read version from build info if version was not injected at build time (go install)

inject version from tag at build time for local builds

.gitignore

@@ -26,5 +26,12 @@ go.work
 
 # End of gignore: github.com/onyx-and-iris/gignore
 
+# Environment
+.env
 .envrc
-*_test.go
+
+# Man pages
+gobs-cli.1
+
+# Config files
+config.yaml

.golangci.yml

@@ -50,3 +50,6 @@ issues:
   exclude:
     # gosec: Duplicated errcheck checks
     - G104
+  exclude-files:
+    # Exclude vendor directory
+    - main_test.go

CHANGELOG.md

@@ -5,6 +5,84 @@ All notable changes to this project will be documented in this file.
 The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
 and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
 
+# [0.9.0]
+
+### Added
+
+-   --version/-v option. See [Flags](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#flags)
+
+### Changed
+
+-   version command renamed to obs-version
+
+# [0.8.2]
+
+### Added
+
+-   record start/stop and stream start/stop commands check outputActive states first. 
+    -   Errors are returned if the command cannot be performed.
+
+### Changed
+
+-   The --parent flag for the sceneitem commands has been renamed to --group, see [SceneItemCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#sceneitemcmd)
+
+# [0.8.0] - 2025-05-27
+
+### Added
+
+-   record directory command, see [directory under RecordCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#recordcmd)
+
+### Changed
+
+-   record stop now prints the output path of the recording.
+
+
+# [0.7.0] - 2025-05-26
+
+### Added
+
+-   projector commands, see [ProjectorCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#projectorcmd)
+
+
+# [0.6.1] - 2025-05-25
+
+### Added
+
+-   filter commands, see [FilterCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#filtercmd)
+
+### Changed
+
+-   list commands are now printed as tables.
+    - This affects group, hotkey, input, profile, scene, scenecollection and sceneitem command groups.
+
+# [0.5.0] - 2025-05-22
+
+### Added
+
+-   hotkey commands, see [HotkeyCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#hotkeycmd)
+
+# [0.4.2] - 2025-05-08
+
+### Added
+
+-   replaybuffer toggle command
+-   studiomode enable/disable now print output to console
+-   stream start/stop now print output to console
+-   Unit tests
+
+# [0.3.1] - 2025-05-02
+
+### Added
+
+-   --man flag for generating/viewing a man page.
+-   Ability to load env vars from env files, see the [README](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#environment-variables)
+
+# [0.2.0] - 2025-04-27
+
+### Added
+
+-   sceneitem transform, see *transform* under [SceneItemCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#sceneitemcmd)
+
 # [0.1.0] - 2025-04-24
 
 ### Added

README.md

@@ -4,35 +4,51 @@ A command line interface for OBS Websocket v5
 
 For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)
 
+## Installation
+
+```console
+go install github.com/onyx-and-iris/gobs-cli@latest
+```
+
 ## Configuration
 
 #### Flags
 
-Pass `--host`, `--port` and `--password` as flags to the root command, for example:
+-   --host/-H: Websocket host
+-   --port/-P Websocket port
+-   --password/-p: Websocket password
+-   --timeout/-T: Websocket timeout
+-   --version/-v: Print the gobs-cli version
+
+Pass `--host`, `--port` and `--password` as flags on the root command, for example:
 
 ```console
-gobs-cli --host=localhost --port=4455 --password=<websocket password> --help
+gobs-cli --host localhost --port 4455 --password 'websocket password' --help
 ```
 
 #### Environment Variables
 
-Load connection details from your environment:
+Store and load environment variables from:
 
-```bash
+-   A `.env` file in the cwd
-#!/usr/bin/env bash
+-   $XDG_CONFIG_HOME / gobs-cli / config.env (see [os.UserConfigDir][userconfigdir])
 
-export OBS_HOST=localhost
+```env
-export OBS_PORT=4455
+OBS_HOST=localhost
-export OBS_PASSWORD=<websocket password>
+OBS_PORT=4455
-export OBS_TIMEOUT=5
+OBS_PASSWORD=<websocket password>
+OBS_TIMEOUT=5
 ```
 
+
 ## Commands
 
-### VersionCmd
+### ObsVersionCmd
+
+-   Print OBS client and websocket version.
 
 ```console
-gobs-cli version
+gobs-cli obs-version
 ```
 
 ### SceneCmd
@@ -71,9 +87,14 @@ gobs-cli scene switch --preview LIVE
 ### SceneItemCmd
 
 -   list: List all scene items.
+
+    *optional*
     -   args: SceneName
+        -   defaults to current scene
 
 ```console
+gobs-cli sceneitem list
+
 gobs-cli sceneitem list LIVE
 ```
 
@@ -81,7 +102,7 @@ gobs-cli sceneitem list LIVE
     -   flags:
 
         *optional*
-        -   --parent: Parent group name.
+        -   --group: Parent group name.
     -   args: SceneName ItemName
 
 ```console
@@ -92,7 +113,7 @@ gobs-cli sceneitem show START "Colour Source"
     -   flags:
 
         *optional*
-        -   --parent: Parent group name.
+        -   --group: Parent group name.
     -   args: SceneName ItemName
 
 ```console
@@ -103,28 +124,29 @@ gobs-cli sceneitem hide START "Colour Source"
     -   flags:
 
         *optional*
-        -   --parent: Parent group name.
+        -   --group: Parent group name.
     -   args: SceneName ItemName
 
 ```console
-gobs-cli sceneitem toggle --parent=test_group START "Colour Source 3"
+gobs-cli sceneitem toggle --group=test_group START "Colour Source 3"
 ```
 
 -   visible: Get scene item visibility.
     -   flags:
 
         *optional*
-        -   --parent: Parent group name.
+        -   --group: Parent group name.
     -   args: SceneName ItemName
 
 ```console
-gobs-cli sceneitem visible --parent=test_group START "Colour Source 4"
+gobs-cli sceneitem visible --group=test_group START "Colour Source 4"
 ```
 
 -   transform: Transform scene item.
     -   flags:
+        
         *optional*
-        -   --parent: Parent group name.
+        -   --group: Parent group name.
 
         -   --alignment: Alignment of the scene item.
         -   --bounds-alignment: Bounds alignment of the scene item.
@@ -153,9 +175,14 @@ gobs-cli sceneitem transform \
 ### GroupCmd
 
 -   list: List all groups.
+
+    *optional*
     -   args: SceneName
+        -   defaults to current scene
 
 ```console
+gobs-cli group list
+
 gobs-cli group list START
 ```
 
@@ -262,6 +289,19 @@ gobs-cli record pause
 gobs-cli record resume
 ```
 
+-   directory: Get/Set recording directory.
+
+    *optional*
+    -   args: RecordDirectory
+        -   if not passed the current record directory will be printed.
+
+```console
+gobs-cli record directory
+
+gobs-cli record directory "/home/me/obs-vids/"
+gobs-cli record directory "C:/Users/me/Videos"
+```
+
 ### StreamCmd
 
 -   start: Start streaming.
@@ -365,6 +405,12 @@ gobs-cli replaybuffer start
 gobs-cli replaybuffer stop
 ```
 
+-   toggle: Toggle replay buffer.
+
+```console
+gobs-cli replaybuffer toggle
+```
+
 -   status: Get replay buffer status.
 
 ```console
@@ -428,3 +474,104 @@ gobs-cli virtualcam toggle
 ```console
 gobs-cli virtualcam status
 ```
+
+### HotkeyCmd
+
+-   list: List all hotkeys.
+
+```console
+gobs-cli hotkey list
+```
+
+-   trigger: Trigger a hotkey by name.
+
+```console
+gobs-cli hotkey trigger OBSBasic.StartStreaming
+
+gobs-cli hotkey trigger OBSBasic.StopStreaming
+```
+
+-   trigger-sequence: Trigger a hotkey by sequence.
+    -   flags:
+
+        *optional*
+        -   --shift: Press shift.
+        -   --ctrl: Press control.
+        -   --alt: Press alt.
+        -   --cmd: Press command (mac).
+
+    -   args: keyID
+        -   Check [obs-hotkeys.h][obs-keyids] for a full list of OBS key ids.
+
+```console
+gobs-cli hotkey trigger-sequence OBS_KEY_F1 --ctrl
+
+gobs-cli hotkey trigger-sequence OBS_KEY_F1 --shift --ctrl
+```
+
+### FilterCmd
+
+-   list: List all filters.
+
+```console
+gobs-cli filter list
+```
+
+-   enable: Enable filter.
+    -   args: SourceName FilterName
+
+```console
+gobs-cli enable 'Mic/Aux' 'Gain'
+```
+
+-   disable: Disable filter.
+    -   args: SourceName FilterName
+
+```console
+gobs-cli disable 'Mic/Aux' 'Gain'
+```
+
+-   toggle: Toggle filter.
+    -   args: SourceName FilterName
+
+```console
+gobs-cli toggle 'Mic/Aux' 'Gain'
+```
+
+-   status: Get filter status.
+    -   args: SourceName FilterName
+
+```console
+gobs-cli status 'Mic/Aux' 'Gain'
+```
+
+### ProjectorCmd
+
+-   list-monitors: List available monitors.
+
+```console
+gobs-cli projector list-monitors
+```
+
+-   open: Open a fullscreen projector for a source on a specific monitor.
+    -   flags:
+
+        *optional*
+        -   --monitor-index: Index of the monitor to open the projector on.
+            -   defaults to 0
+
+    *optional*
+    -   args: <source_name>
+        -   defaults to current scene
+
+```console
+gobs-cli projector open
+
+gobs-cli projector open --monitor-index=1 "test_scene"
+
+gobs-cli projector open --monitor-index=1 "test_group"
+```
+
+
+[userconfigdir]: https://pkg.go.dev/os#UserConfigDir
+[obs-keyids]: https://github.com/obsproject/obs-studio/blob/master/libobs/obs-hotkeys.h

Taskfile.man.yaml

@@ -0,0 +1,17 @@
+version: '3'
+
+tasks:
+  default:
+    desc: View man page
+    cmds:
+      - task: view
+
+  view:
+    desc: View man page
+    cmds:
+      - go run . --man | man -l -
+
+  generate:
+    desc: Generate man page
+    cmds:
+      - go run . --man > {{.PROGRAM}}.1

Taskfile.yaml

@@ -1,9 +1,14 @@
 version: '3'
 
+includes:
+  man: Taskfile.man.yaml
+
 vars:
   PROGRAM: gobs-cli
   SHELL: '{{if eq .OS "Windows_NT"}}powershell{{end}}'
   BIN_DIR: bin
+  VERSION:
+    sh: 'git describe --tags $(git rev-list --tags --max-count=1)'
 
 tasks:
   default:
@@ -32,13 +37,13 @@ tasks:
   build-windows:
     desc: Build the gobs-cli project for Windows
     cmds:
-      - GOOS=windows GOARCH=amd64 go build -o {{.BIN_DIR}}/{{.PROGRAM}}_windows_amd64.exe
+      - GOOS=windows GOARCH=amd64 go build -ldflags "-X 'main.version={{.VERSION}}'" -o {{.BIN_DIR}}/{{.PROGRAM}}_windows_amd64.exe
     internal: true
 
   build-linux:
     desc: Build the gobs-cli project for Linux
     cmds:
-      - GOOS=linux GOARCH=amd64 go build -o {{.BIN_DIR}}/{{.PROGRAM}}_linux_amd64
+      - GOOS=linux GOARCH=amd64 go build -ldflags "-X 'main.version={{.VERSION}}'" -o {{.BIN_DIR}}/{{.PROGRAM}}_linux_amd64
     internal: true
 
   test:

