection." cmd:"" aliases:"cr"`
|
||||
}
|
||||
|
||||
// SceneCollectionListCmd provides a command to list all scene collections.
|
||||
type SceneCollectionListCmd struct{} // size = 0x0
|
||||
// ListSceneCollectionCmd provides a command to list all scene collections.
|
||||
type ListSceneCollectionCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to list all scene collections.
|
||||
// nolint: misspell
|
||||
func (cmd *SceneCollectionListCmd) Run(ctx *context) error {
|
||||
func (cmd *ListSceneCollectionCmd) Run(ctx *context) error {
|
||||
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get scene collection list: %w", err)
|
||||
}
|
||||
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||
Headers("Scene Collection Name").
|
||||
StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Left)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
for _, collection := range collections.SceneCollections {
|
||||
t.Row(collection)
|
||||
fmt.Fprintln(ctx.Out, collection)
|
||||
}
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// SceneCollectionCurrentCmd provides a command to get the current scene collection.
|
||||
type SceneCollectionCurrentCmd struct{} // size = 0x0
|
||||
// CurrentSceneCollectionCmd provides a command to get the current scene collection.
|
||||
type CurrentSceneCollectionCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to get the current scene collection.
|
||||
func (cmd *SceneCollectionCurrentCmd) Run(ctx *context) error {
|
||||
func (cmd *CurrentSceneCollectionCmd) Run(ctx *context) error {
|
||||
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get scene collection list: %w", err)
|
||||
@ -68,13 +45,13 @@ func (cmd *SceneCollectionCurrentCmd) Run(ctx *context) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
// SceneCollectionSwitchCmd provides a command to switch to a different scene collection.
|
||||
type SceneCollectionSwitchCmd struct {
|
||||
// SwitchSceneCollectionCmd provides a command to switch to a different scene collection.
|
||||
type SwitchSceneCollectionCmd struct {
|
||||
Name string `arg:"" help:"Name of the scene collection to switch to." required:""`
|
||||
}
|
||||
|
||||
// Run executes the command to switch to a different scene collection.
|
||||
func (cmd *SceneCollectionSwitchCmd) Run(ctx *context) error {
|
||||
func (cmd *SwitchSceneCollectionCmd) Run(ctx *context) error {
|
||||
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
||||
if err != nil {
|
||||
return err
|
||||
@ -82,35 +59,35 @@ func (cmd *SceneCollectionSwitchCmd) Run(ctx *context) error {
|
||||
current := collections.CurrentSceneCollectionName
|
||||
|
||||
if current == cmd.Name {
|
||||
return fmt.Errorf("scene collection %s is already active", ctx.Style.Error(cmd.Name))
|
||||
return fmt.Errorf("scene collection %s is already active", cmd.Name)
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Config.SetCurrentSceneCollection(
|
||||
config.NewSetCurrentSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to switch scene collection %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||
return fmt.Errorf("failed to switch scene collection: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Switched to scene collection: %s\n", ctx.Style.Highlight(cmd.Name))
|
||||
fmt.Fprintf(ctx.Out, "Switched to scene collection: %s\n", cmd.Name)
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// SceneCollectionCreateCmd provides a command to create a new scene collection.
|
||||
type SceneCollectionCreateCmd struct {
|
||||
// CreateSceneCollectionCmd provides a command to create a new scene collection.
|
||||
type CreateSceneCollectionCmd struct {
|
||||
Name string `arg:"" help:"Name of the scene collection to create." required:""`
|
||||
}
|
||||
|
||||
// Run executes the command to create a new scene collection.
|
||||
func (cmd *SceneCollectionCreateCmd) Run(ctx *context) error {
|
||||
func (cmd *CreateSceneCollectionCmd) Run(ctx *context) error {
|
||||
_, err := ctx.Client.Config.CreateSceneCollection(
|
||||
config.NewCreateSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to create scene collection %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||
return fmt.Errorf("failed to create scene collection: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Created scene collection: %s\n", ctx.Style.Highlight(cmd.Name))
|
||||
fmt.Fprintf(ctx.Out, "Created scene collection: %s\n", cmd.Name)
|
||||
return nil
|
||||
}
|
||||
|
||||
300
sceneitem.go
300
sceneitem.go
@ -1,14 +1,10 @@
|
||||
// nolint: misspell
|
||||
package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"sort"
|
||||
|
||||
"github.com/andreykaipov/goobs"
|
||||
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// SceneItemCmd provides commands to manage scene items in OBS Studio.
|
||||
@ -18,153 +14,50 @@ type SceneItemCmd struct {
|
||||
Hide SceneItemHideCmd `cmd:"" help:"Hide scene item." aliases:"h"`
|
||||
Toggle SceneItemToggleCmd `cmd:"" help:"Toggle scene item." aliases:"tg"`
|
||||
Visible SceneItemVisibleCmd `cmd:"" help:"Get scene item visibility." aliases:"v"`
|
||||
Transform SceneItemTransformCmd `cmd:"" help:"Transform scene item." aliases:"t"`
|
||||
}
|
||||
|
||||
// SceneItemListCmd provides a command to list all scene items in a scene.
|
||||
type SceneItemListCmd struct {
|
||||
UUID bool `flag:"" help:"Display UUIDs of scene items."`
|
||||
SceneName string ` help:"Name of the scene to list items from." arg:"" default:""`
|
||||
SceneName string `arg:"" help:"Scene name."`
|
||||
}
|
||||
|
||||
// Run executes the command to list all scene items in a scene.
|
||||
func (cmd *SceneItemListCmd) Run(ctx *context) error {
|
||||
if cmd.SceneName == "" {
|
||||
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get current program scene: %w", err)
|
||||
}
|
||||
cmd.SceneName = currentScene.SceneName
|
||||
}
|
||||
|
||||
resp, err := ctx.Client.SceneItems.GetSceneItemList(sceneitems.NewGetSceneItemListParams().
