mirror of
https://github.com/onyx-and-iris/gobs-cli.git
synced 2026-01-02 12:07:52 +00:00
Compare commits
76 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
| 1cf983a647 | |||
| dbc26bf6ff | |||
| 101c7552b2 | |||
| 1c0ef025c1 | |||
| 2b7b8e0bd5 | |||
| 040ece840c | |||
| c6406888a9 | |||
| f65af8298d | |||
| 1dfb6f87ac | |||
| 866aedde7c | |||
| 9eb6c8a282 | |||
| eb30cae5b7 | |||
| e6c03a2c92 | |||
| f6b82383f9 | |||
| 55f3b0c981 | |||
| 7da80a1ad2 | |||
| ea4ca2aeb9 | |||
| d2f0a64180 | |||
| f01fd0ca84 | |||
| 10d50df445 | |||
| 06cefe58ed | |||
| 7cd1c78f6a | |||
| 842d98edd3 | |||
| 930b387b85 | |||
| 2ab1c5bfc3 | |||
| 08f23fe47d | |||
| bbc6aec230 | |||
| 5d0ed2a166 | |||
| 62579b1c5e | |||
| 9ed00cd67c | |||
| 69bfaf694d | |||
| 7147c3f1ca | |||
| d699939298 | |||
| 82c0756dde | |||
| 4395c981c6 | |||
| dc043b5847 | |||
| c8a055fa28 | |||
| d9c0e40d8f | |||
| 42ab45b9fb | |||
| 27c3c5369b | |||
| 0a0c75ae51 | |||
| cf5da68137 | |||
| 14d9feb43e | |||
| 8204d6520d | |||
| 1d590eb788 | |||
| 29fe6fedfb | |||
| ee47832cd6 | |||
| 17b8e53da3 | |||
| 92761ab1b3 | |||
| 4446784709 | |||
| 89a5add7ad | |||
| 878ecbd33e | |||
| 18a90e727f | |||
| 95ebb2afb6 | |||
| 666b4cf744 | |||
| 9ee6fa9e34 | |||
| e5223fbdfd | |||
| c22ab4384d | |||
| 93a3d3e49f | |||
| 2228574837 | |||
| 8f1d42b677 | |||
| 620adf7e98 | |||
| 4a7b8a074a | |||
| 0811d711aa | |||
| 306f19eeae | |||
| 43dd77ffdc | |||
| f94ac1ca0c | |||
| c27a5ea6c5 | |||
| af962a26cc | |||
| 360d45aa47 | |||
| 3deb03cf32 | |||
| f58b2dfeab | |||
| 6ad530ce2e | |||
| d9d3c7c8b2 | |||
|
|
f72e34adfb | ||
| ccb3f59513 |
115
CHANGELOG.md
115
CHANGELOG.md
@ -5,12 +5,123 @@ All notable changes to this project will be documented in this file.
|
|||||||
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
||||||
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
||||||
|
|
||||||
|
# [0.14.1] - 2025-07-14
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- text command group, see [TextCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#textcmd)
|
||||||
|
|
||||||
|
# [0.13.3] - 2025-06-27
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- usage is now printed on errors.
|
||||||
|
- help is printed in compact mode. This should make it easier to page through help on the root command.
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Item ID alignment in sceneitem list table.
|
||||||
|
|
||||||
|
# [0.13.0] - 2025-06-23
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- record split and record chapter commands, see [RecordCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#recordcmd)
|
||||||
|
- As of OBS 30.2.0, the only file format supporting *record chapter* is Hybrid MP4.
|
||||||
|
|
||||||
|
# [0.12.1] - 2025-06-21
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Various colouring styles, see [Style](https://github.com/onyx-and-iris/gobs-cli/tree/main?tab=readme-ov-file#style)
|
||||||
|
- colouring is applied to list tables as well as highlighted information in stdout/stderr output.
|
||||||
|
- table border styling may be optionally disabled with the --no-border flag.
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- if an itemName is passed to a sceneitem command that's in a group, without the --group flag, a friendlier error message is displayed.
|
||||||
|
- it will suggest using *gobs-cli si ls* to list sources in the scene.
|
||||||
|
- if an invalid --monitor-index is passed to projector open a friendlier error message is displayed.
|
||||||
|
- it will suggest using *gobs-cli prj ls-m* to list available monitors.
|
||||||
|
|
||||||
|
|
||||||
|
# [0.11.0] - 2025-06-20
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- input list, scene list and sceneitem list now accept --uuid flag.
|
||||||
|
- Active column added to scene list table.
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- scene list no longer prints the UUIDs by default, enable it with the --uuid flag.
|
||||||
|
|
||||||
|
# [0.10.3] - 2025-06-07
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- filter list:
|
||||||
|
- --ffmpeg, --vlc flags
|
||||||
|
- Muted column to list table
|
||||||
|
|
||||||
|
# [0.10.2] - 2025-06-04
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- screenshot save command, see [ScreenshotCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#screenshotcmd)
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- filter list:
|
||||||
|
- sourceName arg now defaults to current scene.
|
||||||
|
- defaults are printed for any unmodified values.
|
||||||
|
- sceneitem list:
|
||||||
|
- prints enabled mark instead of true/false
|
||||||
|
|
||||||
|
# [0.9.0] - 2025-06-02
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- --version/-v option. See [Flags](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#flags)
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- version command renamed to obs-version
|
||||||
|
|
||||||
|
# [0.8.2] - 2025-05-29
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- record start/stop and stream start/stop commands check outputActive states first.
|
||||||
|
- Errors are returned if the command cannot be performed.
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- The --parent flag for the sceneitem commands has been renamed to --group, see [SceneItemCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#sceneitemcmd)
|
||||||
|
|
||||||
|
# [0.8.0] - 2025-05-27
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- record directory command, see [directory under RecordCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#recordcmd)
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- record stop now prints the output path of the recording.
|
||||||
|
|
||||||
|
|
||||||
|
# [0.7.0] - 2025-05-26
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- projector commands, see [ProjectorCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#projectorcmd)
|
||||||
|
|
||||||
|
|
||||||
# [0.6.1] - 2025-05-25
|
# [0.6.1] - 2025-05-25
|
||||||
|
|
||||||
### Added
|
### Added
|
||||||
|
|
||||||
- filter commands, see [Filter](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#filtercmd)
|
- filter commands, see [FilterCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#filtercmd)
|
||||||
|
|
||||||
### Changed
|
### Changed
|
||||||
|
|
||||||
@ -21,7 +132,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
|
|||||||
|
|
||||||
### Added
|
### Added
|
||||||
|
|
||||||
- hotkey commands, see [Hotkey](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#hotkeycmd)
|
- hotkey commands, see [HotkeyCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#hotkeycmd)
|
||||||
|
|
||||||
# [0.4.2] - 2025-05-08
|
# [0.4.2] - 2025-05-08
|
||||||
|
|
||||||
|
|||||||
183
README.md
183
README.md
@ -4,6 +4,16 @@ A command line interface for OBS Websocket v5
|
|||||||
|
|
||||||
For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)
|
For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)
|
||||||
|
|
||||||
|
-----
|
||||||
|
|
||||||
|
## Table of Contents
|
||||||
|
|
||||||
|
- [Installation](#installation)
|
||||||
|
- [Configuration](#configuration)
|
||||||
|
- [Style](#style)
|
||||||
|
- [Commands](#commands)
|
||||||
|
- [License](#license)
|
||||||
|
|
||||||
## Installation
|
## Installation
|
||||||
|
|
||||||
```console
|
```console
|
||||||
@ -14,10 +24,16 @@ go install github.com/onyx-and-iris/gobs-cli@latest
|
|||||||
|
|
||||||
#### Flags
|
#### Flags
|
||||||
|
|
||||||
Pass `--host`, `--port` and `--password` as flags to the root command, for example:
|
- --host/-H: Websocket host
|
||||||
|
- --port/-P Websocket port
|
||||||
|
- --password/-p: Websocket password
|
||||||
|
- --timeout/-T: Websocket timeout
|
||||||
|
- --version/-v: Print the gobs-cli version
|
||||||
|
|
||||||
|
Pass `--host`, `--port` and `--password` as flags on the root command, for example:
|
||||||
|
|
||||||
```console
|
```console
|
||||||
gobs-cli --host=localhost --port=4455 --password=<websocket password> --help
|
gobs-cli --host localhost --port 4455 --password 'websocket password' --help
|
||||||
```
|
```
|
||||||
|
|
||||||
#### Environment Variables
|
#### Environment Variables
|
||||||
@ -34,18 +50,54 @@ OBS_PASSWORD=<websocket password>
|
|||||||
OBS_TIMEOUT=5
|
OBS_TIMEOUT=5
|
||||||
```
|
```
|
||||||
|
|
||||||
|
## Style
|
||||||
|
|
||||||
|
Styling is opt-in, by default you will get a colourless output:
|
||||||
|
|
||||||
|

|
||||||
|
|
||||||
|
You may enable styling with the --style/-s flag:
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli --style="red" sceneitem list
|
||||||
|
```
|
||||||
|
|
||||||
|
Available styles: _red, magenta, purple, blue, cyan, green, yellow, orange, white, grey, navy, black_
|
||||||
|
|
||||||
|

|
||||||
|
|
||||||
|
Optionally you may disable border colouring with the --no-border flag:
|
||||||
|
|
||||||
|

|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli --style="red" --no-border sceneitem list
|
||||||
|
```
|
||||||
|
|
||||||
|
Or with environment variables:
|
||||||
|
|
||||||
|
```env
|
||||||
|
GOBS_STYLE=red
|
||||||
|
GOBS_STYLE_NO_BORDER=true
|
||||||
|
```
|
||||||
|
|
||||||
## Commands
|
## Commands
|
||||||
|
|
||||||
### VersionCmd
|
### ObsVersionCmd
|
||||||
|
|
||||||
|
- Print OBS client and websocket version.