filter.go

@@ -0,0 +1,176 @@
+package main
+
+import (
+	"fmt"
+	"sort"
+	"strings"
+
+	"github.com/andreykaipov/goobs/api/requests/filters"
+	"github.com/aquasecurity/table"
+)
+
+// FilterCmd provides commands to manage filters in OBS Studio.
+type FilterCmd struct {
+	List    FilterListCmd    `cmd:"" help:"List all filters."  aliases:"ls"`
+	Enable  FilterEnableCmd  `cmd:"" help:"Enable filter."     aliases:"on"`
+	Disable FilterDisableCmd `cmd:"" help:"Disable filter."    aliases:"off"`
+	Toggle  FilterToggleCmd  `cmd:"" help:"Toggle filter."     aliases:"tg"`
+	Status  FilterStatusCmd  `cmd:"" help:"Get filter status." aliases:"ss"`
+}
+
+// FilterListCmd provides a command to list all filters in a scene.
+type FilterListCmd struct {
+	SourceName string `arg:"" help:"Name of the source to list filters from."`
+}
+
+// Run executes the command to list all filters in a scene.
+func (cmd *FilterListCmd) Run(ctx *context) error {
+	filters, err := ctx.Client.Filters.GetSourceFilterList(
+		filters.NewGetSourceFilterListParams().WithSourceName(cmd.SourceName),
+	)
+	if err != nil {
+		return err
+	}
+
+	if len(filters.Filters) == 0 {
+		fmt.Fprintf(ctx.Out, "No filters found for source %s.\n", cmd.SourceName)
+		return nil
+	}
+
+	t := table.New(ctx.Out)
+	t.SetPadding(3)
+	t.SetAlignment(table.AlignLeft, table.AlignLeft, table.AlignCenter, table.AlignLeft)
+	t.SetHeaders("Filter Name", "Kind", "Enabled", "Settings")
+
+	for _, filter := range filters.Filters {
+		var lines []string
+		for k, v := range filter.FilterSettings {
+			lines = append(lines, fmt.Sprintf("%s %v", k, v))
+		}
+		sort.Slice(lines, func(i, j int) bool {
+			return strings.ToLower(lines[i]) < strings.ToLower(lines[j])
+		})
+
+		t.AddRow(
+			filter.FilterName,
+			snakeCaseToTitleCase(filter.FilterKind),
+			getEnabledMark(filter.FilterEnabled),
+			strings.Join(lines, "\n"),
+		)
+	}
+	t.Render()
+	return nil
+}
+
+// FilterEnableCmd provides a command to enable a filter in a scene.
+type FilterEnableCmd struct {
+	SourceName string `arg:"" help:"Name of the source to enable filter from."`
+	FilterName string `arg:"" help:"Name of the filter to enable."`
+}
+
+// Run executes the command to enable a filter in a scene.
+func (cmd *FilterEnableCmd) Run(ctx *context) error {
+	_, err := ctx.Client.Filters.SetSourceFilterEnabled(
+		filters.NewSetSourceFilterEnabledParams().
+			WithSourceName(cmd.SourceName).
+			WithFilterName(cmd.FilterName).
+			WithFilterEnabled(true),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to enable filter %s on source %s: %w",
+			cmd.FilterName, cmd.SourceName, err)
+	}
+	fmt.Fprintf(ctx.Out, "Filter %s enabled on source %s.\n",
+		cmd.FilterName, cmd.SourceName)
+	return nil
+}
+
+// FilterDisableCmd provides a command to disable a filter in a scene.
+type FilterDisableCmd struct {
+	SourceName string `arg:"" help:"Name of the source to disable filter from."`
+	FilterName string `arg:"" help:"Name of the filter to disable."`
+}
+
+// Run executes the command to disable a filter in a scene.
+func (cmd *FilterDisableCmd) Run(ctx *context) error {
+	_, err := ctx.Client.Filters.SetSourceFilterEnabled(
+		filters.NewSetSourceFilterEnabledParams().
+			WithSourceName(cmd.SourceName).
+			WithFilterName(cmd.FilterName).
+			WithFilterEnabled(false),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to disable filter %s on source %s: %w",
+			cmd.FilterName, cmd.SourceName, err)
+	}
+	fmt.Fprintf(ctx.Out, "Filter %s disabled on source %s.\n",
+		cmd.FilterName, cmd.SourceName)
+	return nil
+}
+
+// FilterToggleCmd provides a command to toggle a filter in a scene.
+type FilterToggleCmd struct {
+	SourceName string `arg:"" help:"Name of the source to toggle filter from."`
+	FilterName string `arg:"" help:"Name of the filter to toggle."`
+}
+
+// Run executes the command to toggle a filter in a scene.
+func (cmd *FilterToggleCmd) Run(ctx *context) error {
+	filter, err := ctx.Client.Filters.GetSourceFilter(
+		filters.NewGetSourceFilterParams().
+			WithSourceName(cmd.SourceName).
+			WithFilterName(cmd.FilterName),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to get filter %s on source %s: %w",
+			cmd.FilterName, cmd.SourceName, err)
+	}
+
+	newStatus := !filter.FilterEnabled
+	_, err = ctx.Client.Filters.SetSourceFilterEnabled(
+		filters.NewSetSourceFilterEnabledParams().
+			WithSourceName(cmd.SourceName).
+			WithFilterName(cmd.FilterName).
+			WithFilterEnabled(newStatus),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to toggle filter %s on source %s: %w",
+			cmd.FilterName, cmd.SourceName, err)
+	}
+
+	if newStatus {
+		fmt.Fprintf(ctx.Out, "Filter %s on source %s is now enabled.\n",
+			cmd.FilterName, cmd.SourceName)
+	} else {
+		fmt.Fprintf(ctx.Out, "Filter %s on source %s is now disabled.\n",
+			cmd.FilterName, cmd.SourceName)
+	}
+	return nil
+}
+
+// FilterStatusCmd provides a command to get the status of a filter in a scene.
+type FilterStatusCmd struct {
+	SourceName string `arg:"" help:"Name of the source to get filter status from."`
+	FilterName string `arg:"" help:"Name of the filter to get status."`
+}
+
+// Run executes the command to get the status of a filter in a scene.
+func (cmd *FilterStatusCmd) Run(ctx *context) error {
+	filter, err := ctx.Client.Filters.GetSourceFilter(
+		filters.NewGetSourceFilterParams().
+			WithSourceName(cmd.SourceName).
+			WithFilterName(cmd.FilterName),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to get status of filter %s on source %s: %w",
+			cmd.FilterName, cmd.SourceName, err)
+	}
+	if filter.FilterEnabled {
+		fmt.Fprintf(ctx.Out, "Filter %s on source %s is enabled.\n",
+			cmd.FilterName, cmd.SourceName)
+	} else {
+		fmt.Fprintf(ctx.Out, "Filter %s on source %s is disabled.\n",
+			cmd.FilterName, cmd.SourceName)
+	}
+	return nil
+}

filter_test.go

@@ -0,0 +1,76 @@
+package main
+
+import (
+	"bytes"
+	"strings"
+	"testing"
+)
+
+func TestFilterList(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmd := &FilterListCmd{
+		SourceName: "Mic/Aux",
+	}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list filters: %v", err)
+	}
+	if !strings.Contains(out.String(), "test_filter") {
+		t.Fatalf("Expected output to contain 'test_filter', got '%s'", out.String())
+	}
+}
+
+func TestFilterListScene(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmd := &FilterListCmd{
+		SourceName: "gobs-test",
+	}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list filters in scene: %v", err)
+	}
+	if !strings.Contains(out.String(), "test_filter") {
+		t.Fatalf("Expected output to contain 'test_filter', got '%s'", out.String())
+	}
+}
+
+func TestFilterListEmpty(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmd := &FilterListCmd{
+		SourceName: "NonExistentSource",
+	}
+	err := cmd.Run(context)
+	if err == nil {
+		t.Fatal("Expected error for non-existent source, but got none")
+	}
+	if !strings.Contains(err.Error(), "No source was found by the name of `NonExistentSource`.") {
+		t.Fatalf(
+			"Expected error to contain 'No source was found by the name of `NonExistentSource`.', got '%s'",
+			err.Error(),
+		)
+	}
+}

go.mod

@@ -4,14 +4,24 @@ go 1.24.0
 
 require (
 	github.com/alecthomas/kong v1.10.0
+	github.com/alecthomas/mango-kong v0.1.0
 	github.com/andreykaipov/goobs v1.5.6
+	github.com/aquasecurity/table v1.10.0
+	github.com/titusjaka/kong-dotenv-go v0.1.0
 )
 
 require (
 	github.com/buger/jsonparser v1.1.1 // indirect
 	github.com/gorilla/websocket v1.5.3 // indirect
 	github.com/hashicorp/logutils v1.0.0 // indirect
+	github.com/joho/godotenv v1.5.1 // indirect
+	github.com/mattn/go-runewidth v0.0.13 // indirect
 	github.com/mitchellh/mapstructure v1.5.0 // indirect
 	github.com/mmcloughlin/profile v0.1.1 // indirect
+	github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab // indirect
+	github.com/muesli/roff v0.1.0 // indirect
 	github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d // indirect
+	github.com/rivo/uniseg v0.2.0 // indirect
+	golang.org/x/sys v0.1.0 // indirect
+	golang.org/x/term v0.0.0-20220526004731-065cf7ba2467 // indirect
 )

go.sum

@@ -2,10 +2,14 @@ github.com/alecthomas/assert/v2 v2.11.0 h1:2Q9r3ki8+JYXvGsDyBXwH3LcJ+WK5D0gc5E8v
 github.com/alecthomas/assert/v2 v2.11.0/go.mod h1:Bze95FyfUr7x34QZrjL+XP+0qgp/zg8yS+TtBj1WA3k=
 github.com/alecthomas/kong v1.10.0 h1:8K4rGDpT7Iu+jEXCIJUeKqvpwZHbsFRoebLbnzlmrpw=
 github.com/alecthomas/kong v1.10.0/go.mod h1:p2vqieVMeTAnaC83txKtXe8FLke2X07aruPWXyMPQrU=
+github.com/alecthomas/mango-kong v0.1.0 h1:iFVfP1k1K4qpml3JUQmD5I8MCQYfIvsD9mRdrw7jJC4=
+github.com/alecthomas/mango-kong v0.1.0/go.mod h1:t+TYVdsONUolf/BwVcm+15eqcdAj15h4Qe9MMFAwwT4=
 github.com/alecthomas/repr v0.4.0 h1:GhI2A8MACjfegCPVq9f1FLvIBS+DrQ2KQBFZP1iFzXc=
 github.com/alecthomas/repr v0.4.0/go.mod h1:Fr0507jx4eOXV7AlPV6AVZLYrLIuIeSOWtW57eE/O/4=
 github.com/andreykaipov/goobs v1.5.6 h1:eIkEqYN99+2VJvmlY/56Ah60nkRKS6efMQvpM3oUgPQ=
 github.com/andreykaipov/goobs v1.5.6/go.mod h1:iSZP93FJ4d9X/U1x4DD4IyILLtig+vViqZWBGjLywcY=
+github.com/aquasecurity/table v1.10.0 h1:gPWV28qp9XSlvXdT3ku8yKQoZE6II0vsmegKpW+dB08=
+github.com/aquasecurity/table v1.10.0/go.mod h1:eqOmvjjB7AhXFgFqpJUEE/ietg7RrMSJZXyTN8E/wZw=
 github.com/buger/jsonparser v1.1.1 h1:2PnMjfWD7wBILjqQbt530v576A/cAbQvEW9gGIpYMUs=
 github.com/buger/jsonparser v1.1.1/go.mod h1:6RYKKt7H4d4+iWqouImQ9R2FZql3VbhNgx27UK13J/0=
 github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
@@ -16,15 +20,31 @@ github.com/hashicorp/logutils v1.0.0 h1:dLEQVugN8vlakKOUE3ihGLTZJRB4j+M2cdTm/ORI
 github.com/hashicorp/logutils v1.0.0/go.mod h1:QIAnNjmIWmVIIkWDTG1z5v++HQmx9WQRO+LraFDTW64=
 github.com/hexops/gotextdiff v1.0.3 h1:gitA9+qJrrTCsiCl7+kh75nPqQt1cx4ZkudSTLoUqJM=
 github.com/hexops/gotextdiff v1.0.3/go.mod h1:pSWU5MAI3yDq+fZBTazCSJysOMbxWL1BSow5/V2vxeg=
+github.com/joho/godotenv v1.5.1 h1:7eLL/+HRGLY0ldzfGMeQkb7vMd0as4CfYvUVzLqw0N0=
+github.com/joho/godotenv v1.5.1/go.mod h1:f4LDr5Voq0i2e/R5DDNOoa2zzDfwtkZa6DnEwAbqwq4=
+github.com/mattn/go-runewidth v0.0.13 h1:lTGmDsbAYt5DmK6OnoV7EuIF1wEIFAcxld6ypU4OSgU=
+github.com/mattn/go-runewidth v0.0.13/go.mod h1:Jdepj2loyihRzMpdS35Xk/zdY8IAYHsh153qUoGf23w=
 github.com/mitchellh/mapstructure v1.5.0 h1:jeMsZIYE/09sWLaz43PL7Gy6RuMjD2eJVyuac5Z2hdY=
 github.com/mitchellh/mapstructure v1.5.0/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo=
 github.com/mmcloughlin/profile v0.1.1 h1:jhDmAqPyebOsVDOCICJoINoLb/AnLBaUw58nFzxWS2w=
 github.com/mmcloughlin/profile v0.1.1/go.mod h1:IhHD7q1ooxgwTgjxQYkACGA77oFTDdFVejUS1/tS/qU=
+github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab h1:m7QFONkzLK0fVXCjwX5tANcnj1yXxTnYQtnfJiY3tcA=
+github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab/go.mod h1:5XFpbC8jY5UUv89YQciiXNlbi+iJgt29VDC5xbzrLL4=
+github.com/muesli/roff v0.1.0 h1:YD0lalCotmYuF5HhZliKWlIx7IEhiXeSfq7hNjFqGF8=
+github.com/muesli/roff v0.1.0/go.mod h1:pjAHQM9hdUUwm/krAfrLGgJkXJ+YuhtsfZ42kieB2Ig=
 github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d h1:VhgPp6v9qf9Agr/56bj7Y/xa04UccTW04VP0Qed4vnQ=
 github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d/go.mod h1:YUTz3bUH2ZwIWBy3CJBeOBEugqcmXREj14T+iG/4k4U=
 github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
 github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
+github.com/rivo/uniseg v0.2.0 h1:S1pD9weZBuJdFmowNwbpi7BJ8TNftyUImj/0WQi72jY=
+github.com/rivo/uniseg v0.2.0/go.mod h1:J6wj4VEh+S6ZtnVlnTBMWIodfgj8LQOQFoIToxlJtxc=
 github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA=
 github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
+github.com/titusjaka/kong-dotenv-go v0.1.0 h1:TmUjP/sXoNiKLr6oR7n9xrB5XyXi/Ssuebzfz5nxZj4=
+github.com/titusjaka/kong-dotenv-go v0.1.0/go.mod h1:pBgLjcu82oqUgb7+bngK9+Ch7jg49E0YADP8Wnj2MXU=
+golang.org/x/sys v0.1.0 h1:kunALQeHf1/185U1i0GOB/fy1IPRDDpuoOOqRReG57U=
+golang.org/x/sys v0.1.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/term v0.0.0-20220526004731-065cf7ba2467 h1:CBpWXWQpIRjzmkkA+M7q9Fqnwd2mZr3AFqexg8YTfoM=
+golang.org/x/term v0.0.0-20220526004731-065cf7ba2467/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8=
 gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
 gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=