|
||||
WithSceneName(cmd.SceneName))
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get scene item list: %w", err)
|
||||
}
|
||||
|
||||
if len(resp.SceneItems) == 0 {
|
||||
fmt.Fprintf(ctx.Out, "No scene items found in scene %s.\n", ctx.Style.Highlight(cmd.SceneName))
|
||||
return nil
|
||||
}
|
||||
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
|
||||
if cmd.UUID {
|
||||
t.Headers("Item ID", "Item Name", "In Group", "Enabled", "UUID")
|
||||
} else {
|
||||
t.Headers("Item ID", "Item Name", "In Group", "Enabled")
|
||||
}
|
||||
t.StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Center)
|
||||
case 1:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 2:
|
||||
style = style.Align(lipgloss.Center)
|
||||
case 3:
|
||||
style = style.Align(lipgloss.Center)
|
||||
case 4:
|
||||
style = style.Align(lipgloss.Left)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
sort.Slice(resp.SceneItems, func(i, j int) bool {
|
||||
return resp.SceneItems[i].SceneItemID < resp.SceneItems[j].SceneItemID
|
||||
})
|
||||
|
||||
for _, item := range resp.SceneItems {
|
||||
if item.IsGroup {
|
||||
resp, err := ctx.Client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
|
||||
WithSceneName(item.SourceName))
|
||||
if err != nil {
|
||||
return fmt.Errorf(
|
||||
"failed to get group scene item list for group %s: %w",
|
||||
ctx.Style.Error(item.SourceName),
|
||||
err,
|
||||
)
|
||||
fmt.Fprintf(ctx.Out, "Item ID: %d, Source Name: %s\n", item.SceneItemID, item.SourceName)
|
||||
}
|
||||
|
||||
sort.Slice(resp.SceneItems, func(i, j int) bool {
|
||||
return resp.SceneItems[i].SceneItemID < resp.SceneItems[j].SceneItemID
|
||||
})
|
||||
|
||||
for _, groupItem := range resp.SceneItems {
|
||||
if cmd.UUID {
|
||||
t.Row(
|
||||
fmt.Sprintf("%d", groupItem.SceneItemID),
|
||||
groupItem.SourceName,
|
||||
item.SourceName,
|
||||
getEnabledMark(item.SceneItemEnabled && groupItem.SceneItemEnabled),
|
||||
groupItem.SourceUuid,
|
||||
)
|
||||
} else {
|
||||
t.Row(
|
||||
fmt.Sprintf("%d", groupItem.SceneItemID),
|
||||
groupItem.SourceName,
|
||||
item.SourceName,
|
||||
getEnabledMark(item.SceneItemEnabled && groupItem.SceneItemEnabled),
|
||||
)
|
||||
}
|
||||
}
|
||||
} else {
|
||||
if cmd.UUID {
|
||||
t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, "",
|
||||
getEnabledMark(item.SceneItemEnabled), item.SourceUuid)
|
||||
} else {
|
||||
t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, "", getEnabledMark(item.SceneItemEnabled))
|
||||
}
|
||||
}
|
||||
}
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
// getSceneNameAndItemID retrieves the scene name and item ID for a given item in a scene or group.
|
||||
func getSceneNameAndItemID(
|
||||
ctx *context,
|
||||
client *goobs.Client,
|
||||
sceneName string,
|
||||
itemName string,
|
||||
group string,
|
||||
parent string,
|
||||
) (string, int, error) {
|
||||
if group != "" {
|
||||
resp, err := ctx.Client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
|
||||
WithSceneName(group))
|
||||
if parent != "" {
|
||||
resp, err := client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
|
||||
WithSceneName(parent))
|
||||
if err != nil {
|
||||
return "", 0, err
|
||||
}
|
||||
for _, item := range resp.SceneItems {
|
||||
if item.SourceName == itemName {
|
||||
return group, int(item.SceneItemID), nil
|
||||
return parent, int(item.SceneItemID), nil
|
||||
}
|
||||
}
|
||||
return "", 0, fmt.Errorf("item %s not found in scene %s", ctx.Style.Error(itemName), ctx.Style.Error(sceneName))
|
||||
return "", 0, fmt.Errorf("item '%s' not found in scene '%s'", itemName, sceneName)
|
||||
}
|
||||
|
||||
itemID, err := ctx.Client.SceneItems.GetSceneItemId(sceneitems.NewGetSceneItemIdParams().
|
||||
itemID, err := client.SceneItems.GetSceneItemId(sceneitems.NewGetSceneItemIdParams().
|
||||
WithSceneName(sceneName).
|
||||
WithSourceName(itemName))
|
||||
if err != nil {
|
||||
if err.Error() == "request GetSceneItemId: ResourceNotFound (600): No scene items were found in the specified scene by that name or offset." {
|
||||
return "", 0, fmt.Errorf(
|
||||
"item %s not found in scene %s. is it in a group? if so use the %s flag to specify the parent group\nuse %s for a list of items in the scene",
|
||||
ctx.Style.Error(itemName),
|
||||
ctx.Style.Error(sceneName),
|
||||
ctx.Style.Error("--group"),
|
||||
ctx.Style.Error("gobs-cli si ls"),
|
||||
)
|
||||
}
|
||||
return "", 0, err
|
||||
}
|
||||
return sceneName, int(itemID.SceneItemId), nil
|
||||
@ -172,7 +65,7 @@ func getSceneNameAndItemID(
|
||||
|
||||
// SceneItemShowCmd provides a command to show a scene item.
|
||||
type SceneItemShowCmd struct {
|
||||
Group string `flag:"" help:"Parent group name."`
|
||||
Parent string `flag:"" help:"Parent group name."`
|
||||
|
||||
SceneName string `arg:"" help:"Scene name."`
|
||||
ItemName string `arg:"" help:"Item name."`
|
||||
@ -180,7 +73,7 @@ type SceneItemShowCmd struct {
|
||||
|
||||
// Run executes the command to show a scene item.
|
||||
func (cmd *SceneItemShowCmd) Run(ctx *context) error {
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
@ -192,24 +85,12 @@ func (cmd *SceneItemShowCmd) Run(ctx *context) error {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if cmd.Group != "" {
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"Scene item %s in group %s is now visible.\n",
|
||||
ctx.Style.Highlight(cmd.ItemName),
|
||||
ctx.Style.Highlight(cmd.Group),
|
||||
)
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now visible.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// SceneItemHideCmd provides a command to hide a scene item.
