mirror of
https://github.com/onyx-and-iris/gobs-cli.git
synced 2026-04-20 16:13:40 +00:00
Compare commits
34 Commits
v0.10.0
...
9eb6c8a282
| Author | SHA1 | Date | |
|---|---|---|---|
| 9eb6c8a282 | |||
| eb30cae5b7 | |||
| e6c03a2c92 | |||
| f6b82383f9 | |||
| 55f3b0c981 | |||
| 7da80a1ad2 | |||
| ea4ca2aeb9 | |||
| d2f0a64180 | |||
| f01fd0ca84 | |||
| 10d50df445 | |||
| 06cefe58ed | |||
| 7cd1c78f6a | |||
| 842d98edd3 | |||
| 930b387b85 | |||
| 2ab1c5bfc3 | |||
| 08f23fe47d | |||
| bbc6aec230 | |||
| 5d0ed2a166 | |||
| 62579b1c5e | |||
| 9ed00cd67c | |||
| 69bfaf694d | |||
| 7147c3f1ca | |||
| d699939298 | |||
| 82c0756dde | |||
| 4395c981c6 | |||
| dc043b5847 | |||
| c8a055fa28 | |||
| d9c0e40d8f | |||
| 42ab45b9fb | |||
| 27c3c5369b | |||
| 0a0c75ae51 | |||
| cf5da68137 | |||
| 14d9feb43e | |||
| 8204d6520d |
67
CHANGELOG.md
67
CHANGELOG.md
@@ -5,13 +5,74 @@ All notable changes to this project will be documented in this file.
|
|||||||
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
||||||
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
||||||
|
|
||||||
# [0.10.0]
|
# [0.13.3] - 2025-06-27
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- usage is now printed on errors.
|
||||||
|
- help is printed in compact mode. This should make it easier to page through help on the root command.
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Item ID alignment in sceneitem list table.
|
||||||
|
|
||||||
|
# [0.13.0] - 2025-06-23
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- record split and record chapter commands, see [RecordCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#recordcmd)
|
||||||
|
- As of OBS 30.2.0, the only file format supporting *record chapter* is Hybrid MP4.
|
||||||
|
|
||||||
|
# [0.12.1] - 2025-06-21
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Various colouring styles, see [Style](https://github.com/onyx-and-iris/gobs-cli/tree/main?tab=readme-ov-file#style)
|
||||||
|
- colouring is applied to list tables as well as highlighted information in stdout/stderr output.
|
||||||
|
- table border styling may be optionally disabled with the --no-border flag.
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- if an itemName is passed to a sceneitem command that's in a group, without the --group flag, a friendlier error message is displayed.
|
||||||
|
- it will suggest using *gobs-cli si ls* to list sources in the scene.
|
||||||
|
- if an invalid --monitor-index is passed to projector open a friendlier error message is displayed.
|
||||||
|
- it will suggest using *gobs-cli prj ls-m* to list available monitors.
|
||||||
|
|
||||||
|
|
||||||
|
# [0.11.0] - 2025-06-20
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- input list, scene list and sceneitem list now accept --uuid flag.
|
||||||
|
- Active column added to scene list table.
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- scene list no longer prints the UUIDs by default, enable it with the --uuid flag.
|
||||||
|
|
||||||
|
# [0.10.3] - 2025-06-07
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- filter list:
|
||||||
|
- --ffmpeg, --vlc flags
|
||||||
|
- Muted column to list table
|
||||||
|
|
||||||
|
# [0.10.2] - 2025-06-04
|
||||||
|
|
||||||
### Added
|
### Added
|
||||||
|
|
||||||
- screenshot save command, see [ScreenshotCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#screenshotcmd)
|
- screenshot save command, see [ScreenshotCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#screenshotcmd)
|
||||||
|
|
||||||
# [0.9.0]
|
### Fixed
|
||||||
|
|
||||||
|
- filter list:
|
||||||
|
- sourceName arg now defaults to current scene.
|
||||||
|
- defaults are printed for any unmodified values.
|
||||||
|
- sceneitem list:
|
||||||
|
- prints enabled mark instead of true/false
|
||||||
|
|
||||||
|
# [0.9.0] - 2025-06-02
|
||||||
|
|
||||||
### Added
|
### Added
|
||||||
|
|
||||||
@@ -21,7 +82,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
|
|||||||
|
|
||||||
- version command renamed to obs-version
|
- version command renamed to obs-version
|
||||||
|
|
||||||
# [0.8.2]
|
# [0.8.2] - 2025-05-29
|
||||||
|
|
||||||
### Added
|
### Added
|
||||||
|
|
||||||
|
|||||||
79
README.md
79
README.md
@@ -4,6 +4,16 @@ A command line interface for OBS Websocket v5
|
|||||||
|
|
||||||
For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)
|
For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)
|
||||||
|
|
||||||
|
-----
|
||||||
|
|
||||||
|
## Table of Contents
|
||||||
|
|
||||||
|
- [Installation](#installation)
|
||||||
|
- [Configuration](#configuration)
|
||||||
|
- [Style](#style)
|
||||||
|
- [Commands](#commands)
|
||||||
|
- [License](#license)
|
||||||
|
|
||||||
## Installation
|
## Installation
|
||||||
|
|
||||||
```console
|
```console
|
||||||
@@ -40,6 +50,36 @@ OBS_PASSWORD=<websocket password>
|
|||||||
OBS_TIMEOUT=5
|
OBS_TIMEOUT=5
|
||||||
```
|
```
|
||||||
|
|
||||||
|
## Style
|
||||||
|
|
||||||
|
Styling is opt-in, by default you will get a colourless output:
|
||||||
|
|
||||||
|

|
||||||
|
|
||||||
|
You may enable styling with the --style/-s flag:
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli --style="red" sceneitem list
|
||||||
|
```
|
||||||
|
|
||||||
|
Available styles: _red, magenta, purple, blue, cyan, green, yellow, orange, white, grey, navy, black_
|
||||||
|
|
||||||
|

|
||||||
|
|
||||||
|
Optionally you may disable border colouring with the --no-border flag:
|
||||||
|
|
||||||
|

|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli --style="red" --no-border sceneitem list
|
||||||
|
```
|
||||||
|
|
||||||
|
Or with environment variables:
|
||||||
|
|
||||||
|
```env
|
||||||
|
GOBS_STYLE=red
|
||||||
|
GOBS_STYLE_NO_BORDER=true
|
||||||
|
```
|
||||||
|
|
||||||
## Commands
|
## Commands
|
||||||
|
|
||||||
@@ -54,6 +94,10 @@ gobs-cli obs-version
|
|||||||
### SceneCmd
|
### SceneCmd
|
||||||
|
|
||||||
- list: List all scenes.
|
- list: List all scenes.
|
||||||
|
- flags:
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- --UUID: Display UUIDs of scenes.
|
||||||
|
|
||||||
```console
|
```console
|
||||||
gobs-cli scene list
|
gobs-cli scene list
|
||||||
@@ -87,6 +131,10 @@ gobs-cli scene switch --preview LIVE
|
|||||||
### SceneItemCmd
|
### SceneItemCmd
|
||||||
|
|
||||||
- list: List all scene items.
|
- list: List all scene items.
|
||||||
|
- flags:
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- --UUID: Display UUIDs of scene items.
|
||||||
|
|
||||||
*optional*
|
*optional*
|
||||||
- args: SceneName
|
- args: SceneName
|
||||||
@@ -223,6 +271,9 @@ gobs-cli group status START "test_group"
|
|||||||
- --input: List all inputs.
|
- --input: List all inputs.
|
||||||
- --output: List all outputs.
|
- --output: List all outputs.
|
||||||
- --colour: List all colour sources.
|
- --colour: List all colour sources.
|
||||||
|
- --ffmpeg: List all ffmpeg sources.
|
||||||
|
- --vlc: List all VLC sources.
|
||||||
|
- --uuid: Display UUIDs of inputs.
|
||||||
|
|
||||||
```console
|
```console
|
||||||
gobs-cli input list
|
gobs-cli input list
|
||||||
@@ -302,6 +353,21 @@ gobs-cli record directory "/home/me/obs-vids/"
|
|||||||
gobs-cli record directory "C:/Users/me/Videos"
|
gobs-cli record directory "C:/Users/me/Videos"
|
||||||
```
|
```
|
||||||
|
|
||||||
|
- split: Split recording.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli record split
|
||||||
|
```
|
||||||
|
|
||||||
|
- chapter: Create a chapter in the recording.
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- arg: ChapterName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli record chapter "Chapter Name"
|
||||||
|
```
|
||||||
|
|
||||||
### StreamCmd
|
### StreamCmd
|
||||||
|
|
||||||
- start: Start streaming.
|
- start: Start streaming.
|
||||||
@@ -513,6 +579,10 @@ gobs-cli hotkey trigger-sequence OBS_KEY_F1 --shift --ctrl
|
|||||||
|
|
||||||
- list: List all filters.
|
- list: List all filters.
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- args: SourceName
|
||||||
|
- defaults to current scene
|
||||||
|
|
||||||
```console
|
```console
|
||||||
gobs-cli filter list
|
gobs-cli filter list
|
||||||
```
|
```
|
||||||
@@ -561,7 +631,7 @@ gobs-cli projector list-monitors
|
|||||||
- defaults to 0
|
- defaults to 0
|
||||||
|
|
||||||
*optional*
|
*optional*
|
||||||
- args: <source_name>
|
- args: SourceName
|
||||||
- defaults to current scene
|
- defaults to current scene
|
||||||
|
|
||||||
```console
|
```console
|
||||||
@@ -585,12 +655,17 @@ gobs-cli projector open --monitor-index=1 "test_group"
|
|||||||
- --quality:
|
- --quality:
|
||||||
- defaults to -1
|
- defaults to -1
|
||||||
|
|
||||||
- args: <source_name> <output_path>
|
- args: SourceName FilePath
|
||||||
|
|
||||||
```console
|
```console
|
||||||
gobs-cli screenshot save --width=2560 --height=1440 "Scene" "C:\Users\me\Videos\screenshot.png"
|
gobs-cli screenshot save --width=2560 --height=1440 "Scene" "C:\Users\me\Videos\screenshot.png"
|
||||||
```
|
```
|
||||||
|
|
||||||
|
## License
|
||||||
|
|
||||||
|
`gobs-cli` is distributed under the terms of the [MIT](https://spdx.org/licenses/MIT.html) license.
|
||||||
|
|
||||||
|
|
||||||
[userconfigdir]: https://pkg.go.dev/os#UserConfigDir
|
[userconfigdir]: https://pkg.go.dev/os#UserConfigDir
|
||||||
[obs-keyids]: https://github.com/obsproject/obs-studio/blob/master/libobs/obs-hotkeys.h
|
[obs-keyids]: https://github.com/obsproject/obs-studio/blob/master/libobs/obs-hotkeys.h
|
||||||
|
[no-colour]: https://no-color.org/
|
||||||
|
|||||||
92
filter.go
92
filter.go
@@ -2,11 +2,13 @@ package main
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"fmt"
|
"fmt"
|
||||||
|
"maps"
|
||||||
"sort"
|
"sort"
|
||||||
"strings"
|
"strings"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/filters"
|
"github.com/andreykaipov/goobs/api/requests/filters"
|
||||||
"github.com/aquasecurity/table"
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// FilterCmd provides commands to manage filters in OBS Studio.
|
// FilterCmd provides commands to manage filters in OBS Studio.
|
||||||
@@ -20,45 +22,85 @@ type FilterCmd struct {
|
|||||||
|
|
||||||
// FilterListCmd provides a command to list all filters in a scene.
|
// FilterListCmd provides a command to list all filters in a scene.
|
||||||
type FilterListCmd struct {
|
type FilterListCmd struct {
|
||||||
SourceName string `arg:"" help:"Name of the source to list filters from."`
|
SourceName string `arg:"" help:"Name of the source to list filters from." default:""`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to list all filters in a scene.
|
// Run executes the command to list all filters in a scene.
|
||||||
|
// nolint: misspell
|
||||||
func (cmd *FilterListCmd) Run(ctx *context) error {
|
func (cmd *FilterListCmd) Run(ctx *context) error {
|
||||||
filters, err := ctx.Client.Filters.GetSourceFilterList(
|
if cmd.SourceName == "" {
|
||||||
|
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get current program scene: %w", err)
|
||||||
|
}
|
||||||
|
cmd.SourceName = currentScene.SceneName
|
||||||
|
}
|
||||||
|
|
||||||
|
sourceFilters, err := ctx.Client.Filters.GetSourceFilterList(
|
||||||
filters.NewGetSourceFilterListParams().WithSourceName(cmd.SourceName),
|
filters.NewGetSourceFilterListParams().WithSourceName(cmd.SourceName),
|
||||||
)
|
)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
if len(filters.Filters) == 0 {
|
if len(sourceFilters.Filters) == 0 {
|
||||||
fmt.Fprintf(ctx.Out, "No filters found for source %s.\n", cmd.SourceName)
|
fmt.Fprintf(ctx.Out, "No filters found for source %s.\n", ctx.Style.Highlight(cmd.SourceName))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
t := table.New(ctx.Out)
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
t.SetPadding(3)
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||||
t.SetAlignment(table.AlignLeft, table.AlignLeft, table.AlignCenter, table.AlignLeft)
|
Headers("Filter Name", "Kind", "Enabled", "Settings").
|
||||||
t.SetHeaders("Filter Name", "Kind", "Enabled", "Settings")
|
StyleFunc(func(row, col int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch col {
|
||||||
|
case 0:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
case 1:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
case 2:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
case 3:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
}
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center)
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
|
for _, filter := range sourceFilters.Filters {
|
||||||
|
defaultSettings, err := ctx.Client.Filters.GetSourceFilterDefaultSettings(
|
||||||
|
filters.NewGetSourceFilterDefaultSettingsParams().