|
||||||
|
|
||||||
```console
|
```console
|
||||||
gobs-cli version
|
gobs-cli obs-version
|
||||||
```
|
```
|
||||||
|
|
||||||
### SceneCmd
|
### SceneCmd
|
||||||
|
|
||||||
- list: List all scenes.
|
- list: List all scenes.
|
||||||
|
- flags:
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- --UUID: Display UUIDs of scenes.
|
||||||
|
|
||||||
```console
|
```console
|
||||||
gobs-cli scene list
|
gobs-cli scene list
|
||||||
@ -79,6 +131,10 @@ gobs-cli scene switch --preview LIVE
|
|||||||
### SceneItemCmd
|
### SceneItemCmd
|
||||||
|
|
||||||
- list: List all scene items.
|
- list: List all scene items.
|
||||||
|
- flags:
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- --UUID: Display UUIDs of scene items.
|
||||||
|
|
||||||
*optional*
|
*optional*
|
||||||
- args: SceneName
|
- args: SceneName
|
||||||
@ -94,7 +150,7 @@ gobs-cli sceneitem list LIVE
|
|||||||
- flags:
|
- flags:
|
||||||
|
|
||||||
*optional*
|
*optional*
|
||||||
- --parent: Parent group name.
|
- --group: Parent group name.
|
||||||
- args: SceneName ItemName
|
- args: SceneName ItemName
|
||||||
|
|
||||||
```console
|
```console
|
||||||
@ -105,7 +161,7 @@ gobs-cli sceneitem show START "Colour Source"
|
|||||||
- flags:
|
- flags:
|
||||||
|
|
||||||
*optional*
|
*optional*
|
||||||
- --parent: Parent group name.
|
- --group: Parent group name.
|
||||||
- args: SceneName ItemName
|
- args: SceneName ItemName
|
||||||
|
|
||||||
```console
|
```console
|
||||||
@ -116,28 +172,29 @@ gobs-cli sceneitem hide START "Colour Source"
|
|||||||
- flags:
|
- flags:
|
||||||
|
|
||||||
*optional*
|
*optional*
|
||||||
- --parent: Parent group name.
|
- --group: Parent group name.
|
||||||
- args: SceneName ItemName
|
- args: SceneName ItemName
|
||||||
|
|
||||||
```console
|
```console
|
||||||
gobs-cli sceneitem toggle --parent=test_group START "Colour Source 3"
|
gobs-cli sceneitem toggle --group=test_group START "Colour Source 3"
|
||||||
```
|
```
|
||||||
|
|
||||||
- visible: Get scene item visibility.
|
- visible: Get scene item visibility.
|
||||||
- flags:
|
- flags:
|
||||||
|
|
||||||
*optional*
|
*optional*
|
||||||
- --parent: Parent group name.
|
- --group: Parent group name.
|
||||||
- args: SceneName ItemName
|
- args: SceneName ItemName
|
||||||
|
|
||||||
```console
|
```console
|
||||||
gobs-cli sceneitem visible --parent=test_group START "Colour Source 4"
|
gobs-cli sceneitem visible --group=test_group START "Colour Source 4"
|
||||||
```
|
```
|
||||||
|
|
||||||
- transform: Transform scene item.
|
- transform: Transform scene item.
|
||||||
- flags:
|
- flags:
|
||||||
|
|
||||||
*optional*
|
*optional*
|
||||||
- --parent: Parent group name.
|
- --group: Parent group name.
|
||||||
|
|
||||||
- --alignment: Alignment of the scene item.
|
- --alignment: Alignment of the scene item.
|
||||||
- --bounds-alignment: Bounds alignment of the scene item.
|
- --bounds-alignment: Bounds alignment of the scene item.
|
||||||
@ -214,6 +271,9 @@ gobs-cli group status START "test_group"
|
|||||||
- --input: List all inputs.
|
- --input: List all inputs.
|
||||||
- --output: List all outputs.
|
- --output: List all outputs.
|
||||||
- --colour: List all colour sources.
|
- --colour: List all colour sources.
|
||||||
|
- --ffmpeg: List all ffmpeg sources.
|
||||||
|
- --vlc: List all VLC sources.
|
||||||
|
- --uuid: Display UUIDs of inputs.
|
||||||
|
|
||||||
```console
|
```console
|
||||||
gobs-cli input list
|
gobs-cli input list
|
||||||
@ -242,6 +302,22 @@ gobs-cli input unmute "Mic/Aux"
|
|||||||
gobs-cli input toggle "Mic/Aux"
|
gobs-cli input toggle "Mic/Aux"
|
||||||
```
|
```
|
||||||
|
|
||||||
|
### TextCmd
|
||||||
|
|
||||||
|
- current: Display current text for a text input.
|
||||||
|
- args: InputName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli text current "My Text Input"
|
||||||
|
```
|
||||||
|
|
||||||
|
- update: Update the text of a text input.
|
||||||
|
- args: InputName NewText
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli text update "My Text Input" "hi OBS!"
|
||||||
|
```
|
||||||
|
|
||||||
### RecordCmd
|
### RecordCmd
|
||||||
|
|
||||||
- start: Start recording.
|
- start: Start recording.
|
||||||
@ -280,6 +356,34 @@ gobs-cli record pause
|
|||||||
gobs-cli record resume
|
gobs-cli record resume
|
||||||
```
|
```
|
||||||
|
|
||||||
|
- directory: Get/Set recording directory.
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- args: RecordDirectory
|
||||||
|
- if not passed the current record directory will be printed.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli record directory
|
||||||
|
|
||||||
|
gobs-cli record directory "/home/me/obs-vids/"
|
||||||
|
gobs-cli record directory "C:/Users/me/Videos"
|
||||||
|
```
|
||||||
|
|
||||||
|
- split: Split recording.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli record split
|
||||||
|
```
|
||||||
|
|
||||||
|
- chapter: Create a chapter in the recording.
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- arg: ChapterName
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli record chapter "Chapter Name"
|
||||||
|
```
|
||||||
|
|
||||||
### StreamCmd
|
### StreamCmd
|
||||||
|
|
||||||
- start: Start streaming.
|
- start: Start streaming.
|
||||||
@ -491,6 +595,10 @@ gobs-cli hotkey trigger-sequence OBS_KEY_F1 --shift --ctrl
|
|||||||
|
|
||||||
- list: List all filters.
|
- list: List all filters.
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- args: SourceName
|
||||||
|
- defaults to current scene
|
||||||
|
|
||||||
```console
|
```console
|
||||||
gobs-cli filter list
|
gobs-cli filter list
|
||||||
```
|
```
|
||||||
@ -523,6 +631,57 @@ gobs-cli toggle 'Mic/Aux' 'Gain'
|
|||||||
gobs-cli status 'Mic/Aux' 'Gain'
|
gobs-cli status 'Mic/Aux' 'Gain'
|
||||||
```
|
```
|
||||||
|
|
||||||
|
### ProjectorCmd
|
||||||
|
|
||||||
|
- list-monitors: List available monitors.