|
||||
type SceneItemHideCmd struct {
|
||||
Group string `flag:"" help:"Parent group name."`
|
||||
Parent string `flag:"" help:"Parent group name."`
|
||||
|
||||
SceneName string `arg:"" help:"Scene name."`
|
||||
ItemName string `arg:"" help:"Item name."`
|
||||
@ -217,7 +98,7 @@ type SceneItemHideCmd struct {
|
||||
|
||||
// Run executes the command to hide a scene item.
|
||||
func (cmd *SceneItemHideCmd) Run(ctx *context) error {
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
@ -229,18 +110,6 @@ func (cmd *SceneItemHideCmd) Run(ctx *context) error {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if cmd.Group != "" {
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"Scene item %s in group %s is now hidden.\n",
|
||||
ctx.Style.Highlight(cmd.ItemName),
|
||||
ctx.Style.Highlight(cmd.Group),
|
||||
)
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now hidden.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
@ -257,7 +126,7 @@ func getItemEnabled(client *goobs.Client, sceneName string, itemID int) (bool, e
|
||||
|
||||
// SceneItemToggleCmd provides a command to toggle the visibility of a scene item.
|
||||
type SceneItemToggleCmd struct {
|
||||
Group string `flag:"" help:"Parent group name."`
|
||||
Parent string `flag:"" help:"Parent group name."`
|
||||
|
||||
SceneName string `arg:"" help:"Scene name."`
|
||||
ItemName string `arg:"" help:"Item name."`
|
||||
@ -265,7 +134,7 @@ type SceneItemToggleCmd struct {
|
||||
|
||||
// Run executes the command to toggle the visibility of a scene item.
|
||||
func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
@ -282,24 +151,12 @@ func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if itemEnabled {
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"Scene item %s in scene %s is now hidden.\n",
|
||||
ctx.Style.Highlight(cmd.ItemName),
|
||||
ctx.Style.Highlight(cmd.SceneName),
|
||||
)
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now visible.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// SceneItemVisibleCmd provides a command to check the visibility of a scene item.
|
||||
type SceneItemVisibleCmd struct {
|
||||
Group string `flag:"" help:"Parent group name."`
|
||||
Parent string `flag:"" help:"Parent group name."`
|
||||
|
||||
SceneName string `arg:"" help:"Scene name."`
|
||||
ItemName string `arg:"" help:"Item name."`
|
||||
@ -307,7 +164,7 @@ type SceneItemVisibleCmd struct {
|
||||
|
||||
// Run executes the command to check the visibility of a scene item.
|
||||
func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
@ -318,126 +175,9 @@ func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
|
||||
}
|
||||
|
||||
if itemEnabled {
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"Scene item %s in scene %s is visible.\n",
|
||||
ctx.Style.Highlight(cmd.ItemName),
|
||||
ctx.Style.Highlight(cmd.SceneName),
|
||||
)
|
||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is visible.\n", cmd.ItemName, cmd.SceneName)
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is hidden.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is hidden.\n", cmd.ItemName, cmd.SceneName)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// SceneItemTransformCmd provides a command to transform a scene item.
|
||||
type SceneItemTransformCmd struct {
|
||||
SceneName string `arg:"" help:"Scene name."`
|
||||
ItemName string `arg:"" help:"Item name."`
|
||||
|
||||
Group string `flag:"" help:"Parent group name."`
|
||||
|
||||
Alignment float64 `flag:"" help:"Alignment of the scene item."`
|
||||
BoundsAlignment float64 `flag:"" help:"Bounds alignment of the scene item."`
|
||||
BoundsHeight float64 `flag:"" help:"Bounds height of the scene item." default:"1.0"`
|
||||
BoundsType string `flag:"" help:"Bounds type of the scene item." default:"OBS_BOUNDS_NONE"`
|
||||
BoundsWidth float64 `flag:"" help:"Bounds width of the scene item." default:"1.0"`
|
||||
CropToBounds bool `flag:"" help:"Whether to crop the scene item to bounds."`
|
||||
CropBottom float64 `flag:"" help:"Crop bottom value of the scene item."`
|
||||
CropLeft float64 `flag:"" help:"Crop left value of the scene item."`
|
||||
CropRight float64 `flag:"" help:"Crop right value of the scene item."`
|
||||
CropTop float64 `flag:"" help:"Crop top value of the scene item."`
|
||||
PositionX float64 `flag:"" help:"X position of the scene item."`
|
||||
PositionY float64 `flag:"" help:"Y position of the scene item."`
|
||||
Rotation float64 `flag:"" help:"Rotation of the scene item."`
|
||||
ScaleX float64 `flag:"" help:"X scale of the scene item."`
|
||||
ScaleY float64 `flag:"" help:"Y scale of the scene item."`
|
||||
}
|
||||
|
||||
// Run executes the command to transform a scene item.
|
||||
func (cmd *SceneItemTransformCmd) Run(ctx *context) error {
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// Get the current transform of the scene item
|
||||
resp, err := ctx.Client.SceneItems.GetSceneItemTransform(sceneitems.NewGetSceneItemTransformParams().
|
||||
WithSceneName(sceneName).
|
||||
WithSceneItemId(sceneItemID))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// Update the transform with the provided values
|
||||
transform := resp.SceneItemTransform
|
||||
|
||||
if cmd.Alignment != 0 {
|
||||
transform.Alignment = cmd.Alignment
|
||||
}
|
||||
if cmd.BoundsAlignment != 0 {
|
||||
transform.BoundsAlignment = cmd.BoundsAlignment
|
||||
}
|
||||
|
||||
if cmd.BoundsHeight != 0 {
|
||||
transform.BoundsHeight = cmd.BoundsHeight
|
||||
}
|
||||
if cmd.BoundsType != "" {
|
||||
transform.BoundsType = cmd.BoundsType
|
||||
}
|
||||
if cmd.BoundsWidth != 0 {
|
||||
transform.BoundsWidth = cmd.BoundsWidth
|
||||
}
|
||||
|
||||
if cmd.CropToBounds {
|
||||
transform.CropToBounds = cmd.CropToBounds
|
||||
}
|
||||
if cmd.CropBottom != 0 {
|
||||
transform.CropBottom = cmd.CropBottom
|
||||
}
|
||||
if cmd.CropLeft != 0 {
|
||||
transform.CropLeft = cmd.CropLeft
|
||||
}
|
||||
if cmd.CropRight != 0 {
|
||||
transform.CropRight = cmd.CropRight
|
||||
}
|
||||
if cmd.CropTop != 0 {
|
||||
transform.CropTop = cmd.CropTop
|
||||
}
|
||||
if cmd.PositionX != 0 {
|
||||
transform.PositionX = cmd.PositionX
|
||||
}
|
||||
if cmd.PositionY != 0 {
|
||||
transform.PositionY = cmd.PositionY
|
||||
}
|
||||
if cmd.Rotation != 0 {
|
||||
transform.Rotation = cmd.Rotation
|
||||
}
|
||||
if cmd.ScaleX != 0 {
|
||||
transform.ScaleX = cmd.ScaleX
|
||||
}
|
||||
if cmd.ScaleY != 0 {
|
||||
transform.ScaleY = cmd.ScaleY
|
||||
}
|
||||
|
||||
_, err = ctx.Client.SceneItems.SetSceneItemTransform(sceneitems.NewSetSceneItemTransformParams().