|
||||||
|
WithFilterKind(filter.FilterKind),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get default settings for filter %s: %w",
|
||||||
|
ctx.Style.Error(filter.FilterName), err)
|
||||||
|
}
|
||||||
|
maps.Insert(defaultSettings.DefaultFilterSettings, maps.All(filter.FilterSettings))
|
||||||
|
|
||||||
for _, filter := range filters.Filters {
|
|
||||||
var lines []string
|
var lines []string
|
||||||
for k, v := range filter.FilterSettings {
|
for k, v := range defaultSettings.DefaultFilterSettings {
|
||||||
lines = append(lines, fmt.Sprintf("%s %v", k, v))
|
lines = append(lines, fmt.Sprintf("%s: %v", snakeCaseToTitleCase(k), v))
|
||||||
}
|
}
|
||||||
sort.Slice(lines, func(i, j int) bool {
|
sort.Slice(lines, func(i, j int) bool {
|
||||||
return strings.ToLower(lines[i]) < strings.ToLower(lines[j])
|
return strings.ToLower(lines[i]) < strings.ToLower(lines[j])
|
||||||
})
|
})
|
||||||
|
|
||||||
t.AddRow(
|
t.Row(
|
||||||
filter.FilterName,
|
filter.FilterName,
|
||||||
snakeCaseToTitleCase(filter.FilterKind),
|
snakeCaseToTitleCase(filter.FilterKind),
|
||||||
getEnabledMark(filter.FilterEnabled),
|
getEnabledMark(filter.FilterEnabled),
|
||||||
strings.Join(lines, "\n"),
|
strings.Join(lines, "\n"),
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
t.Render()
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -78,10 +120,10 @@ func (cmd *FilterEnableCmd) Run(ctx *context) error {
|
|||||||
)
|
)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to enable filter %s on source %s: %w",
|
return fmt.Errorf("failed to enable filter %s on source %s: %w",
|
||||||
cmd.FilterName, cmd.SourceName, err)
|
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||||
}
|
}
|
||||||
fmt.Fprintf(ctx.Out, "Filter %s enabled on source %s.\n",
|
fmt.Fprintf(ctx.Out, "Filter %s enabled on source %s.\n",
|
||||||
cmd.FilterName, cmd.SourceName)
|
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -101,10 +143,10 @@ func (cmd *FilterDisableCmd) Run(ctx *context) error {
|
|||||||
)
|
)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to disable filter %s on source %s: %w",
|
return fmt.Errorf("failed to disable filter %s on source %s: %w",
|
||||||
cmd.FilterName, cmd.SourceName, err)
|
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||||
}
|
}
|
||||||
fmt.Fprintf(ctx.Out, "Filter %s disabled on source %s.\n",
|
fmt.Fprintf(ctx.Out, "Filter %s disabled on source %s.\n",
|
||||||
cmd.FilterName, cmd.SourceName)
|
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -123,7 +165,7 @@ func (cmd *FilterToggleCmd) Run(ctx *context) error {
|
|||||||
)
|
)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to get filter %s on source %s: %w",
|
return fmt.Errorf("failed to get filter %s on source %s: %w",
|
||||||
cmd.FilterName, cmd.SourceName, err)
|
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||||
}
|
}
|
||||||
|
|
||||||
newStatus := !filter.FilterEnabled
|
newStatus := !filter.FilterEnabled
|
||||||
@@ -135,15 +177,15 @@ func (cmd *FilterToggleCmd) Run(ctx *context) error {
|
|||||||
)
|
)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to toggle filter %s on source %s: %w",
|
return fmt.Errorf("failed to toggle filter %s on source %s: %w",
|
||||||
cmd.FilterName, cmd.SourceName, err)
|
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||||
}
|
}
|
||||||
|
|
||||||
if newStatus {
|
if newStatus {
|
||||||
fmt.Fprintf(ctx.Out, "Filter %s on source %s is now enabled.\n",
|
fmt.Fprintf(ctx.Out, "Filter %s on source %s is now enabled.\n",
|
||||||
cmd.FilterName, cmd.SourceName)
|
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Filter %s on source %s is now disabled.\n",
|
fmt.Fprintf(ctx.Out, "Filter %s on source %s is now disabled.\n",
|
||||||
cmd.FilterName, cmd.SourceName)
|
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@@ -163,14 +205,14 @@ func (cmd *FilterStatusCmd) Run(ctx *context) error {
|
|||||||
)
|
)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to get status of filter %s on source %s: %w",
|
return fmt.Errorf("failed to get status of filter %s on source %s: %w",
|
||||||
cmd.FilterName, cmd.SourceName, err)
|
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||||
}
|
}
|
||||||
if filter.FilterEnabled {
|
if filter.FilterEnabled {
|
||||||
fmt.Fprintf(ctx.Out, "Filter %s on source %s is enabled.\n",
|
fmt.Fprintf(ctx.Out, "Filter %s on source %s is enabled.\n",
|
||||||
cmd.FilterName, cmd.SourceName)
|
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Filter %s on source %s is disabled.\n",
|
fmt.Fprintf(ctx.Out, "Filter %s on source %s is disabled.\n",
|
||||||
cmd.FilterName, cmd.SourceName)
|
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -11,10 +11,7 @@ func TestFilterList(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &FilterListCmd{
|
cmd := &FilterListCmd{
|
||||||
SourceName: "Mic/Aux",
|
SourceName: "Mic/Aux",
|
||||||
@@ -33,10 +30,7 @@ func TestFilterListScene(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &FilterListCmd{
|
cmd := &FilterListCmd{
|
||||||
SourceName: "gobs-test",
|
SourceName: "gobs-test",
|
||||||
@@ -55,10 +49,7 @@ func TestFilterListEmpty(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &FilterListCmd{
|
cmd := &FilterListCmd{
|
||||||
SourceName: "NonExistentSource",
|
SourceName: "NonExistentSource",
|
||||||
|
|||||||
18
go.mod
18
go.mod
@@ -6,22 +6,30 @@ require (
|
|||||||
github.com/alecthomas/kong v1.10.0
|
github.com/alecthomas/kong v1.10.0
|
||||||
github.com/alecthomas/mango-kong v0.1.0
|
github.com/alecthomas/mango-kong v0.1.0
|
||||||
github.com/andreykaipov/goobs v1.5.6
|
github.com/andreykaipov/goobs v1.5.6
|
||||||
github.com/aquasecurity/table v1.10.0
|
github.com/charmbracelet/lipgloss v1.1.0
|
||||||
github.com/titusjaka/kong-dotenv-go v0.1.0
|
github.com/titusjaka/kong-dotenv-go v0.1.0
|
||||||
)
|
)
|
||||||
|
|
||||||
require (
|
require (
|
||||||
|
github.com/aymanbagabas/go-osc52/v2 v2.0.1 // indirect
|
||||||
github.com/buger/jsonparser v1.1.1 // indirect
|
github.com/buger/jsonparser v1.1.1 // indirect
|
||||||
|
github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc // indirect
|
||||||
|
github.com/charmbracelet/x/ansi v0.8.0 // indirect
|
||||||
|
github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd // indirect
|
||||||
|
github.com/charmbracelet/x/term v0.2.1 // indirect
|
||||||
github.com/gorilla/websocket v1.5.3 // indirect
|
github.com/gorilla/websocket v1.5.3 // indirect
|
||||||
github.com/hashicorp/logutils v1.0.0 // indirect
|
github.com/hashicorp/logutils v1.0.0 // indirect
|
||||||
github.com/joho/godotenv v1.5.1 // indirect
|
github.com/joho/godotenv v1.5.1 // indirect
|
||||||
github.com/mattn/go-runewidth v0.0.13 // indirect
|
github.com/lucasb-eyer/go-colorful v1.2.0 // indirect
|
||||||
|
github.com/mattn/go-isatty v0.0.20 // indirect
|
||||||
|
github.com/mattn/go-runewidth v0.0.16 // indirect
|
||||||
github.com/mitchellh/mapstructure v1.5.0 // indirect
|
github.com/mitchellh/mapstructure v1.5.0 // indirect
|
||||||
github.com/mmcloughlin/profile v0.1.1 // indirect
|
github.com/mmcloughlin/profile v0.1.1 // indirect
|
||||||
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab // indirect
|
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab // indirect
|
||||||
github.com/muesli/roff v0.1.0 // indirect
|
github.com/muesli/roff v0.1.0 // indirect
|
||||||
|
github.com/muesli/termenv v0.16.0 // indirect
|
||||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d // indirect
|
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d // indirect
|
||||||
github.com/rivo/uniseg v0.2.0 // indirect
|
github.com/rivo/uniseg v0.4.7 // indirect
|
||||||
golang.org/x/sys v0.1.0 // indirect
|
github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e // indirect
|
||||||
golang.org/x/term v0.0.0-20220526004731-065cf7ba2467 // indirect
|
golang.org/x/sys v0.30.0 // indirect
|
||||||
)
|
)
|
||||||
|
|||||||
42
go.sum
42
go.sum
@@ -8,10 +8,24 @@ github.com/alecthomas/repr v0.4.0 h1:GhI2A8MACjfegCPVq9f1FLvIBS+DrQ2KQBFZP1iFzXc
|
|||||||
github.com/alecthomas/repr v0.4.0/go.mod h1:Fr0507jx4eOXV7AlPV6AVZLYrLIuIeSOWtW57eE/O/4=
|
github.com/alecthomas/repr v0.4.0/go.mod h1:Fr0507jx4eOXV7AlPV6AVZLYrLIuIeSOWtW57eE/O/4=
|
||||||
github.com/andreykaipov/goobs v1.5.6 h1:eIkEqYN99+2VJvmlY/56Ah60nkRKS6efMQvpM3oUgPQ=
|
github.com/andreykaipov/goobs v1.5.6 h1:eIkEqYN99+2VJvmlY/56Ah60nkRKS6efMQvpM3oUgPQ=
|
||||||
github.com/andreykaipov/goobs v1.5.6/go.mod h1:iSZP93FJ4d9X/U1x4DD4IyILLtig+vViqZWBGjLywcY=
|
github.com/andreykaipov/goobs v1.5.6/go.mod h1:iSZP93FJ4d9X/U1x4DD4IyILLtig+vViqZWBGjLywcY=
|
||||||
github.com/aquasecurity/table v1.10.0 h1:gPWV28qp9XSlvXdT3ku8yKQoZE6II0vsmegKpW+dB08=
|
github.com/aymanbagabas/go-osc52/v2 v2.0.1 h1:HwpRHbFMcZLEVr42D4p7XBqjyuxQH5SMiErDT4WkJ2k=
|
||||||
github.com/aquasecurity/table v1.10.0/go.mod h1:eqOmvjjB7AhXFgFqpJUEE/ietg7RrMSJZXyTN8E/wZw=
|
github.com/aymanbagabas/go-osc52/v2 v2.0.1/go.mod h1:uYgXzlJ7ZpABp8OJ+exZzJJhRNQ2ASbcXHWsFqH8hp8=
|
||||||
|
github.com/aymanbagabas/go-udiff v0.2.0 h1:TK0fH4MteXUDspT88n8CKzvK0X9O2xu9yQjWpi6yML8=
|
||||||
|
github.com/aymanbagabas/go-udiff v0.2.0/go.mod h1:RE4Ex0qsGkTAJoQdQQCA0uG+nAzJO/pI/QwceO5fgrA=
|
||||||
github.com/buger/jsonparser v1.1.1 h1:2PnMjfWD7wBILjqQbt530v576A/cAbQvEW9gGIpYMUs=
|
github.com/buger/jsonparser v1.1.1 h1:2PnMjfWD7wBILjqQbt530v576A/cAbQvEW9gGIpYMUs=
|
||||||
github.com/buger/jsonparser v1.1.1/go.mod h1:6RYKKt7H4d4+iWqouImQ9R2FZql3VbhNgx27UK13J/0=
|
github.com/buger/jsonparser v1.1.1/go.mod h1:6RYKKt7H4d4+iWqouImQ9R2FZql3VbhNgx27UK13J/0=
|
||||||
|
github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc h1:4pZI35227imm7yK2bGPcfpFEmuY1gc2YSTShr4iJBfs=
|
||||||
|
github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc/go.mod h1:X4/0JoqgTIPSFcRA/P6INZzIuyqdFY5rm8tb41s9okk=
|
||||||
|
github.com/charmbracelet/lipgloss v1.1.0 h1:vYXsiLHVkK7fp74RkV7b2kq9+zDLoEU4MZoFqR/noCY=
|
||||||
|
github.com/charmbracelet/lipgloss v1.1.0/go.mod h1:/6Q8FR2o+kj8rz4Dq0zQc3vYf7X+B0binUUBwA0aL30=
|
||||||
|
github.com/charmbracelet/x/ansi v0.8.0 h1:9GTq3xq9caJW8ZrBTe0LIe2fvfLR/bYXKTx2llXn7xE=
|
||||||
|
github.com/charmbracelet/x/ansi v0.8.0/go.mod h1:wdYl/ONOLHLIVmQaxbIYEC/cRKOQyjTkowiI4blgS9Q=
|
||||||
|
github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd h1:vy0GVL4jeHEwG5YOXDmi86oYw2yuYUGqz6a8sLwg0X8=
|
||||||
|
github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd/go.mod h1:xe0nKWGd3eJgtqZRaN9RjMtK7xUYchjzPr7q6kcvCCs=
|
||||||
|
github.com/charmbracelet/x/exp/golden v0.0.0-20240806155701-69247e0abc2a h1:G99klV19u0QnhiizODirwVksQB91TJKV/UaTnACcG30=
|
||||||
|
github.com/charmbracelet/x/exp/golden v0.0.0-20240806155701-69247e0abc2a/go.mod h1:wDlXFlCrmJ8J+swcL/MnGUuYnqgQdW9rhSD61oNMb6U=
|
||||||
|
github.com/charmbracelet/x/term v0.2.1 h1:AQeHeLZ1OqSXhrAWpYUtZyX1T3zVxfpZuEQMIQaGIAQ=
|
||||||
|
github.com/charmbracelet/x/term v0.2.1/go.mod h1:oQ4enTYFV7QN4m0i9mzHrViD7TQKvNEEkHUMCmsxdUg=
|
||||||
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||||
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||||
github.com/gorilla/websocket v1.5.3 h1:saDtZ6Pbx/0u+bgYQ3q96pZgCzfhKXGPqt7kZ72aNNg=
|
github.com/gorilla/websocket v1.5.3 h1:saDtZ6Pbx/0u+bgYQ3q96pZgCzfhKXGPqt7kZ72aNNg=
|
||||||
@@ -22,8 +36,12 @@ github.com/hexops/gotextdiff v1.0.3 h1:gitA9+qJrrTCsiCl7+kh75nPqQt1cx4ZkudSTLoUq
|
|||||||
github.com/hexops/gotextdiff v1.0.3/go.mod h1:pSWU5MAI3yDq+fZBTazCSJysOMbxWL1BSow5/V2vxeg=
|
github.com/hexops/gotextdiff v1.0.3/go.mod h1:pSWU5MAI3yDq+fZBTazCSJysOMbxWL1BSow5/V2vxeg=
|
||||||
github.com/joho/godotenv v1.5.1 h1:7eLL/+HRGLY0ldzfGMeQkb7vMd0as4CfYvUVzLqw0N0=
|
github.com/joho/godotenv v1.5.1 h1:7eLL/+HRGLY0ldzfGMeQkb7vMd0as4CfYvUVzLqw0N0=
|
||||||
github.com/joho/godotenv v1.5.1/go.mod h1:f4LDr5Voq0i2e/R5DDNOoa2zzDfwtkZa6DnEwAbqwq4=
|