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli projector list-monitors
|
||||||
|
```
|
||||||
|
|
||||||
|
- open: Open a fullscreen projector for a source on a specific monitor.
|
||||||
|
- flags:
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- --monitor-index: Index of the monitor to open the projector on.
|
||||||
|
- defaults to 0
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- args: SourceName
|
||||||
|
- defaults to current scene
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli projector open
|
||||||
|
|
||||||
|
gobs-cli projector open --monitor-index=1 "test_scene"
|
||||||
|
|
||||||
|
gobs-cli projector open --monitor-index=1 "test_group"
|
||||||
|
```
|
||||||
|
|
||||||
|
### ScreenshotCmd
|
||||||
|
|
||||||
|
- save: Take a screenshot and save it to a file.
|
||||||
|
- flags:
|
||||||
|
|
||||||
|
*optional*
|
||||||
|
- --width:
|
||||||
|
- defaults to 1920
|
||||||
|
- --height:
|
||||||
|
- defaults to 1080
|
||||||
|
- --quality:
|
||||||
|
- defaults to -1
|
||||||
|
|
||||||
|
- args: SourceName FilePath
|
||||||
|
|
||||||
|
```console
|
||||||
|
gobs-cli screenshot save --width=2560 --height=1440 "Scene" "C:\Users\me\Videos\screenshot.png"
|
||||||
|
```
|
||||||
|
|
||||||
|
## License
|
||||||
|
|
||||||
|
`gobs-cli` is distributed under the terms of the [MIT](https://spdx.org/licenses/MIT.html) license.
|
||||||
|
|
||||||
|
|
||||||
[userconfigdir]: https://pkg.go.dev/os#UserConfigDir
|
[userconfigdir]: https://pkg.go.dev/os#UserConfigDir
|
||||||
[obs-keyids]: https://github.com/obsproject/obs-studio/blob/master/libobs/obs-hotkeys.h
|
[obs-keyids]: https://github.com/obsproject/obs-studio/blob/master/libobs/obs-hotkeys.h
|
||||||
|
[no-colour]: https://no-color.org/
|
||||||
|
|||||||
@ -7,6 +7,8 @@ vars:
|
|||||||
PROGRAM: gobs-cli
|
PROGRAM: gobs-cli
|
||||||
SHELL: '{{if eq .OS "Windows_NT"}}powershell{{end}}'
|
SHELL: '{{if eq .OS "Windows_NT"}}powershell{{end}}'
|
||||||
BIN_DIR: bin
|
BIN_DIR: bin
|
||||||
|
VERSION:
|
||||||
|
sh: 'git describe --tags $(git rev-list --tags --max-count=1)'
|
||||||
|
|
||||||
tasks:
|
tasks:
|
||||||
default:
|
default:
|
||||||
@ -20,6 +22,7 @@ tasks:
|
|||||||
cmds:
|
cmds:
|
||||||
- task: build-windows
|
- task: build-windows
|
||||||
- task: build-linux
|
- task: build-linux
|
||||||
|
- task: build-macos
|
||||||
|
|
||||||
vet:
|
vet:
|
||||||
desc: Vet the code
|
desc: Vet the code
|
||||||
@ -35,13 +38,19 @@ tasks:
|
|||||||
build-windows:
|
build-windows:
|
||||||
desc: Build the gobs-cli project for Windows
|
desc: Build the gobs-cli project for Windows
|
||||||
cmds:
|
cmds:
|
||||||
- GOOS=windows GOARCH=amd64 go build -o {{.BIN_DIR}}/{{.PROGRAM}}_windows_amd64.exe
|
- GOOS=windows GOARCH=amd64 go build -ldflags "-X 'main.version={{.VERSION}}'" -o {{.BIN_DIR}}/{{.PROGRAM}}_windows_amd64.exe
|
||||||
internal: true
|
internal: true
|
||||||
|
|
||||||
build-linux:
|
build-linux:
|
||||||
desc: Build the gobs-cli project for Linux
|
desc: Build the gobs-cli project for Linux
|
||||||
cmds:
|
cmds:
|
||||||
- GOOS=linux GOARCH=amd64 go build -o {{.BIN_DIR}}/{{.PROGRAM}}_linux_amd64
|
- GOOS=linux GOARCH=amd64 go build -ldflags "-X 'main.version={{.VERSION}}'" -o {{.BIN_DIR}}/{{.PROGRAM}}_linux_amd64
|
||||||
|
internal: true
|
||||||
|
|
||||||
|
build-macos:
|
||||||
|
desc: Build the gobs-cli project for macOS
|
||||||
|
cmds:
|
||||||
|
- GOOS=darwin GOARCH=amd64 go build -ldflags "-X 'main.version={{.VERSION}}'" -o {{.BIN_DIR}}/{{.PROGRAM}}_darwin_amd64
|
||||||
internal: true
|
internal: true
|
||||||
|
|
||||||
test:
|
test:
|
||||||
|
|||||||
92
filter.go
92
filter.go
@ -2,11 +2,13 @@ package main
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"fmt"
|
"fmt"
|
||||||
|
"maps"
|
||||||
"sort"
|
"sort"
|
||||||
"strings"
|
"strings"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/filters"
|
"github.com/andreykaipov/goobs/api/requests/filters"
|
||||||
"github.com/aquasecurity/table"
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// FilterCmd provides commands to manage filters in OBS Studio.
|
// FilterCmd provides commands to manage filters in OBS Studio.
|
||||||
@ -20,45 +22,85 @@ type FilterCmd struct {
|
|||||||
|
|
||||||
// FilterListCmd provides a command to list all filters in a scene.
|
// FilterListCmd provides a command to list all filters in a scene.
|
||||||
type FilterListCmd struct {
|
type FilterListCmd struct {
|
||||||
SourceName string `arg:"" help:"Name of the source to list filters from."`
|
SourceName string `arg:"" help:"Name of the source to list filters from." default:""`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to list all filters in a scene.
|
// Run executes the command to list all filters in a scene.
|
||||||
|
// nolint: misspell
|
||||||
func (cmd *FilterListCmd) Run(ctx *context) error {
|
func (cmd *FilterListCmd) Run(ctx *context) error {
|
||||||
filters, err := ctx.Client.Filters.GetSourceFilterList(
|
if cmd.SourceName == "" {
|
||||||
|
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get current program scene: %w", err)
|
||||||
|
}
|
||||||
|
cmd.SourceName = currentScene.SceneName
|
||||||
|
}
|
||||||
|
|
||||||
|
sourceFilters, err := ctx.Client.Filters.GetSourceFilterList(
|
||||||
filters.NewGetSourceFilterListParams().WithSourceName(cmd.SourceName),
|
filters.NewGetSourceFilterListParams().WithSourceName(cmd.SourceName),
|
||||||
)
|
)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
if len(filters.Filters) == 0 {
|
if len(sourceFilters.Filters) == 0 {
|
||||||
fmt.Fprintf(ctx.Out, "No filters found for source %s.\n", cmd.SourceName)
|
fmt.Fprintf(ctx.Out, "No filters found for source %s.\n", ctx.Style.Highlight(cmd.SourceName))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
t := table.New(ctx.Out)
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
t.SetPadding(3)
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||||
t.SetAlignment(table.AlignLeft, table.AlignLeft, table.AlignCenter, table.AlignLeft)
|
Headers("Filter Name", "Kind", "Enabled", "Settings").
|
||||||
t.SetHeaders("Filter Name", "Kind", "Enabled", "Settings")
|
StyleFunc(func(row, col int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch col {
|
||||||
|
case 0:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
case 1:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
case 2:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
case 3:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
}
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center)
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
|
for _, filter := range sourceFilters.Filters {
|
||||||
|
defaultSettings, err := ctx.Client.Filters.GetSourceFilterDefaultSettings(
|
||||||
|
filters.NewGetSourceFilterDefaultSettingsParams().
