add 0.15.0 to CHANGELOG

add input kind-defaults

CHANGELOG.md

@@ -5,11 +5,35 @@ All notable changes to this project will be documented in this file.
 The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
 and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
 
+# [0.15.0] - 2026-01-26
+
+### Added
+
+-   new subcommands added to input, see [InputCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#inputcmd)
+
+# [0.14.1] - 2025-07-14
+
+### Added
+
+-   text command group, see [TextCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#textcmd)
+
+# [0.13.3] - 2025-06-27
+
+### Changed
+
+-   usage is now printed on errors.
+-   help is printed in compact mode. This should make it easier to page through help on the root command.
+
+### Fixed
+
+-   Item ID alignment in sceneitem list table.
+
 # [0.13.0] - 2025-06-23
 
 ### Added
 
 -   record split and record chapter commands, see [RecordCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#recordcmd)
+    -   As of OBS 30.2.0, the only file format supporting *record chapter* is Hybrid MP4.
 
 # [0.12.1] - 2025-06-21
 

README.md

@@ -4,6 +4,16 @@ A command line interface for OBS Websocket v5
 
 For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)
 
+-----
+
+## Table of Contents
+
+- [Installation](#installation)
+- [Configuration](#configuration)
+- [Style](#style)
+- [Commands](#commands)
+- [License](#license)
+
 ## Installation
 
 ```console
@@ -40,6 +50,36 @@ OBS_PASSWORD=<websocket password>
 OBS_TIMEOUT=5
 ```
 
+## Style
+
+Styling is opt-in, by default you will get a colourless output:
+
+![colourless](./img/colourless.png)
+
+You may enable styling with the --style/-s flag:
+
+```console
+gobs-cli --style="red" sceneitem list
+```
+
+Available styles: _red, magenta, purple, blue, cyan, green, yellow, orange, white, grey, navy, black_
+
+![coloured](./img/coloured-border.png)
+
+Optionally you may disable border colouring with the --no-border flag:
+
+![coloured-no-border](./img/coloured-no-border.png)
+
+```console
+gobs-cli --style="red" --no-border sceneitem list
+```
+
+Or with environment variables:
+
+```env
+GOBS_STYLE=red
+GOBS_STYLE_NO_BORDER=true
+```
 
 ## Commands
 
@@ -224,6 +264,20 @@ gobs-cli group status START "test_group"
 
 ### InputCmd
 
+-   create: Create input.
+    -   args: Name Kind
+
+```console
+gobs-cli input create 'stream mix' 'wasapi_input_capture'
+```
+
+-   remove: Remove input.
+    -   args: Name
+
+```console
+gobs-cli input remove 'stream mix'
+```
+
 -   list: List all inputs.
     -   flags:
 
@@ -241,6 +295,12 @@ gobs-cli input list
 gobs-cli input list --input --colour
 ```
 
+-   list-kinds: List input kinds.
+
+```console
+gobs-cli input list-kinds
+```
+
 -   mute: Mute input.
     -   args: InputName
 
@@ -262,6 +322,50 @@ gobs-cli input unmute "Mic/Aux"
 gobs-cli input toggle "Mic/Aux"
 ```
 
+-   volume: Set input volume.
+    -   args: InputName Volume
+
+```console
+gobs-cli input volume -- 'Mic/Aux' -30.6
+```
+
+-   show: Show input details.
+    -   args: Name
+    -   flags:
+
+        *optional*
+        -   --verbose: List all available input devices.
+
+-   update: Update input settings.
+    -   args: InputName DeviceName
+
+```console
+gobs-cli input update 'Mic/Aux' 'Voicemeeter Out B1 (VB-Audio Voicemeeter VAIO)'
+```
+
+-   kind-defaults: Get default settings for an input kind.
+    -   args: Kind
+
+```console
+gobs-cli input kind-defaults 'wasapi_input_capture'
+```
+
+### TextCmd
+
+-   current: Display current text for a text input.
+    -   args: InputName
+
+```console
+gobs-cli text current "My Text Input"
+```
+
+-   update: Update the text of a text input.
+    -   args: InputName NewText
+
+```console
+gobs-cli text update "My Text Input" "hi OBS!"
+```
+
 ### RecordCmd
 