group.go

@@ -4,6 +4,7 @@ import (
 	"fmt"
 
 	"github.com/andreykaipov/goobs/api/requests/sceneitems"
+	"github.com/aquasecurity/table"
 )
 
 // GroupCmd provides commands to manage groups in OBS Studio.
@@ -17,21 +18,36 @@ type GroupCmd struct {
 
 // GroupListCmd provides a command to list all groups in a scene.
 type GroupListCmd struct {
-	SceneName string `arg:"" help:"Name of the scene to list groups from."`
+	SceneName string `arg:"" help:"Name of the scene to list groups from." default:""`
 }
 
 // Run executes the command to list all groups in a scene.
 func (cmd *GroupListCmd) Run(ctx *context) error {
+	if cmd.SceneName == "" {
+		currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
+		if err != nil {
+			return fmt.Errorf("failed to get current program scene: %w", err)
+		}
+		cmd.SceneName = currentScene.SceneName
+	}
+
 	resp, err := ctx.Client.SceneItems.GetSceneItemList(sceneitems.NewGetSceneItemListParams().
 		WithSceneName(cmd.SceneName))
 	if err != nil {
 		return fmt.Errorf("failed to get scene item list: %w", err)
 	}
+
+	t := table.New(ctx.Out)
+	t.SetPadding(3)
+	t.SetAlignment(table.AlignCenter, table.AlignLeft, table.AlignCenter)
+	t.SetHeaders("ID", "Group Name", "Enabled")
+
 	for _, item := range resp.SceneItems {
 		if item.IsGroup {
-			fmt.Fprintf(ctx.Out, "Group ID: %d, Source Name: %s\n", item.SceneItemID, item.SourceName)
+			t.AddRow(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, getEnabledMark(item.SceneItemEnabled))
 		}
 	}
+	t.Render()
 	return nil
 }
 

group_test.go

@@ -0,0 +1,130 @@
+package main
+
+import (
+	"bytes"
+	"strings"
+	"testing"
+)
+
+func TestGroupList(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmd := &GroupListCmd{
+		SceneName: "Scene",
+	}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list groups: %v", err)
+	}
+	if !strings.Contains(out.String(), "test_group") {
+		t.Fatalf("Expected output to contain 'test_group', got '%s'", out.String())
+	}
+}
+
+func TestGroupShow(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmd := &GroupShowCmd{
+		SceneName: "Scene",
+		GroupName: "test_group",
+	}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to show group: %v", err)
+	}
+	if out.String() != "Group test_group is now shown.\n" {
+		t.Fatalf("Expected output to be 'Group test_group is now shown.', got '%s'", out.String())
+	}
+}
+
+func TestGroupToggle(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmdStatus := &GroupStatusCmd{
+		SceneName: "Scene",
+		GroupName: "test_group",
+	}
+	err := cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get group status: %v", err)
+	}
+	var enabled bool
+	if strings.Contains(out.String(), "Group test_group is shown.") {
+		enabled = true
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdToggle := &GroupToggleCmd{
+		SceneName: "Scene",
+		GroupName: "test_group",
+	}
+	err = cmdToggle.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to toggle group: %v", err)
+	}
+	if enabled {
+		if out.String() != "Group test_group is now hidden.\n" {
+			t.Fatalf("Expected output to be 'Group test_group is now hidden.', got '%s'", out.String())
+		}
+	} else {
+		if out.String() != "Group test_group is now shown.\n" {
+			t.Fatalf("Expected output to be 'Group test_group is now shown.', got '%s'", out.String())
+		}
+	}
+}
+
+func TestGroupStatus(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmdShow := &GroupShowCmd{
+		SceneName: "Scene",
+		GroupName: "test_group",
+	}
+	err := cmdShow.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to show group: %v", err)
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdStatus := &GroupStatusCmd{
+		SceneName: "Scene",
+		GroupName: "test_group",
+	}
+	err = cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get group status: %v", err)
+	}
+	if out.String() != "Group test_group is shown.\n" {
+		t.Fatalf("Expected output to be 'Group test_group is shown.', got '%s'", out.String())
+	}
+}

hotkey.go

@@ -0,0 +1,79 @@
+package main
+
+import (
+	"github.com/andreykaipov/goobs/api/requests/general"
+	"github.com/andreykaipov/goobs/api/typedefs"
+	"github.com/aquasecurity/table"
+)
+
+// HotkeyCmd provides commands to manage hotkeys in OBS Studio.
+type HotkeyCmd struct {
+	List            HotkeyListCmd            `cmd:"" help:"List all hotkeys."             aliases:"ls"`
+	Trigger         HotkeyTriggerCmd         `cmd:"" help:"Trigger a hotkey by name."     aliases:"tr"`
+	TriggerSequence HotkeyTriggerSequenceCmd `cmd:"" help:"Trigger a hotkey by sequence." aliases:"trs"`
+}
+
+// HotkeyListCmd provides a command to list all hotkeys.
+type HotkeyListCmd struct{} // size = 0x0
+
+// Run executes the command to list all hotkeys.
+func (cmd *HotkeyListCmd) Run(ctx *context) error {
+	resp, err := ctx.Client.General.GetHotkeyList()
+	if err != nil {
+		return err
+	}
+
+	t := table.New(ctx.Out)
+	t.SetPadding(3)
+	t.SetAlignment(table.AlignLeft)
+	t.SetHeaders("Hotkey Name")
+
+	for _, hotkey := range resp.Hotkeys {
+		t.AddRow(hotkey)
+	}
+	t.Render()
+	return nil
+}
+
+// HotkeyTriggerCmd provides a command to trigger a hotkey.
+type HotkeyTriggerCmd struct {
+	Hotkey string `help:"Hotkey name to trigger." arg:""`
+}
+
+// Run executes the command to trigger a hotkey.
+func (cmd *HotkeyTriggerCmd) Run(ctx *context) error {
+	_, err := ctx.Client.General.TriggerHotkeyByName(
+		general.NewTriggerHotkeyByNameParams().WithHotkeyName(cmd.Hotkey),
+	)
+	if err != nil {
+		return err
+	}
+	return nil
+}
+
+// HotkeyTriggerSequenceCmd provides a command to trigger a hotkey sequence.
+type HotkeyTriggerSequenceCmd struct {
+	Shift bool   `flag:"" help:"Shift modifier."`
+	Ctrl  bool   `flag:"" help:"Control modifier."`
+	Alt   bool   `flag:"" help:"Alt modifier."`
+	Cmd   bool   `flag:"" help:"Command modifier."`
+	KeyID string `        help:"Key ID to trigger." arg:""`
+}
+
+// Run executes the command to trigger a hotkey sequence.
+func (cmd *HotkeyTriggerSequenceCmd) Run(ctx *context) error {
+	_, err := ctx.Client.General.TriggerHotkeyByKeySequence(
+		general.NewTriggerHotkeyByKeySequenceParams().
+			WithKeyId(cmd.KeyID).
+			WithKeyModifiers(&typedefs.KeyModifiers{
+				Shift:   cmd.Shift,
+				Control: cmd.Ctrl,
+				Alt:     cmd.Alt,
+				Command: cmd.Cmd,
+			}),
+	)
+	if err != nil {
+		return err
+	}
+	return nil
+}

input.go

@@ -5,6 +5,7 @@ import (
 	"strings"
 
 	"github.com/andreykaipov/goobs/api/requests/inputs"
+	"github.com/aquasecurity/table"
 )
 
 // InputCmd provides commands to manage inputs in OBS Studio.
@@ -28,21 +29,28 @@ func (cmd *InputListCmd) Run(ctx *context) error {
 	if err != nil {
 		return err
 	}
+
+	t := table.New(ctx.Out)
+	t.SetPadding(3)
+	t.SetAlignment(table.AlignLeft, table.AlignLeft)
+	t.SetHeaders("Input Name", "Kind")
+
 	for _, input := range resp.Inputs {
 		if cmd.Input && strings.Contains(input.InputKind, "input") {
-			fmt.Fprintln(ctx.Out, "Input:", input.InputName)
+			t.AddRow(input.InputName, input.InputKind)
 		}
 		if cmd.Output && strings.Contains(input.InputKind, "output") {
-			fmt.Fprintln(ctx.Out, "Output:", input.InputName)
+			t.AddRow(input.InputName, input.InputKind)
 		}
 		if cmd.Colour && strings.Contains(input.InputKind, "color") { // nolint
-			fmt.Fprintln(ctx.Out, "Colour Source:", input.InputName)
+			t.AddRow(input.InputName, input.InputKind)
 		}
 
 		if !cmd.Input && !cmd.Output && !cmd.Colour {
-			fmt.Fprintln(ctx.Out, "Source:", input.InputName)
+			t.AddRow(input.InputName, input.InputKind)
 		}
 	}
+	t.Render()
 	return nil
 }
 