github.com/joho/godotenv v1.5.1/go.mod h1:f4LDr5Voq0i2e/R5DDNOoa2zzDfwtkZa6DnEwAbqwq4=
|
||||||
github.com/mattn/go-runewidth v0.0.13 h1:lTGmDsbAYt5DmK6OnoV7EuIF1wEIFAcxld6ypU4OSgU=
|
github.com/lucasb-eyer/go-colorful v1.2.0 h1:1nnpGOrhyZZuNyfu1QjKiUICQ74+3FNCN69Aj6K7nkY=
|
||||||
github.com/mattn/go-runewidth v0.0.13/go.mod h1:Jdepj2loyihRzMpdS35Xk/zdY8IAYHsh153qUoGf23w=
|
github.com/lucasb-eyer/go-colorful v1.2.0/go.mod h1:R4dSotOR9KMtayYi1e77YzuveK+i7ruzyGqttikkLy0=
|
||||||
|
github.com/mattn/go-isatty v0.0.20 h1:xfD0iDuEKnDkl03q4limB+vH+GxLEtL/jb4xVJSWWEY=
|
||||||
|
github.com/mattn/go-isatty v0.0.20/go.mod h1:W+V8PltTTMOvKvAeJH7IuucS94S2C6jfK/D7dTCTo3Y=
|
||||||
|
github.com/mattn/go-runewidth v0.0.16 h1:E5ScNMtiwvlvB5paMFdw9p4kSQzbXFikJ5SQO6TULQc=
|
||||||
|
github.com/mattn/go-runewidth v0.0.16/go.mod h1:Jdepj2loyihRzMpdS35Xk/zdY8IAYHsh153qUoGf23w=
|
||||||
github.com/mitchellh/mapstructure v1.5.0 h1:jeMsZIYE/09sWLaz43PL7Gy6RuMjD2eJVyuac5Z2hdY=
|
github.com/mitchellh/mapstructure v1.5.0 h1:jeMsZIYE/09sWLaz43PL7Gy6RuMjD2eJVyuac5Z2hdY=
|
||||||
github.com/mitchellh/mapstructure v1.5.0/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo=
|
github.com/mitchellh/mapstructure v1.5.0/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo=
|
||||||
github.com/mmcloughlin/profile v0.1.1 h1:jhDmAqPyebOsVDOCICJoINoLb/AnLBaUw58nFzxWS2w=
|
github.com/mmcloughlin/profile v0.1.1 h1:jhDmAqPyebOsVDOCICJoINoLb/AnLBaUw58nFzxWS2w=
|
||||||
@@ -32,19 +50,25 @@ github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab h1:m7QFONkzLK0fVXCj
|
|||||||
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab/go.mod h1:5XFpbC8jY5UUv89YQciiXNlbi+iJgt29VDC5xbzrLL4=
|
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab/go.mod h1:5XFpbC8jY5UUv89YQciiXNlbi+iJgt29VDC5xbzrLL4=
|
||||||
github.com/muesli/roff v0.1.0 h1:YD0lalCotmYuF5HhZliKWlIx7IEhiXeSfq7hNjFqGF8=
|
github.com/muesli/roff v0.1.0 h1:YD0lalCotmYuF5HhZliKWlIx7IEhiXeSfq7hNjFqGF8=
|
||||||
github.com/muesli/roff v0.1.0/go.mod h1:pjAHQM9hdUUwm/krAfrLGgJkXJ+YuhtsfZ42kieB2Ig=
|
github.com/muesli/roff v0.1.0/go.mod h1:pjAHQM9hdUUwm/krAfrLGgJkXJ+YuhtsfZ42kieB2Ig=
|
||||||
|
github.com/muesli/termenv v0.16.0 h1:S5AlUN9dENB57rsbnkPyfdGuWIlkmzJjbFf0Tf5FWUc=
|
||||||
|
github.com/muesli/termenv v0.16.0/go.mod h1:ZRfOIKPFDYQoDFF4Olj7/QJbW60Ol/kL1pU3VfY/Cnk=
|
||||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d h1:VhgPp6v9qf9Agr/56bj7Y/xa04UccTW04VP0Qed4vnQ=
|
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d h1:VhgPp6v9qf9Agr/56bj7Y/xa04UccTW04VP0Qed4vnQ=
|
||||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d/go.mod h1:YUTz3bUH2ZwIWBy3CJBeOBEugqcmXREj14T+iG/4k4U=
|
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d/go.mod h1:YUTz3bUH2ZwIWBy3CJBeOBEugqcmXREj14T+iG/4k4U=
|
||||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||||
github.com/rivo/uniseg v0.2.0 h1:S1pD9weZBuJdFmowNwbpi7BJ8TNftyUImj/0WQi72jY=
|
|
||||||
github.com/rivo/uniseg v0.2.0/go.mod h1:J6wj4VEh+S6ZtnVlnTBMWIodfgj8LQOQFoIToxlJtxc=
|
github.com/rivo/uniseg v0.2.0/go.mod h1:J6wj4VEh+S6ZtnVlnTBMWIodfgj8LQOQFoIToxlJtxc=
|
||||||
|
github.com/rivo/uniseg v0.4.7 h1:WUdvkW8uEhrYfLC4ZzdpI2ztxP1I582+49Oc5Mq64VQ=
|
||||||
|
github.com/rivo/uniseg v0.4.7/go.mod h1:FN3SvrM+Zdj16jyLfmOkMNblXMcoc8DfTHruCPUcx88=
|
||||||
github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA=
|
github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA=
|
||||||
github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
|
github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
|
||||||
github.com/titusjaka/kong-dotenv-go v0.1.0 h1:TmUjP/sXoNiKLr6oR7n9xrB5XyXi/Ssuebzfz5nxZj4=
|
github.com/titusjaka/kong-dotenv-go v0.1.0 h1:TmUjP/sXoNiKLr6oR7n9xrB5XyXi/Ssuebzfz5nxZj4=
|
||||||
github.com/titusjaka/kong-dotenv-go v0.1.0/go.mod h1:pBgLjcu82oqUgb7+bngK9+Ch7jg49E0YADP8Wnj2MXU=
|
github.com/titusjaka/kong-dotenv-go v0.1.0/go.mod h1:pBgLjcu82oqUgb7+bngK9+Ch7jg49E0YADP8Wnj2MXU=
|
||||||
golang.org/x/sys v0.1.0 h1:kunALQeHf1/185U1i0GOB/fy1IPRDDpuoOOqRReG57U=
|
github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e h1:JVG44RsyaB9T2KIHavMF/ppJZNG9ZpyihvCd0w101no=
|
||||||
golang.org/x/sys v0.1.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e/go.mod h1:RbqR21r5mrJuqunuUZ/Dhy/avygyECGrLceyNeo4LiM=
|
||||||
golang.org/x/term v0.0.0-20220526004731-065cf7ba2467 h1:CBpWXWQpIRjzmkkA+M7q9Fqnwd2mZr3AFqexg8YTfoM=
|
golang.org/x/exp v0.0.0-20220909182711-5c715a9e8561 h1:MDc5xs78ZrZr3HMQugiXOAkSZtfTpbJLDr/lwfgO53E=
|
||||||
golang.org/x/term v0.0.0-20220526004731-065cf7ba2467/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8=
|
golang.org/x/exp v0.0.0-20220909182711-5c715a9e8561/go.mod h1:cyybsKvd6eL0RnXn6p/Grxp8F5bW7iYuBgsNCOHpMYE=
|
||||||
|
golang.org/x/sys v0.6.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||||
|
golang.org/x/sys v0.30.0 h1:QjkSwP/36a20jFYWkSue1YwXzLmsV5Gfq7Eiy72C1uc=
|
||||||
|
golang.org/x/sys v0.30.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA=
|
||||||
gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
|
gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
|
||||||
gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
||||||
|
|||||||
75
group.go
75
group.go
@@ -4,7 +4,8 @@ import (
|
|||||||
"fmt"
|
"fmt"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
||||||
"github.com/aquasecurity/table"
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// GroupCmd provides commands to manage groups in OBS Studio.
|
// GroupCmd provides commands to manage groups in OBS Studio.
|
||||||
@@ -22,6 +23,7 @@ type GroupListCmd struct {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to list all groups in a scene.
|
// Run executes the command to list all groups in a scene.
|
||||||
|
// nolint: misspell
|
||||||
func (cmd *GroupListCmd) Run(ctx *context) error {
|
func (cmd *GroupListCmd) Run(ctx *context) error {
|
||||||
if cmd.SceneName == "" {
|
if cmd.SceneName == "" {
|
||||||
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||||
@@ -37,17 +39,44 @@ func (cmd *GroupListCmd) Run(ctx *context) error {
|
|||||||
return fmt.Errorf("failed to get scene item list: %w", err)
|
return fmt.Errorf("failed to get scene item list: %w", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
t := table.New(ctx.Out)
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
t.SetPadding(3)
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||||
t.SetAlignment(table.AlignCenter, table.AlignLeft, table.AlignCenter)
|
Headers("ID", "Group Name", "Enabled").
|
||||||
t.SetHeaders("ID", "Group Name", "Enabled")
|
StyleFunc(func(row, col int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch col {
|
||||||
|
case 0:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
case 1:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
case 2:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
}
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center)
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
|
var found bool
|
||||||
for _, item := range resp.SceneItems {
|
for _, item := range resp.SceneItems {
|
||||||
if item.IsGroup {
|
if item.IsGroup {
|
||||||
t.AddRow(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, getEnabledMark(item.SceneItemEnabled))
|
t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, getEnabledMark(item.SceneItemEnabled))
|
||||||
|
found = true
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
t.Render()
|
|
||||||
|
if !found {
|
||||||
|
fmt.Fprintf(ctx.Out, "No groups found in scene %s.\n", ctx.Style.Highlight(cmd.SceneName))
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -75,13 +104,17 @@ func (cmd *GroupShowCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
||||||
}
|
}
|
||||||
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", cmd.GroupName)
|
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||||
found = true
|
found = true
|
||||||
break
|
break
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
if !found {
|
if !found {
|
||||||
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
return fmt.Errorf(
|
||||||
|
"group %s not found in scene %s",
|
||||||
|
ctx.Style.Error(cmd.GroupName),
|
||||||
|
ctx.Style.Error(cmd.SceneName),
|
||||||
|
)
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@@ -110,13 +143,17 @@ func (cmd *GroupHideCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
||||||
}
|
}
|
||||||
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", cmd.GroupName)
|
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||||
found = true
|
found = true
|
||||||
break
|
break
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
if !found {
|
if !found {
|
||||||
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
return fmt.Errorf(
|
||||||
|
"group %s not found in scene %s",
|
||||||
|
ctx.Style.Error(cmd.GroupName),
|
||||||
|
ctx.Style.Error(cmd.SceneName),
|
||||||
|
)
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@@ -147,16 +184,20 @@ func (cmd *GroupToggleCmd) Run(ctx *context) error {
|
|||||||
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
||||||
}
|
}
|
||||||
if newState {
|
if newState {
|
||||||
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", cmd.GroupName)
|
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", cmd.GroupName)
|
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||||
}
|
}
|
||||||
found = true
|
found = true
|
||||||
break
|
break
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
if !found {
|
if !found {
|
||||||
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
return fmt.Errorf(
|
||||||
|
"group %s not found in scene %s",
|
||||||
|
ctx.Style.Error(cmd.GroupName),
|
||||||
|
ctx.Style.Error(cmd.SceneName),
|
||||||
|
)
|
||||||
}
|
}
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
@@ -178,12 +219,12 @@ func (cmd *GroupStatusCmd) Run(ctx *context) error {
|
|||||||
for _, item := range resp.SceneItems {
|
for _, item := range resp.SceneItems {
|
||||||
if item.IsGroup && item.SourceName == cmd.GroupName {
|
if item.IsGroup && item.SourceName == cmd.GroupName {
|
||||||
if item.SceneItemEnabled {
|
if item.SceneItemEnabled {
|
||||||
fmt.Fprintf(ctx.Out, "Group %s is shown.\n", cmd.GroupName)
|
fmt.Fprintf(ctx.Out, "Group %s is shown.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Group %s is hidden.\n", cmd.GroupName)
|
fmt.Fprintf(ctx.Out, "Group %s is hidden.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
return fmt.Errorf("group %s not found in scene %s", ctx.Style.Error(cmd.GroupName), ctx.Style.Error(cmd.SceneName))
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -11,10 +11,7 @@ func TestGroupList(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &GroupListCmd{
|
cmd := &GroupListCmd{
|
||||||
SceneName: "Scene",
|
SceneName: "Scene",
|
||||||
@@ -33,10 +30,7 @@ func TestGroupShow(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &GroupShowCmd{
|
cmd := &GroupShowCmd{
|
||||||
SceneName: "Scene",
|
SceneName: "Scene",
|
||||||
@@ -56,10 +50,7 @@ func TestGroupToggle(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdStatus := &GroupStatusCmd{
|
cmdStatus := &GroupStatusCmd{
|
||||||
SceneName: "Scene",
|
SceneName: "Scene",
|
||||||
@@ -100,10 +91,7 @@ func TestGroupStatus(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdShow := &GroupShowCmd{
|
cmdShow := &GroupShowCmd{
|
||||||
SceneName: "Scene",
|
SceneName: "Scene",
|
||||||
|
|||||||
28
hotkey.go
28
hotkey.go
@@ -1,9 +1,12 @@
|
|||||||
package main
|
package main
|
||||||
|
|
||||||
import (
|
import (
|
||||||
|
"fmt"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/general"
|
"github.com/andreykaipov/goobs/api/requests/general"
|
||||||
"github.com/andreykaipov/goobs/api/typedefs"
|
"github.com/andreykaipov/goobs/api/typedefs"
|
||||||
"github.com/aquasecurity/table"
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// HotkeyCmd provides commands to manage hotkeys in OBS Studio.