 -   start: Start recording.
@@ -621,33 +725,9 @@ gobs-cli projector open --monitor-index=1 "test_group"
 gobs-cli screenshot save --width=2560 --height=1440 "Scene" "C:\Users\me\Videos\screenshot.png"
 ```
 
-## Style
+## License
 
-By default styling is disabled but you may enable and configure it in the following ways:
-
--   --style/-s: Style used in output.
-    -  GOBS_STYLE
--   --no-border/-b: Disable table border styling in output.
-    -   GOBS_STYLE_NO_BORDER
-
-Available styles:
-
-- red
-- magenta
-- purple
-- blue
-- cyan
-- green
-- yellow
-- orange
-- white
-- grey
-- navy
-- black
-
-```console
-gobs-cli --style=cyan --no-border scene list
-```
+`gobs-cli` is distributed under the terms of the [MIT](https://spdx.org/licenses/MIT.html) license.
 
 
 [userconfigdir]: https://pkg.go.dev/os#UserConfigDir

input.go

@@ -3,6 +3,7 @@ package main
 
 import (
 	"fmt"
+	"maps"
 	"sort"
 	"strings"
 
@@ -13,10 +14,63 @@ import (
 
 // InputCmd provides commands to manage inputs in OBS Studio.
 type InputCmd struct {
-	List   InputListCmd   `cmd:"" help:"List all inputs." aliases:"ls"`
-	Mute   InputMuteCmd   `cmd:"" help:"Mute input."      aliases:"m"`
-	Unmute InputUnmuteCmd `cmd:"" help:"Unmute input."    aliases:"um"`
-	Toggle InputToggleCmd `cmd:"" help:"Toggle input."    aliases:"tg"`
+	Create       InputCreateCmd       `cmd:"" help:"Create input."                           aliases:"c"`
+	Remove       InputRemoveCmd       `cmd:"" help:"Remove input."                           aliases:"d"`
+	List         InputListCmd         `cmd:"" help:"List all inputs."                        aliases:"ls"`
+	ListKinds    InputListKindsCmd    `cmd:"" help:"List input kinds."                       aliases:"k"`
+	Mute         InputMuteCmd         `cmd:"" help:"Mute input."                             aliases:"m"`
+	Unmute       InputUnmuteCmd       `cmd:"" help:"Unmute input."                           aliases:"um"`
+	Toggle       InputToggleCmd       `cmd:"" help:"Toggle input."                           aliases:"tg"`
+	Volume       InputVolumeCmd       `cmd:"" help:"Set input volume."                       aliases:"v"`
+	Show         InputShowCmd         `cmd:"" help:"Show input details."                     aliases:"s"`
+	Update       InputUpdateCmd       `cmd:"" help:"Update input settings."                  aliases:"up"`
+	KindDefaults InputKindDefaultsCmd `cmd:"" help:"Get default settings for an input kind." aliases:"df"`
+}
+
+// InputCreateCmd provides a command to create an input.
+type InputCreateCmd struct {
+	Name string `arg:"" help:"Name for the input."                                          required:""`
+	Kind string `arg:"" help:"Input kind (e.g., coreaudio_input_capture, macos-avcapture)." required:""`
+}
+
+// Run executes the command to create an input.
+func (cmd *InputCreateCmd) Run(ctx *context) error {
+	currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
+	if err != nil {
+		return err
+	}
+
+	_, err = ctx.Client.Inputs.CreateInput(
+		inputs.NewCreateInputParams().
+			WithInputKind(cmd.Kind).
+			WithInputName(cmd.Name).
+			WithSceneName(currentScene.CurrentProgramSceneName),
+	)
+	if err != nil {
+		return err
+	}
+
+	fmt.Fprintf(ctx.Out, "Created input: %s (%s) in scene %s\n",
+		ctx.Style.Highlight(cmd.Name), cmd.Kind, ctx.Style.Highlight(currentScene.CurrentProgramSceneName))
+	return nil
+}
+
+// InputRemoveCmd provides a command to remove an input.