|
||||
WithSceneName(sceneName).
|
||||
WithSceneItemId(sceneItemID).
|
||||
WithSceneItemTransform(transform))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if cmd.Group != "" {
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"Scene item %s in group %s transformed.\n",
|
||||
ctx.Style.Highlight(cmd.ItemName),
|
||||
ctx.Style.Highlight(cmd.Group),
|
||||
)
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s transformed.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
@ -1,29 +0,0 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"strings"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestSceneItemList(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &SceneItemListCmd{
|
||||
SceneName: "gobs-test-scene",
|
||||
}
|
||||
err := cmd.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to list scene items: %v", err)
|
||||
}
|
||||
if !strings.Contains(out.String(), "gobs-test-input") {
|
||||
t.Fatalf("Expected output to contain 'gobs-test-input', got '%s'", out.String())
|
||||
}
|
||||
if !strings.Contains(out.String(), "gobs-test-input-2") {
|
||||
t.Fatalf("Expected output to contain 'gobs-test-input-2', got '%s'", out.String())
|
||||
}
|
||||
}
|
||||
@ -1,41 +0,0 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"path/filepath"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/sources"
|
||||
)
|
||||
|
||||
// ScreenshotCmd provides commands to manage screenshots in OBS Studio.
|
||||
type ScreenshotCmd struct {
|
||||
Save ScreenshotSaveCmd `cmd:"" help:"Take a screenshot and save it to a file." aliases:"sv"`
|
||||
}
|
||||
|
||||
// ScreenshotSaveCmd represents the command to save a screenshot of a source in OBS.
|
||||
type ScreenshotSaveCmd struct {
|
||||
SourceName string `arg:"" help:"Name of the source to take a screenshot of."`
|
||||
FilePath string `arg:"" help:"Path to the file where the screenshot will be saved."`
|
||||
Width float64 ` help:"Width of the screenshot in pixels." flag:"" default:"1920"`
|
||||
Height float64 ` help:"Height of the screenshot in pixels." flag:"" default:"1080"`
|
||||
Quality float64 ` help:"Quality of the screenshot (1-100)." flag:"" default:"-1"`
|
||||
}
|
||||
|
||||
// Run executes the command to take a screenshot and save it to a file.
|
||||
func (cmd *ScreenshotSaveCmd) Run(ctx *context) error {
|
||||
_, err := ctx.Client.Sources.SaveSourceScreenshot(
|
||||
sources.NewSaveSourceScreenshotParams().
|
||||
WithSourceName(cmd.SourceName).
|
||||
WithImageFormat(trimPrefix(filepath.Ext(cmd.FilePath), ".")).
|
||||
WithImageFilePath(cmd.FilePath).
|
||||
WithImageWidth(cmd.Width).
|
||||
WithImageHeight(cmd.Height).
|
||||
WithImageCompressionQuality(cmd.Quality),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to take screenshot: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Screenshot saved to %s.\n", ctx.Style.Highlight(cmd.FilePath))
|
||||
return nil
|
||||
}
|
||||
38
stream.go
38
stream.go
@ -17,21 +17,10 @@ type StreamStartCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to start streaming.
|
||||
func (cmd *StreamStartCmd) Run(ctx *context) error {
|
||||
// Check if the stream is already active
|
||||
status, err := ctx.Client.Stream.GetStreamStatus()
|
||||
_, err := ctx.Client.Stream.StartStream()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if status.OutputActive {
|
||||
return fmt.Errorf("stream is already in progress")
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Stream.StartStream()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, "Stream started successfully.")
|
||||
return nil
|
||||
}
|
||||
|
||||
@ -40,21 +29,10 @@ type StreamStopCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to stop streaming.
|
||||
func (cmd *StreamStopCmd) Run(ctx *context) error {
|
||||
// Check if the stream is already inactive
|
||||
status, err := ctx.Client.Stream.GetStreamStatus()
|
||||
_, err := ctx.Client.Stream.StopStream()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if !status.OutputActive {
|
||||
return fmt.Errorf("stream is not in progress")
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Stream.StopStream()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, "Stream stopped successfully.")
|
||||
return nil
|
||||
}
|
||||
|
||||
@ -63,15 +41,19 @@ type StreamToggleCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to toggle streaming.
|
||||
func (cmd *StreamToggleCmd) Run(ctx *context) error {
|
||||
status, err := ctx.Client.Stream.ToggleStream()
|
||||
status, err := ctx.Client.Stream.GetStreamStatus()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if status.OutputActive {
|
||||
fmt.Fprintln(ctx.Out, "Stream started successfully.")
|
||||
_, err = ctx.Client.Stream.StopStream()
|
||||
fmt.Fprintf(ctx.Out, "Stopping stream...\n")
|
||||
} else {
|
||||
fmt.Fprintln(ctx.Out, "Stream stopped successfully.")