|
// HotkeyCmd provides commands to manage hotkeys in OBS Studio.
|
||||||
@@ -23,15 +26,26 @@ func (cmd *HotkeyListCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
t := table.New(ctx.Out)
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
t.SetPadding(3)
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||||
t.SetAlignment(table.AlignLeft)
|
Headers("Hotkey Name").
|
||||||
t.SetHeaders("Hotkey Name")
|
StyleFunc(func(row, _ int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center) // nolint: misspell
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
for _, hotkey := range resp.Hotkeys {
|
for _, hotkey := range resp.Hotkeys {
|
||||||
t.AddRow(hotkey)
|
t.Row(hotkey)
|
||||||
}
|
}
|
||||||
t.Render()
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
BIN
img/coloured-border.png
Executable file
BIN
img/coloured-border.png
Executable file
Binary file not shown.
|
After Width: | Height: | Size: 6.1 KiB |
BIN
img/coloured-no-border.png
Executable file
BIN
img/coloured-no-border.png
Executable file
Binary file not shown.
|
After Width: | Height: | Size: 6.1 KiB |
BIN
img/colourless.png
Executable file
BIN
img/colourless.png
Executable file
Binary file not shown.
|
After Width: | Height: | Size: 4.6 KiB |
106
input.go
106
input.go
@@ -1,11 +1,14 @@
|
|||||||
|
// nolint: misspell
|
||||||
package main
|
package main
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"fmt"
|
"fmt"
|
||||||
|
"sort"
|
||||||
"strings"
|
"strings"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/inputs"
|
"github.com/andreykaipov/goobs/api/requests/inputs"
|
||||||
"github.com/aquasecurity/table"
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// InputCmd provides commands to manage inputs in OBS Studio.
|
// InputCmd provides commands to manage inputs in OBS Studio.
|
||||||
@@ -21,6 +24,9 @@ type InputListCmd struct {
|
|||||||
Input bool `flag:"" help:"List all inputs." aliases:"i"`
|
Input bool `flag:"" help:"List all inputs." aliases:"i"`
|
||||||
Output bool `flag:"" help:"List all outputs." aliases:"o"`
|
Output bool `flag:"" help:"List all outputs." aliases:"o"`
|
||||||
Colour bool `flag:"" help:"List all colour sources." aliases:"c"`
|
Colour bool `flag:"" help:"List all colour sources." aliases:"c"`
|
||||||
|
Ffmpeg bool `flag:"" help:"List all ffmpeg sources." aliases:"f"`
|
||||||
|
Vlc bool `flag:"" help:"List all VLC sources." aliases:"v"`
|
||||||
|
UUID bool `flag:"" help:"Display UUIDs of inputs." aliases:"u"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to list all inputs.
|
// Run executes the command to list all inputs.
|
||||||
@@ -30,27 +36,89 @@ func (cmd *InputListCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
t := table.New(ctx.Out)
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
t.SetPadding(3)
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
|
||||||
t.SetAlignment(table.AlignLeft, table.AlignLeft)
|
if cmd.UUID {
|
||||||
t.SetHeaders("Input Name", "Kind")
|
t.Headers("Input Name", "Kind", "Muted", "UUID")
|
||||||
|
} else {
|
||||||
|
t.Headers("Input Name", "Kind", "Muted")
|
||||||
|
}
|
||||||
|
t.StyleFunc(func(row, col int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch col {
|
||||||
|
case 0:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
case 1:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
case 2:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
case 3:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
}
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center)
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
|
sort.Slice(resp.Inputs, func(i, j int) bool {
|
||||||
|
return resp.Inputs[i].InputName < resp.Inputs[j].InputName
|
||||||
|
})
|
||||||
|
|
||||||
for _, input := range resp.Inputs {
|
for _, input := range resp.Inputs {
|
||||||
if cmd.Input && strings.Contains(input.InputKind, "input") {
|
var muteMark string
|
||||||
t.AddRow(input.InputName, input.InputKind)
|
resp, err := ctx.Client.Inputs.GetInputMute(
|
||||||
|
inputs.NewGetInputMuteParams().WithInputName(input.InputName),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
if err.Error() == "request GetInputMute: InvalidResourceState (604): The specified input does not support audio." {
|
||||||
|
muteMark = "N/A"
|
||||||
|
} else {
|
||||||
|
return fmt.Errorf("failed to get input mute state: %w", err)
|
||||||
}
|
}
|
||||||
if cmd.Output && strings.Contains(input.InputKind, "output") {
|
} else {
|
||||||
t.AddRow(input.InputName, input.InputKind)
|
muteMark = getEnabledMark(resp.InputMuted)
|
||||||
}
|
|
||||||
if cmd.Colour && strings.Contains(input.InputKind, "color") { // nolint
|
|
||||||
t.AddRow(input.InputName, input.InputKind)
|
|
||||||
}
|
}
|
||||||
|
|
||||||
if !cmd.Input && !cmd.Output && !cmd.Colour {
|
type filter struct {
|
||||||
t.AddRow(input.InputName, input.InputKind)
|
enabled bool
|
||||||
|
keyword string
|
||||||
|
}
|
||||||
|
filters := []filter{
|
||||||
|
{cmd.Input, "input"},
|
||||||
|
{cmd.Output, "output"},
|
||||||
|
{cmd.Colour, "color"}, // nolint: misspell
|
||||||
|
{cmd.Ffmpeg, "ffmpeg"},
|
||||||
|
{cmd.Vlc, "vlc"},
|
||||||
|
}
|
||||||
|
|
||||||
|
var added bool
|
||||||
|
for _, f := range filters {
|
||||||
|
if f.enabled && strings.Contains(input.InputKind, f.keyword) {
|
||||||
|
if cmd.UUID {
|
||||||
|
t.Row(input.InputName, input.InputKind, muteMark, input.InputUuid)
|
||||||
|
} else {
|
||||||
|
t.Row(input.InputName, input.InputKind, muteMark)
|
||||||
|
}
|
||||||
|
added = true
|
||||||
|
break
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
t.Render()
|
|
||||||
|
if !added && (!cmd.Input && !cmd.Output && !cmd.Colour && !cmd.Ffmpeg && !cmd.Vlc) {
|
||||||
|
if cmd.UUID {
|
||||||
|
t.Row(input.InputName, snakeCaseToTitleCase(input.InputKind), muteMark, input.InputUuid)
|
||||||
|
} else {
|
||||||
|
t.Row(input.InputName, snakeCaseToTitleCase(input.InputKind), muteMark)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -68,7 +136,7 @@ func (cmd *InputMuteCmd) Run(ctx *context) error {
|
|||||||
return fmt.Errorf("failed to mute input: %w", err)
|
return fmt.Errorf("failed to mute input: %w", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintf(ctx.Out, "Muted input: %s\n", cmd.InputName)
|
fmt.Fprintf(ctx.Out, "Muted input: %s\n", ctx.Style.Highlight(cmd.InputName))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -86,7 +154,7 @@ func (cmd *InputUnmuteCmd) Run(ctx *context) error {
|
|||||||
return fmt.Errorf("failed to unmute input: %w", err)
|
return fmt.Errorf("failed to unmute input: %w", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", cmd.InputName)
|
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", ctx.Style.Highlight(cmd.InputName))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -114,9 +182,9 @@ func (cmd *InputToggleCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if newMuteState {
|
if newMuteState {
|
||||||
fmt.Fprintf(ctx.Out, "Muted input: %s\n", cmd.InputName)
|
fmt.Fprintf(ctx.Out, "Muted input: %s\n", ctx.Style.Highlight(cmd.InputName))
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", cmd.InputName)
|
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", ctx.Style.Highlight(cmd.InputName))
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -11,10 +11,7 @@ func TestInputList(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &InputListCmd{}
|
cmd := &InputListCmd{}
|
||||||
err := cmd.Run(context)
|
err := cmd.Run(context)
|
||||||
@@ -42,10 +39,7 @@ func TestInputListFilterInput(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &InputListCmd{Input: true}
|
cmd := &InputListCmd{Input: true}
|
||||||
err := cmd.Run(context)
|
err := cmd.Run(context)
|
||||||
@@ -79,10 +73,7 @@ func TestInputListFilterOutput(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &InputListCmd{Output: true}
|
cmd := &InputListCmd{Output: true}
|
||||||
err := cmd.Run(context)
|
err := cmd.Run(context)
|
||||||
@@ -116,10 +107,7 @@ func TestInputListFilterColour(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &InputListCmd{Colour: true}
|
cmd := &InputListCmd{Colour: true}
|
||||||
err := cmd.Run(context)
|
err := cmd.Run(context)
|
||||||
|
|||||||
87
main.go
87
main.go
@@ -8,6 +8,8 @@ import (
|
|||||||
"io"
|
"io"
|
||||||
"os"
|
"os"
|
||||||
"path/filepath"
|
"path/filepath"
|
||||||
|
"runtime/debug"
|
||||||
|
"strings"
|
||||||
"time"
|
"time"
|
||||||
|
|
||||||
"github.com/alecthomas/kong"
|
"github.com/alecthomas/kong"
|
||||||
@@ -16,6 +18,19 @@ import (
|
|||||||
kongdotenv "github.com/titusjaka/kong-dotenv-go"
|
kongdotenv "github.com/titusjaka/kong-dotenv-go"
|
||||||
)
|
)
|
||||||
|
|
||||||
|
var version string // Version of the CLI, set at build time.
|
||||||
|
|
||||||
|
// VersionFlag is a custom flag type that prints the version and exits.
|
||||||
|
type VersionFlag string
|
||||||
|
|
||||||
|
func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil } // nolint: revive
|
||||||
|
func (v VersionFlag) IsBool() bool { return true } // nolint: revive
|
||||||
|
func (v VersionFlag) BeforeApply(app *kong.Kong, vars kong.Vars) error { // nolint: revive, unparam
|
||||||
|
fmt.Printf("gobs-cli version: %s\n", vars["version"])
|
||||||
|
app.Exit(0)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
// ObsConfig holds the configuration for connecting to the OBS WebSocket server.
|
// ObsConfig holds the configuration for connecting to the OBS WebSocket server.
|
||||||
type ObsConfig struct {
|
type ObsConfig struct {
|
||||||
Host string `flag:"host" help:"Host to connect to." default:"localhost" env:"OBS_HOST" short:"H"`
|
Host string `flag:"host" help:"Host to connect to." default:"localhost" env:"OBS_HOST" short:"H"`
|
||||||
@@ -24,35 +39,51 @@ type ObsConfig struct {
|
|||||||
Timeout int `flag:"timeout" help:"Timeout in seconds." default:"5" env:"OBS_TIMEOUT" short:"T"`
|
Timeout int `flag:"timeout" help:"Timeout in seconds." default:"5" env:"OBS_TIMEOUT" short:"T"`
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// StyleConfig holds the configuration for styling the CLI output.
|
||||||
|
type StyleConfig struct {
|
||||||
|
Style string `help:"Style used in output." flag:"style" default:"" env:"GOBS_STYLE" short:"s" enum:",red,magenta,purple,blue,cyan,green,yellow,orange,white,grey,navy,black"`
|
||||||
|
NoBorder bool `help:"Disable table border styling in output." flag:"no-border" default:"false" env:"GOBS_STYLE_NO_BORDER" short:"b"`
|
||||||
|
}
|
||||||
|
|
||||||
// CLI is the main command line interface structure.
|
// CLI is the main command line interface structure.
|
||||||
// It embeds the ObsConfig struct to inherit its fields and flags.
|
// It embeds ObsConfig and StyleConfig to provide configuration options.