+type InputRemoveCmd struct {
+	Name string `arg:"" help:"Name of the input to remove." required:""`
+}
+
+// Run executes the command to remove an input.
+func (cmd *InputRemoveCmd) Run(ctx *context) error {
+	_, err := ctx.Client.Inputs.RemoveInput(
+		inputs.NewRemoveInputParams().WithInputName(cmd.Name),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to delete input: %w", err)
+	}
+
+	fmt.Fprintf(ctx.Out, "Deleted %s\n", ctx.Style.Highlight(cmd.Name))
+	return nil
 }
 
 // InputListCmd provides a command to list all inputs.
@@ -122,6 +176,47 @@ func (cmd *InputListCmd) Run(ctx *context) error {
 	return nil
 }
 
+// InputListKindsCmd provides a command to list all input kinds.
+type InputListKindsCmd struct{}
+
+// Run executes the command to list all input kinds.
+func (cmd *InputListKindsCmd) Run(ctx *context) error {
+	resp, err := ctx.Client.Inputs.GetInputKindList(
+		inputs.NewGetInputKindListParams().WithUnversioned(false),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to get input kinds: %w", err)
+	}
+
+	t := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
+	t.Headers("Kind")
+	t.StyleFunc(func(row, col int) lipgloss.Style {
+		style := lipgloss.NewStyle().Padding(0, 3)
+		switch col {
+		case 0:
+			style = style.Align(lipgloss.Left)
+		}
+		switch {
+		case row == table.HeaderRow:
+			style = style.Bold(true).Align(lipgloss.Center)
+		case row%2 == 0:
+			style = style.Foreground(ctx.Style.evenRows)
+		default:
+			style = style.Foreground(ctx.Style.oddRows)
+		}
+		return style
+	})
+
+	for _, kind := range resp.InputKinds {
+		t.Row(kind)
+	}
+
+	fmt.Fprintln(ctx.Out, t.Render())
+
+	return nil
+}
+
 // InputMuteCmd provides a command to mute an input.
 type InputMuteCmd struct {
 	InputName string `arg:"" help:"Name of the input to mute."`
@@ -188,3 +283,273 @@ func (cmd *InputToggleCmd) Run(ctx *context) error {
 	}
 	return nil
 }
+
+// InputVolumeCmd provides a command to set the volume of an input.
+type InputVolumeCmd struct {
+	InputName string  `arg:"" help:"Name of the input to set volume for." required:""`
+	Volume    float64 `arg:"" help:"Volume level (-90.0 to 0.0)."         required:""`
+}
+
+// Run executes the command to set the volume of an input.
+// accepts values between -90.0 and 0.0 representing decibels (dB).
+func (cmd *InputVolumeCmd) Run(ctx *context) error {
+	if cmd.Volume < -90.0 || cmd.Volume > 0.0 {
+		return fmt.Errorf("volume must be between -90.0 and 0.0 dB")
+	}
+
+	_, err := ctx.Client.Inputs.SetInputVolume(
+		inputs.NewSetInputVolumeParams().
+			WithInputName(cmd.InputName).
+			WithInputVolumeDb(cmd.Volume),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to set input volume: %w", err)
+	}
+
+	fmt.Fprintf(ctx.Out, "Set volume of input %s to %.1f dB\n",
+		ctx.Style.Highlight(cmd.InputName), cmd.Volume)
+	return nil
+}
+
+// InputShowCmd provides a command to show input details.
+type InputShowCmd struct {
+	Name    string `arg:"" help:"Name of the input to show."        required:""`
+	Verbose bool   `       help:"List all available input devices."             flag:""`
+}
+
+// Run executes the command to show input details.
+func (cmd *InputShowCmd) Run(ctx *context) error {
+	lresp, err := ctx.Client.Inputs.GetInputList(inputs.NewGetInputListParams())
+	if err != nil {
+		return fmt.Errorf("failed to get input list: %w", err)
+	}
+
+	var inputKind string
+	var found bool
+	for _, input := range lresp.Inputs {