|
||||||
|
WithFilterKind(filter.FilterKind),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get default settings for filter %s: %w",
|
||||||
|
ctx.Style.Error(filter.FilterName), err)
|
||||||
|
}
|
||||||
|
maps.Insert(defaultSettings.DefaultFilterSettings, maps.All(filter.FilterSettings))
|
||||||
|
|
||||||
for _, filter := range filters.Filters {
|
|
||||||
var lines []string
|
var lines []string
|
||||||
for k, v := range filter.FilterSettings {
|
for k, v := range defaultSettings.DefaultFilterSettings {
|
||||||
lines = append(lines, fmt.Sprintf("%s %v", k, v))
|
lines = append(lines, fmt.Sprintf("%s: %v", snakeCaseToTitleCase(k), v))
|
||||||
}
|
}
|
||||||
sort.Slice(lines, func(i, j int) bool {
|
sort.Slice(lines, func(i, j int) bool {
|
||||||
return strings.ToLower(lines[i]) < strings.ToLower(lines[j])
|
return strings.ToLower(lines[i]) < strings.ToLower(lines[j])
|
||||||
})
|
})
|
||||||
|
|
||||||
t.AddRow(
|
t.Row(
|
||||||
filter.FilterName,
|
filter.FilterName,
|
||||||
snakeCaseToTitleCase(filter.FilterKind),
|
snakeCaseToTitleCase(filter.FilterKind),
|
||||||
getEnabledMark(filter.FilterEnabled),
|
getEnabledMark(filter.FilterEnabled),
|
||||||
strings.Join(lines, "\n"),
|
strings.Join(lines, "\n"),
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
t.Render()
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -78,10 +120,10 @@ func (cmd *FilterEnableCmd) Run(ctx *context) error {
|
|||||||
)
|
)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to enable filter %s on source %s: %w",
|
return fmt.Errorf("failed to enable filter %s on source %s: %w",
|
||||||
cmd.FilterName, cmd.SourceName, err)
|
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||||
}
|
}
|
||||||
fmt.Fprintf(ctx.Out, "Filter %s enabled on source %s.\n",
|
fmt.Fprintf(ctx.Out, "Filter %s enabled on source %s.\n",
|
||||||
cmd.FilterName, cmd.SourceName)
|
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -101,10 +143,10 @@ func (cmd *FilterDisableCmd) Run(ctx *context) error {
|
|||||||
)
|
)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to disable filter %s on source %s: %w",
|
return fmt.Errorf("failed to disable filter %s on source %s: %w",
|
||||||
cmd.FilterName, cmd.SourceName, err)
|
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||||
}
|
}
|
||||||
fmt.Fprintf(ctx.Out, "Filter %s disabled on source %s.\n",
|
fmt.Fprintf(ctx.Out, "Filter %s disabled on source %s.\n",
|
||||||
cmd.FilterName, cmd.SourceName)
|
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -123,7 +165,7 @@ func (cmd *FilterToggleCmd) Run(ctx *context) error {
|
|||||||
)
|
)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to get filter %s on source %s: %w",
|
return fmt.Errorf("failed to get filter %s on source %s: %w",
|
||||||
cmd.FilterName, cmd.SourceName, err)
|
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||||
}
|
}
|
||||||
|
|
||||||
newStatus := !filter.FilterEnabled
|
newStatus := !filter.FilterEnabled
|
||||||
@ -135,15 +177,15 @@ func (cmd *FilterToggleCmd) Run(ctx *context) error {
|
|||||||
)
|
)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to toggle filter %s on source %s: %w",
|
return fmt.Errorf("failed to toggle filter %s on source %s: %w",
|
||||||
cmd.FilterName, cmd.SourceName, err)
|
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||||
}
|
}
|
||||||
|
|
||||||
if newStatus {
|
if newStatus {
|
||||||
fmt.Fprintf(ctx.Out, "Filter %s on source %s is now enabled.\n",
|
fmt.Fprintf(ctx.Out, "Filter %s on source %s is now enabled.\n",
|
||||||
cmd.FilterName, cmd.SourceName)
|
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Filter %s on source %s is now disabled.\n",
|
fmt.Fprintf(ctx.Out, "Filter %s on source %s is now disabled.\n",
|
||||||
cmd.FilterName, cmd.SourceName)
|
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@ -163,14 +205,14 @@ func (cmd *FilterStatusCmd) Run(ctx *context) error {
|
|||||||
)
|
)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to get status of filter %s on source %s: %w",
|
return fmt.Errorf("failed to get status of filter %s on source %s: %w",
|
||||||
cmd.FilterName, cmd.SourceName, err)
|
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||||
}
|
}
|
||||||
if filter.FilterEnabled {
|
if filter.FilterEnabled {
|
||||||
fmt.Fprintf(ctx.Out, "Filter %s on source %s is enabled.\n",
|
fmt.Fprintf(ctx.Out, "Filter %s on source %s is enabled.\n",
|
||||||
cmd.FilterName, cmd.SourceName)
|
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Filter %s on source %s is disabled.\n",
|
fmt.Fprintf(ctx.Out, "Filter %s on source %s is disabled.\n",
|
||||||
cmd.FilterName, cmd.SourceName)
|
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
67
filter_test.go
Normal file
67
filter_test.go
Normal file
@ -0,0 +1,67 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestFilterList(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := newContext(client, &out, StyleConfig{})
|
||||||
|
|
||||||
|
cmd := &FilterListCmd{
|
||||||
|
SourceName: "Mic/Aux",
|
||||||
|
}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list filters: %v", err)
|
||||||
|
}
|
||||||
|
if !strings.Contains(out.String(), "test_filter") {
|
||||||
|
t.Fatalf("Expected output to contain 'test_filter', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestFilterListScene(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := newContext(client, &out, StyleConfig{})
|
||||||
|
|
||||||
|
cmd := &FilterListCmd{
|
||||||
|
SourceName: "gobs-test-scene",
|
||||||
|
}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list filters in scene: %v", err)
|
||||||
|
}
|
||||||
|
if !strings.Contains(out.String(), "test_filter") {
|
||||||
|
t.Fatalf("Expected output to contain 'test_filter', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestFilterListEmpty(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := newContext(client, &out, StyleConfig{})
|
||||||
|
|
||||||
|
cmd := &FilterListCmd{
|
||||||
|
SourceName: "NonExistentSource",
|
||||||
|
}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err == nil {
|
||||||
|
t.Fatal("Expected error for non-existent source, but got none")
|
||||||
|
}
|
||||||
|
if !strings.Contains(err.Error(), "No source was found by the name of `NonExistentSource`.") {
|
||||||
|
t.Fatalf(
|
||||||
|
"Expected error to contain 'No source was found by the name of `NonExistentSource`.', got '%s'",
|
||||||
|
err.Error(),
|
||||||
|
)
|
||||||
|
}
|
||||||
|
}
|
||||||
18
go.mod
18
go.mod
@ -6,22 +6,30 @@ require (
|
|||||||
github.com/alecthomas/kong v1.10.0
|
github.com/alecthomas/kong v1.10.0
|
||||||
github.com/alecthomas/mango-kong v0.1.0
|
github.com/alecthomas/mango-kong v0.1.0
|
||||||
github.com/andreykaipov/goobs v1.5.6
|
github.com/andreykaipov/goobs v1.5.6
|
||||||
github.com/aquasecurity/table v1.10.0
|
github.com/charmbracelet/lipgloss v1.1.0
|
||||||
github.com/titusjaka/kong-dotenv-go v0.1.0
|
github.com/titusjaka/kong-dotenv-go v0.1.0
|
||||||
)
|
)
|
||||||
|
|
||||||
require (
|
require (
|
||||||
|
github.com/aymanbagabas/go-osc52/v2 v2.0.1 // indirect
|
||||||
github.com/buger/jsonparser v1.1.1 // indirect
|
github.com/buger/jsonparser v1.1.1 // indirect
|
||||||
|
github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc // indirect
|
||||||
|
github.com/charmbracelet/x/ansi v0.8.0 // indirect
|
||||||
|
github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd // indirect
|
||||||
|
github.com/charmbracelet/x/term v0.2.1 // indirect
|
||||||
github.com/gorilla/websocket v1.5.3 // indirect
|
github.com/gorilla/websocket v1.5.3 // indirect
|
||||||
github.com/hashicorp/logutils v1.0.0 // indirect
|
github.com/hashicorp/logutils v1.0.0 // indirect
|
||||||
github.com/joho/godotenv v1.5.1 // indirect
|
github.com/joho/godotenv v1.5.1 // indirect
|
||||||
github.com/mattn/go-runewidth v0.0.13 // indirect
|
github.com/lucasb-eyer/go-colorful v1.2.0 // indirect
|
||||||
|
github.com/mattn/go-isatty v0.0.20 // indirect
|
||||||
|
github.com/mattn/go-runewidth v0.0.16 // indirect
|
||||||
github.com/mitchellh/mapstructure v1.5.0 // indirect
|
github.com/mitchellh/mapstructure v1.5.0 // indirect
|
||||||
github.com/mmcloughlin/profile v0.1.1 // indirect
|
github.com/mmcloughlin/profile v0.1.1 // indirect
|
||||||
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab // indirect
|
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab // indirect
|
||||||
github.com/muesli/roff v0.1.0 // indirect
|
github.com/muesli/roff v0.1.0 // indirect
|
||||||
|
github.com/muesli/termenv v0.16.0 // indirect
|
||||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d // indirect
|
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d // indirect
|
||||||
github.com/rivo/uniseg v0.2.0 // indirect
|