input_test.go

@@ -0,0 +1,140 @@
+package main
+
+import (
+	"bytes"
+	"strings"
+	"testing"
+)
+
+func TestInputList(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmd := &InputListCmd{}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list inputs: %v", err)
+	}
+
+	expectedInputs := []string{
+		"Desktop Audio",
+		"Mic/Aux",
+		"Colour Source",
+		"Colour Source 2",
+		"Colour Source 3",
+	}
+	output := out.String()
+	for _, input := range expectedInputs {
+		if !strings.Contains(output, input) {
+			t.Fatalf("Expected output to contain '%s', got '%s'", input, output)
+		}
+	}
+}
+
+func TestInputListFilterInput(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmd := &InputListCmd{Input: true}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list inputs with filter: %v", err)
+	}
+
+	expectedInputs := []string{
+		"Mic/Aux",
+	}
+	expectedFilteredOut := []string{
+		"Desktop Audio",
+		"Colour Source",
+		"Colour Source 2",
+		"Colour Source 3",
+	}
+	for _, input := range expectedInputs {
+		if !strings.Contains(out.String(), input) {
+			t.Fatalf("Expected output to contain '%s', got '%s'", input, out.String())
+		}
+	}
+	for _, filteredOut := range expectedFilteredOut {
+		if strings.Contains(out.String(), filteredOut) {
+			t.Fatalf("Expected output to NOT contain '%s', got '%s'", filteredOut, out.String())
+		}
+	}
+}
+
+func TestInputListFilterOutput(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmd := &InputListCmd{Output: true}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list outputs with filter: %v", err)
+	}
+
+	expectedInputs := []string{
+		"Desktop Audio",
+	}
+	expectedFilteredOut := []string{
+		"Mic/Aux",
+		"Colour Source",
+		"Colour Source 2",
+		"Colour Source 3",
+	}
+	for _, input := range expectedInputs {
+		if !strings.Contains(out.String(), input) {
+			t.Fatalf("Expected output to contain '%s', got '%s'", input, out.String())
+		}
+	}
+	for _, filteredOut := range expectedFilteredOut {
+		if strings.Contains(out.String(), filteredOut) {
+			t.Fatalf("Expected output to NOT contain '%s', got '%s'", filteredOut, out.String())
+		}
+	}
+}
+
+func TestInputListFilterColour(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmd := &InputListCmd{Colour: true}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list colour inputs with filter: %v", err)
+	}
+
+	expectedInputs := []string{
+		"Colour Source",
+		"Colour Source 2",
+		"Colour Source 3",
+	}
+	for _, input := range expectedInputs {
+		if !strings.Contains(out.String(), input) {
+			t.Fatalf("Expected output to contain '%s', got '%s'", input, out.String())
+		}
+	}
+}

main.go

@@ -7,26 +7,32 @@ import (
 	"fmt"
 	"io"
 	"os"
+	"path/filepath"
 	"time"
 
 	"github.com/alecthomas/kong"
+	mangokong "github.com/alecthomas/mango-kong"
 	"github.com/andreykaipov/goobs"
+	kongdotenv "github.com/titusjaka/kong-dotenv-go"
 )
 
 // ObsConfig holds the configuration for connecting to the OBS WebSocket server.
 type ObsConfig struct {
-	Host     string `flag:"host"     help:"Host to connect to."          default:"localhost" env:"OBS_HOST"`
+	Host     string `flag:"host"     help:"Host to connect to."          default:"localhost" env:"OBS_HOST"     short:"H"`
-	Port     int    `flag:"port"     help:"Port to connect to."          default:"4455"      env:"OBS_PORT"`
+	Port     int    `flag:"port"     help:"Port to connect to."          default:"4455"      env:"OBS_PORT"     short:"P"`
-	Password string `flag:"password" help:"Password for authentication." default:""          env:"OBS_PASSWORD"`
+	Password string `flag:"password" help:"Password for authentication." default:""          env:"OBS_PASSWORD" short:"p"`
-	Timeout  int    `flag:"timeout"  help:"Timeout in seconds."          default:"5"         env:"OBS_TIMEOUT"`
+	Timeout  int    `flag:"timeout"  help:"Timeout in seconds."          default:"5"         env:"OBS_TIMEOUT"  short:"T"`
 }
 
-// cli is the main command line interface structure.
+// CLI is the main command line interface structure.
 // It embeds the ObsConfig struct to inherit its fields and flags.
-type cli struct {
+type CLI struct {
 	ObsConfig `embed:"" help:"OBS WebSocket configuration."`
 
-	Version         VersionCmd         `help:"Show version."             cmd:"" aliases:"v"`
+	Man     mangokong.ManFlag `help:"Print man page."`
+	Version VersionFlag       `help:"Print gobs-cli version information and quit" name:"version" short:"v"`
+
+	ObsVersion      ObsVersionCmd      `help:"Print OBS client and websocket version." cmd:"" aliases:"v"`
 	Scene           SceneCmd           `help:"Manage scenes."                          cmd:"" aliases:"sc"`
 	Sceneitem       SceneItemCmd       `help:"Manage scene items."                     cmd:"" aliases:"si"`
 	Group           GroupCmd           `help:"Manage groups."                          cmd:"" aliases:"g"`
@@ -38,6 +44,9 @@ type cli struct {
 	Replaybuffer    ReplayBufferCmd    `help:"Manage replay buffer."                   cmd:"" aliases:"rb"`
 	Studiomode      StudioModeCmd      `help:"Manage studio mode."                     cmd:"" aliases:"sm"`
 	Virtualcam      VirtualCamCmd      `help:"Manage virtual camera."                  cmd:"" aliases:"vc"`
+	Hotkey          HotkeyCmd          `help:"Manage hotkeys."                         cmd:"" aliases:"hk"`
+	Filter          FilterCmd          `help:"Manage filters."                         cmd:"" aliases:"f"`
+	Projector       ProjectorCmd       `help:"Manage projectors."                      cmd:"" aliases:"prj"`
 }
 
 type context struct {
@@ -46,11 +55,18 @@ type context struct {
 }
 
 func main() {
-	cli := cli{}
+	userConfigDir, err := os.UserConfigDir()
+	if err != nil {
+		fmt.Fprintf(os.Stderr, "Error getting user config directory: %v\n", err)
+		os.Exit(1)
+	}
+
+	var cli CLI
 	ctx := kong.Parse(
 		&cli,
 		kong.Name("GOBS-CLI"),
 		kong.Description("A command line tool to interact with OBS Websocket."),
+		kong.Configuration(kongdotenv.ENVFileReader, ".env", filepath.Join(userConfigDir, "gobs-cli", "config.env")),
 	)
 
 	client, err := connectObs(cli.ObsConfig)

main_test.go

@@ -0,0 +1,136 @@
+package main
+
+import (
+	"os"
+	"testing"
+
+	"github.com/andreykaipov/goobs"
+	"github.com/andreykaipov/goobs/api/requests/config"
+	"github.com/andreykaipov/goobs/api/requests/filters"
+	"github.com/andreykaipov/goobs/api/requests/inputs"
+	"github.com/andreykaipov/goobs/api/requests/scenes"
+	"github.com/andreykaipov/goobs/api/requests/ui"
+	typedefs "github.com/andreykaipov/goobs/api/typedefs"
+)
+
+func getClient(t *testing.T) (*goobs.Client, func()) {
+	t.Helper()
+	client, err := connectObs(ObsConfig{
+		Host:     os.Getenv("OBS_HOST"),
+		Port:     4455,
+		Password: os.Getenv("OBS_PASSWORD"),
+		Timeout:  5,
+	})
+	if err != nil {
+		t.Fatalf("Failed to connect to OBS: %v", err)
+	}
+	return client, func() {
+		if err := client.Disconnect(); err != nil {
+			t.Fatalf("Failed to disconnect from OBS: %v", err)
+		}
+	}
+}
+
+func TestMain(m *testing.M) {
+	client, err := connectObs(ObsConfig{
+		Host:     os.Getenv("OBS_HOST"),
+		Port:     4455,
+		Password: os.Getenv("OBS_PASSWORD"),
+		Timeout:  5,
+	})
+	if err != nil {
+		os.Exit(1)
+	}
+	defer client.Disconnect()
+
+	setup(client)
+
+	// Run the tests
+	exitCode := m.Run()
+
+	teardown(client)
+
+	// Exit with the appropriate code
+	os.Exit(exitCode)
+}
+
+func setup(client *goobs.Client) {
+	client.Config.SetStreamServiceSettings(config.NewSetStreamServiceSettingsParams().
+		WithStreamServiceType("rtmp_common").
+		WithStreamServiceSettings(&typedefs.StreamServiceSettings{
+			Server: "auto",
+			Key:    os.Getenv("OBS_STREAM_KEY"),
+		}))
+
+	client.Config.SetCurrentSceneCollection(config.NewSetCurrentSceneCollectionParams().
+		WithSceneCollectionName("test-collection"))
+
+	client.Scenes.CreateScene(scenes.NewCreateSceneParams().
+		WithSceneName("gobs-test"))
+	client.Inputs.CreateInput(inputs.NewCreateInputParams().
+		WithSceneName("gobs-test").
+		WithInputName("gobs-test-input").
+		WithInputKind("color_source_v3").
+		WithInputSettings(map[string]any{
+			"color":   3279460728,
+			"width":   1920,
+			"height":  1080,
+			"visible": true,
+		}).
+		WithSceneItemEnabled(true))
+	client.Inputs.CreateInput(inputs.NewCreateInputParams().
+		WithSceneName("gobs-test").
+		WithInputName("gobs-test-input-2").
+		WithInputKind("color_source_v3").
+		WithInputSettings(map[string]any{
+			"color":   1789347616,
+			"width":   720,
+			"height":  480,
+			"visible": true,
+		}).
+		WithSceneItemEnabled(true))
+
+	// Create source filter on an audio input
+	client.Filters.CreateSourceFilter(filters.NewCreateSourceFilterParams().
+		WithSourceName("Mic/Aux").
+		WithFilterName("test_filter").
+		WithFilterKind("compressor_filter").
+		WithFilterSettings(map[string]any{
+			"threshold":        -20,
+			"ratio":            4,
+			"attack_time":      10,
+			"release_time":     100,
+			"output_gain":      -3.6,
+			"sidechain_source": nil,
+		}))
+
+	// Create source filter on a scene
+	client.Filters.CreateSourceFilter(filters.NewCreateSourceFilterParams().
+		WithSourceName("gobs-test").
+		WithFilterName("test_filter").
+		WithFilterKind("luma_key_filter_v2").
+		WithFilterSettings(map[string]any{
+			"luma": 0.5,
+		}))
+}
+
+func teardown(client *goobs.Client) {
+	client.Filters.RemoveSourceFilter(filters.NewRemoveSourceFilterParams().
+		WithSourceName("Mic/Aux").
+		WithFilterName("test_filter"))
+	client.Filters.RemoveSourceFilter(filters.NewRemoveSourceFilterParams().
+		WithSourceName("gobs-test").
+		WithFilterName("test_filter"))
+
+	client.Scenes.RemoveScene(scenes.NewRemoveSceneParams().
+		WithSceneName("gobs-test"))
+
+	client.Config.SetCurrentSceneCollection(config.NewSetCurrentSceneCollectionParams().
+		WithSceneCollectionName("default"))
+
+	client.Stream.StopStream()
+	client.Record.StopRecord()
+	client.Outputs.StopReplayBuffer()
+	client.Ui.SetStudioModeEnabled(ui.NewSetStudioModeEnabledParams().
+		WithStudioModeEnabled(false))
+}

profile.go

@@ -5,39 +5,50 @@ import (
 	"slices"
 
 	"github.com/andreykaipov/goobs/api/requests/config"
+	"github.com/aquasecurity/table"
 )
 
 // ProfileCmd provides commands to manage profiles in OBS Studio.
 type ProfileCmd struct {
-	List    ListProfileCmd    `help:"List profiles."       cmd:"" aliases:"ls"`
+	List    ProfileListCmd    `help:"List profiles."       cmd:"" aliases:"ls"`
-	Current CurrentProfileCmd `help:"Get current profile." cmd:"" aliases:"c"`
+	Current ProfileCurrentCmd `help:"Get current profile." cmd:"" aliases:"c"`
-	Switch  SwitchProfileCmd  `help:"Switch profile."      cmd:"" aliases:"sw"`
+	Switch  ProfileSwitchCmd  `help:"Switch profile."      cmd:"" aliases:"sw"`
-	Create  CreateProfileCmd  `help:"Create profile."      cmd:"" aliases:"new"`
+	Create  ProfileCreateCmd  `help:"Create profile."      cmd:"" aliases:"new"`
-	Remove  RemoveProfileCmd  `help:"Remove profile."      cmd:"" aliases:"rm"`
+	Remove  ProfileRemoveCmd  `help:"Remove profile."      cmd:"" aliases:"rm"`
 }
 
-// ListProfileCmd provides a command to list all profiles.
+// ProfileListCmd provides a command to list all profiles.
-type ListProfileCmd struct{} // size = 0x0
+type ProfileListCmd struct{} // size = 0x0
 