+		if input.InputName == cmd.Name {
+			inputKind = input.InputKind
+			found = true
+			break
+		}
+	}
+
+	if !found {
+		return fmt.Errorf("input '%s' not found", cmd.Name)
+	}
+
+	prop, name := device(ctx, cmd.Name)
+	if prop == "" {
+		return fmt.Errorf("no device property found for input '%s'", cmd.Name)
+	}
+
+	t := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
+	t.Headers("Input Name", "Kind", "Device")
+	t.StyleFunc(func(row, col int) lipgloss.Style {
+		style := lipgloss.NewStyle().Padding(0, 3)
+		switch col {
+		case 0:
+			style = style.Align(lipgloss.Left)
+		case 1:
+			style = style.Align(lipgloss.Left)
+		case 2:
+			style = style.Align(lipgloss.Center)
+		}
+		switch {
+		case row == table.HeaderRow:
+			style = style.Bold(true).Align(lipgloss.Center)
+		case row%2 == 0:
+			style = style.Foreground(ctx.Style.evenRows)
+		default:
+			style = style.Foreground(ctx.Style.oddRows)
+		}
+		return style
+	})
+	t.Row(cmd.Name, snakeCaseToTitleCase(inputKind), name)
+
+	fmt.Fprintln(ctx.Out, t.Render())
+
+	if cmd.Verbose {
+		deviceListResp, err := ctx.Client.Inputs.GetInputPropertiesListPropertyItems(
+			inputs.NewGetInputPropertiesListPropertyItemsParams().
+				WithInputName(cmd.Name).
+				WithPropertyName(prop),
+		)
+		if err != nil {
+			return fmt.Errorf("failed to get device list: %w", err)
+		}
+
+		t := table.New().Border(lipgloss.RoundedBorder()).
+			BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
+		t.StyleFunc(func(row, col int) lipgloss.Style {
+			style := lipgloss.NewStyle().Padding(0, 3)
+			switch col {
+			case 0:
+				style = style.Align(lipgloss.Left)
+			}
+			switch {
+			case row == table.HeaderRow:
+				style = style.Bold(true).Align(lipgloss.Center)
+			case row%2 == 0:
+				style = style.Foreground(ctx.Style.evenRows)
+			default:
+				style = style.Foreground(ctx.Style.oddRows)
+			}
+			return style
+		})
+
+		t.Headers("Devices")
+
+		for _, item := range deviceListResp.PropertyItems {
+			if item.ItemName != "" {
+				t.Row(item.ItemName)
+			}
+		}
+
+		fmt.Fprintln(ctx.Out, t.Render())
+	}
+
+	return nil
+}
+
+func device(ctx *context, inputName string) (string, string) {
+	settings, err := ctx.Client.Inputs.GetInputSettings(
+		inputs.NewGetInputSettingsParams().WithInputName(inputName),
+	)
+	if err != nil {
+		return "", ""
+	}
+
+	for _, propName := range []string{"device", "device_id"} {
+		deviceListResp, err := ctx.Client.Inputs.GetInputPropertiesListPropertyItems(
+			inputs.NewGetInputPropertiesListPropertyItemsParams().
+				WithInputName(inputName).
+				WithPropertyName(propName),
+		)
+		if err == nil && len(deviceListResp.PropertyItems) > 0 {
+			for _, item := range deviceListResp.PropertyItems {
+				if item.ItemValue == settings.InputSettings[propName] {
+					return propName, item.ItemName
+				}
+			}
+		}
+	}
+
+	return "", ""
+}
+
+// InputUpdateCmd provides a command to update input settings.
+type InputUpdateCmd struct {
+	InputName  string `arg:"" help:"Name of the input to update." required:""`
+	DeviceName string `arg:"" help:"Name of the device to set."   required:""`
+}
+
+// Run executes the command to update input settings.
+func (cmd *InputUpdateCmd) Run(ctx *context) error {
+	// Use the device helper to find the correct device property name
+	prop, _ := device(ctx, cmd.InputName)
+	if prop == "" {
+		return fmt.Errorf("no device property found for input '%s'", cmd.InputName)
+	}
+