github.com/rivo/uniseg v0.4.7 // indirect
|
||||||
golang.org/x/sys v0.0.0-20210615035016-665e8c7367d1 // indirect
|
github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e // indirect
|
||||||
golang.org/x/term v0.0.0-20220526004731-065cf7ba2467 // indirect
|
golang.org/x/sys v0.30.0 // indirect
|
||||||
)
|
)
|
||||||
|
|||||||
42
go.sum
42
go.sum
@ -8,10 +8,24 @@ github.com/alecthomas/repr v0.4.0 h1:GhI2A8MACjfegCPVq9f1FLvIBS+DrQ2KQBFZP1iFzXc
|
|||||||
github.com/alecthomas/repr v0.4.0/go.mod h1:Fr0507jx4eOXV7AlPV6AVZLYrLIuIeSOWtW57eE/O/4=
|
github.com/alecthomas/repr v0.4.0/go.mod h1:Fr0507jx4eOXV7AlPV6AVZLYrLIuIeSOWtW57eE/O/4=
|
||||||
github.com/andreykaipov/goobs v1.5.6 h1:eIkEqYN99+2VJvmlY/56Ah60nkRKS6efMQvpM3oUgPQ=
|
github.com/andreykaipov/goobs v1.5.6 h1:eIkEqYN99+2VJvmlY/56Ah60nkRKS6efMQvpM3oUgPQ=
|
||||||
github.com/andreykaipov/goobs v1.5.6/go.mod h1:iSZP93FJ4d9X/U1x4DD4IyILLtig+vViqZWBGjLywcY=
|
github.com/andreykaipov/goobs v1.5.6/go.mod h1:iSZP93FJ4d9X/U1x4DD4IyILLtig+vViqZWBGjLywcY=
|
||||||
github.com/aquasecurity/table v1.10.0 h1:gPWV28qp9XSlvXdT3ku8yKQoZE6II0vsmegKpW+dB08=
|
github.com/aymanbagabas/go-osc52/v2 v2.0.1 h1:HwpRHbFMcZLEVr42D4p7XBqjyuxQH5SMiErDT4WkJ2k=
|
||||||
github.com/aquasecurity/table v1.10.0/go.mod h1:eqOmvjjB7AhXFgFqpJUEE/ietg7RrMSJZXyTN8E/wZw=
|
github.com/aymanbagabas/go-osc52/v2 v2.0.1/go.mod h1:uYgXzlJ7ZpABp8OJ+exZzJJhRNQ2ASbcXHWsFqH8hp8=
|
||||||
|
github.com/aymanbagabas/go-udiff v0.2.0 h1:TK0fH4MteXUDspT88n8CKzvK0X9O2xu9yQjWpi6yML8=
|
||||||
|
github.com/aymanbagabas/go-udiff v0.2.0/go.mod h1:RE4Ex0qsGkTAJoQdQQCA0uG+nAzJO/pI/QwceO5fgrA=
|
||||||
github.com/buger/jsonparser v1.1.1 h1:2PnMjfWD7wBILjqQbt530v576A/cAbQvEW9gGIpYMUs=
|
github.com/buger/jsonparser v1.1.1 h1:2PnMjfWD7wBILjqQbt530v576A/cAbQvEW9gGIpYMUs=
|
||||||
github.com/buger/jsonparser v1.1.1/go.mod h1:6RYKKt7H4d4+iWqouImQ9R2FZql3VbhNgx27UK13J/0=
|
github.com/buger/jsonparser v1.1.1/go.mod h1:6RYKKt7H4d4+iWqouImQ9R2FZql3VbhNgx27UK13J/0=
|
||||||
|
github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc h1:4pZI35227imm7yK2bGPcfpFEmuY1gc2YSTShr4iJBfs=
|
||||||
|
github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc/go.mod h1:X4/0JoqgTIPSFcRA/P6INZzIuyqdFY5rm8tb41s9okk=
|
||||||
|
github.com/charmbracelet/lipgloss v1.1.0 h1:vYXsiLHVkK7fp74RkV7b2kq9+zDLoEU4MZoFqR/noCY=
|
||||||
|
github.com/charmbracelet/lipgloss v1.1.0/go.mod h1:/6Q8FR2o+kj8rz4Dq0zQc3vYf7X+B0binUUBwA0aL30=
|
||||||
|
github.com/charmbracelet/x/ansi v0.8.0 h1:9GTq3xq9caJW8ZrBTe0LIe2fvfLR/bYXKTx2llXn7xE=
|
||||||
|
github.com/charmbracelet/x/ansi v0.8.0/go.mod h1:wdYl/ONOLHLIVmQaxbIYEC/cRKOQyjTkowiI4blgS9Q=
|
||||||
|
github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd h1:vy0GVL4jeHEwG5YOXDmi86oYw2yuYUGqz6a8sLwg0X8=
|
||||||
|
github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd/go.mod h1:xe0nKWGd3eJgtqZRaN9RjMtK7xUYchjzPr7q6kcvCCs=
|
||||||
|
github.com/charmbracelet/x/exp/golden v0.0.0-20240806155701-69247e0abc2a h1:G99klV19u0QnhiizODirwVksQB91TJKV/UaTnACcG30=
|
||||||
|
github.com/charmbracelet/x/exp/golden v0.0.0-20240806155701-69247e0abc2a/go.mod h1:wDlXFlCrmJ8J+swcL/MnGUuYnqgQdW9rhSD61oNMb6U=
|
||||||
|
github.com/charmbracelet/x/term v0.2.1 h1:AQeHeLZ1OqSXhrAWpYUtZyX1T3zVxfpZuEQMIQaGIAQ=
|
||||||
|
github.com/charmbracelet/x/term v0.2.1/go.mod h1:oQ4enTYFV7QN4m0i9mzHrViD7TQKvNEEkHUMCmsxdUg=
|
||||||
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||||
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||||
github.com/gorilla/websocket v1.5.3 h1:saDtZ6Pbx/0u+bgYQ3q96pZgCzfhKXGPqt7kZ72aNNg=
|
github.com/gorilla/websocket v1.5.3 h1:saDtZ6Pbx/0u+bgYQ3q96pZgCzfhKXGPqt7kZ72aNNg=
|
||||||
@ -22,8 +36,12 @@ github.com/hexops/gotextdiff v1.0.3 h1:gitA9+qJrrTCsiCl7+kh75nPqQt1cx4ZkudSTLoUq
|
|||||||
github.com/hexops/gotextdiff v1.0.3/go.mod h1:pSWU5MAI3yDq+fZBTazCSJysOMbxWL1BSow5/V2vxeg=
|
github.com/hexops/gotextdiff v1.0.3/go.mod h1:pSWU5MAI3yDq+fZBTazCSJysOMbxWL1BSow5/V2vxeg=
|
||||||
github.com/joho/godotenv v1.5.1 h1:7eLL/+HRGLY0ldzfGMeQkb7vMd0as4CfYvUVzLqw0N0=
|
github.com/joho/godotenv v1.5.1 h1:7eLL/+HRGLY0ldzfGMeQkb7vMd0as4CfYvUVzLqw0N0=
|
||||||
github.com/joho/godotenv v1.5.1/go.mod h1:f4LDr5Voq0i2e/R5DDNOoa2zzDfwtkZa6DnEwAbqwq4=
|
github.com/joho/godotenv v1.5.1/go.mod h1:f4LDr5Voq0i2e/R5DDNOoa2zzDfwtkZa6DnEwAbqwq4=
|
||||||
github.com/mattn/go-runewidth v0.0.13 h1:lTGmDsbAYt5DmK6OnoV7EuIF1wEIFAcxld6ypU4OSgU=
|
github.com/lucasb-eyer/go-colorful v1.2.0 h1:1nnpGOrhyZZuNyfu1QjKiUICQ74+3FNCN69Aj6K7nkY=
|
||||||
github.com/mattn/go-runewidth v0.0.13/go.mod h1:Jdepj2loyihRzMpdS35Xk/zdY8IAYHsh153qUoGf23w=
|
github.com/lucasb-eyer/go-colorful v1.2.0/go.mod h1:R4dSotOR9KMtayYi1e77YzuveK+i7ruzyGqttikkLy0=
|
||||||
|
github.com/mattn/go-isatty v0.0.20 h1:xfD0iDuEKnDkl03q4limB+vH+GxLEtL/jb4xVJSWWEY=
|
||||||
|
github.com/mattn/go-isatty v0.0.20/go.mod h1:W+V8PltTTMOvKvAeJH7IuucS94S2C6jfK/D7dTCTo3Y=
|
||||||
|
github.com/mattn/go-runewidth v0.0.16 h1:E5ScNMtiwvlvB5paMFdw9p4kSQzbXFikJ5SQO6TULQc=
|
||||||
|
github.com/mattn/go-runewidth v0.0.16/go.mod h1:Jdepj2loyihRzMpdS35Xk/zdY8IAYHsh153qUoGf23w=
|
||||||
github.com/mitchellh/mapstructure v1.5.0 h1:jeMsZIYE/09sWLaz43PL7Gy6RuMjD2eJVyuac5Z2hdY=
|
github.com/mitchellh/mapstructure v1.5.0 h1:jeMsZIYE/09sWLaz43PL7Gy6RuMjD2eJVyuac5Z2hdY=
|
||||||
github.com/mitchellh/mapstructure v1.5.0/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo=
|
github.com/mitchellh/mapstructure v1.5.0/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo=
|
||||||
github.com/mmcloughlin/profile v0.1.1 h1:jhDmAqPyebOsVDOCICJoINoLb/AnLBaUw58nFzxWS2w=
|
github.com/mmcloughlin/profile v0.1.1 h1:jhDmAqPyebOsVDOCICJoINoLb/AnLBaUw58nFzxWS2w=
|
||||||
@ -32,19 +50,25 @@ github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab h1:m7QFONkzLK0fVXCj
|
|||||||
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab/go.mod h1:5XFpbC8jY5UUv89YQciiXNlbi+iJgt29VDC5xbzrLL4=
|
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab/go.mod h1:5XFpbC8jY5UUv89YQciiXNlbi+iJgt29VDC5xbzrLL4=
|
||||||
github.com/muesli/roff v0.1.0 h1:YD0lalCotmYuF5HhZliKWlIx7IEhiXeSfq7hNjFqGF8=
|
github.com/muesli/roff v0.1.0 h1:YD0lalCotmYuF5HhZliKWlIx7IEhiXeSfq7hNjFqGF8=
|
||||||
github.com/muesli/roff v0.1.0/go.mod h1:pjAHQM9hdUUwm/krAfrLGgJkXJ+YuhtsfZ42kieB2Ig=
|
github.com/muesli/roff v0.1.0/go.mod h1:pjAHQM9hdUUwm/krAfrLGgJkXJ+YuhtsfZ42kieB2Ig=
|
||||||
|
github.com/muesli/termenv v0.16.0 h1:S5AlUN9dENB57rsbnkPyfdGuWIlkmzJjbFf0Tf5FWUc=
|
||||||
|
github.com/muesli/termenv v0.16.0/go.mod h1:ZRfOIKPFDYQoDFF4Olj7/QJbW60Ol/kL1pU3VfY/Cnk=
|
||||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d h1:VhgPp6v9qf9Agr/56bj7Y/xa04UccTW04VP0Qed4vnQ=
|
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d h1:VhgPp6v9qf9Agr/56bj7Y/xa04UccTW04VP0Qed4vnQ=
|
||||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d/go.mod h1:YUTz3bUH2ZwIWBy3CJBeOBEugqcmXREj14T+iG/4k4U=
|
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d/go.mod h1:YUTz3bUH2ZwIWBy3CJBeOBEugqcmXREj14T+iG/4k4U=
|
||||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||||
github.com/rivo/uniseg v0.2.0 h1:S1pD9weZBuJdFmowNwbpi7BJ8TNftyUImj/0WQi72jY=
|
|
||||||
github.com/rivo/uniseg v0.2.0/go.mod h1:J6wj4VEh+S6ZtnVlnTBMWIodfgj8LQOQFoIToxlJtxc=
|
github.com/rivo/uniseg v0.2.0/go.mod h1:J6wj4VEh+S6ZtnVlnTBMWIodfgj8LQOQFoIToxlJtxc=
|
||||||
|
github.com/rivo/uniseg v0.4.7 h1:WUdvkW8uEhrYfLC4ZzdpI2ztxP1I582+49Oc5Mq64VQ=
|
||||||
|
github.com/rivo/uniseg v0.4.7/go.mod h1:FN3SvrM+Zdj16jyLfmOkMNblXMcoc8DfTHruCPUcx88=
|
||||||
github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA=
|
github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA=
|
||||||
github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
|
github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
|
||||||
github.com/titusjaka/kong-dotenv-go v0.1.0 h1:TmUjP/sXoNiKLr6oR7n9xrB5XyXi/Ssuebzfz5nxZj4=
|
github.com/titusjaka/kong-dotenv-go v0.1.0 h1:TmUjP/sXoNiKLr6oR7n9xrB5XyXi/Ssuebzfz5nxZj4=
|
||||||
github.com/titusjaka/kong-dotenv-go v0.1.0/go.mod h1:pBgLjcu82oqUgb7+bngK9+Ch7jg49E0YADP8Wnj2MXU=
|
github.com/titusjaka/kong-dotenv-go v0.1.0/go.mod h1:pBgLjcu82oqUgb7+bngK9+Ch7jg49E0YADP8Wnj2MXU=
|
||||||
golang.org/x/sys v0.0.0-20210615035016-665e8c7367d1 h1:SrN+KX8Art/Sf4HNj6Zcz06G7VEz+7w9tdXTPOZ7+l4=
|
github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e h1:JVG44RsyaB9T2KIHavMF/ppJZNG9ZpyihvCd0w101no=
|
||||||
golang.org/x/sys v0.0.0-20210615035016-665e8c7367d1/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e/go.mod h1:RbqR21r5mrJuqunuUZ/Dhy/avygyECGrLceyNeo4LiM=
|
||||||
golang.org/x/term v0.0.0-20220526004731-065cf7ba2467 h1:CBpWXWQpIRjzmkkA+M7q9Fqnwd2mZr3AFqexg8YTfoM=
|
golang.org/x/exp v0.0.0-20220909182711-5c715a9e8561 h1:MDc5xs78ZrZr3HMQugiXOAkSZtfTpbJLDr/lwfgO53E=
|
||||||