 // Run executes the command to list all profiles.
-func (cmd *ListProfileCmd) Run(ctx *context) error {
+func (cmd *ProfileListCmd) Run(ctx *context) error {
 	profiles, err := ctx.Client.Config.GetProfileList()
 	if err != nil {
 		return err
 	}
 
+	t := table.New(ctx.Out)
+	t.SetPadding(3)
+	t.SetAlignment(table.AlignLeft, table.AlignCenter)
+	t.SetHeaders("Profile Name", "Current")
+
 	for _, profile := range profiles.Profiles {
-		fmt.Fprintln(ctx.Out, profile)
+		var enabledMark string
+		if profile == profiles.CurrentProfileName {
+			enabledMark = getEnabledMark(true)
 		}
 
+		t.AddRow(profile, enabledMark)
+	}
+	t.Render()
 	return nil
 }
 
-// CurrentProfileCmd provides a command to get the current profile.
+// ProfileCurrentCmd provides a command to get the current profile.
-type CurrentProfileCmd struct{} // size = 0x0
+type ProfileCurrentCmd struct{} // size = 0x0
 
 // Run executes the command to get the current profile.
-func (cmd *CurrentProfileCmd) Run(ctx *context) error {
+func (cmd *ProfileCurrentCmd) Run(ctx *context) error {
 	profiles, err := ctx.Client.Config.GetProfileList()
 	if err != nil {
 		return err
@@ -47,13 +58,13 @@ func (cmd *CurrentProfileCmd) Run(ctx *context) error {
 	return nil
 }
 
-// SwitchProfileCmd provides a command to switch to a different profile.
+// ProfileSwitchCmd provides a command to switch to a different profile.
-type SwitchProfileCmd struct {
+type ProfileSwitchCmd struct {
 	Name string `arg:"" help:"Name of the profile to switch to." required:""`
 }
 
 // Run executes the command to switch to a different profile.
-func (cmd *SwitchProfileCmd) Run(ctx *context) error {
+func (cmd *ProfileSwitchCmd) Run(ctx *context) error {
 	profiles, err := ctx.Client.Config.GetProfileList()
 	if err != nil {
 		return err
@@ -74,13 +85,13 @@ func (cmd *SwitchProfileCmd) Run(ctx *context) error {
 	return nil
 }
 
-// CreateProfileCmd provides a command to create a new profile.
+// ProfileCreateCmd provides a command to create a new profile.
-type CreateProfileCmd struct {
+type ProfileCreateCmd struct {
 	Name string `arg:"" help:"Name of the profile to create." required:""`
 }
 
 // Run executes the command to create a new profile.
-func (cmd *CreateProfileCmd) Run(ctx *context) error {
+func (cmd *ProfileCreateCmd) Run(ctx *context) error {
 	profiles, err := ctx.Client.Config.GetProfileList()
 	if err != nil {
 		return err
@@ -100,13 +111,13 @@ func (cmd *CreateProfileCmd) Run(ctx *context) error {
 	return nil
 }
 
-// RemoveProfileCmd provides a command to remove an existing profile.
+// ProfileRemoveCmd provides a command to remove an existing profile.
-type RemoveProfileCmd struct {
+type ProfileRemoveCmd struct {
 	Name string `arg:"" help:"Name of the profile to delete." required:""`
 }
 
 // Run executes the command to remove an existing profile.
-func (cmd *RemoveProfileCmd) Run(ctx *context) error {
+func (cmd *ProfileRemoveCmd) Run(ctx *context) error {
 	profiles, err := ctx.Client.Config.GetProfileList()
 	if err != nil {
 		return err

projector.go

@@ -0,0 +1,66 @@
+package main
+
+import (
+	"fmt"
+
+	"github.com/andreykaipov/goobs/api/requests/ui"
+	"github.com/aquasecurity/table"
+)
+
+// ProjectorCmd provides a command to manage projectors in OBS.
+type ProjectorCmd struct {
+	ListMonitors ProjectorListMonitorsCmd `cmd:"" help:"List available monitors."                                        aliases:"ls-m"`
+	Open         ProjectorOpenCmd         `cmd:"" help:"Open a fullscreen projector for a source on a specific monitor." aliases:"o"`
+}
+
+// ProjectorListMonitorsCmd provides a command to list all monitors available for projectors.
+type ProjectorListMonitorsCmd struct{} // size = 0x0
+
+// Run executes the command to list all monitors available for projectors.
+func (cmd *ProjectorListMonitorsCmd) Run(ctx *context) error {
+	monitors, err := ctx.Client.Ui.GetMonitorList()
+	if err != nil {
+		return err
+	}
+
+	if len(monitors.Monitors) == 0 {
+		ctx.Out.Write([]byte("No monitors found for projectors.\n"))
+		return nil
+	}
+
+	t := table.New(ctx.Out)
+	t.SetPadding(3)
+	t.SetAlignment(table.AlignCenter, table.AlignLeft)
+	t.SetHeaders("Monitor ID", "Monitor Name")
+
+	for _, monitor := range monitors.Monitors {
+		t.AddRow(fmt.Sprintf("%d", monitor.MonitorIndex), monitor.MonitorName)
+	}
+
+	t.Render()
+	return nil
+}
+
+// ProjectorOpenCmd provides a command to open a fullscreen projector for a specific source.
+type ProjectorOpenCmd struct {
+	MonitorIndex int    `flag:"" help:"Index of the monitor to open the projector on." default:"0"`
+	SourceName   string `        help:"Name of the source to project."                 default:""  arg:""`
+}
+
+// Run executes the command to show details of a specific projector.
+func (cmd *ProjectorOpenCmd) Run(ctx *context) error {
+	if cmd.SourceName == "" {
+		currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
+		if err != nil {
+			return fmt.Errorf("failed to get current program scene: %w", err)
+		}
+		cmd.SourceName = currentScene.SceneName
+	}
+
+	ctx.Client.Ui.OpenSourceProjector(ui.NewOpenSourceProjectorParams().
+		WithSourceName(cmd.SourceName).
+		WithMonitorIndex(cmd.MonitorIndex))
+
+	fmt.Fprintf(ctx.Out, "Opened projector for source '%s' on monitor index %d.\n", cmd.SourceName, cmd.MonitorIndex)
+	return nil
+}

record.go

@@ -2,6 +2,8 @@ package main
 
 import (
 	"fmt"
+
+	"github.com/andreykaipov/goobs/api/requests/config"
 )
 
 // RecordCmd handles the recording commands.
@@ -9,8 +11,10 @@ type RecordCmd struct {
 	Start     RecordStartCmd     `cmd:"" help:"Start recording."             aliases:"s"`
 	Stop      RecordStopCmd      `cmd:"" help:"Stop recording."              aliases:"st"`
 	Toggle    RecordToggleCmd    `cmd:"" help:"Toggle recording."            aliases:"tg"`
+	Status    RecordStatusCmd    `cmd:"" help:"Show recording status."       aliases:"ss"`
 	Pause     RecordPauseCmd     `cmd:"" help:"Pause recording."             aliases:"p"`
 	Resume    RecordResumeCmd    `cmd:"" help:"Resume recording."            aliases:"r"`
+	Directory RecordDirectoryCmd `cmd:"" help:"Get/Set recording directory." aliases:"d"`
 }
 
 // RecordStartCmd starts the recording.
@@ -18,7 +22,19 @@ type RecordStartCmd struct{} // size = 0x0
 
 // Run executes the command to start recording.
 func (cmd *RecordStartCmd) Run(ctx *context) error {
-	_, err := ctx.Client.Record.StartRecord()
+	status, err := ctx.Client.Record.GetRecordStatus()
+	if err != nil {
+		return err
+	}
+
+	if status.OutputActive {
+		if status.OutputPaused {
+			return fmt.Errorf("recording is already in progress and paused")
+		}
+		return fmt.Errorf("recording is already in progress")
+	}
+
+	_, err = ctx.Client.Record.StartRecord()
 	if err != nil {
 		return err
 	}
@@ -31,11 +47,20 @@ type RecordStopCmd struct{} // size = 0x0
 
 // Run executes the command to stop recording.
 func (cmd *RecordStopCmd) Run(ctx *context) error {
-	_, err := ctx.Client.Record.StopRecord()
+	status, err := ctx.Client.Record.GetRecordStatus()
 	if err != nil {
 		return err
 	}
-	fmt.Fprintln(ctx.Out, "Recording stopped successfully.")
+
+	if !status.OutputActive {
+		return fmt.Errorf("recording is not in progress")
+	}
+
+	resp, err := ctx.Client.Record.StopRecord()
+	if err != nil {
+		return err
+	}
+	fmt.Fprintf(ctx.Out, "%s", fmt.Sprintf("Recording stopped successfully. Output file: %s\n", resp.OutputPath))
 	return nil
 }
 
@@ -44,25 +69,39 @@ type RecordToggleCmd struct{} // size = 0x0
 
 // Run executes the command to toggle recording.
 func (cmd *RecordToggleCmd) Run(ctx *context) error {
-	// Check if recording is in progress
+	status, err := ctx.Client.Record.ToggleRecord()
+	if err != nil {
+		return err
+	}
+
+	if status.OutputActive {
+		fmt.Fprintln(ctx.Out, "Recording started successfully.")
+	} else {
+		fmt.Fprintln(ctx.Out, "Recording stopped successfully.")
+	}
+	return nil
+}
+
+// RecordStatusCmd shows the recording status.
+type RecordStatusCmd struct{} // size = 0x0
+
+// Run executes the command to show recording status.
+func (cmd *RecordStatusCmd) Run(ctx *context) error {
 	status, err := ctx.Client.Record.GetRecordStatus()
 	if err != nil {
 		return err
 	}
 
 	if status.OutputActive {
-		_, err = ctx.Client.Record.StopRecord()
+		if status.OutputPaused {
-		if err != nil {
+			fmt.Fprintln(ctx.Out, "Recording is paused.")
-			return err
-		}
-		fmt.Fprintln(ctx.Out, "Recording stopped successfully.")
 		} else {
-		_, err = ctx.Client.Record.StartRecord()
+			fmt.Fprintln(ctx.Out, "Recording is in progress.")
-		if err != nil {
-			return err
 		}
-		fmt.Fprintln(ctx.Out, "Recording started successfully.")
+	} else {
+		fmt.Fprintln(ctx.Out, "Recording is not in progress.")
 	}
+
 	return nil
 }
 
@@ -117,3 +156,30 @@ func (cmd *RecordResumeCmd) Run(ctx *context) error {
 	fmt.Fprintln(ctx.Out, "Recording resumed successfully.")
 	return nil
 }
+
+// RecordDirectoryCmd sets the recording directory.
+type RecordDirectoryCmd struct {
+	RecordDirectory string `arg:"" help:"Directory to save recordings." default:""`
+}
+
+// Run executes the command to set the recording directory.
+func (cmd *RecordDirectoryCmd) Run(ctx *context) error {
+	if cmd.RecordDirectory == "" {
+		resp, err := ctx.Client.Config.GetRecordDirectory()
+		if err != nil {
+			return err
+		}
+		fmt.Fprintf(ctx.Out, "Current recording directory: %s\n", resp.RecordDirectory)
+		return nil
+	}
+
+	_, err := ctx.Client.Config.SetRecordDirectory(
+		config.NewSetRecordDirectoryParams().WithRecordDirectory(cmd.RecordDirectory),
+	)
+	if err != nil {
+		return err
+	}
+
+	fmt.Fprintf(ctx.Out, "Recording directory set to: %s\n", cmd.RecordDirectory)
+	return nil
+}