|
||||||
type CLI struct {
|
type CLI struct {
|
||||||
ObsConfig `embed:"" help:"OBS WebSocket configuration."`
|
ObsConfig `embed:"" help:"OBS WebSocket configuration."`
|
||||||
|
StyleConfig `embed:"" help:"Style configuration."`
|
||||||
|
|
||||||
Man mangokong.ManFlag `help:"Print man page."`
|
Man mangokong.ManFlag `help:"Print man page."`
|
||||||
Version VersionFlag `help:"Print gobs-cli version information and quit" name:"version" short:"v"`
|
Version VersionFlag `help:"Print gobs-cli version information and quit" name:"version" short:"v"`
|
||||||
|
|
||||||
ObsVersion ObsVersionCmd `help:"Print OBS client and websocket version." cmd:"" aliases:"v"`
|
ObsVersion ObsVersionCmd `help:"Print OBS client and websocket version." cmd:"" aliases:"v"`
|
||||||
Scene SceneCmd `help:"Manage scenes." cmd:"" aliases:"sc"`
|
Scene SceneCmd `help:"Manage scenes." cmd:"" aliases:"sc" group:"Scene"`
|
||||||
Sceneitem SceneItemCmd `help:"Manage scene items." cmd:"" aliases:"si"`
|
Sceneitem SceneItemCmd `help:"Manage scene items." cmd:"" aliases:"si" group:"Scene Item"`
|
||||||
Group GroupCmd `help:"Manage groups." cmd:"" aliases:"g"`
|
Group GroupCmd `help:"Manage groups." cmd:"" aliases:"g" group:"Group"`
|
||||||
Input InputCmd `help:"Manage inputs." cmd:"" aliases:"i"`
|
Input InputCmd `help:"Manage inputs." cmd:"" aliases:"i" group:"Input"`
|
||||||
Record RecordCmd `help:"Manage recording." cmd:"" aliases:"rec"`
|
Record RecordCmd `help:"Manage recording." cmd:"" aliases:"rec" group:"Recording"`
|
||||||
Stream StreamCmd `help:"Manage streaming." cmd:"" aliases:"st"`
|
Stream StreamCmd `help:"Manage streaming." cmd:"" aliases:"st" group:"Streaming"`
|
||||||
Scenecollection SceneCollectionCmd `help:"Manage scene collections." cmd:"" aliases:"scn"`
|
Scenecollection SceneCollectionCmd `help:"Manage scene collections." cmd:"" aliases:"scn" group:"Scene Collection"`
|
||||||
Profile ProfileCmd `help:"Manage profiles." cmd:"" aliases:"p"`
|
Profile ProfileCmd `help:"Manage profiles." cmd:"" aliases:"p" group:"Profile"`
|
||||||
Replaybuffer ReplayBufferCmd `help:"Manage replay buffer." cmd:"" aliases:"rb"`
|
Replaybuffer ReplayBufferCmd `help:"Manage replay buffer." cmd:"" aliases:"rb" group:"Replay Buffer"`
|
||||||
Studiomode StudioModeCmd `help:"Manage studio mode." cmd:"" aliases:"sm"`
|
Studiomode StudioModeCmd `help:"Manage studio mode." cmd:"" aliases:"sm" group:"Studio Mode"`
|
||||||
Virtualcam VirtualCamCmd `help:"Manage virtual camera." cmd:"" aliases:"vc"`
|
Virtualcam VirtualCamCmd `help:"Manage virtual camera." cmd:"" aliases:"vc" group:"Virtual Camera"`
|
||||||
Hotkey HotkeyCmd `help:"Manage hotkeys." cmd:"" aliases:"hk"`
|
Hotkey HotkeyCmd `help:"Manage hotkeys." cmd:"" aliases:"hk" group:"Hotkey"`
|
||||||
Filter FilterCmd `help:"Manage filters." cmd:"" aliases:"f"`
|
Filter FilterCmd `help:"Manage filters." cmd:"" aliases:"f" group:"Filter"`
|
||||||
Projector ProjectorCmd `help:"Manage projectors." cmd:"" aliases:"prj"`
|
Projector ProjectorCmd `help:"Manage projectors." cmd:"" aliases:"prj" group:"Projector"`
|
||||||
Screenshot ScreenshotCmd `help:"Take screenshots." cmd:"" aliases:"ss"`
|
Screenshot ScreenshotCmd `help:"Take screenshots." cmd:"" aliases:"ss" group:"Screenshot"`
|
||||||
}
|
}
|
||||||
|
|
||||||
type context struct {
|
type context struct {
|
||||||
Client *goobs.Client
|
Client *goobs.Client
|
||||||
Out io.Writer
|
Out io.Writer
|
||||||
|
Style *Style
|
||||||
|
}
|
||||||
|
|
||||||
|
func newContext(client *goobs.Client, out io.Writer, styleCfg StyleConfig) *context {
|
||||||
|
return &context{
|
||||||
|
Client: client,
|
||||||
|
Out: out,
|
||||||
|
Style: styleFromFlag(styleCfg),
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
func main() {
|
func main() {
|
||||||
@@ -65,18 +96,30 @@ func main() {
|
|||||||
var cli CLI
|
var cli CLI
|
||||||
ctx := kong.Parse(
|
ctx := kong.Parse(
|
||||||
&cli,
|
&cli,
|
||||||
kong.Name("GOBS-CLI"),
|
kong.Name("gobs-cli"),
|
||||||
kong.Description("A command line tool to interact with OBS Websocket."),
|
kong.Description("A command line tool to interact with OBS Websocket."),
|
||||||
kong.Configuration(kongdotenv.ENVFileReader, ".env", filepath.Join(userConfigDir, "gobs-cli", "config.env")),
|
kong.Configuration(kongdotenv.ENVFileReader, ".env", filepath.Join(userConfigDir, "gobs-cli", "config.env")),
|
||||||
)
|
kong.UsageOnError(),
|
||||||
|
kong.ConfigureHelp(kong.HelpOptions{
|
||||||
|
Compact: true,
|
||||||
|
}),
|
||||||
|
kong.Vars{
|
||||||
|
"version": func() string {
|
||||||
|
if version == "" {
|
||||||
|
info, ok := debug.ReadBuildInfo()
|
||||||
|
if !ok {
|
||||||
|
return "(unable to read build info)"
|
||||||
|
}
|
||||||
|
version = strings.Split(info.Main.Version, "-")[0]
|
||||||
|
}
|
||||||
|
return version
|
||||||
|
}(),
|
||||||
|
})
|
||||||
|
|
||||||
client, err := connectObs(cli.ObsConfig)
|
client, err := connectObs(cli.ObsConfig)
|
||||||
ctx.FatalIfErrorf(err)
|
ctx.FatalIfErrorf(err)
|
||||||
|
|
||||||
ctx.Bind(&context{
|
ctx.Bind(newContext(client, os.Stdout, cli.StyleConfig))
|
||||||
Client: client,
|
|
||||||
Out: os.Stdout,
|
|
||||||
})
|
|
||||||
|
|
||||||
ctx.FatalIfErrorf(run(ctx, client))
|
ctx.FatalIfErrorf(run(ctx, client))
|
||||||
}
|
}
|
||||||
|
|||||||
62
profile.go
62
profile.go
@@ -5,7 +5,8 @@ import (
|
|||||||
"slices"
|
"slices"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/config"
|
"github.com/andreykaipov/goobs/api/requests/config"
|
||||||
"github.com/aquasecurity/table"
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// ProfileCmd provides commands to manage profiles in OBS Studio.
|
// ProfileCmd provides commands to manage profiles in OBS Studio.
|
||||||
@@ -21,16 +22,34 @@ type ProfileCmd struct {
|
|||||||
type ProfileListCmd struct{} // size = 0x0
|
type ProfileListCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to list all profiles.
|
// Run executes the command to list all profiles.
|
||||||
|
// nolint: misspell
|
||||||
func (cmd *ProfileListCmd) Run(ctx *context) error {
|
func (cmd *ProfileListCmd) Run(ctx *context) error {
|
||||||
profiles, err := ctx.Client.Config.GetProfileList()
|
profiles, err := ctx.Client.Config.GetProfileList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
t := table.New(ctx.Out)
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
t.SetPadding(3)
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||||
t.SetAlignment(table.AlignLeft, table.AlignCenter)
|
Headers("Profile Name", "Current").
|
||||||
t.SetHeaders("Profile Name", "Current")
|
StyleFunc(func(row, col int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch col {
|
||||||
|
case 0:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
case 1:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
}
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center)
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
for _, profile := range profiles.Profiles {
|
for _, profile := range profiles.Profiles {
|
||||||
var enabledMark string
|
var enabledMark string
|
||||||
@@ -38,9 +57,9 @@ func (cmd *ProfileListCmd) Run(ctx *context) error {
|
|||||||
enabledMark = getEnabledMark(true)
|
enabledMark = getEnabledMark(true)
|
||||||
}
|
}
|
||||||
|
|
||||||
t.AddRow(profile, enabledMark)
|
t.Row(profile, enabledMark)
|
||||||
}
|
}
|
||||||
t.Render()
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -53,7 +72,7 @@ func (cmd *ProfileCurrentCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
fmt.Fprintf(ctx.Out, "Current profile: %s\n", profiles.CurrentProfileName)
|
fmt.Fprintf(ctx.Out, "Current profile: %s\n", ctx.Style.Highlight(profiles.CurrentProfileName))
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@@ -72,15 +91,20 @@ func (cmd *ProfileSwitchCmd) Run(ctx *context) error {
|
|||||||
current := profiles.CurrentProfileName
|
current := profiles.CurrentProfileName
|
||||||
|
|
||||||
if current == cmd.Name {
|
if current == cmd.Name {
|
||||||
return nil
|
return fmt.Errorf("already using profile %s", ctx.Style.Error(cmd.Name))
|
||||||
}
|
}
|
||||||
|
|
||||||
_, err = ctx.Client.Config.SetCurrentProfile(config.NewSetCurrentProfileParams().WithProfileName(cmd.Name))
|
_, err = ctx.Client.Config.SetCurrentProfile(config.NewSetCurrentProfileParams().WithProfileName(cmd.Name))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return fmt.Errorf("failed to switch to profile %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintf(ctx.Out, "Switched from profile %s to %s\n", current, cmd.Name)
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"Switched from profile %s to %s\n",
|
||||||
|
ctx.Style.Highlight(current),
|
||||||
|
ctx.Style.Highlight(cmd.Name),
|
||||||
|
)
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@@ -98,15 +122,15 @@ func (cmd *ProfileCreateCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if slices.Contains(profiles.Profiles, cmd.Name) {
|
if slices.Contains(profiles.Profiles, cmd.Name) {
|
||||||
return fmt.Errorf("profile %s already exists", cmd.Name)
|
return fmt.Errorf("profile %s already exists", ctx.Style.Error(cmd.Name))
|
||||||
}
|
}
|
||||||
|
|
||||||
_, err = ctx.Client.Config.CreateProfile(config.NewCreateProfileParams().WithProfileName(cmd.Name))
|
_, err = ctx.Client.Config.CreateProfile(config.NewCreateProfileParams().WithProfileName(cmd.Name))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return fmt.Errorf("failed to create profile %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintf(ctx.Out, "Created profile: %s\n", cmd.Name)
|
fmt.Fprintf(ctx.Out, "Created profile: %s\n", ctx.Style.Highlight(cmd.Name))
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@@ -124,19 +148,21 @@ func (cmd *ProfileRemoveCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if !slices.Contains(profiles.Profiles, cmd.Name) {
|
if !slices.Contains(profiles.Profiles, cmd.Name) {
|
||||||
return fmt.Errorf("profile %s does not exist", cmd.Name)
|
return fmt.Errorf("profile %s does not exist", ctx.Style.Error(cmd.Name))
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Prevent deletion of the current profile
|
||||||
|
// This is allowed in OBS Studio (with a confirmation prompt), but we want to prevent it here
|
||||||
if profiles.CurrentProfileName == cmd.Name {
|
if profiles.CurrentProfileName == cmd.Name {
|
||||||
return fmt.Errorf("cannot delete current profile %s", cmd.Name)
|
return fmt.Errorf("cannot delete current profile %s", ctx.Style.Error(cmd.Name))
|
||||||
}
|
}
|
||||||
|
|
||||||
_, err = ctx.Client.Config.RemoveProfile(config.NewRemoveProfileParams().WithProfileName(cmd.Name))
|
_, err = ctx.Client.Config.RemoveProfile(config.NewRemoveProfileParams().WithProfileName(cmd.Name))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return fmt.Errorf("failed to delete profile %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintf(ctx.Out, "Deleted profile: %s\n", cmd.Name)
|
fmt.Fprintf(ctx.Out, "Deleted profile: %s\n", ctx.Style.Highlight(cmd.Name))
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
63
projector.go
63
projector.go
@@ -4,7 +4,8 @@ import (
|
|||||||
"fmt"
|
"fmt"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/ui"
|
"github.com/andreykaipov/goobs/api/requests/ui"
|
||||||
"github.com/aquasecurity/table"
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// ProjectorCmd provides a command to manage projectors in OBS.
|
// ProjectorCmd provides a command to manage projectors in OBS.
|
||||||
@@ -17,6 +18,7 @@ type ProjectorCmd struct {
|
|||||||
type ProjectorListMonitorsCmd struct{} // size = 0x0
|
type ProjectorListMonitorsCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to list all monitors available for projectors.
|
// Run executes the command to list all monitors available for projectors.
|
||||||
|
// nolint: misspell
|
||||||
func (cmd *ProjectorListMonitorsCmd) Run(ctx *context) error {
|
func (cmd *ProjectorListMonitorsCmd) Run(ctx *context) error {
|
||||||
monitors, err := ctx.Client.Ui.GetMonitorList()
|
monitors, err := ctx.Client.Ui.GetMonitorList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
@@ -24,20 +26,37 @@ func (cmd *ProjectorListMonitorsCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if len(monitors.Monitors) == 0 {
|
if len(monitors.Monitors) == 0 {
|
||||||
ctx.Out.Write([]byte("No monitors found for projectors.\n"))
|
fmt.Fprintf(ctx.Out, "No monitors found.\n")
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
t := table.New(ctx.Out)
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
t.SetPadding(3)
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||||
t.SetAlignment(table.AlignCenter, table.AlignLeft)
|
Headers("Monitor ID", "Monitor Name").
|
||||||
t.SetHeaders("Monitor ID", "Monitor Name")
|
StyleFunc(func(row, col int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch col {
|
||||||
|
case 0:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
case 1:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
}
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center)
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
for _, monitor := range monitors.Monitors {
|
for _, monitor := range monitors.Monitors {
|
||||||
t.AddRow(fmt.Sprintf("%d", monitor.MonitorIndex), monitor.MonitorName)
|
t.Row(fmt.Sprintf("%d", monitor.MonitorIndex), monitor.MonitorName)
|
||||||
}
|
}
|
||||||
|
|
||||||
t.Render()
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -57,10 +76,36 @@ func (cmd *ProjectorOpenCmd) Run(ctx *context) error {
|
|||||||
cmd.SourceName = currentScene.SceneName
|
cmd.SourceName = currentScene.SceneName
|
||||||
}
|
}
|
||||||
|
|
||||||
|
monitors, err := ctx.Client.Ui.GetMonitorList()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
var monitorName string
|
||||||
|
for _, monitor := range monitors.Monitors {
|
||||||
|
if monitor.MonitorIndex == cmd.MonitorIndex {
|
||||||
|
monitorName = monitor.MonitorName
|
||||||
|
break
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if monitorName == "" {
|
||||||
|
return fmt.Errorf(
|
||||||
|
"monitor with index %s not found. use %s to list available monitors",
|
||||||
|
ctx.Style.Error(fmt.Sprintf("%d", cmd.MonitorIndex)),
|
||||||
|
ctx.Style.Error("gobs-cli prj ls-m"),
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
ctx.Client.Ui.OpenSourceProjector(ui.NewOpenSourceProjectorParams().