golang.org/x/term v0.0.0-20220526004731-065cf7ba2467/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8=
|
golang.org/x/exp v0.0.0-20220909182711-5c715a9e8561/go.mod h1:cyybsKvd6eL0RnXn6p/Grxp8F5bW7iYuBgsNCOHpMYE=
|
||||||
|
golang.org/x/sys v0.6.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||||
|
golang.org/x/sys v0.30.0 h1:QjkSwP/36a20jFYWkSue1YwXzLmsV5Gfq7Eiy72C1uc=
|
||||||
|
golang.org/x/sys v0.30.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA=
|
||||||
gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
|
gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
|
||||||
gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
||||||
|
|||||||
75
group.go
75
group.go
@ -4,7 +4,8 @@ import (
|
|||||||
"fmt"
|
"fmt"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
||||||
"github.com/aquasecurity/table"
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// GroupCmd provides commands to manage groups in OBS Studio.
|
// GroupCmd provides commands to manage groups in OBS Studio.
|
||||||
@ -22,6 +23,7 @@ type GroupListCmd struct {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to list all groups in a scene.
|
// Run executes the command to list all groups in a scene.
|
||||||
|
// nolint: misspell
|
||||||
func (cmd *GroupListCmd) Run(ctx *context) error {
|
func (cmd *GroupListCmd) Run(ctx *context) error {
|
||||||
if cmd.SceneName == "" {
|
if cmd.SceneName == "" {
|
||||||
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||||
@ -37,17 +39,44 @@ func (cmd *GroupListCmd) Run(ctx *context) error {
|
|||||||
return fmt.Errorf("failed to get scene item list: %w", err)
|
return fmt.Errorf("failed to get scene item list: %w", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
t := table.New(ctx.Out)
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
t.SetPadding(3)
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||||
t.SetAlignment(table.AlignCenter, table.AlignLeft, table.AlignCenter)
|
Headers("ID", "Group Name", "Enabled").
|
||||||
t.SetHeaders("ID", "Group Name", "Enabled")
|
StyleFunc(func(row, col int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch col {
|
||||||
|
case 0:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
case 1:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
case 2:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
}
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center)
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
|
var found bool
|
||||||
for _, item := range resp.SceneItems {
|
for _, item := range resp.SceneItems {
|
||||||
if item.IsGroup {
|
if item.IsGroup {
|
||||||
t.AddRow(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, getEnabledMark(item.SceneItemEnabled))
|
t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, getEnabledMark(item.SceneItemEnabled))
|
||||||
|
found = true
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
t.Render()
|
|
||||||
|
if !found {
|
||||||
|
fmt.Fprintf(ctx.Out, "No groups found in scene %s.\n", ctx.Style.Highlight(cmd.SceneName))
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -75,13 +104,17 @@ func (cmd *GroupShowCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
||||||
}
|
}
|
||||||
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", cmd.GroupName)
|
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||||
found = true
|
found = true
|
||||||
break
|
break
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
if !found {
|
if !found {
|
||||||
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
return fmt.Errorf(
|
||||||
|
"group %s not found in scene %s",
|
||||||
|
ctx.Style.Error(cmd.GroupName),
|
||||||
|
ctx.Style.Error(cmd.SceneName),
|
||||||
|
)
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@ -110,13 +143,17 @@ func (cmd *GroupHideCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
||||||
}
|
}
|
||||||
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", cmd.GroupName)
|
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||||
found = true
|
found = true
|
||||||
break
|
break
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
if !found {
|
if !found {
|
||||||
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
return fmt.Errorf(
|
||||||
|
"group %s not found in scene %s",
|
||||||
|
ctx.Style.Error(cmd.GroupName),
|
||||||
|
ctx.Style.Error(cmd.SceneName),
|
||||||
|
)
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@ -147,16 +184,20 @@ func (cmd *GroupToggleCmd) Run(ctx *context) error {
|
|||||||
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
||||||
}
|
}
|
||||||
if newState {
|
if newState {
|
||||||
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", cmd.GroupName)
|
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", cmd.GroupName)
|
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||||
}
|
}
|
||||||
found = true
|
found = true
|
||||||
break
|
break
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
if !found {
|
if !found {
|
||||||
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
return fmt.Errorf(
|
||||||
|
"group %s not found in scene %s",
|
||||||
|
ctx.Style.Error(cmd.GroupName),
|
||||||
|
ctx.Style.Error(cmd.SceneName),
|
||||||
|
)
|
||||||
}
|
}
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
@ -178,12 +219,12 @@ func (cmd *GroupStatusCmd) Run(ctx *context) error {
|
|||||||
for _, item := range resp.SceneItems {
|
for _, item := range resp.SceneItems {
|
||||||
if item.IsGroup && item.SourceName == cmd.GroupName {
|
if item.IsGroup && item.SourceName == cmd.GroupName {
|
||||||
if item.SceneItemEnabled {
|
if item.SceneItemEnabled {
|
||||||
fmt.Fprintf(ctx.Out, "Group %s is shown.\n", cmd.GroupName)
|
fmt.Fprintf(ctx.Out, "Group %s is shown.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Group %s is hidden.\n", cmd.GroupName)
|
fmt.Fprintf(ctx.Out, "Group %s is hidden.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
return fmt.Errorf("group %s not found in scene %s", ctx.Style.Error(cmd.GroupName), ctx.Style.Error(cmd.SceneName))
|
||||||
}
|
}
|
||||||
|
|||||||
@ -2,19 +2,25 @@ package main
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"bytes"
|
"bytes"
|
||||||
|
"os"
|
||||||
"strings"
|
"strings"
|
||||||
"testing"
|
"testing"
|
||||||
)
|
)
|
||||||
|
|
||||||
|
func skipIfSkipGroupTests(t *testing.T) {
|
||||||
|
if os.Getenv("GOBS_TEST_SKIP_GROUP_TESTS") != "" {
|
||||||
|
t.Skip("Skipping group tests due to GOBS_TEST_SKIP_GROUP_TESTS environment variable")
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
func TestGroupList(t *testing.T) {
|
func TestGroupList(t *testing.T) {
|
||||||
|
skipIfSkipGroupTests(t)
|
||||||
|
|
||||||
client, disconnect := getClient(t)
|
client, disconnect := getClient(t)
|
||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &GroupListCmd{
|
cmd := &GroupListCmd{
|
||||||
SceneName: "Scene",
|
SceneName: "Scene",
|
||||||
@ -29,14 +35,13 @@ func TestGroupList(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func TestGroupShow(t *testing.T) {
|
func TestGroupShow(t *testing.T) {
|
||||||
|
skipIfSkipGroupTests(t)
|
||||||
|
|
||||||
client, disconnect := getClient(t)
|
client, disconnect := getClient(t)
|
||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &GroupShowCmd{
|
cmd := &GroupShowCmd{
|
||||||
SceneName: "Scene",
|
SceneName: "Scene",
|
||||||
@ -52,14 +57,13 @@ func TestGroupShow(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func TestGroupToggle(t *testing.T) {
|
func TestGroupToggle(t *testing.T) {
|
||||||
|
skipIfSkipGroupTests(t)
|
||||||
|
|
||||||
client, disconnect := getClient(t)
|
client, disconnect := getClient(t)
|
||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdStatus := &GroupStatusCmd{
|
cmdStatus := &GroupStatusCmd{
|
||||||
SceneName: "Scene",
|
SceneName: "Scene",
|
||||||
@ -96,14 +100,13 @@ func TestGroupToggle(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func TestGroupStatus(t *testing.T) {
|
func TestGroupStatus(t *testing.T) {
|
||||||
|
skipIfSkipGroupTests(t)
|
||||||
|
|
||||||
client, disconnect := getClient(t)
|
client, disconnect := getClient(t)
|
||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdShow := &GroupShowCmd{
|
cmdShow := &GroupShowCmd{
|
||||||
SceneName: "Scene",
|
SceneName: "Scene",
|
||||||
|
|||||||
28
hotkey.go
28
hotkey.go
@ -1,9 +1,12 @@
|
|||||||
package main
|
package main
|
||||||
|
|
||||||
import (
|
import (
|
||||||
|
"fmt"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/general"
|
"github.com/andreykaipov/goobs/api/requests/general"
|
||||||
"github.com/andreykaipov/goobs/api/typedefs"
|
"github.com/andreykaipov/goobs/api/typedefs"
|
||||||
"github.com/aquasecurity/table"
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// HotkeyCmd provides commands to manage hotkeys in OBS Studio.