record_test.go

@@ -0,0 +1,135 @@
+package main
+
+import (
+	"bytes"
+	"strings"
+	"testing"
+	"time"
+)
+
+func TestRecordStart(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmdStatus := &RecordStatusCmd{}
+	err := cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get recording status: %v", err)
+	}
+	var active bool
+	if out.String() == "Recording is in progress.\n" {
+		active = true
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdStart := &RecordStartCmd{}
+	err = cmdStart.Run(context)
+	if active {
+		if err == nil {
+			t.Fatalf("Expected error when starting recording while active, got nil")
+		}
+		if !strings.Contains(err.Error(), "recording is already in progress") {
+			t.Fatalf("Expected error message to contain 'recording is already in progress', got '%s'", err.Error())
+		}
+		return
+	}
+
+	if err != nil {
+		t.Fatalf("Failed to start recording: %v", err)
+	}
+	if out.String() != "Recording started successfully.\n" {
+		t.Fatalf("Expected output to contain 'Recording started successfully.', got '%s'", out.String())
+	}
+	time.Sleep(1 * time.Second) // Wait for the recording to start
+}
+
+func TestRecordStop(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmdStatus := &RecordStatusCmd{}
+	err := cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get recording status: %v", err)
+	}
+	var active bool
+	if out.String() == "Recording is in progress.\n" {
+		active = true
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdStop := &RecordStopCmd{}
+	err = cmdStop.Run(context)
+	if !active {
+		if err == nil {
+			t.Fatalf("Expected error when stopping recording while inactive, got nil")
+		}
+		if !strings.Contains(err.Error(), "recording is not in progress") {
+			t.Fatalf("Expected error message to contain 'recording is not in progress', got '%s'", err.Error())
+		}
+		return
+	}
+
+	if err != nil {
+		t.Fatalf("Failed to stop recording: %v", err)
+	}
+	if !strings.Contains(out.String(), "Recording stopped successfully. Output file: ") {
+		t.Fatalf("Expected output to contain 'Recording stopped successfully. Output file: ', got '%s'", out.String())
+	}
+	time.Sleep(1 * time.Second) // Wait for the recording to stop
+}
+
+func TestRecordToggle(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmdStatus := &RecordStatusCmd{}
+	err := cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get recording status: %v", err)
+	}
+	var active bool
+	if out.String() == "Recording is in progress.\n" {
+		active = true
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdToggle := &RecordToggleCmd{}
+	err = cmdToggle.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to toggle recording: %v", err)
+	}
+
+	time.Sleep(1 * time.Second) // Wait for a second to ensure toggle has taken effect
+
+	if active {
+		if out.String() != "Recording stopped successfully.\n" {
+			t.Fatalf("Expected output to be 'Recording stopped successfully.', got '%s'", out.String())
+		}
+	} else {
+		if out.String() != "Recording started successfully.\n" {
+			t.Fatalf("Expected output to be 'Recording started successfully.', got '%s'", out.String())
+		}
+	}
+}

replaybuffer.go

@@ -8,6 +8,7 @@ import (
 type ReplayBufferCmd struct {
 	Start  ReplayBufferStartCmd  `help:"Start replay buffer."      cmd:"" aliases:"s"`
 	Stop   ReplayBufferStopCmd   `help:"Stop replay buffer."       cmd:"" aliases:"st"`
+	Toggle ReplayBufferToggleCmd `help:"Toggle replay buffer."     cmd:"" aliases:"tg"`
 	Status ReplayBufferStatusCmd `help:"Get replay buffer status." cmd:"" aliases:"ss"`
 	Save   ReplayBufferSaveCmd   `help:"Save replay buffer."       cmd:"" aliases:"sv"`
 }
@@ -18,7 +19,11 @@ type ReplayBufferStartCmd struct{} // size = 0x0
 // Run executes the command to start the replay buffer.
 func (cmd *ReplayBufferStartCmd) Run(ctx *context) error {
 	_, err := ctx.Client.Outputs.StartReplayBuffer()
-	return err
+	if err != nil {
+		return fmt.Errorf("failed to start replay buffer: %w", err)
+	}
+	fmt.Fprintln(ctx.Out, "Replay buffer started.")
+	return nil
 }
 
 // ReplayBufferStopCmd stops the replay buffer.
@@ -27,7 +32,29 @@ type ReplayBufferStopCmd struct{} // size = 0x0
 // Run executes the command to stop the replay buffer.
 func (cmd *ReplayBufferStopCmd) Run(ctx *context) error {
 	_, err := ctx.Client.Outputs.StopReplayBuffer()
+	if err != nil {
+		return fmt.Errorf("failed to stop replay buffer: %w", err)
+	}
+	fmt.Fprintln(ctx.Out, "Replay buffer stopped.")
+	return nil
+}
+
+// ReplayBufferToggleCmd toggles the replay buffer state.
+type ReplayBufferToggleCmd struct{} // size = 0x0
+
+// Run executes the command to toggle the replay buffer.
+func (cmd *ReplayBufferToggleCmd) Run(ctx *context) error {
+	status, err := ctx.Client.Outputs.ToggleReplayBuffer()
+	if err != nil {
 		return err
+	}
+
+	if status.OutputActive {
+		fmt.Fprintln(ctx.Out, "Replay buffer started.")
+	} else {
+		fmt.Fprintln(ctx.Out, "Replay buffer stopped.")
+	}
+	return nil
 }
 
 // ReplayBufferStatusCmd retrieves the status of the replay buffer.

replaybuffer_test.go

@@ -0,0 +1,85 @@
+package main
+
+import (
+	"bytes"
+	"strings"
+	"testing"
+)
+
+func TestReplayBufferStart(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmd := &ReplayBufferStartCmd{}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to start replay buffer: %v", err)
+	}
+	if out.String() != "Replay buffer started.\n" {
+		t.Fatalf("Expected output to be 'Replay buffer started', got '%s'", out.String())
+	}
+}
+
+func TestReplayBufferStop(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmd := &ReplayBufferStopCmd{}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to stop replay buffer: %v", err)
+	}
+	if out.String() != "Replay buffer stopped.\n" {
+		t.Fatalf("Expected output to be 'Replay buffer stopped.', got '%s'", out.String())
+	}
+}
+
+func TestReplayBufferToggle(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmdStatus := &ReplayBufferStatusCmd{}
+	err := cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get replay buffer status: %v", err)
+	}
+	var active bool
+	if strings.Contains(out.String(), "Replay buffer is active") {
+		active = true
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdToggle := &ReplayBufferToggleCmd{}
+	err = cmdToggle.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to toggle replay buffer: %v", err)
+	}
+	if active {
+		if out.String() != "Replay buffer stopped.\n" {
+			t.Fatalf("Expected output to be 'Replay buffer stopped.', got '%s'", out.String())
+		}
+	} else {
+		if out.String() != "Replay buffer started.\n" {
+			t.Fatalf("Expected output to be 'Replay buffer started.', got '%s'", out.String())
+		}
+	}
+}

scene.go

@@ -5,6 +5,7 @@ import (
 	"slices"
 
 	"github.com/andreykaipov/goobs/api/requests/scenes"
+	"github.com/aquasecurity/table"
 )
 
 // SceneCmd provides commands to manage scenes in OBS Studio.
@@ -24,10 +25,16 @@ func (cmd *SceneListCmd) Run(ctx *context) error {
 		return err
 	}
 
+	t := table.New(ctx.Out)
+	t.SetPadding(3)
+	t.SetAlignment(table.AlignLeft, table.AlignLeft)
+	t.SetHeaders("Scene Name", "UUID")
+
 	slices.Reverse(scenes.Scenes)
 	for _, scene := range scenes.Scenes {
-		fmt.Fprintln(ctx.Out, scene.SceneName)
+		t.AddRow(scene.SceneName, scene.SceneUuid)
 	}
+	t.Render()
 	return nil
 }
 

scene_test.go

@@ -0,0 +1,58 @@
+package main
+
+import (
+	"bytes"
+	"strings"
+	"testing"
+)
+
+func TestSceneList(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmd := &SceneListCmd{}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list scenes: %v", err)
+	}
+	if !strings.Contains(out.String(), "gobs-test") {
+		t.Fatalf("Expected output to contain 'gobs-test', got '%s'", out.String())
+	}
+}
+
+func TestSceneCurrent(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	// Set the current scene to "gobs-test"
+	cmdSwitch := &SceneSwitchCmd{
+		NewScene: "gobs-test",
+	}
+	err := cmdSwitch.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to switch to scene: %v", err)
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdCurrent := &SceneCurrentCmd{}
+	err = cmdCurrent.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get current scene: %v", err)
+	}
+	if out.String() != "gobs-test\n" {
+		t.Fatalf("Expected output to contain 'gobs-test', got '%s'", out.String())
+	}
+}

scenecollection.go

@@ -4,38 +4,44 @@ import (
 	"fmt"
 
 	"github.com/andreykaipov/goobs/api/requests/config"
+	"github.com/aquasecurity/table"
 )
 
 // SceneCollectionCmd provides commands to manage scene collections in OBS Studio.
 type SceneCollectionCmd struct {
-	List    ListSceneCollectionCmd    `help:"List scene collections."       cmd:"" aliases:"ls"`
+	List    SceneCollectionListCmd    `help:"List scene collections."       cmd:"" aliases:"ls"`
-	Current CurrentSceneCollectionCmd `help:"Get current scene collection." cmd:"" aliases:"c"`
+	Current SceneCollectionCurrentCmd `help:"Get current scene collection." cmd:"" aliases:"c"`
-	Switch  SwitchSceneCollectionCmd  `help:"Switch scene collection."      cmd:"" aliases:"sw"`
+	Switch  SceneCollectionSwitchCmd  `help:"Switch scene collection."      cmd:"" aliases:"sw"`
-	Create  CreateSceneCollectionCmd  `help:"Create scene collection."      cmd:"" aliases:"new"`
+	Create  SceneCollectionCreateCmd  `help:"Create scene collection."      cmd:"" aliases:"new"`
 }
 
-// ListSceneCollectionCmd provides a command to list all scene collections.
+// SceneCollectionListCmd provides a command to list all scene collections.
-type ListSceneCollectionCmd struct{} // size = 0x0
+type SceneCollectionListCmd struct{} // size = 0x0
 
 // Run executes the command to list all scene collections.
-func (cmd *ListSceneCollectionCmd) Run(ctx *context) error {
+func (cmd *SceneCollectionListCmd) Run(ctx *context) error {
 	collections, err := ctx.Client.Config.GetSceneCollectionList()
 	if err != nil {
 		return fmt.Errorf("failed to get scene collection list: %w", err)
 	}
 
-	for _, collection := range collections.SceneCollections {
+	t := table.New(ctx.Out)
-		fmt.Fprintln(ctx.Out, collection)
+	t.SetPadding(3)
-	}
+	t.SetAlignment(table.AlignLeft)
+	t.SetHeaders("Scene Collection Name")
 
+	for _, collection := range collections.SceneCollections {
+		t.AddRow(collection)
+	}
+	t.Render()
 	return nil
 }
 
-// CurrentSceneCollectionCmd provides a command to get the current scene collection.
+// SceneCollectionCurrentCmd provides a command to get the current scene collection.
-type CurrentSceneCollectionCmd struct{} // size = 0x0
+type SceneCollectionCurrentCmd struct{} // size = 0x0
 
 // Run executes the command to get the current scene collection.
-func (cmd *CurrentSceneCollectionCmd) Run(ctx *context) error {
+func (cmd *SceneCollectionCurrentCmd) Run(ctx *context) error {
 	collections, err := ctx.Client.Config.GetSceneCollectionList()
 	if err != nil {
 		return fmt.Errorf("failed to get scene collection list: %w", err)
@@ -45,13 +51,13 @@ func (cmd *CurrentSceneCollectionCmd) Run(ctx *context) error {
 	return nil
 }
 
-// SwitchSceneCollectionCmd provides a command to switch to a different scene collection.
+// SceneCollectionSwitchCmd provides a command to switch to a different scene collection.
-type SwitchSceneCollectionCmd struct {
+type SceneCollectionSwitchCmd struct {
 	Name string `arg:"" help:"Name of the scene collection to switch to." required:""`
 }
 
 // Run executes the command to switch to a different scene collection.
-func (cmd *SwitchSceneCollectionCmd) Run(ctx *context) error {
+func (cmd *SceneCollectionSwitchCmd) Run(ctx *context) error {
 	collections, err := ctx.Client.Config.GetSceneCollectionList()
 	if err != nil {
 		return err
@@ -74,13 +80,13 @@ func (cmd *SwitchSceneCollectionCmd) Run(ctx *context) error {
 	return nil
 }
 
-// CreateSceneCollectionCmd provides a command to create a new scene collection.
+// SceneCollectionCreateCmd provides a command to create a new scene collection.
-type CreateSceneCollectionCmd struct {
+type SceneCollectionCreateCmd struct {
 	Name string `arg:"" help:"Name of the scene collection to create." required:""`
 }
 