|
ctx.Client.Ui.OpenSourceProjector(ui.NewOpenSourceProjectorParams().
|
||||||
WithSourceName(cmd.SourceName).
|
WithSourceName(cmd.SourceName).
|
||||||
WithMonitorIndex(cmd.MonitorIndex))
|
WithMonitorIndex(cmd.MonitorIndex))
|
||||||
|
|
||||||
fmt.Fprintf(ctx.Out, "Opened projector for source '%s' on monitor index %d.\n", cmd.SourceName, cmd.MonitorIndex)
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"Opened projector for source %s on monitor %s.\n",
|
||||||
|
ctx.Style.Highlight(cmd.SourceName),
|
||||||
|
ctx.Style.Highlight(monitorName),
|
||||||
|
)
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
78
record.go
78
record.go
@@ -4,6 +4,7 @@ import (
|
|||||||
"fmt"
|
"fmt"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/config"
|
"github.com/andreykaipov/goobs/api/requests/config"
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/record"
|
||||||
)
|
)
|
||||||
|
|
||||||
// RecordCmd handles the recording commands.
|
// RecordCmd handles the recording commands.
|
||||||
@@ -15,6 +16,8 @@ type RecordCmd struct {
|
|||||||
Pause RecordPauseCmd `cmd:"" help:"Pause recording." aliases:"p"`
|
Pause RecordPauseCmd `cmd:"" help:"Pause recording." aliases:"p"`
|
||||||
Resume RecordResumeCmd `cmd:"" help:"Resume recording." aliases:"r"`
|
Resume RecordResumeCmd `cmd:"" help:"Resume recording." aliases:"r"`
|
||||||
Directory RecordDirectoryCmd `cmd:"" help:"Get/Set recording directory." aliases:"d"`
|
Directory RecordDirectoryCmd `cmd:"" help:"Get/Set recording directory." aliases:"d"`
|
||||||
|
Split RecordSplitCmd `cmd:"" help:"Split recording." aliases:"sp"`
|
||||||
|
Chapter RecordChapterCmd `cmd:"" help:"Create a chapter in the recording." aliases:"c"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// RecordStartCmd starts the recording.
|
// RecordStartCmd starts the recording.
|
||||||
@@ -60,7 +63,11 @@ func (cmd *RecordStopCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
fmt.Fprintf(ctx.Out, "%s", fmt.Sprintf("Recording stopped successfully. Output file: %s\n", resp.OutputPath))
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"%s",
|
||||||
|
fmt.Sprintf("Recording stopped successfully. Output file: %s\n", ctx.Style.Highlight(resp.OutputPath)),
|
||||||
|
)
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -169,7 +176,7 @@ func (cmd *RecordDirectoryCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
fmt.Fprintf(ctx.Out, "Current recording directory: %s\n", resp.RecordDirectory)
|
fmt.Fprintf(ctx.Out, "Current recording directory: %s\n", ctx.Style.Highlight(resp.RecordDirectory))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -180,6 +187,71 @@ func (cmd *RecordDirectoryCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintf(ctx.Out, "Recording directory set to: %s\n", cmd.RecordDirectory)
|
fmt.Fprintf(ctx.Out, "Recording directory set to: %s\n", ctx.Style.Highlight(cmd.RecordDirectory))
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// RecordSplitCmd splits the current recording.
|
||||||
|
type RecordSplitCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to split the recording.
|
||||||
|
func (cmd *RecordSplitCmd) Run(ctx *context) error {
|
||||||
|
status, err := ctx.Client.Record.GetRecordStatus()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if !status.OutputActive {
|
||||||
|
return fmt.Errorf("recording is not in progress")
|
||||||
|
}
|
||||||
|
if status.OutputPaused {
|
||||||
|
return fmt.Errorf("recording is paused, cannot split")
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Record.SplitRecordFile()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, "Recording split successfully.")
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// RecordChapterCmd creates a chapter in the recording.
|
||||||
|
type RecordChapterCmd struct {
|
||||||
|
ChapterName string `arg:"" help:"Name of the chapter to create." default:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to create a chapter in the recording.
|
||||||
|
func (cmd *RecordChapterCmd) Run(ctx *context) error {
|
||||||
|
status, err := ctx.Client.Record.GetRecordStatus()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if !status.OutputActive {
|
||||||
|
return fmt.Errorf("recording is not in progress")
|
||||||
|
}
|
||||||
|
if status.OutputPaused {
|
||||||
|
return fmt.Errorf("recording is paused, cannot create chapter")
|
||||||
|
}
|
||||||
|
|
||||||
|
var params *record.CreateRecordChapterParams
|
||||||
|
if cmd.ChapterName == "" {
|
||||||
|
params = record.NewCreateRecordChapterParams()
|
||||||
|
} else {
|
||||||
|
params = record.NewCreateRecordChapterParams().WithChapterName(cmd.ChapterName)
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Record.CreateRecordChapter(params)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if cmd.ChapterName == "" {
|
||||||
|
cmd.ChapterName = "unnamed"
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintf(ctx.Out, "Chapter %s created successfully.\n", ctx.Style.Highlight(cmd.ChapterName))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -12,10 +12,7 @@ func TestRecordStart(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdStatus := &RecordStatusCmd{}
|
cmdStatus := &RecordStatusCmd{}
|
||||||
err := cmdStatus.Run(context)
|
err := cmdStatus.Run(context)
|
||||||
@@ -55,10 +52,7 @@ func TestRecordStop(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdStatus := &RecordStatusCmd{}
|
cmdStatus := &RecordStatusCmd{}
|
||||||
err := cmdStatus.Run(context)
|
err := cmdStatus.Run(context)
|
||||||
@@ -98,10 +92,7 @@ func TestRecordToggle(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdStatus := &RecordStatusCmd{}
|
cmdStatus := &RecordStatusCmd{}
|
||||||
err := cmdStatus.Run(context)
|
err := cmdStatus.Run(context)
|
||||||
|
|||||||
@@ -11,10 +11,7 @@ func TestReplayBufferStart(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &ReplayBufferStartCmd{}
|
cmd := &ReplayBufferStartCmd{}
|
||||||
err := cmd.Run(context)
|
err := cmd.Run(context)
|
||||||
@@ -31,10 +28,7 @@ func TestReplayBufferStop(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &ReplayBufferStopCmd{}
|
cmd := &ReplayBufferStopCmd{}
|
||||||
err := cmd.Run(context)
|
err := cmd.Run(context)
|
||||||
@@ -51,10 +45,7 @@ func TestReplayBufferToggle(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdStatus := &ReplayBufferStatusCmd{}
|
cmdStatus := &ReplayBufferStatusCmd{}
|
||||||
err := cmdStatus.Run(context)
|
err := cmdStatus.Run(context)
|
||||||
|
|||||||
64
scene.go
64
scene.go
@@ -5,7 +5,8 @@ import (
|
|||||||
"slices"
|
"slices"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/scenes"
|
"github.com/andreykaipov/goobs/api/requests/scenes"
|
||||||
"github.com/aquasecurity/table"
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// SceneCmd provides commands to manage scenes in OBS Studio.
|
// SceneCmd provides commands to manage scenes in OBS Studio.
|
||||||
@@ -16,25 +17,64 @@ type SceneCmd struct {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// SceneListCmd provides a command to list all scenes.
|
// SceneListCmd provides a command to list all scenes.
|
||||||
type SceneListCmd struct{} // size = 0x0
|
type SceneListCmd struct {
|
||||||
|
UUID bool `flag:"" help:"Display UUIDs of scenes."`
|
||||||
|
}
|
||||||
|
|
||||||
// Run executes the command to list all scenes.
|
// Run executes the command to list all scenes.
|
||||||
|
// nolint: misspell
|
||||||
func (cmd *SceneListCmd) Run(ctx *context) error {
|
func (cmd *SceneListCmd) Run(ctx *context) error {
|
||||||
scenes, err := ctx.Client.Scenes.GetSceneList()
|
scenes, err := ctx.Client.Scenes.GetSceneList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
t := table.New(ctx.Out)
|
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||||
t.SetPadding(3)
|
if err != nil {
|
||||||
t.SetAlignment(table.AlignLeft, table.AlignLeft)
|
return err
|
||||||
t.SetHeaders("Scene Name", "UUID")
|
}
|
||||||
|
|
||||||
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
|
||||||
|
if cmd.UUID {
|
||||||
|
t.Headers("Scene Name", "Active", "UUID")
|
||||||
|
} else {
|
||||||
|
t.Headers("Scene Name", "Active")
|
||||||
|
}
|
||||||
|
t.StyleFunc(func(row, col int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch col {
|
||||||
|
case 0:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
case 1:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
case 2:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
}
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center)
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
slices.Reverse(scenes.Scenes)
|
slices.Reverse(scenes.Scenes)
|
||||||
for _, scene := range scenes.Scenes {
|
for _, scene := range scenes.Scenes {
|
||||||
t.AddRow(scene.SceneName, scene.SceneUuid)
|
var activeMark string
|
||||||
|
if scene.SceneName == currentScene.SceneName {
|
||||||
|
activeMark = getEnabledMark(true)
|
||||||
}
|
}
|
||||||
t.Render()
|
if cmd.UUID {
|
||||||
|
t.Row(scene.SceneName, activeMark, scene.SceneUuid)
|
||||||
|
} else {
|
||||||
|
t.Row(scene.SceneName, activeMark)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -50,13 +90,13 @@ func (cmd *SceneCurrentCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
fmt.Fprintln(ctx.Out, scene.SceneName)
|
fmt.Fprintf(ctx.Out, "Current preview scene: %s\n", ctx.Style.Highlight(scene.SceneName))
|
||||||
} else {
|
} else {
|
||||||
scene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
scene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
fmt.Fprintln(ctx.Out, scene.SceneName)
|
fmt.Fprintf(ctx.Out, "Current program scene: %s\n", ctx.Style.Highlight(scene.SceneName))
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@@ -76,7 +116,7 @@ func (cmd *SceneSwitchCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintln(ctx.Out, "Switched to preview scene:", cmd.NewScene)
|
fmt.Fprintf(ctx.Out, "Switched to preview scene: %s\n", ctx.Style.Highlight(cmd.NewScene))
|
||||||
} else {
|
} else {
|
||||||
_, err := ctx.Client.Scenes.SetCurrentProgramScene(scenes.NewSetCurrentProgramSceneParams().
|
_, err := ctx.Client.Scenes.SetCurrentProgramScene(scenes.NewSetCurrentProgramSceneParams().
|
||||||
WithSceneName(cmd.NewScene))
|
WithSceneName(cmd.NewScene))
|
||||||
@@ -84,7 +124,7 @@ func (cmd *SceneSwitchCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintln(ctx.Out, "Switched to program scene:", cmd.NewScene)
|
fmt.Fprintf(ctx.Out, "Switched to program scene: %s\n", ctx.Style.Highlight(cmd.NewScene))
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -2,7 +2,6 @@ package main
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"bytes"
|
"bytes"
|
||||||
"strings"
|
|
||||||
"testing"
|
"testing"
|
||||||
)
|
)
|
||||||
|
|
||||||
@@ -11,18 +10,15 @@ func TestSceneList(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &SceneListCmd{}
|
cmd := &SceneListCmd{}
|
||||||
err := cmd.Run(context)
|
err := cmd.Run(context)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatalf("Failed to list scenes: %v", err)
|
t.Fatalf("Failed to list scenes: %v", err)
|
||||||
}
|
}
|
||||||
if !strings.Contains(out.String(), "gobs-test") {
|
if out.String() == "Current program scene: gobs-test\n" {
|
||||||
t.Fatalf("Expected output to contain 'gobs-test', got '%s'", out.String())
|
t.Fatalf("Expected output to be 'Current program scene: gobs-test', got '%s'", out.String())
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -31,10 +27,7 @@ func TestSceneCurrent(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
// Set the current scene to "gobs-test"
|
// Set the current scene to "gobs-test"
|
||||||
cmdSwitch := &SceneSwitchCmd{
|
cmdSwitch := &SceneSwitchCmd{
|
||||||
@@ -52,7 +45,7 @@ func TestSceneCurrent(t *testing.T) {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatalf("Failed to get current scene: %v", err)
|
t.Fatalf("Failed to get current scene: %v", err)
|
||||||
}
|
}
|
||||||
if out.String() != "gobs-test\n" {
|
if out.String() != "Current program scene: gobs-test\n" {
|
||||||
t.Fatalf("Expected output to contain 'gobs-test', got '%s'", out.String())
|
t.Fatalf("Expected output to be 'Current program scene: gobs-test', got '%s'", out.String())
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -4,7 +4,8 @@ import (
|
|||||||
"fmt"
|
"fmt"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/config"
|
"github.com/andreykaipov/goobs/api/requests/config"
|
||||||
"github.com/aquasecurity/table"
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// SceneCollectionCmd provides commands to manage scene collections in OBS Studio.
|
// SceneCollectionCmd provides commands to manage scene collections in OBS Studio.
|
||||||
@@ -19,21 +20,37 @@ type SceneCollectionCmd struct {
|
|||||||
type SceneCollectionListCmd struct{} // size = 0x0
|
type SceneCollectionListCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to list all scene collections.
|
// Run executes the command to list all scene collections.