|
// HotkeyCmd provides commands to manage hotkeys in OBS Studio.
|
||||||
@ -23,15 +26,26 @@ func (cmd *HotkeyListCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
t := table.New(ctx.Out)
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
t.SetPadding(3)
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||||
t.SetAlignment(table.AlignLeft)
|
Headers("Hotkey Name").
|
||||||
t.SetHeaders("Hotkey Name")
|
StyleFunc(func(row, _ int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center) // nolint: misspell
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
for _, hotkey := range resp.Hotkeys {
|
for _, hotkey := range resp.Hotkeys {
|
||||||
t.AddRow(hotkey)
|
t.Row(hotkey)
|
||||||
}
|
}
|
||||||
t.Render()
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
BIN
img/coloured-border.png
Executable file
BIN
img/coloured-border.png
Executable file
Binary file not shown.
|
After Width: | Height: | Size: 6.1 KiB |
BIN
img/coloured-no-border.png
Executable file
BIN
img/coloured-no-border.png
Executable file
Binary file not shown.
|
After Width: | Height: | Size: 6.1 KiB |
BIN
img/colourless.png
Executable file
BIN
img/colourless.png
Executable file
Binary file not shown.
|
After Width: | Height: | Size: 4.6 KiB |
108
input.go
108
input.go
@ -1,11 +1,14 @@
|
|||||||
|
// nolint: misspell
|
||||||
package main
|
package main
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"fmt"
|
"fmt"
|
||||||
|
"sort"
|
||||||
"strings"
|
"strings"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/inputs"
|
"github.com/andreykaipov/goobs/api/requests/inputs"
|
||||||
"github.com/aquasecurity/table"
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// InputCmd provides commands to manage inputs in OBS Studio.
|
// InputCmd provides commands to manage inputs in OBS Studio.
|
||||||
@ -21,6 +24,9 @@ type InputListCmd struct {
|
|||||||
Input bool `flag:"" help:"List all inputs." aliases:"i"`
|
Input bool `flag:"" help:"List all inputs." aliases:"i"`
|
||||||
Output bool `flag:"" help:"List all outputs." aliases:"o"`
|
Output bool `flag:"" help:"List all outputs." aliases:"o"`
|
||||||
Colour bool `flag:"" help:"List all colour sources." aliases:"c"`
|
Colour bool `flag:"" help:"List all colour sources." aliases:"c"`
|
||||||
|
Ffmpeg bool `flag:"" help:"List all ffmpeg sources." aliases:"f"`
|
||||||
|
Vlc bool `flag:"" help:"List all VLC sources." aliases:"v"`
|
||||||
|
UUID bool `flag:"" help:"Display UUIDs of inputs." aliases:"u"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to list all inputs.
|
// Run executes the command to list all inputs.
|
||||||
@ -30,27 +36,89 @@ func (cmd *InputListCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
t := table.New(ctx.Out)
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
t.SetPadding(3)
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
|
||||||
t.SetAlignment(table.AlignLeft, table.AlignLeft)
|
if cmd.UUID {
|
||||||
t.SetHeaders("Input Name", "Kind")
|
t.Headers("Input Name", "Kind", "Muted", "UUID")
|
||||||
|
} else {
|
||||||
|
t.Headers("Input Name", "Kind", "Muted")
|
||||||
|
}
|
||||||
|
t.StyleFunc(func(row, col int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch col {
|
||||||
|
case 0:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
case 1:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
case 2:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
case 3:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
}
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center)
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
|
sort.Slice(resp.Inputs, func(i, j int) bool {
|
||||||
|
return resp.Inputs[i].InputName < resp.Inputs[j].InputName
|
||||||
|
})
|
||||||
|
|
||||||
for _, input := range resp.Inputs {
|
for _, input := range resp.Inputs {
|
||||||
if cmd.Input && strings.Contains(input.InputKind, "input") {
|
var muteMark string
|
||||||
t.AddRow(input.InputName, input.InputKind)
|
resp, err := ctx.Client.Inputs.GetInputMute(
|
||||||
}
|
inputs.NewGetInputMuteParams().WithInputName(input.InputName),
|
||||||
if cmd.Output && strings.Contains(input.InputKind, "output") {
|
)
|
||||||
t.AddRow(input.InputName, input.InputKind)
|
if err != nil {
|
||||||
}
|
if err.Error() == "request GetInputMute: InvalidResourceState (604): The specified input does not support audio." {
|
||||||
if cmd.Colour && strings.Contains(input.InputKind, "color") { // nolint
|
muteMark = "N/A"
|
||||||
t.AddRow(input.InputName, input.InputKind)
|
} else {
|
||||||
|
return fmt.Errorf("failed to get input mute state: %w", err)
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
muteMark = getEnabledMark(resp.InputMuted)
|
||||||
}
|
}
|
||||||
|
|
||||||
if !cmd.Input && !cmd.Output && !cmd.Colour {
|
type filter struct {
|
||||||
t.AddRow(input.InputName, input.InputKind)
|
enabled bool
|
||||||
|
keyword string
|
||||||
|
}
|
||||||
|
filters := []filter{
|
||||||
|
{cmd.Input, "input"},
|
||||||
|
{cmd.Output, "output"},
|
||||||
|
{cmd.Colour, "color"}, // nolint: misspell
|
||||||
|
{cmd.Ffmpeg, "ffmpeg"},
|
||||||
|
{cmd.Vlc, "vlc"},
|
||||||
|
}
|
||||||
|
|
||||||
|
var added bool
|
||||||
|
for _, f := range filters {
|
||||||
|
if f.enabled && strings.Contains(input.InputKind, f.keyword) {
|
||||||
|
if cmd.UUID {
|
||||||
|
t.Row(input.InputName, input.InputKind, muteMark, input.InputUuid)
|
||||||
|
} else {
|
||||||
|
t.Row(input.InputName, input.InputKind, muteMark)
|
||||||
|
}
|
||||||
|
added = true
|
||||||
|
break
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if !added && (!cmd.Input && !cmd.Output && !cmd.Colour && !cmd.Ffmpeg && !cmd.Vlc) {
|
||||||
|
if cmd.UUID {
|
||||||
|
t.Row(input.InputName, snakeCaseToTitleCase(input.InputKind), muteMark, input.InputUuid)
|
||||||
|
} else {
|
||||||
|
t.Row(input.InputName, snakeCaseToTitleCase(input.InputKind), muteMark)
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
t.Render()
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -68,7 +136,7 @@ func (cmd *InputMuteCmd) Run(ctx *context) error {
|
|||||||
return fmt.Errorf("failed to mute input: %w", err)
|
return fmt.Errorf("failed to mute input: %w", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintf(ctx.Out, "Muted input: %s\n", cmd.InputName)
|
fmt.Fprintf(ctx.Out, "Muted input: %s\n", ctx.Style.Highlight(cmd.InputName))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -86,7 +154,7 @@ func (cmd *InputUnmuteCmd) Run(ctx *context) error {
|
|||||||
return fmt.Errorf("failed to unmute input: %w", err)
|
return fmt.Errorf("failed to unmute input: %w", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", cmd.InputName)
|
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", ctx.Style.Highlight(cmd.InputName))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -114,9 +182,9 @@ func (cmd *InputToggleCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if newMuteState {
|
if newMuteState {
|
||||||
fmt.Fprintf(ctx.Out, "Muted input: %s\n", cmd.InputName)
|
fmt.Fprintf(ctx.Out, "Muted input: %s\n", ctx.Style.Highlight(cmd.InputName))
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", cmd.InputName)
|
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", ctx.Style.Highlight(cmd.InputName))
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
124
input_test.go
Normal file
124
input_test.go
Normal file