|
||||
_, err = ctx.Client.Stream.StartStream()
|
||||
fmt.Fprintf(ctx.Out, "Starting stream...\n")
|
||||
}
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
123
stream_test.go
123
stream_test.go
@ -1,123 +0,0 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"strings"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
func TestStreamStart(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdStatus := &StreamStatusCmd{}
|
||||
err := cmdStatus.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to get stream status: %v", err)
|
||||
}
|
||||
var active bool
|
||||
if strings.Contains(out.String(), "Output active: true") {
|
||||
active = true
|
||||
}
|
||||
// Reset output buffer for the next command
|
||||
out.Reset()
|
||||
|
||||
cmdStart := &StreamStartCmd{}
|
||||
err = cmdStart.Run(context)
|
||||
if active {
|
||||
if err == nil {
|
||||
t.Fatalf("Expected error when starting stream while active, got nil")
|
||||
}
|
||||
if !strings.Contains(err.Error(), "stream is already in progress") {
|
||||
t.Fatalf("Expected error message to contain 'stream is already in progress', got '%s'", err.Error())
|
||||
}
|
||||
return
|
||||
}
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to start stream: %v", err)
|
||||
}
|
||||
if out.String() != "Stream started successfully.\n" {
|
||||
t.Fatalf("Expected output to contain 'Stream started successfully.', got '%s'", out.String())
|
||||
}
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the stream to start
|
||||
}
|
||||
|
||||
func TestStreamStop(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdStatus := &StreamStatusCmd{}
|
||||
err := cmdStatus.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to get stream status: %v", err)
|
||||
}
|
||||
var active bool
|
||||
if strings.Contains(out.String(), "Output active: true") {
|
||||
active = true
|
||||
}
|
||||
// Reset output buffer for the next command
|
||||
out.Reset()
|
||||
|
||||
cmdStop := &StreamStopCmd{}
|
||||
err = cmdStop.Run(context)
|
||||
if !active {
|
||||
if err == nil {
|
||||
t.Fatalf("Expected error when stopping stream while inactive, got nil")
|
||||
}
|
||||
if !strings.Contains(err.Error(), "stream is not in progress") {
|
||||
t.Fatalf("Expected error message to contain 'stream is not in progress', got '%s'", err.Error())
|
||||
}
|
||||
return
|
||||
}
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to stop stream: %v", err)
|
||||
}
|
||||
if out.String() != "Stream stopped successfully.\n" {
|
||||
t.Fatalf("Expected output to contain 'Stream stopped successfully.', got '%s'", out.String())
|
||||
}
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the stream to stop
|
||||
}
|
||||
|
||||
func TestStreamToggle(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdStatus := &StreamStatusCmd{}
|
||||
err := cmdStatus.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to get stream status: %v", err)
|
||||
}
|
||||
var active bool
|
||||
if strings.Contains(out.String(), "Output active: true") {
|
||||
active = true
|
||||
}
|
||||
// Reset output buffer for the next command
|
||||
out.Reset()
|
||||
|
||||
cmdToggle := &StreamToggleCmd{}
|
||||
err = cmdToggle.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to toggle stream: %v", err)
|
||||
}
|
||||
|
||||
if active {
|
||||
if out.String() != "Stream stopped successfully.\n" {
|
||||
t.Fatalf("Expected 'Stream stopped successfully.', got: %s", out.String())
|
||||
}
|
||||
} else {
|
||||
if out.String() != "Stream started successfully.\n" {
|
||||
t.Fatalf("Expected 'Stream started successfully.', got: %s", out.String())
|
||||
}
|
||||
}
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the stream to toggle
|
||||
}
|
||||
@ -23,8 +23,6 @@ func (cmd *StudioModeEnableCmd) Run(ctx *context) error {
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to enable studio mode: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, "Studio mode is now enabled")
|
||||
return nil
|
||||
}
|
||||
|
||||
@ -37,8 +35,6 @@ func (cmd *StudioModeDisableCmd) Run(ctx *context) error {
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to disable studio mode: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, "Studio mode is now disabled")
|
||||
return nil
|
||||
}
|
||||
|
||||
|
||||
@ -1,62 +0,0 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestStudioModeEnable(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdEnable := &StudioModeEnableCmd{}
|
||||
err := cmdEnable.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("failed to enable studio mode: %v", err)
|
||||
}
|
||||
if out.String() != "Studio mode is now enabled\n" {
|
||||
t.Fatalf("expected 'Studio mode is now enabled', got: %s", out.String())
|
||||
}
|
||||
// Reset output buffer for the next command
|
||||
out.Reset()
|
||||
|
||||
cmdStatus := &StudioModeStatusCmd{}
|
||||
err = cmdStatus.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("failed to get studio mode status: %v", err)
|
||||
}
|
||||
if out.String() != "Studio mode is enabled\n" {
|
||||
t.Fatalf("expected 'Studio mode is enabled', got: %s", out.String())
|
||||
}
|
||||
}
|
||||
|
||||
func TestStudioModeDisable(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdDisable := &StudioModeDisableCmd{}
|
||||
err := cmdDisable.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("failed to disable studio mode: %v", err)
|
||||
}
|
||||
if out.String() != "Studio mode is now disabled\n" {
|
||||
t.Fatalf("expected 'Studio mode is now disabled', got: %s", out.String())
|
||||
}
|
||||
// Reset output buffer for the next command
|
||||
out.Reset()
|
||||
|
||||
cmdStatus := &StudioModeStatusCmd{}
|
||||
err = cmdStatus.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("failed to get studio mode status: %v", err)
|
||||
}
|
||||
if out.String() != "Studio mode is disabled\n" {
|
||||
t.Fatalf("expected 'Studio mode is disabled', got: %s", out.String())
|
||||
}
|
||||
}
|
||||
192
style.go
192
style.go
@ -1,192 +0,0 @@
|
||||
// nolint: misspell
|
||||
package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"os"
|
||||
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
)
|
||||
|
||||
// Style defines colours for the table styles.
|
||||
type Style struct {
|
||||
name string
|
||||
border lipgloss.Color
|
||||
oddRows lipgloss.Color
|
||||
evenRows lipgloss.Color
|
||||
highlight lipgloss.Color
|
||||
}
|
||||
|
||||
// Highlight applies the highlight style to the given text.