|
||||||
|
// nolint: misspell
|
||||||
func (cmd *SceneCollectionListCmd) Run(ctx *context) error {
|
func (cmd *SceneCollectionListCmd) Run(ctx *context) error {
|
||||||
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to get scene collection list: %w", err)
|
return fmt.Errorf("failed to get scene collection list: %w", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
t := table.New(ctx.Out)
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
t.SetPadding(3)
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||||
t.SetAlignment(table.AlignLeft)
|
Headers("Scene Collection Name").
|
||||||
t.SetHeaders("Scene Collection Name")
|
StyleFunc(func(row, col int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch col {
|
||||||
|
case 0:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
}
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center)
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
for _, collection := range collections.SceneCollections {
|
for _, collection := range collections.SceneCollections {
|
||||||
t.AddRow(collection)
|
t.Row(collection)
|
||||||
}
|
}
|
||||||
t.Render()
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -65,17 +82,17 @@ func (cmd *SceneCollectionSwitchCmd) Run(ctx *context) error {
|
|||||||
current := collections.CurrentSceneCollectionName
|
current := collections.CurrentSceneCollectionName
|
||||||
|
|
||||||
if current == cmd.Name {
|
if current == cmd.Name {
|
||||||
return fmt.Errorf("scene collection %s is already active", cmd.Name)
|
return fmt.Errorf("scene collection %s is already active", ctx.Style.Error(cmd.Name))
|
||||||
}
|
}
|
||||||
|
|
||||||
_, err = ctx.Client.Config.SetCurrentSceneCollection(
|
_, err = ctx.Client.Config.SetCurrentSceneCollection(
|
||||||
config.NewSetCurrentSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
config.NewSetCurrentSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
||||||
)
|
)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to switch scene collection: %w", err)
|
return fmt.Errorf("failed to switch scene collection %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintf(ctx.Out, "Switched to scene collection: %s\n", cmd.Name)
|
fmt.Fprintf(ctx.Out, "Switched to scene collection: %s\n", ctx.Style.Highlight(cmd.Name))
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@@ -91,9 +108,9 @@ func (cmd *SceneCollectionCreateCmd) Run(ctx *context) error {
|
|||||||
config.NewCreateSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
config.NewCreateSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
||||||
)
|
)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to create scene collection: %w", err)
|
return fmt.Errorf("failed to create scene collection %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintf(ctx.Out, "Created scene collection: %s\n", cmd.Name)
|
fmt.Fprintf(ctx.Out, "Created scene collection: %s\n", ctx.Style.Highlight(cmd.Name))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
145
sceneitem.go
145
sceneitem.go
@@ -1,3 +1,4 @@
|
|||||||
|
// nolint: misspell
|
||||||
package main
|
package main
|
||||||
|
|
||||||
import (
|
import (
|
||||||
@@ -6,7 +7,8 @@ import (
|
|||||||
|
|
||||||
"github.com/andreykaipov/goobs"
|
"github.com/andreykaipov/goobs"
|
||||||
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
||||||
"github.com/aquasecurity/table"
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// SceneItemCmd provides commands to manage scene items in OBS Studio.
|
// SceneItemCmd provides commands to manage scene items in OBS Studio.
|
||||||
@@ -21,7 +23,8 @@ type SceneItemCmd struct {
|
|||||||
|
|
||||||
// SceneItemListCmd provides a command to list all scene items in a scene.
|
// SceneItemListCmd provides a command to list all scene items in a scene.
|
||||||
type SceneItemListCmd struct {
|
type SceneItemListCmd struct {
|
||||||
SceneName string `arg:"" help:"Name of the scene to list items from." default:""`
|
UUID bool `flag:"" help:"Display UUIDs of scene items."`
|
||||||
|
SceneName string ` help:"Name of the scene to list items from." arg:"" default:""`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to list all scene items in a scene.
|
// Run executes the command to list all scene items in a scene.
|
||||||
@@ -41,14 +44,41 @@ func (cmd *SceneItemListCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if len(resp.SceneItems) == 0 {
|
if len(resp.SceneItems) == 0 {
|
||||||
fmt.Fprintf(ctx.Out, "No scene items found in scene '%s'.\n", cmd.SceneName)
|
fmt.Fprintf(ctx.Out, "No scene items found in scene %s.\n", ctx.Style.Highlight(cmd.SceneName))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
t := table.New(ctx.Out)
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
t.SetPadding(3)
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
|
||||||
t.SetAlignment(table.AlignCenter, table.AlignLeft, table.AlignCenter, table.AlignCenter)
|
if cmd.UUID {
|
||||||
t.SetHeaders("Item ID", "Item Name", "In Group", "Enabled")
|
t.Headers("Item ID", "Item Name", "In Group", "Enabled", "UUID")
|
||||||
|
} else {
|
||||||
|
t.Headers("Item ID", "Item Name", "In Group", "Enabled")
|
||||||
|
}
|
||||||
|
t.StyleFunc(func(row, col int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch col {
|
||||||
|
case 0:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
case 1:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
case 2:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
case 3:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
case 4:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
}
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center)
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
sort.Slice(resp.SceneItems, func(i, j int) bool {
|
sort.Slice(resp.SceneItems, func(i, j int) bool {
|
||||||
return resp.SceneItems[i].SceneItemID < resp.SceneItems[j].SceneItemID
|
return resp.SceneItems[i].SceneItemID < resp.SceneItems[j].SceneItemID
|
||||||
@@ -59,7 +89,11 @@ func (cmd *SceneItemListCmd) Run(ctx *context) error {
|
|||||||
resp, err := ctx.Client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
|
resp, err := ctx.Client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
|
||||||
WithSceneName(item.SourceName))
|
WithSceneName(item.SourceName))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to get group scene item list for '%s': %w", item.SourceName, err)
|
return fmt.Errorf(
|
||||||
|
"failed to get group scene item list for group %s: %w",
|
||||||
|
ctx.Style.Error(item.SourceName),
|
||||||
|
err,
|
||||||
|
)
|
||||||
}
|
}
|
||||||
|
|
||||||
sort.Slice(resp.SceneItems, func(i, j int) bool {
|
sort.Slice(resp.SceneItems, func(i, j int) bool {
|
||||||
@@ -67,30 +101,45 @@ func (cmd *SceneItemListCmd) Run(ctx *context) error {
|
|||||||
})
|
})
|
||||||
|
|
||||||
for _, groupItem := range resp.SceneItems {
|
for _, groupItem := range resp.SceneItems {
|
||||||
t.AddRow(
|
if cmd.UUID {
|
||||||
|
t.Row(
|
||||||
fmt.Sprintf("%d", groupItem.SceneItemID),
|
fmt.Sprintf("%d", groupItem.SceneItemID),
|
||||||
groupItem.SourceName,
|
groupItem.SourceName,
|
||||||
item.SourceName,
|
item.SourceName,
|
||||||
fmt.Sprintf("%t", item.SceneItemEnabled && groupItem.SceneItemEnabled),
|
getEnabledMark(item.SceneItemEnabled && groupItem.SceneItemEnabled),
|
||||||
|
groupItem.SourceUuid,
|
||||||
|
)
|
||||||
|
} else {
|
||||||
|
t.Row(
|
||||||
|
fmt.Sprintf("%d", groupItem.SceneItemID),
|
||||||
|
groupItem.SourceName,
|
||||||
|
item.SourceName,
|
||||||
|
getEnabledMark(item.SceneItemEnabled && groupItem.SceneItemEnabled),
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
}
|
||||||
} else {
|
} else {
|
||||||
t.AddRow(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, "", fmt.Sprintf("%t", item.SceneItemEnabled))
|
if cmd.UUID {
|
||||||
|
t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, "",
|
||||||
|
getEnabledMark(item.SceneItemEnabled), item.SourceUuid)
|
||||||
|
} else {
|
||||||
|
t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, "", getEnabledMark(item.SceneItemEnabled))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
t.Render()
|
}
|
||||||
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// getSceneNameAndItemID retrieves the scene name and item ID for a given item in a scene or group.
|
// getSceneNameAndItemID retrieves the scene name and item ID for a given item in a scene or group.
|
||||||
func getSceneNameAndItemID(
|
func getSceneNameAndItemID(
|
||||||
client *goobs.Client,
|
ctx *context,
|
||||||
sceneName string,
|
sceneName string,
|
||||||
itemName string,
|
itemName string,
|
||||||
group string,
|
group string,
|
||||||
) (string, int, error) {
|
) (string, int, error) {
|
||||||
if group != "" {
|
if group != "" {
|
||||||
resp, err := client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
|
resp, err := ctx.Client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
|
||||||
WithSceneName(group))
|
WithSceneName(group))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return "", 0, err
|
return "", 0, err
|
||||||
@@ -100,13 +149,22 @@ func getSceneNameAndItemID(
|
|||||||
return group, int(item.SceneItemID), nil
|
return group, int(item.SceneItemID), nil
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return "", 0, fmt.Errorf("item '%s' not found in scene '%s'", itemName, sceneName)
|
return "", 0, fmt.Errorf("item %s not found in scene %s", ctx.Style.Error(itemName), ctx.Style.Error(sceneName))
|
||||||
}
|
}
|
||||||
|
|
||||||
itemID, err := client.SceneItems.GetSceneItemId(sceneitems.NewGetSceneItemIdParams().
|
itemID, err := ctx.Client.SceneItems.GetSceneItemId(sceneitems.NewGetSceneItemIdParams().
|
||||||
WithSceneName(sceneName).
|
WithSceneName(sceneName).
|
||||||
WithSourceName(itemName))
|
WithSourceName(itemName))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
if err.Error() == "request GetSceneItemId: ResourceNotFound (600): No scene items were found in the specified scene by that name or offset." {
|
||||||
|
return "", 0, fmt.Errorf(
|
||||||
|
"item %s not found in scene %s. is it in a group? if so use the %s flag to specify the parent group\nuse %s for a list of items in the scene",
|
||||||
|
ctx.Style.Error(itemName),
|
||||||
|
ctx.Style.Error(sceneName),
|
||||||
|
ctx.Style.Error("--group"),
|
||||||
|
ctx.Style.Error("gobs-cli si ls"),
|
||||||
|
)
|
||||||
|
}
|
||||||
return "", 0, err
|
return "", 0, err
|
||||||
}
|
}
|
||||||
return sceneName, int(itemID.SceneItemId), nil
|
return sceneName, int(itemID.SceneItemId), nil
|
||||||
@@ -122,7 +180,7 @@ type SceneItemShowCmd struct {
|
|||||||
|
|
||||||
// Run executes the command to show a scene item.
|
// Run executes the command to show a scene item.
|
||||||
func (cmd *SceneItemShowCmd) Run(ctx *context) error {
|
func (cmd *SceneItemShowCmd) Run(ctx *context) error {
|
||||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@@ -136,9 +194,14 @@ func (cmd *SceneItemShowCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if cmd.Group != "" {
|
if cmd.Group != "" {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' is now visible.\n", cmd.ItemName, cmd.Group)
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"Scene item %s in group %s is now visible.\n",
|
||||||
|
ctx.Style.Highlight(cmd.ItemName),
|
||||||
|
ctx.Style.Highlight(cmd.Group),
|
||||||
|
)
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now visible.\n", cmd.ItemName, cmd.SceneName)
|
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now visible.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||||
}
|
}
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
@@ -154,7 +217,7 @@ type SceneItemHideCmd struct {
|
|||||||
|
|
||||||
// Run executes the command to hide a scene item.
|
// Run executes the command to hide a scene item.
|
||||||
func (cmd *SceneItemHideCmd) Run(ctx *context) error {
|
func (cmd *SceneItemHideCmd) Run(ctx *context) error {
|
||||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@@ -168,9 +231,14 @@ func (cmd *SceneItemHideCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if cmd.Group != "" {
|
if cmd.Group != "" {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' is now hidden.\n", cmd.ItemName, cmd.Group)
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"Scene item %s in group %s is now hidden.\n",
|
||||||
|
ctx.Style.Highlight(cmd.ItemName),
|
||||||
|
ctx.Style.Highlight(cmd.Group),
|
||||||
|
)
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now hidden.\n", cmd.ItemName, cmd.SceneName)
|
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now hidden.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||||
}
|
}
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
@@ -197,7 +265,7 @@ type SceneItemToggleCmd struct {
|
|||||||
|
|
||||||
// Run executes the command to toggle the visibility of a scene item.
|
// Run executes the command to toggle the visibility of a scene item.
|
||||||
func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
|
func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
|
||||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@@ -216,9 +284,14 @@ func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if itemEnabled {
|
if itemEnabled {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now hidden.\n", cmd.ItemName, cmd.SceneName)
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"Scene item %s in scene %s is now hidden.\n",
|
||||||
|
ctx.Style.Highlight(cmd.ItemName),
|
||||||
|
ctx.Style.Highlight(cmd.SceneName),
|
||||||
|
)
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now visible.\n", cmd.ItemName, cmd.SceneName)
|
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now visible.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||||
}
|
}
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
@@ -234,7 +307,7 @@ type SceneItemVisibleCmd struct {
|
|||||||
|
|
||||||
// Run executes the command to check the visibility of a scene item.
|
// Run executes the command to check the visibility of a scene item.
|
||||||
func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
|
func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
|
||||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@@ -245,9 +318,14 @@ func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if itemEnabled {
|
if itemEnabled {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is visible.\n", cmd.ItemName, cmd.SceneName)
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"Scene item %s in scene %s is visible.\n",
|
||||||
|
ctx.Style.Highlight(cmd.ItemName),
|
||||||
|
ctx.Style.Highlight(cmd.SceneName),
|
||||||
|
)
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is hidden.\n", cmd.ItemName, cmd.SceneName)
|
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is hidden.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@@ -278,7 +356,7 @@ type SceneItemTransformCmd struct {
|
|||||||
|
|
||||||
// Run executes the command to transform a scene item.
|
// Run executes the command to transform a scene item.