 // Run executes the command to create a new scene collection.
-func (cmd *CreateSceneCollectionCmd) Run(ctx *context) error {
+func (cmd *SceneCollectionCreateCmd) Run(ctx *context) error {
 	_, err := ctx.Client.Config.CreateSceneCollection(
 		config.NewCreateSceneCollectionParams().WithSceneCollectionName(cmd.Name),
 	)

sceneitem.go

@@ -2,9 +2,11 @@ package main
 
 import (
 	"fmt"
+	"sort"
 
 	"github.com/andreykaipov/goobs"
 	"github.com/andreykaipov/goobs/api/requests/sceneitems"
+	"github.com/aquasecurity/table"
 )
 
 // SceneItemCmd provides commands to manage scene items in OBS Studio.
@@ -19,37 +21,83 @@ type SceneItemCmd struct {
 
 // SceneItemListCmd provides a command to list all scene items in a scene.
 type SceneItemListCmd struct {
-	SceneName string `arg:"" help:"Scene name."`
+	SceneName string `arg:"" help:"Name of the scene to list items from." default:""`
 }
 
 // Run executes the command to list all scene items in a scene.
 func (cmd *SceneItemListCmd) Run(ctx *context) error {
+	if cmd.SceneName == "" {
+		currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
+		if err != nil {
+			return fmt.Errorf("failed to get current program scene: %w", err)
+		}
+		cmd.SceneName = currentScene.SceneName
+	}
+
 	resp, err := ctx.Client.SceneItems.GetSceneItemList(sceneitems.NewGetSceneItemListParams().
 		WithSceneName(cmd.SceneName))
 	if err != nil {
 		return fmt.Errorf("failed to get scene item list: %w", err)
 	}
-	for _, item := range resp.SceneItems {
+
-		fmt.Fprintf(ctx.Out, "Item ID: %d, Source Name: %s\n", item.SceneItemID, item.SourceName)
+	if len(resp.SceneItems) == 0 {
+		fmt.Fprintf(ctx.Out, "No scene items found in scene '%s'.\n", cmd.SceneName)
+		return nil
 	}
+
+	t := table.New(ctx.Out)
+	t.SetPadding(3)
+	t.SetAlignment(table.AlignCenter, table.AlignLeft, table.AlignCenter, table.AlignCenter)
+	t.SetHeaders("Item ID", "Item Name", "In Group", "Enabled")
+
+	sort.Slice(resp.SceneItems, func(i, j int) bool {
+		return resp.SceneItems[i].SceneItemID < resp.SceneItems[j].SceneItemID
+	})
+
+	for _, item := range resp.SceneItems {
+		if item.IsGroup {
+			resp, err := ctx.Client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
+				WithSceneName(item.SourceName))
+			if err != nil {
+				return fmt.Errorf("failed to get group scene item list for '%s': %w", item.SourceName, err)
+			}
+
+			sort.Slice(resp.SceneItems, func(i, j int) bool {
+				return resp.SceneItems[i].SceneItemID < resp.SceneItems[j].SceneItemID
+			})
+
+			for _, groupItem := range resp.SceneItems {
+				t.AddRow(
+					fmt.Sprintf("%d", groupItem.SceneItemID),
+					groupItem.SourceName,
+					item.SourceName,
+					fmt.Sprintf("%t", item.SceneItemEnabled && groupItem.SceneItemEnabled),
+				)
+			}
+		} else {
+			t.AddRow(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, "", fmt.Sprintf("%t", item.SceneItemEnabled))
+		}
+	}
+	t.Render()
 	return nil
 }
 
+// getSceneNameAndItemID retrieves the scene name and item ID for a given item in a scene or group.
 func getSceneNameAndItemID(
 	client *goobs.Client,
 	sceneName string,
 	itemName string,
-	parent string,
+	group string,
 ) (string, int, error) {
-	if parent != "" {
+	if group != "" {
 		resp, err := client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
-			WithSceneName(parent))
+			WithSceneName(group))
 		if err != nil {
 			return "", 0, err
 		}
 		for _, item := range resp.SceneItems {
 			if item.SourceName == itemName {
-				return parent, int(item.SceneItemID), nil
+				return group, int(item.SceneItemID), nil
 			}
 		}
 		return "", 0, fmt.Errorf("item '%s' not found in scene '%s'", itemName, sceneName)
@@ -66,7 +114,7 @@ func getSceneNameAndItemID(
 
 // SceneItemShowCmd provides a command to show a scene item.
 type SceneItemShowCmd struct {
-	Parent string `flag:"" help:"Parent group name."`
+	Group string `flag:"" help:"Parent group name."`
 
 	SceneName string `arg:"" help:"Scene name."`
 	ItemName  string `arg:"" help:"Item name."`
@@ -74,7 +122,7 @@ type SceneItemShowCmd struct {
 
 // Run executes the command to show a scene item.
 func (cmd *SceneItemShowCmd) Run(ctx *context) error {
-	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
+	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
 	if err != nil {
 		return err
 	}
@@ -87,8 +135,8 @@ func (cmd *SceneItemShowCmd) Run(ctx *context) error {
 		return err
 	}
 
-	if cmd.Parent != "" {
+	if cmd.Group != "" {
-		fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' is now visible.\n", cmd.ItemName, cmd.Parent)
+		fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' is now visible.\n", cmd.ItemName, cmd.Group)
 	} else {
 		fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now visible.\n", cmd.ItemName, cmd.SceneName)
 	}
@@ -98,7 +146,7 @@ func (cmd *SceneItemShowCmd) Run(ctx *context) error {
 
 // SceneItemHideCmd provides a command to hide a scene item.
 type SceneItemHideCmd struct {
-	Parent string `flag:"" help:"Parent group name."`
+	Group string `flag:"" help:"Parent group name."`
 
 	SceneName string `arg:"" help:"Scene name."`
 	ItemName  string `arg:"" help:"Item name."`
@@ -106,7 +154,7 @@ type SceneItemHideCmd struct {
 
 // Run executes the command to hide a scene item.
 func (cmd *SceneItemHideCmd) Run(ctx *context) error {
-	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
+	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
 	if err != nil {
 		return err
 	}
@@ -119,8 +167,8 @@ func (cmd *SceneItemHideCmd) Run(ctx *context) error {
 		return err
 	}
 
-	if cmd.Parent != "" {
+	if cmd.Group != "" {
-		fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' is now hidden.\n", cmd.ItemName, cmd.Parent)
+		fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' is now hidden.\n", cmd.ItemName, cmd.Group)
 	} else {
 		fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now hidden.\n", cmd.ItemName, cmd.SceneName)
 	}
@@ -141,7 +189,7 @@ func getItemEnabled(client *goobs.Client, sceneName string, itemID int) (bool, e
 
 // SceneItemToggleCmd provides a command to toggle the visibility of a scene item.
 type SceneItemToggleCmd struct {
-	Parent string `flag:"" help:"Parent group name."`
+	Group string `flag:"" help:"Parent group name."`
 
 	SceneName string `arg:"" help:"Scene name."`
 	ItemName  string `arg:"" help:"Item name."`
@@ -149,7 +197,7 @@ type SceneItemToggleCmd struct {
 
 // Run executes the command to toggle the visibility of a scene item.
 func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
-	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
+	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
 	if err != nil {
 		return err
 	}
@@ -178,7 +226,7 @@ func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
 
 // SceneItemVisibleCmd provides a command to check the visibility of a scene item.
 type SceneItemVisibleCmd struct {
-	Parent string `flag:"" help:"Parent group name."`
+	Group string `flag:"" help:"Parent group name."`
 
 	SceneName string `arg:"" help:"Scene name."`
 	ItemName  string `arg:"" help:"Item name."`
@@ -186,7 +234,7 @@ type SceneItemVisibleCmd struct {
 
 // Run executes the command to check the visibility of a scene item.
 func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
-	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
+	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
 	if err != nil {
 		return err
 	}
@@ -209,7 +257,7 @@ type SceneItemTransformCmd struct {
 	SceneName string `arg:"" help:"Scene name."`
 	ItemName  string `arg:"" help:"Item name."`
 
-	Parent string `flag:"" help:"Parent group name."`
+	Group string `flag:"" help:"Parent group name."`
 
 	Alignment       float64 `flag:"" help:"Alignment of the scene item."`
 	BoundsAlignment float64 `flag:"" help:"Bounds alignment of the scene item."`
@@ -230,7 +278,7 @@ type SceneItemTransformCmd struct {
 
 // Run executes the command to transform a scene item.
 func (cmd *SceneItemTransformCmd) Run(ctx *context) error {
-	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
+	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
 	if err != nil {
 		return err
 	}
@@ -302,8 +350,8 @@ func (cmd *SceneItemTransformCmd) Run(ctx *context) error {
 		return err
 	}
 
-	if cmd.Parent != "" {
+	if cmd.Group != "" {
-		fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' transformed.\n", cmd.ItemName, cmd.Parent)
+		fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' transformed.\n", cmd.ItemName, cmd.Group)
 	} else {
 		fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' transformed.\n", cmd.ItemName, cmd.SceneName)
 	}

sceneitem_test.go

@@ -0,0 +1,32 @@
+package main
+
+import (
+	"bytes"
+	"strings"
+	"testing"
+)
+
+func TestSceneItemList(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmd := &SceneItemListCmd{
+		SceneName: "gobs-test",
+	}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to list scene items: %v", err)
+	}
+	if !strings.Contains(out.String(), "gobs-test-input") {
+		t.Fatalf("Expected output to contain 'gobs-test-input', got '%s'", out.String())
+	}
+	if !strings.Contains(out.String(), "gobs-test-input-2") {
+		t.Fatalf("Expected output to contain 'gobs-test-input-2', got '%s'", out.String())
+	}
+}

stream.go

@@ -17,10 +17,21 @@ type StreamStartCmd struct{} // size = 0x0
 
 // Run executes the command to start streaming.
 func (cmd *StreamStartCmd) Run(ctx *context) error {
-	_, err := ctx.Client.Stream.StartStream()
+	// Check if the stream is already active
+	status, err := ctx.Client.Stream.GetStreamStatus()
 	if err != nil {
 		return err
 	}
+	if status.OutputActive {
+		return fmt.Errorf("stream is already in progress")
+	}
+
+	_, err = ctx.Client.Stream.StartStream()
+	if err != nil {
+		return err
+	}
+
+	fmt.Fprintln(ctx.Out, "Stream started successfully.")
 	return nil
 }
 
@@ -29,10 +40,21 @@ type StreamStopCmd struct{} // size = 0x0
 
 // Run executes the command to stop streaming.
 func (cmd *StreamStopCmd) Run(ctx *context) error {
-	_, err := ctx.Client.Stream.StopStream()
+	// Check if the stream is already inactive
+	status, err := ctx.Client.Stream.GetStreamStatus()
 	if err != nil {
 		return err
 	}
+	if !status.OutputActive {
+		return fmt.Errorf("stream is not in progress")
+	}
+
+	_, err = ctx.Client.Stream.StopStream()
+	if err != nil {
+		return err
+	}
+
+	fmt.Fprintln(ctx.Out, "Stream stopped successfully.")
 	return nil
 }
 