|
||||
func (s *Style) Highlight(text string) string {
|
||||
return lipgloss.NewStyle().Foreground(s.highlight).Render(text)
|
||||
}
|
||||
|
||||
func (s *Style) Error(text string) string {
|
||||
return lipgloss.NewStyle().Foreground(lipgloss.Color("#FF0000")).Render(text) // Red for errors
|
||||
}
|
||||
|
||||
func newRedStyle() Style {
|
||||
return Style{
|
||||
name: "red",
|
||||
border: lipgloss.Color("#D32F2F"), // Strong red for border
|
||||
oddRows: lipgloss.Color("#FFCDD2"), // Very light red for odd rows
|
||||
evenRows: lipgloss.Color("#EF9A9A"), // Light red for even rows
|
||||
highlight: lipgloss.Color("#EF9A9A"), // Highlight in light red
|
||||
}
|
||||
}
|
||||
|
||||
func newMagentaStyle() Style {
|
||||
return Style{
|
||||
name: "magenta",
|
||||
border: lipgloss.Color("#C2185B"), // Strong magenta for border
|
||||
oddRows: lipgloss.Color("#F8BBD0"), // Very light magenta/pink for odd rows
|
||||
evenRows: lipgloss.Color("#F48FB1"), // Light magenta/pink for even rows
|
||||
highlight: lipgloss.Color("#F48FB1"), // Highlight in light magenta/pink
|
||||
}
|
||||
}
|
||||
|
||||
func newPurpleStyle() Style {
|
||||
return Style{
|
||||
name: "purple",
|
||||
border: lipgloss.Color("#7B1FA2"), // Strong purple for border
|
||||
oddRows: lipgloss.Color("#E1BEE7"), // Very light purple for odd rows
|
||||
evenRows: lipgloss.Color("#CE93D8"), // Light purple for even rows
|
||||
highlight: lipgloss.Color("#CE93D8"), // Highlight in light purple
|
||||
}
|
||||
}
|
||||
|
||||
func newBlueStyle() Style {
|
||||
return Style{
|
||||
name: "blue",
|
||||
border: lipgloss.Color("#1976D2"), // Medium blue for border
|
||||
oddRows: lipgloss.Color("#E3F2FD"), // Very light blue for odd rows
|
||||
evenRows: lipgloss.Color("#BBDEFB"), // Light blue for even rows
|
||||
highlight: lipgloss.Color("#1976D2"), // Highlight in medium blue
|
||||
}
|
||||
}
|
||||
|
||||
func newCyanStyle() Style {
|
||||
return Style{
|
||||
name: "cyan",
|
||||
border: lipgloss.Color("#00BFCF"), // A strong cyan for border
|
||||
oddRows: lipgloss.Color("#E0F7FA"), // Very light cyan for odd rows
|
||||
evenRows: lipgloss.Color("#B2EBF2"), // Slightly darker light cyan for even rows
|
||||
highlight: lipgloss.Color("#00BFCF"), // Highlight in strong cyan
|
||||
}
|
||||
}
|
||||
|
||||
func newGreenStyle() Style {
|
||||
return Style{
|
||||
name: "green",
|
||||
border: lipgloss.Color("#43A047"), // Medium green for border
|
||||
oddRows: lipgloss.Color("#E8F5E9"), // Very light green for odd rows
|
||||
evenRows: lipgloss.Color("#C8E6C9"), // Light green for even rows
|
||||
highlight: lipgloss.Color("#43A047"), // Highlight in medium green
|
||||
}
|
||||
}
|
||||
|
||||
func newYellowStyle() Style {
|
||||
return Style{
|
||||
name: "yellow",
|
||||
border: lipgloss.Color("#FBC02D"), // Strong yellow for border
|
||||
oddRows: lipgloss.Color("#FFF9C4"), // Very light yellow for odd rows
|
||||
evenRows: lipgloss.Color("#FFF59D"), // Light yellow for even rows
|
||||
highlight: lipgloss.Color("#FBC02D"), // Highlight in strong yellow
|
||||
}
|
||||
}
|
||||
|
||||
func newOrangeStyle() Style {
|
||||
return Style{
|
||||
name: "orange",
|
||||
border: lipgloss.Color("#F57C00"), // Strong orange for border
|
||||
oddRows: lipgloss.Color("#FFF3E0"), // Very light orange for odd rows
|
||||
evenRows: lipgloss.Color("#FFE0B2"), // Light orange for even rows
|
||||
highlight: lipgloss.Color("#F57C00"), // Highlight in strong orange
|
||||
}
|
||||
}
|
||||
|
||||
func newWhiteStyle() Style {
|
||||
return Style{
|
||||
name: "white",
|
||||
border: lipgloss.Color("#FFFFFF"), // White for border
|
||||
oddRows: lipgloss.Color("#F0F0F0"), // Very light grey for odd rows
|
||||
evenRows: lipgloss.Color("#E0E0E0"), // Light grey for even rows
|
||||
highlight: lipgloss.Color("#FFFFFF"), // Highlight in white
|
||||
}
|
||||
}
|
||||
|
||||
func newGreyStyle() Style {
|
||||
return Style{
|
||||
name: "grey",
|
||||
border: lipgloss.Color("#9E9E9E"), // Medium grey for border
|
||||
oddRows: lipgloss.Color("#F5F5F5"), // Very light grey for odd rows
|
||||
evenRows: lipgloss.Color("#EEEEEE"), // Light grey for even rows
|
||||
highlight: lipgloss.Color("#9E9E9E"), // Highlight in medium grey
|
||||
}
|
||||
}
|
||||
|
||||
func newNavyBlueStyle() Style {
|
||||
return Style{
|
||||
name: "navy",
|
||||
border: lipgloss.Color("#001F3F"), // Navy blue for border
|
||||
oddRows: lipgloss.Color("#CFE2F3"), // Very light blue for odd rows
|
||||
evenRows: lipgloss.Color("#A9CCE3"), // Light blue for even rows
|
||||
highlight: lipgloss.Color("#001F3F"), // Highlight in navy blue
|
||||
}
|
||||
}
|
||||
|
||||
func newBlackStyle() Style {
|
||||
return Style{
|
||||
name: "black",
|
||||
border: lipgloss.Color("#000000"), // Black for border
|
||||
oddRows: lipgloss.Color("#333333"), // Dark grey for odd rows
|
||||
evenRows: lipgloss.Color("#444444"), // Slightly lighter dark grey for even rows
|
||||
highlight: lipgloss.Color("#000000"), // Highlight in black
|
||||
}
|
||||
}
|
||||
|
||||
func styleFromFlag(cfg StyleConfig) *Style {
|
||||
var style Style
|
||||
|
||||
switch cfg.Style {
|
||||
case "red":
|
||||
style = newRedStyle()
|
||||
case "magenta":
|
||||
style = newMagentaStyle()
|
||||
case "purple":
|
||||
style = newPurpleStyle()
|
||||
case "blue":
|
||||
style = newBlueStyle()
|
||||
case "cyan":
|
||||
style = newCyanStyle()
|
||||
case "green":
|
||||
style = newGreenStyle()
|
||||
case "yellow":
|
||||
style = newYellowStyle()
|
||||
case "orange":
|
||||
style = newOrangeStyle()
|
||||
case "white":
|
||||
style = newWhiteStyle()
|
||||
case "grey":
|
||||
style = newGreyStyle()
|
||||
case "navy":
|
||||
style = newNavyBlueStyle()
|
||||
case "black":
|
||||
style = newBlackStyle()
|
||||
default:
|
||||
err := os.Setenv("NO_COLOR", "1") // nolint: misspell
|
||||
if err != nil {
|
||||
// If we can't set NO_COLOR, we just log the error and continue
|
||||
// This is a fallback to ensure that the application can still run
|
||||
fmt.Fprintf(os.Stderr, "Error setting NO_COLOR: %v\n", err)
|
||||
}
|
||||
}
|
||||
|
||||
// If noBorder is true, we disable the border styling
|
||||
if cfg.NoBorder {
|
||||
style.border = ""
|
||||
}
|
||||
|
||||
return &style
|
||||
}
|
||||
85
text.go
85
text.go
@ -1,85 +0,0 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"strings"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/inputs"
|
||||
)
|
||||
|
||||
// TextCmd provides commands for managing text inputs in OBS.