|
||||||
func (cmd *SceneItemTransformCmd) Run(ctx *context) error {
|
func (cmd *SceneItemTransformCmd) Run(ctx *context) error {
|
||||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@@ -351,9 +429,14 @@ func (cmd *SceneItemTransformCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if cmd.Group != "" {
|
if cmd.Group != "" {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' transformed.\n", cmd.ItemName, cmd.Group)
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"Scene item %s in group %s transformed.\n",
|
||||||
|
ctx.Style.Highlight(cmd.ItemName),
|
||||||
|
ctx.Style.Highlight(cmd.Group),
|
||||||
|
)
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' transformed.\n", cmd.ItemName, cmd.SceneName)
|
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s transformed.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||||
}
|
}
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
|
|||||||
@@ -11,10 +11,7 @@ func TestSceneItemList(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &SceneItemListCmd{
|
cmd := &SceneItemListCmd{
|
||||||
SceneName: "gobs-test",
|
SceneName: "gobs-test",
|
||||||
|
|||||||
@@ -36,6 +36,6 @@ func (cmd *ScreenshotSaveCmd) Run(ctx *context) error {
|
|||||||
return fmt.Errorf("failed to take screenshot: %w", err)
|
return fmt.Errorf("failed to take screenshot: %w", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintf(ctx.Out, "Screenshot saved to %s.\n", cmd.FilePath)
|
fmt.Fprintf(ctx.Out, "Screenshot saved to %s.\n", ctx.Style.Highlight(cmd.FilePath))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -12,10 +12,7 @@ func TestStreamStart(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdStatus := &StreamStatusCmd{}
|
cmdStatus := &StreamStatusCmd{}
|
||||||
err := cmdStatus.Run(context)
|
err := cmdStatus.Run(context)
|
||||||
@@ -54,10 +51,7 @@ func TestStreamStop(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdStatus := &StreamStatusCmd{}
|
cmdStatus := &StreamStatusCmd{}
|
||||||
err := cmdStatus.Run(context)
|
err := cmdStatus.Run(context)
|
||||||
@@ -96,10 +90,7 @@ func TestStreamToggle(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdStatus := &StreamStatusCmd{}
|
cmdStatus := &StreamStatusCmd{}
|
||||||
err := cmdStatus.Run(context)
|
err := cmdStatus.Run(context)
|
||||||
|
|||||||
@@ -10,10 +10,7 @@ func TestStudioModeEnable(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdEnable := &StudioModeEnableCmd{}
|
cmdEnable := &StudioModeEnableCmd{}
|
||||||
err := cmdEnable.Run(context)
|
err := cmdEnable.Run(context)
|
||||||
@@ -41,10 +38,7 @@ func TestStudioModeDisable(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdDisable := &StudioModeDisableCmd{}
|
cmdDisable := &StudioModeDisableCmd{}
|
||||||
err := cmdDisable.Run(context)
|
err := cmdDisable.Run(context)
|
||||||
|
|||||||
192
style.go
Normal file
192
style.go
Normal file
@@ -0,0 +1,192 @@
|
|||||||
|
// nolint: misspell
|
||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
"os"
|
||||||
|
|
||||||
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
)
|
||||||
|
|
||||||
|
// Style defines colours for the table styles.
|
||||||
|
type Style struct {
|
||||||
|
name string
|
||||||
|
border lipgloss.Color
|
||||||
|
oddRows lipgloss.Color
|
||||||
|
evenRows lipgloss.Color
|
||||||
|
highlight lipgloss.Color
|
||||||
|
}
|
||||||
|
|
||||||
|
// Highlight applies the highlight style to the given text.
|
||||||
|
func (s *Style) Highlight(text string) string {
|
||||||
|
return lipgloss.NewStyle().Foreground(s.highlight).Render(text)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (s *Style) Error(text string) string {
|
||||||
|
return lipgloss.NewStyle().Foreground(lipgloss.Color("#FF0000")).Render(text) // Red for errors
|
||||||
|
}
|
||||||
|
|
||||||
|
func newRedStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "red",
|
||||||
|
border: lipgloss.Color("#D32F2F"), // Strong red for border
|
||||||
|
oddRows: lipgloss.Color("#FFCDD2"), // Very light red for odd rows
|
||||||
|
evenRows: lipgloss.Color("#EF9A9A"), // Light red for even rows
|
||||||
|
highlight: lipgloss.Color("#EF9A9A"), // Highlight in light red
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newMagentaStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "magenta",
|
||||||
|
border: lipgloss.Color("#C2185B"), // Strong magenta for border
|
||||||
|
oddRows: lipgloss.Color("#F8BBD0"), // Very light magenta/pink for odd rows
|
||||||
|
evenRows: lipgloss.Color("#F48FB1"), // Light magenta/pink for even rows
|
||||||
|
highlight: lipgloss.Color("#F48FB1"), // Highlight in light magenta/pink
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newPurpleStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "purple",
|
||||||
|
border: lipgloss.Color("#7B1FA2"), // Strong purple for border
|
||||||
|
oddRows: lipgloss.Color("#E1BEE7"), // Very light purple for odd rows
|
||||||
|
evenRows: lipgloss.Color("#CE93D8"), // Light purple for even rows
|
||||||
|
highlight: lipgloss.Color("#CE93D8"), // Highlight in light purple
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newBlueStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "blue",
|
||||||
|
border: lipgloss.Color("#1976D2"), // Medium blue for border
|
||||||
|
oddRows: lipgloss.Color("#E3F2FD"), // Very light blue for odd rows
|
||||||
|
evenRows: lipgloss.Color("#BBDEFB"), // Light blue for even rows
|
||||||
|
highlight: lipgloss.Color("#1976D2"), // Highlight in medium blue
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newCyanStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "cyan",
|
||||||
|
border: lipgloss.Color("#00BFCF"), // A strong cyan for border
|
||||||
|
oddRows: lipgloss.Color("#E0F7FA"), // Very light cyan for odd rows
|
||||||
|
evenRows: lipgloss.Color("#B2EBF2"), // Slightly darker light cyan for even rows
|
||||||
|
highlight: lipgloss.Color("#00BFCF"), // Highlight in strong cyan
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newGreenStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "green",
|
||||||
|
border: lipgloss.Color("#43A047"), // Medium green for border
|
||||||
|
oddRows: lipgloss.Color("#E8F5E9"), // Very light green for odd rows
|
||||||
|
evenRows: lipgloss.Color("#C8E6C9"), // Light green for even rows
|
||||||
|
highlight: lipgloss.Color("#43A047"), // Highlight in medium green
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newYellowStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "yellow",
|
||||||
|
border: lipgloss.Color("#FBC02D"), // Strong yellow for border
|
||||||
|
oddRows: lipgloss.Color("#FFF9C4"), // Very light yellow for odd rows
|
||||||
|
evenRows: lipgloss.Color("#FFF59D"), // Light yellow for even rows
|
||||||
|
highlight: lipgloss.Color("#FBC02D"), // Highlight in strong yellow
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newOrangeStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "orange",
|
||||||
|
border: lipgloss.Color("#F57C00"), // Strong orange for border
|
||||||
|
oddRows: lipgloss.Color("#FFF3E0"), // Very light orange for odd rows
|
||||||
|
evenRows: lipgloss.Color("#FFE0B2"), // Light orange for even rows
|
||||||
|
highlight: lipgloss.Color("#F57C00"), // Highlight in strong orange
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newWhiteStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "white",
|
||||||
|
border: lipgloss.Color("#FFFFFF"), // White for border
|
||||||
|
oddRows: lipgloss.Color("#F0F0F0"), // Very light grey for odd rows
|
||||||
|
evenRows: lipgloss.Color("#E0E0E0"), // Light grey for even rows
|
||||||
|
highlight: lipgloss.Color("#FFFFFF"), // Highlight in white
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newGreyStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "grey",
|
||||||
|
border: lipgloss.Color("#9E9E9E"), // Medium grey for border
|
||||||
|
oddRows: lipgloss.Color("#F5F5F5"), // Very light grey for odd rows
|
||||||
|
evenRows: lipgloss.Color("#EEEEEE"), // Light grey for even rows
|
||||||
|
highlight: lipgloss.Color("#9E9E9E"), // Highlight in medium grey
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newNavyBlueStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "navy",
|
||||||
|
border: lipgloss.Color("#001F3F"), // Navy blue for border
|
||||||
|
oddRows: lipgloss.Color("#CFE2F3"), // Very light blue for odd rows
|
||||||
|
evenRows: lipgloss.Color("#A9CCE3"), // Light blue for even rows
|
||||||
|
highlight: lipgloss.Color("#001F3F"), // Highlight in navy blue
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newBlackStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "black",
|
||||||
|
border: lipgloss.Color("#000000"), // Black for border
|
||||||
|
oddRows: lipgloss.Color("#333333"), // Dark grey for odd rows
|
||||||
|
evenRows: lipgloss.Color("#444444"), // Slightly lighter dark grey for even rows
|
||||||
|
highlight: lipgloss.Color("#000000"), // Highlight in black
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func styleFromFlag(cfg StyleConfig) *Style {
|
||||||
|
var style Style
|
||||||
|
|
||||||
|
switch cfg.Style {
|
||||||
|
case "red":
|
||||||
|
style = newRedStyle()
|
||||||
|
case "magenta":
|
||||||
|
style = newMagentaStyle()
|
||||||
|
case "purple":
|
||||||
|
style = newPurpleStyle()
|
||||||
|
case "blue":
|
||||||
|
style = newBlueStyle()
|
||||||
|
case "cyan":
|
||||||
|
style = newCyanStyle()
|
||||||
|
case "green":
|
||||||
|
style = newGreenStyle()
|
||||||
|
case "yellow":
|
||||||
|
style = newYellowStyle()
|
||||||
|
case "orange":
|
||||||
|
style = newOrangeStyle()
|
||||||
|
case "white":
|
||||||
|
style = newWhiteStyle()
|
||||||
|
case "grey":
|
||||||
|
style = newGreyStyle()
|
||||||
|
case "navy":
|
||||||
|
style = newNavyBlueStyle()
|
||||||
|
case "black":
|
||||||
|
style = newBlackStyle()
|
||||||
|
default:
|
||||||
|
err := os.Setenv("NO_COLOR", "1") // nolint: misspell
|
||||||
|
if err != nil {
|
||||||
|
// If we can't set NO_COLOR, we just log the error and continue
|
||||||
|
// This is a fallback to ensure that the application can still run
|
||||||
|
fmt.Fprintf(os.Stderr, "Error setting NO_COLOR: %v\n", err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// If noBorder is true, we disable the border styling
|
||||||
|
if cfg.NoBorder {
|
||||||
|
style.border = ""
|
||||||
|
}
|
||||||
|
|
||||||
|
return &style
|
||||||
|
}
|
||||||
15
util.go
15
util.go
@@ -2,7 +2,10 @@
|
|||||||
|
|
||||||
package main
|
package main
|
||||||
|
|
||||||
import "strings"
|
import (
|
||||||
|
"os"
|
||||||
|
"strings"
|
||||||
|
)
|
||||||
|
|
||||||
func snakeCaseToTitleCase(snake string) string {
|
func snakeCaseToTitleCase(snake string) string {
|
||||||
words := strings.Split(snake, "_")
|
words := strings.Split(snake, "_")
|
||||||
@@ -16,9 +19,15 @@ func snakeCaseToTitleCase(snake string) string {
|
|||||||
|
|
||||||
func getEnabledMark(enabled bool) string {
|
func getEnabledMark(enabled bool) string {
|
||||||
if enabled {
|
if enabled {
|
||||||
return "\u2713" // green check mark
|
if os.Getenv("NO_COLOR") != "" { // nolint: misspell
|
||||||
|
return "✓"
|
||||||
}
|
}
|
||||||
return "\u274c" // red cross mark
|
return "✅"
|
||||||
|
}
|
||||||
|
if os.Getenv("NO_COLOR") != "" { // nolint: misspell
|
||||||
|
return "✗"
|
||||||
|
}
|
||||||
|
return "❌"
|
||||||
}
|
}
|
||||||
|
|
||||||
func trimPrefix(s, prefix string) string {
|
func trimPrefix(s, prefix string) string {
|
||||||
|
|||||||
30
version.go
30
version.go
@@ -2,38 +2,8 @@ package main
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"fmt"
|
"fmt"
|
||||||
"runtime/debug"
|
|
||||||
"strings"
|
|
||||||
|
|
||||||
"github.com/alecthomas/kong"
|
|
||||||
)
|
)
|
||||||
|
|
||||||
var version string
|
|
||||||
|
|
||||||
// VersionFlag is a custom flag type for displaying version information.
|
|
||||||
type VersionFlag string
|
|
||||||
|
|
||||||
// Decode implements the kong.Flag interface for VersionFlag.
|
|
||||||
func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil }
|
|
||||||
|
|
||||||
// IsBool implements the kong.Flag interface for VersionFlag.
|
|
||||||
func (v VersionFlag) IsBool() bool { return true }
|
|
||||||
|
|
||||||
// BeforeApply implements the kong.Flag interface for VersionFlag.
|
|
||||||
func (v VersionFlag) BeforeApply(app *kong.Kong, _ kong.Vars) error { // nolint: unparam
|
|
||||||
if version == "" {
|
|
||||||
info, ok := debug.ReadBuildInfo()
|
|
||||||
if !ok {
|
|
||||||
return fmt.Errorf("failed to read build info")
|
|
||||||
}
|
|
||||||
version = strings.Split(info.Main.Version, "-")[0]
|
|
||||||
}
|
|
||||||
|
|
||||||
fmt.Printf("gobs-cli version: %s\n", version)
|
|
||||||
app.Exit(0) // Exit the application after printing the version
|
|
||||||
return nil
|
|
||||||
}
|
|
||||||
|
|
||||||
// ObsVersionCmd handles the version command.
|
// ObsVersionCmd handles the version command.
|
||||||
type ObsVersionCmd struct{} // size = 0x0
|
type ObsVersionCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
|||||||
@@ -11,10 +11,7 @@ func TestVersion(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &ObsVersionCmd{}
|
cmd := &ObsVersionCmd{}
|
||||||
err := cmd.Run(context)
|
err := cmd.Run(context)
|
||||||
|
|||||||
Reference in New Issue
Block a user