+	resp, err := ctx.Client.Inputs.GetInputPropertiesListPropertyItems(
+		inputs.NewGetInputPropertiesListPropertyItemsParams().
+			WithInputName(cmd.InputName).
+			WithPropertyName(prop),
+	)
+	if err != nil {
+		return err
+	}
+
+	var deviceValue any
+	var found bool
+	for _, item := range resp.PropertyItems {
+		if item.ItemName == cmd.DeviceName {
+			deviceValue = item.ItemValue
+			found = true
+			break
+		}
+	}
+
+	if !found {
+		return fmt.Errorf("device '%s' not found for input '%s'", cmd.DeviceName, cmd.InputName)
+	}
+
+	sresp, err := ctx.Client.Inputs.GetInputSettings(
+		inputs.NewGetInputSettingsParams().WithInputName(cmd.InputName),
+	)
+	if err != nil {
+		return err
+	}
+
+	settings := make(map[string]any)
+	maps.Copy(settings, sresp.InputSettings)
+	settings[prop] = deviceValue
+
+	_, err = ctx.Client.Inputs.SetInputSettings(
+		inputs.NewSetInputSettingsParams().
+			WithInputName(cmd.InputName).
+			WithInputSettings(settings),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to update input settings: %w", err)
+	}
+
+	fmt.Fprintf(ctx.Out, "Input %s %s set to %s\n",
+		ctx.Style.Highlight(cmd.InputName), prop, ctx.Style.Highlight(cmd.DeviceName))
+
+	return nil
+}
+
+// InputKindDefaultsCmd provides a command to get default settings for an input kind.
+type InputKindDefaultsCmd struct {
+	Kind string `arg:"" help:"Input kind to get default settings for." required:""`
+}
+
+// Run executes the command to get default settings for an input kind.
+func (cmd *InputKindDefaultsCmd) Run(ctx *context) error {
+	resp, err := ctx.Client.Inputs.GetInputDefaultSettings(
+		inputs.NewGetInputDefaultSettingsParams().
+			WithInputKind(cmd.Kind),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to get default settings for input kind '%s': %w", cmd.Kind, err)
+	}
+
+	t := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
+	t.Headers("Setting", "Value")
+	t.StyleFunc(func(row, col int) lipgloss.Style {
+		style := lipgloss.NewStyle().Padding(0, 3)
+		switch col {
+		case 0:
+			style = style.Align(lipgloss.Left)
+		case 1:
+			style = style.Align(lipgloss.Center)
+		}
+		switch {
+		case row == table.HeaderRow:
+			style = style.Bold(true).Align(lipgloss.Center)
+		case row%2 == 0:
+			style = style.Foreground(ctx.Style.evenRows)
+		default:
+			style = style.Foreground(ctx.Style.oddRows)
+		}
+		return style
+	})
+
+	keys := make([]string, 0, len(resp.DefaultInputSettings))
+	for k := range resp.DefaultInputSettings {
+		keys = append(keys, k)
+	}
+	sort.Strings(keys)
+
+	for _, key := range keys {
+		value := resp.DefaultInputSettings[key]
+		t.Row(key, fmt.Sprintf("%v", value))
+	}
+
+	fmt.Fprintln(ctx.Out, t.Render())
+	return nil
+}

main.go

@@ -8,6 +8,8 @@ import (
 	"io"
 	"os"
 	"path/filepath"
+	"runtime/debug"
+	"strings"
 	"time"
 
 	"github.com/alecthomas/kong"
@@ -16,6 +18,19 @@ import (
 	kongdotenv "github.com/titusjaka/kong-dotenv-go"
 )
 
+var version string // Version of the CLI, set at build time.
+
+// VersionFlag is a custom flag type that prints the version and exits.
+type VersionFlag string
+
+func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil }  // nolint: revive
+func (v VersionFlag) IsBool() bool                       { return true } // nolint: revive
+func (v VersionFlag) BeforeApply(app *kong.Kong, vars kong.Vars) error { // nolint: revive, unparam
+	fmt.Printf("gobs-cli version: %s\n", vars["version"])
+	app.Exit(0)
+	return nil
+}
+