|
||||
type TextCmd struct {
|
||||
Current TextCurrentCmd `cmd:"current" help:"Display current text for a text input." aliases:"c"`
|
||||
Update TextUpdateCmd `cmd:"update" help:"Update the text of a text input." aliases:"u"`
|
||||
}
|
||||
|
||||
// TextCurrentCmd provides a command to display the current text of a text input.
|
||||
type TextCurrentCmd struct {
|
||||
InputName string `arg:"" help:"Name of the text source."`
|
||||
}
|
||||
|
||||
// Run executes the command to display the current text of a text input.
|
||||
func (cmd *TextCurrentCmd) Run(ctx *context) error {
|
||||
resp, err := ctx.Client.Inputs.GetInputSettings(
|
||||
inputs.NewGetInputSettingsParams().WithInputName(cmd.InputName),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get input settings: %w", err)
|
||||
}
|
||||
|
||||
// Check if the input is a text input
|
||||
kind := resp.InputKind
|
||||
if !strings.HasPrefix(kind, "text_") {
|
||||
return fmt.Errorf("input %s is of %s", cmd.InputName, kind)
|
||||
}
|
||||
|
||||
currentText, ok := resp.InputSettings["text"]
|
||||
if !ok {
|
||||
return fmt.Errorf("input %s does not have a 'text' setting", cmd.InputName)
|
||||
}
|
||||
if currentText == "" {
|
||||
currentText = "(empty)"
|
||||
}
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"Current text for source %s: %s\n",
|
||||
ctx.Style.Highlight(cmd.InputName),
|
||||
currentText,
|
||||
)
|
||||
return nil
|
||||
}
|
||||
|
||||
// TextUpdateCmd provides a command to update the text of a text input.
|
||||
type TextUpdateCmd struct {
|
||||
InputName string `arg:"" help:"Name of the text source."`
|
||||
NewText string `arg:"" help:"New text to set for the source." default:""`
|
||||
}
|
||||
|
||||
// Run executes the command to update the text of a text input.
|
||||
func (cmd *TextUpdateCmd) Run(ctx *context) error {
|
||||
resp, err := ctx.Client.Inputs.GetInputSettings(
|
||||
inputs.NewGetInputSettingsParams().WithInputName(cmd.InputName),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get input settings: %w", err)
|
||||
}
|
||||
|
||||
// Check if the input is a text input
|
||||
kind := resp.InputKind
|
||||
if !strings.HasPrefix(kind, "text_") {
|
||||
return fmt.Errorf("input %s is of %s", cmd.InputName, kind)
|
||||
}
|
||||
|
||||
if _, err := ctx.Client.Inputs.SetInputSettings(&inputs.SetInputSettingsParams{
|
||||
InputName: &cmd.InputName,
|
||||
InputSettings: map[string]any{"text": &cmd.NewText},
|
||||
}); err != nil {
|
||||
return fmt.Errorf("failed to update text for source %s: %w", cmd.InputName, err)
|
||||
}
|
||||
|
||||
if cmd.NewText == "" {
|
||||
cmd.NewText = "(empty)"
|
||||
}
|
||||
fmt.Fprintf(ctx.Out, "Updated text for source %s to: %s\n", ctx.Style.Highlight(cmd.InputName), cmd.NewText)
|
||||
return nil
|
||||
}
|
||||
38
util.go
38
util.go
@ -1,38 +0,0 @@
|
||||
// Package util provides utility functions for the application.
|
||||
|
||||
package main
|
||||
|
||||
import (
|
||||
"os"
|
||||
"strings"
|
||||
)
|
||||
|
||||
func snakeCaseToTitleCase(snake string) string {
|
||||
words := strings.Split(snake, "_")
|
||||
for i, word := range words {
|
||||
if len(word) > 0 {
|
||||
words[i] = strings.ToUpper(word[:1]) + word[1:]
|
||||
}
|
||||
}
|
||||
return strings.Join(words, " ")
|
||||
}
|
||||
|
||||
func getEnabledMark(enabled bool) string {
|
||||
if enabled {
|
||||
if os.Getenv("NO_COLOR") != "" { // nolint: misspell
|
||||
return "✓"
|
||||
}
|
||||
return "✅"
|
||||
}
|
||||
if os.Getenv("NO_COLOR") != "" { // nolint: misspell
|
||||
return "✗"
|
||||
}
|
||||
return "❌"
|
||||
}
|
||||
|
||||
func trimPrefix(s, prefix string) string {
|
||||
if strings.HasPrefix(s, prefix) {
|
||||
return s[len(prefix):]
|
||||
}
|
||||
return s
|
||||
}
|
||||
20
util_test.go
20
util_test.go
@ -1,20 +0,0 @@
|
||||
package main
|
||||
|
||||
import "testing"
|
||||
|
||||
func TestSnakeCaseToTitleCase(t *testing.T) {
|
||||
tests := []struct {
|
||||
input string
|
||||
expected string
|
||||
}{
|
||||
{"hello_world", "Hello World"},
|
||||
{"snake_case_to_title_case", "Snake Case To Title Case"},
|
||||
}
|
||||
|
||||
for _, test := range tests {
|
||||
result := snakeCaseToTitleCase(test.input)
|
||||
if result != test.expected {
|
||||
t.Errorf("Expected '%s' but got '%s'", test.expected, result)
|
||||
}
|
||||
}
|
||||
}
|
||||
@ -4,11 +4,11 @@ import (
|
||||
"fmt"
|
||||
)
|
||||
|
||||
// ObsVersionCmd handles the version command.