@@ -41,19 +63,15 @@ type StreamToggleCmd struct{} // size = 0x0
 
 // Run executes the command to toggle streaming.
 func (cmd *StreamToggleCmd) Run(ctx *context) error {
-	status, err := ctx.Client.Stream.GetStreamStatus()
+	status, err := ctx.Client.Stream.ToggleStream()
 	if err != nil {
 		return err
 	}
+
 	if status.OutputActive {
-		_, err = ctx.Client.Stream.StopStream()
+		fmt.Fprintln(ctx.Out, "Stream started successfully.")
-		fmt.Fprintf(ctx.Out, "Stopping stream...\n")
 	} else {
-		_, err = ctx.Client.Stream.StartStream()
+		fmt.Fprintln(ctx.Out, "Stream stopped successfully.")
-		fmt.Fprintf(ctx.Out, "Starting stream...\n")
-	}
-	if err != nil {
-		return err
 	}
 	return nil
 }

stream_test.go

@@ -0,0 +1,132 @@
+package main
+
+import (
+	"bytes"
+	"strings"
+	"testing"
+	"time"
+)
+
+func TestStreamStart(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmdStatus := &StreamStatusCmd{}
+	err := cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get stream status: %v", err)
+	}
+	var active bool
+	if strings.Contains(out.String(), "Output active: true") {
+		active = true
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdStart := &StreamStartCmd{}
+	err = cmdStart.Run(context)
+	if active {
+		if err == nil {
+			t.Fatalf("Expected error when starting stream while active, got nil")
+		}
+		if !strings.Contains(err.Error(), "stream is already in progress") {
+			t.Fatalf("Expected error message to contain 'stream is already in progress', got '%s'", err.Error())
+		}
+		return
+	}
+	if err != nil {
+		t.Fatalf("Failed to start stream: %v", err)
+	}
+	if out.String() != "Stream started successfully.\n" {
+		t.Fatalf("Expected output to contain 'Stream started successfully.', got '%s'", out.String())
+	}
+	time.Sleep(2 * time.Second) // Wait for the stream to start
+}
+
+func TestStreamStop(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmdStatus := &StreamStatusCmd{}
+	err := cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get stream status: %v", err)
+	}
+	var active bool
+	if strings.Contains(out.String(), "Output active: true") {
+		active = true
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdStop := &StreamStopCmd{}
+	err = cmdStop.Run(context)
+	if !active {
+		if err == nil {
+			t.Fatalf("Expected error when stopping stream while inactive, got nil")
+		}
+		if !strings.Contains(err.Error(), "stream is not in progress") {
+			t.Fatalf("Expected error message to contain 'stream is not in progress', got '%s'", err.Error())
+		}
+		return
+	}
+	if err != nil {
+		t.Fatalf("Failed to stop stream: %v", err)
+	}
+	if out.String() != "Stream stopped successfully.\n" {
+		t.Fatalf("Expected output to contain 'Stream stopped successfully.', got '%s'", out.String())
+	}
+	time.Sleep(2 * time.Second) // Wait for the stream to stop
+}
+
+func TestStreamToggle(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmdStatus := &StreamStatusCmd{}
+	err := cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get stream status: %v", err)
+	}
+	var active bool
+	if strings.Contains(out.String(), "Output active: true") {
+		active = true
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdToggle := &StreamToggleCmd{}
+	err = cmdToggle.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to toggle stream: %v", err)
+	}
+
+	if active {
+		if out.String() != "Stream stopped successfully.\n" {
+			t.Fatalf("Expected 'Stream stopped successfully.', got: %s", out.String())
+		}
+	} else {
+		if out.String() != "Stream started successfully.\n" {
+			t.Fatalf("Expected 'Stream started successfully.', got: %s", out.String())
+		}
+	}
+	time.Sleep(2 * time.Second) // Wait for the stream to toggle
+}

studiomode.go

@@ -23,6 +23,8 @@ func (cmd *StudioModeEnableCmd) Run(ctx *context) error {
 	if err != nil {
 		return fmt.Errorf("failed to enable studio mode: %w", err)
 	}
+
+	fmt.Fprintln(ctx.Out, "Studio mode is now enabled")
 	return nil
 }
 
@@ -35,6 +37,8 @@ func (cmd *StudioModeDisableCmd) Run(ctx *context) error {
 	if err != nil {
 		return fmt.Errorf("failed to disable studio mode: %w", err)
 	}
+
+	fmt.Fprintln(ctx.Out, "Studio mode is now disabled")
 	return nil
 }
 

studiomode_test.go

@@ -0,0 +1,68 @@
+package main
+
+import (
+	"bytes"
+	"testing"
+)
+
+func TestStudioModeEnable(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmdEnable := &StudioModeEnableCmd{}
+	err := cmdEnable.Run(context)
+	if err != nil {
+		t.Fatalf("failed to enable studio mode: %v", err)
+	}
+	if out.String() != "Studio mode is now enabled\n" {
+		t.Fatalf("expected 'Studio mode is now enabled', got: %s", out.String())
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdStatus := &StudioModeStatusCmd{}
+	err = cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("failed to get studio mode status: %v", err)
+	}
+	if out.String() != "Studio mode is enabled\n" {
+		t.Fatalf("expected 'Studio mode is enabled', got: %s", out.String())
+	}
+}
+
+func TestStudioModeDisable(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmdDisable := &StudioModeDisableCmd{}
+	err := cmdDisable.Run(context)
+	if err != nil {
+		t.Fatalf("failed to disable studio mode: %v", err)
+	}
+	if out.String() != "Studio mode is now disabled\n" {
+		t.Fatalf("expected 'Studio mode is now disabled', got: %s", out.String())
+	}
+	// Reset output buffer for the next command
+	out.Reset()
+
+	cmdStatus := &StudioModeStatusCmd{}
+	err = cmdStatus.Run(context)
+	if err != nil {
+		t.Fatalf("failed to get studio mode status: %v", err)
+	}
+	if out.String() != "Studio mode is disabled\n" {
+		t.Fatalf("expected 'Studio mode is disabled', got: %s", out.String())
+	}
+}

util.go

@@ -0,0 +1,22 @@
+// Package util provides utility functions for the application.
+
+package main
+
+import "strings"
+
+func snakeCaseToTitleCase(snake string) string {
+	words := strings.Split(snake, "_")
+	for i, word := range words {
+		if len(word) > 0 {
+			words[i] = strings.ToUpper(word[:1]) + word[1:]
+		}
+	}
+	return strings.Join(words, " ")
+}
+
+func getEnabledMark(enabled bool) string {
+	if enabled {
+		return "\u2713" // green check mark
+	}
+	return "\u274c" // red cross mark
+}

util_test.go

@@ -0,0 +1,20 @@
+package main
+
+import "testing"
+
+func TestSnakeCaseToTitleCase(t *testing.T) {
+	tests := []struct {
+		input    string
+		expected string
+	}{
+		{"hello_world", "Hello World"},
+		{"snake_case_to_title_case", "Snake Case To Title Case"},
+	}
+
+	for _, test := range tests {
+		result := snakeCaseToTitleCase(test.input)
+		if result != test.expected {
+			t.Errorf("Expected '%s' but got '%s'", test.expected, result)
+		}
+	}
+}

version.go

@@ -2,13 +2,43 @@ package main
 
 import (
 	"fmt"
+	"runtime/debug"
+	"strings"
+
+	"github.com/alecthomas/kong"
 )
 
-// VersionCmd handles the version command.
+var version string
-type VersionCmd struct{} // size = 0x0
+
+// VersionFlag is a custom flag type for displaying version information.
+type VersionFlag string
+
+// Decode implements the kong.Flag interface for VersionFlag.
+func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil }
+
+// IsBool implements the kong.Flag interface for VersionFlag.
+func (v VersionFlag) IsBool() bool { return true }
+
+// BeforeApply implements the kong.Flag interface for VersionFlag.
+func (v VersionFlag) BeforeApply(app *kong.Kong, _ kong.Vars) error { // nolint: unparam
+	if version == "" {
+		info, ok := debug.ReadBuildInfo()
+		if !ok {
+			return fmt.Errorf("failed to read build info")
+		}
+		version = strings.Split(info.Main.Version, "-")[0]
+	}
+
+	fmt.Printf("gobs-cli version: %s\n", version)
+	app.Exit(0) // Exit the application after printing the version
+	return nil
+}
+
+// ObsVersionCmd handles the version command.
+type ObsVersionCmd struct{} // size = 0x0
 
 // Run executes the command to get the OBS client version.
-func (cmd *VersionCmd) Run(ctx *context) error {
+func (cmd *ObsVersionCmd) Run(ctx *context) error {
 	version, err := ctx.Client.General.GetVersion()
 	if err != nil {
 		return err

version_test.go

@@ -0,0 +1,30 @@
+package main
+
+import (
+	"bytes"
+	"strings"
+	"testing"
+)
+
+func TestVersion(t *testing.T) {
+	client, disconnect := getClient(t)
+	defer disconnect()
+
+	var out bytes.Buffer
+	context := &context{
+		Client: client,
+		Out:    &out,
+	}
+
+	cmd := &ObsVersionCmd{}
+	err := cmd.Run(context)
+	if err != nil {
+		t.Fatalf("Failed to get version: %v", err)
+	}
+	if !strings.Contains(out.String(), "OBS Client Version:") {
+		t.Fatalf("Expected output to contain 'OBS Client Version:', got '%s'", out.String())
+	}
+	if !strings.Contains(out.String(), "with Websocket Version:") {
+		t.Fatalf("Expected output to contain 'with Websocket Version:', got '%s'", out.String())
+	}
+}

virtualcam.go

@@ -6,17 +6,17 @@ import (
 
 // VirtualCamCmd handles the virtual camera commands.
 type VirtualCamCmd struct {
-	Start  StartVirtualCamCmd  `help:"Start virtual camera."      cmd:"" aliases:"s"`
+	Start  VirtualCamStartCmd  `help:"Start virtual camera."      cmd:"" aliases:"s"`
-	Stop   StopVirtualCamCmd   `help:"Stop virtual camera."       cmd:"" aliases:"st"`
+	Stop   VirtualCamStopCmd   `help:"Stop virtual camera."       cmd:"" aliases:"st"`
-	Toggle ToggleVirtualCamCmd `help:"Toggle virtual camera."     cmd:"" aliases:"tg"`
+	Toggle VirtualCamToggleCmd `help:"Toggle virtual camera."     cmd:"" aliases:"tg"`
-	Status StatusVirtualCamCmd `help:"Get virtual camera status." cmd:"" aliases:"ss"`
+	Status VirtualCamStatusCmd `help:"Get virtual camera status." cmd:"" aliases:"ss"`
 }
 
-// StartVirtualCamCmd starts the virtual camera.
+// VirtualCamStartCmd starts the virtual camera.
-type StartVirtualCamCmd struct{} // size = 0x0
+type VirtualCamStartCmd struct{} // size = 0x0
 
 // Run executes the command to start the virtual camera.
-func (c *StartVirtualCamCmd) Run(ctx *context) error {
+func (c *VirtualCamStartCmd) Run(ctx *context) error {
 	_, err := ctx.Client.Outputs.StartVirtualCam()
 	if err != nil {
 		return fmt.Errorf("failed to start virtual camera: %w", err)
@@ -25,11 +25,11 @@ func (c *StartVirtualCamCmd) Run(ctx *context) error {
 	return nil
 }
 
-// StopVirtualCamCmd stops the virtual camera.
+// VirtualCamStopCmd stops the virtual camera.
-type StopVirtualCamCmd struct{} // size = 0x0
+type VirtualCamStopCmd struct{} // size = 0x0
 
 // Run executes the command to stop the virtual camera.
-func (c *StopVirtualCamCmd) Run(ctx *context) error {
+func (c *VirtualCamStopCmd) Run(ctx *context) error {
 	_, err := ctx.Client.Outputs.StopVirtualCam()
 	if err != nil {
 		return fmt.Errorf("failed to stop virtual camera: %w", err)
@@ -38,23 +38,29 @@ func (c *StopVirtualCamCmd) Run(ctx *context) error {
 	return nil
 }
 
-// ToggleVirtualCamCmd toggles the virtual camera.
+// VirtualCamToggleCmd toggles the virtual camera.
-type ToggleVirtualCamCmd struct{} // size = 0x0
+type VirtualCamToggleCmd struct{} // size = 0x0
 
 // Run executes the command to toggle the virtual camera.
-func (c *ToggleVirtualCamCmd) Run(ctx *context) error {
+func (c *VirtualCamToggleCmd) Run(ctx *context) error {
-	_, err := ctx.Client.Outputs.ToggleVirtualCam()
+	resp, err := ctx.Client.Outputs.ToggleVirtualCam()
 	if err != nil {
 		return fmt.Errorf("failed to toggle virtual camera: %w", err)
 	}
+
+	if resp.OutputActive {
+		fmt.Fprintln(ctx.Out, "Virtual camera is now active.")
+	} else {
+		fmt.Fprintln(ctx.Out, "Virtual camera is now inactive.")
+	}
 	return nil
 }
 
-// StatusVirtualCamCmd retrieves the status of the virtual camera.
+// VirtualCamStatusCmd retrieves the status of the virtual camera.
-type StatusVirtualCamCmd struct{} // size = 0x0
+type VirtualCamStatusCmd struct{} // size = 0x0
 
 // Run executes the command to get the status of the virtual camera.
-func (c *StatusVirtualCamCmd) Run(ctx *context) error {
+func (c *VirtualCamStatusCmd) Run(ctx *context) error {
 	status, err := ctx.Client.Outputs.GetVirtualCamStatus()
 	if err != nil {
 		return fmt.Errorf("failed to get virtual camera status: %w", err)