 // ObsConfig holds the configuration for connecting to the OBS WebSocket server.
 type ObsConfig struct {
 	Host     string `flag:"host"     help:"Host to connect to."          default:"localhost" env:"OBS_HOST"     short:"H"`
@@ -31,7 +46,7 @@ type StyleConfig struct {
 }
 
 // CLI is the main command line interface structure.
-// It embeds the ObsConfig struct to inherit its fields and flags.
+// It embeds ObsConfig and StyleConfig to provide configuration options.
 type CLI struct {
 	ObsConfig   `embed:"" help:"OBS WebSocket configuration."`
 	StyleConfig `embed:"" help:"Style configuration."`
@@ -44,6 +59,7 @@ type CLI struct {
 	Sceneitem       SceneItemCmd       `help:"Manage scene items."                     cmd:"" aliases:"si"  group:"Scene Item"`
 	Group           GroupCmd           `help:"Manage groups."                          cmd:"" aliases:"g"   group:"Group"`
 	Input           InputCmd           `help:"Manage inputs."                          cmd:"" aliases:"i"   group:"Input"`
+	Text            TextCmd            `help:"Manage text inputs."                     cmd:"" aliases:"t"   group:"Text Input"`
 	Record          RecordCmd          `help:"Manage recording."                       cmd:"" aliases:"rec" group:"Recording"`
 	Stream          StreamCmd          `help:"Manage streaming."                       cmd:"" aliases:"st"  group:"Streaming"`
 	Scenecollection SceneCollectionCmd `help:"Manage scene collections."               cmd:"" aliases:"scn" group:"Scene Collection"`
@@ -81,10 +97,25 @@ func main() {
 	var cli CLI
 	ctx := kong.Parse(
 		&cli,
-		kong.Name("GOBS-CLI"),
+		kong.Name("gobs-cli"),
 		kong.Description("A command line tool to interact with OBS Websocket."),
 		kong.Configuration(kongdotenv.ENVFileReader, ".env", filepath.Join(userConfigDir, "gobs-cli", "config.env")),
-	)
+		kong.UsageOnError(),
+		kong.ConfigureHelp(kong.HelpOptions{
+			Compact: true,
+		}),
+		kong.Vars{
+			"version": func() string {
+				if version == "" {
+					info, ok := debug.ReadBuildInfo()
+					if !ok {
+						return "(unable to read build info)"
+					}
+					version = strings.Split(info.Main.Version, "-")[0]
+				}
+				return version
+			}(),
+		})
 
 	client, err := connectObs(cli.ObsConfig)
 	ctx.FatalIfErrorf(err)

record.go

@@ -204,6 +204,9 @@ func (cmd *RecordSplitCmd) Run(ctx *context) error {
 	if !status.OutputActive {
 		return fmt.Errorf("recording is not in progress")
 	}
+	if status.OutputPaused {
+		return fmt.Errorf("recording is paused, cannot split")
+	}
 
 	_, err = ctx.Client.Record.SplitRecordFile()
 	if err != nil {
@@ -229,6 +232,9 @@ func (cmd *RecordChapterCmd) Run(ctx *context) error {
 	if !status.OutputActive {
 		return fmt.Errorf("recording is not in progress")
 	}
+	if status.OutputPaused {
+		return fmt.Errorf("recording is paused, cannot create chapter")
+	}
 
 	var params *record.CreateRecordChapterParams
 	if cmd.ChapterName == "" {

sceneitem.go

@@ -59,7 +59,7 @@ func (cmd *SceneItemListCmd) Run(ctx *context) error {
 		style := lipgloss.NewStyle().Padding(0, 3)
 		switch col {
 		case 0:
-			style = style.Align(lipgloss.Left)
+			style = style.Align(lipgloss.Center)
 		case 1:
 			style = style.Align(lipgloss.Left)
 		case 2:

text.go

@@ -0,0 +1,85 @@
+package main
+
+import (
+	"fmt"
+	"strings"
+
+	"github.com/andreykaipov/goobs/api/requests/inputs"
+)
+
+// TextCmd provides commands for managing text inputs in OBS.
+type TextCmd struct {