|
||||
type ObsVersionCmd struct{} // size = 0x0
|
||||
// VersionCmd handles the version command.
|
||||
type VersionCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to get the OBS client version.
|
||||
func (cmd *ObsVersionCmd) Run(ctx *context) error {
|
||||
func (cmd *VersionCmd) Run(ctx *context) error {
|
||||
version, err := ctx.Client.General.GetVersion()
|
||||
if err != nil {
|
||||
return err
|
||||
|
||||
@ -1,27 +0,0 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"strings"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestVersion(t *testing.T) {
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &ObsVersionCmd{}
|
||||
err := cmd.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to get version: %v", err)
|
||||
}
|
||||
if !strings.Contains(out.String(), "OBS Client Version:") {
|
||||
t.Fatalf("Expected output to contain 'OBS Client Version:', got '%s'", out.String())
|
||||
}
|
||||
if !strings.Contains(out.String(), "with Websocket Version:") {
|
||||
t.Fatalf("Expected output to contain 'with Websocket Version:', got '%s'", out.String())
|
||||
}
|
||||
}
|
||||
@ -6,17 +6,17 @@ import (
|
||||
|
||||
// VirtualCamCmd handles the virtual camera commands.
|
||||
type VirtualCamCmd struct {
|
||||
Start VirtualCamStartCmd `help:"Start virtual camera." cmd:"" aliases:"s"`
|
||||
Stop VirtualCamStopCmd `help:"Stop virtual camera." cmd:"" aliases:"st"`
|
||||
Toggle VirtualCamToggleCmd `help:"Toggle virtual camera." cmd:"" aliases:"tg"`
|
||||
Status VirtualCamStatusCmd `help:"Get virtual camera status." cmd:"" aliases:"ss"`
|
||||
Start StartVirtualCamCmd `help:"Start virtual camera." cmd:"" aliases:"s"`
|
||||
Stop StopVirtualCamCmd `help:"Stop virtual camera." cmd:"" aliases:"st"`
|
||||
Toggle ToggleVirtualCamCmd `help:"Toggle virtual camera." cmd:"" aliases:"tg"`
|
||||
Status StatusVirtualCamCmd `help:"Get virtual camera status." cmd:"" aliases:"ss"`
|
||||
}
|
||||
|
||||
// VirtualCamStartCmd starts the virtual camera.
|
||||
type VirtualCamStartCmd struct{} // size = 0x0
|
||||
// StartVirtualCamCmd starts the virtual camera.
|
||||
type StartVirtualCamCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to start the virtual camera.
|
||||
func (c *VirtualCamStartCmd) Run(ctx *context) error {
|
||||
func (c *StartVirtualCamCmd) Run(ctx *context) error {
|
||||
_, err := ctx.Client.Outputs.StartVirtualCam()
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to start virtual camera: %w", err)
|
||||
@ -25,11 +25,11 @@ func (c *VirtualCamStartCmd) Run(ctx *context) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
// VirtualCamStopCmd stops the virtual camera.
|
||||
type VirtualCamStopCmd struct{} // size = 0x0
|
||||
// StopVirtualCamCmd stops the virtual camera.
|
||||
type StopVirtualCamCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to stop the virtual camera.
|
||||
func (c *VirtualCamStopCmd) Run(ctx *context) error {
|
||||
func (c *StopVirtualCamCmd) Run(ctx *context) error {
|
||||
_, err := ctx.Client.Outputs.StopVirtualCam()
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to stop virtual camera: %w", err)
|
||||
@ -38,29 +38,23 @@ func (c *VirtualCamStopCmd) Run(ctx *context) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
// VirtualCamToggleCmd toggles the virtual camera.
|
||||
type VirtualCamToggleCmd struct{} // size = 0x0
|
||||
// ToggleVirtualCamCmd toggles the virtual camera.
|
||||
type ToggleVirtualCamCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to toggle the virtual camera.
|
||||
func (c *VirtualCamToggleCmd) Run(ctx *context) error {
|
||||
resp, err := ctx.Client.Outputs.ToggleVirtualCam()
|
||||
func (c *ToggleVirtualCamCmd) Run(ctx *context) error {
|
||||
_, err := ctx.Client.Outputs.ToggleVirtualCam()
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to toggle virtual camera: %w", err)
|
||||
}
|
||||
|
||||
if resp.OutputActive {
|
||||
fmt.Fprintln(ctx.Out, "Virtual camera is now active.")
|
||||
} else {
|
||||
fmt.Fprintln(ctx.Out, "Virtual camera is now inactive.")
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// VirtualCamStatusCmd retrieves the status of the virtual camera.
|
||||
type VirtualCamStatusCmd struct{} // size = 0x0
|
||||
// StatusVirtualCamCmd retrieves the status of the virtual camera.
|
||||
type StatusVirtualCamCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to get the status of the virtual camera.
|
||||
func (c *VirtualCamStatusCmd) Run(ctx *context) error {
|
||||
func (c *StatusVirtualCamCmd) Run(ctx *context) error {
|
||||
status, err := ctx.Client.Outputs.GetVirtualCamStatus()
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get virtual camera status: %w", err)
|
||||
|
||||
Loading…
x
Reference in New Issue
Block a user