+	Current TextCurrentCmd `cmd:"current" help:"Display current text for a text input." aliases:"c"`
+	Update  TextUpdateCmd  `cmd:"update"  help:"Update the text of a text input."       aliases:"u"`
+}
+
+// TextCurrentCmd provides a command to display the current text of a text input.
+type TextCurrentCmd struct {
+	InputName string `arg:"" help:"Name of the text source."`
+}
+
+// Run executes the command to display the current text of a text input.
+func (cmd *TextCurrentCmd) Run(ctx *context) error {
+	resp, err := ctx.Client.Inputs.GetInputSettings(
+		inputs.NewGetInputSettingsParams().WithInputName(cmd.InputName),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to get input settings: %w", err)
+	}
+
+	// Check if the input is a text input
+	kind := resp.InputKind
+	if !strings.HasPrefix(kind, "text_") {
+		return fmt.Errorf("input %s is of %s", cmd.InputName, kind)
+	}
+
+	currentText, ok := resp.InputSettings["text"]
+	if !ok {
+		return fmt.Errorf("input %s does not have a 'text' setting", cmd.InputName)
+	}
+	if currentText == "" {
+		currentText = "(empty)"
+	}
+	fmt.Fprintf(
+		ctx.Out,
+		"Current text for source %s: %s\n",
+		ctx.Style.Highlight(cmd.InputName),
+		currentText,
+	)
+	return nil
+}
+
+// TextUpdateCmd provides a command to update the text of a text input.
+type TextUpdateCmd struct {
+	InputName string `arg:"" help:"Name of the text source."`
+	NewText   string `arg:"" help:"New text to set for the source." default:""`
+}
+
+// Run executes the command to update the text of a text input.
+func (cmd *TextUpdateCmd) Run(ctx *context) error {
+	resp, err := ctx.Client.Inputs.GetInputSettings(
+		inputs.NewGetInputSettingsParams().WithInputName(cmd.InputName),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to get input settings: %w", err)
+	}
+
+	// Check if the input is a text input
+	kind := resp.InputKind
+	if !strings.HasPrefix(kind, "text_") {
+		return fmt.Errorf("input %s is of %s", cmd.InputName, kind)
+	}
+
+	if _, err := ctx.Client.Inputs.SetInputSettings(&inputs.SetInputSettingsParams{
+		InputName:     &cmd.InputName,
+		InputSettings: map[string]any{"text": &cmd.NewText},
+	}); err != nil {
+		return fmt.Errorf("failed to update text for source %s: %w", cmd.InputName, err)
+	}
+
+	if cmd.NewText == "" {
+		cmd.NewText = "(empty)"
+	}
+	fmt.Fprintf(ctx.Out, "Updated text for source %s to: %s\n", ctx.Style.Highlight(cmd.InputName), cmd.NewText)
+	return nil
+}

version.go

@@ -2,38 +2,8 @@ package main
 
 import (
 	"fmt"
-	"runtime/debug"
-	"strings"
-
-	"github.com/alecthomas/kong"
 )
 
-var version string
-
-// VersionFlag is a custom flag type for displaying version information.
-type VersionFlag string
-
-// Decode implements the kong.Flag interface.
-func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil }
-
-// IsBool implements the kong.Flag interface.
-func (v VersionFlag) IsBool() bool { return true }
-
-// BeforeApply implements the kong.Flag interface.
-func (v VersionFlag) BeforeApply(app *kong.Kong, _ kong.Vars) error { // nolint: unparam
-	if version == "" {
-		info, ok := debug.ReadBuildInfo()
-		if !ok {
-			return fmt.Errorf("failed to read build info")
-		}
-		version = strings.Split(info.Main.Version, "-")[0]
-	}
-
-	fmt.Printf("gobs-cli version: %s\n", version)
-	app.Exit(0) // Exit the application after printing the version
-	return nil
-}
-
 // ObsVersionCmd handles the version command.
 type ObsVersionCmd struct{} // size = 0x0