@ -0,0 +1,124 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestInputList(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := newContext(client, &out, StyleConfig{})
|
||||||
|
|
||||||
|
cmd := &InputListCmd{}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list inputs: %v", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
expectedInputs := []string{
|
||||||
|
"Desktop Audio",
|
||||||
|
"Mic/Aux",
|
||||||
|
"gobs-test-input",
|
||||||
|
"gobs-test-input-2",
|
||||||
|
}
|
||||||
|
output := out.String()
|
||||||
|
for _, input := range expectedInputs {
|
||||||
|
if !strings.Contains(output, input) {
|
||||||
|
t.Fatalf("Expected output to contain '%s', got '%s'", input, output)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestInputListFilterInput(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := newContext(client, &out, StyleConfig{})
|
||||||
|
|
||||||
|
cmd := &InputListCmd{Input: true}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list inputs with filter: %v", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
expectedInputs := []string{
|
||||||
|
"Mic/Aux",
|
||||||
|
}
|
||||||
|
expectedFilteredOut := []string{
|
||||||
|
"Desktop Audio",
|
||||||
|
"gobs-test-input",
|
||||||
|
"gobs-test-input-2",
|
||||||
|
}
|
||||||
|
for _, input := range expectedInputs {
|
||||||
|
if !strings.Contains(out.String(), input) {
|
||||||
|
t.Fatalf("Expected output to contain '%s', got '%s'", input, out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
for _, filteredOut := range expectedFilteredOut {
|
||||||
|
if strings.Contains(out.String(), filteredOut) {
|
||||||
|
t.Fatalf("Expected output to NOT contain '%s', got '%s'", filteredOut, out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestInputListFilterOutput(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := newContext(client, &out, StyleConfig{})
|
||||||
|
|
||||||
|
cmd := &InputListCmd{Output: true}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list outputs with filter: %v", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
expectedInputs := []string{
|
||||||
|
"Desktop Audio",
|
||||||
|
}
|
||||||
|
expectedFilteredOut := []string{
|
||||||
|
"Mic/Aux",
|
||||||
|
"gobs-test-input",
|
||||||
|
"gobs-test-input-2",
|
||||||
|
}
|
||||||
|
for _, input := range expectedInputs {
|
||||||
|
if !strings.Contains(out.String(), input) {
|
||||||
|
t.Fatalf("Expected output to contain '%s', got '%s'", input, out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
for _, filteredOut := range expectedFilteredOut {
|
||||||
|
if strings.Contains(out.String(), filteredOut) {
|
||||||
|
t.Fatalf("Expected output to NOT contain '%s', got '%s'", filteredOut, out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestInputListFilterColour(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := newContext(client, &out, StyleConfig{})
|
||||||
|
|
||||||
|
cmd := &InputListCmd{Colour: true}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to list colour inputs with filter: %v", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
expectedInputs := []string{
|
||||||
|
"gobs-test-input",
|
||||||
|
"gobs-test-input-2",
|
||||||
|
}
|
||||||
|
for _, input := range expectedInputs {
|
||||||
|
if !strings.Contains(out.String(), input) {
|
||||||
|
t.Fatalf("Expected output to contain '%s', got '%s'", input, out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
101
main.go
101
main.go
@ -8,6 +8,8 @@ import (
|
|||||||
"io"
|
"io"
|
||||||
"os"
|
"os"
|
||||||
"path/filepath"
|
"path/filepath"
|
||||||
|
"runtime/debug"
|
||||||
|
"strings"
|
||||||
"time"
|
"time"
|
||||||
|
|
||||||
"github.com/alecthomas/kong"
|
"github.com/alecthomas/kong"
|
||||||
@ -16,40 +18,73 @@ import (
|
|||||||
kongdotenv "github.com/titusjaka/kong-dotenv-go"
|
kongdotenv "github.com/titusjaka/kong-dotenv-go"
|
||||||
)
|
)
|
||||||
|
|
||||||
|
var version string // Version of the CLI, set at build time.
|
||||||
|
|
||||||
|
// VersionFlag is a custom flag type that prints the version and exits.
|
||||||
|
type VersionFlag string
|
||||||
|
|
||||||
|
func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil } // nolint: revive
|
||||||
|
func (v VersionFlag) IsBool() bool { return true } // nolint: revive
|
||||||
|
func (v VersionFlag) BeforeApply(app *kong.Kong, vars kong.Vars) error { // nolint: revive, unparam
|
||||||
|
fmt.Printf("gobs-cli version: %s\n", vars["version"])
|
||||||
|
app.Exit(0)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
// ObsConfig holds the configuration for connecting to the OBS WebSocket server.
|
// ObsConfig holds the configuration for connecting to the OBS WebSocket server.
|
||||||
type ObsConfig struct {
|
type ObsConfig struct {
|
||||||
Host string `flag:"host" help:"Host to connect to." default:"localhost" env:"OBS_HOST"`
|
Host string `flag:"host" help:"Host to connect to." default:"localhost" env:"OBS_HOST" short:"H"`
|
||||||
Port int `flag:"port" help:"Port to connect to." default:"4455" env:"OBS_PORT"`
|
Port int `flag:"port" help:"Port to connect to." default:"4455" env:"OBS_PORT" short:"P"`
|
||||||
Password string `flag:"password" help:"Password for authentication." default:"" env:"OBS_PASSWORD"`
|
Password string `flag:"password" help:"Password for authentication." default:"" env:"OBS_PASSWORD" short:"p"`
|
||||||
Timeout int `flag:"timeout" help:"Timeout in seconds." default:"5" env:"OBS_TIMEOUT"`
|
Timeout int `flag:"timeout" help:"Timeout in seconds." default:"5" env:"OBS_TIMEOUT" short:"T"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// StyleConfig holds the configuration for styling the CLI output.
|
||||||
|
type StyleConfig struct {
|
||||||
|
Style string `help:"Style used in output." flag:"style" default:"" env:"GOBS_STYLE" short:"s" enum:",red,magenta,purple,blue,cyan,green,yellow,orange,white,grey,navy,black"`
|
||||||
|
NoBorder bool `help:"Disable table border styling in output." flag:"no-border" default:"false" env:"GOBS_STYLE_NO_BORDER" short:"b"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// CLI is the main command line interface structure.
|
// CLI is the main command line interface structure.
|
||||||
// It embeds the ObsConfig struct to inherit its fields and flags.
|
// It embeds ObsConfig and StyleConfig to provide configuration options.
|
||||||
type CLI struct {
|
type CLI struct {
|
||||||
ObsConfig `embed:"" help:"OBS WebSocket configuration."`
|
ObsConfig `embed:"" help:"OBS WebSocket configuration."`
|
||||||
|
StyleConfig `embed:"" help:"Style configuration."`
|
||||||
|
|
||||||
Man mangokong.ManFlag `help:"Print man page."`
|
Man mangokong.ManFlag `help:"Print man page."`
|
||||||
|
Version VersionFlag `help:"Print gobs-cli version information and quit" name:"version" short:"v"`
|
||||||
|
|
||||||
Version VersionCmd `help:"Show version." cmd:"" aliases:"v"`
|
ObsVersion ObsVersionCmd `help:"Print OBS client and websocket version." cmd:"" aliases:"v"`
|
||||||
Scene SceneCmd `help:"Manage scenes." cmd:"" aliases:"sc"`
|
Scene SceneCmd `help:"Manage scenes." cmd:"" aliases:"sc" group:"Scene"`
|
||||||
Sceneitem SceneItemCmd `help:"Manage scene items." cmd:"" aliases:"si"`
|
Sceneitem SceneItemCmd `help:"Manage scene items." cmd:"" aliases:"si" group:"Scene Item"`
|
||||||
Group GroupCmd `help:"Manage groups." cmd:"" aliases:"g"`
|
Group GroupCmd `help:"Manage groups." cmd:"" aliases:"g" group:"Group"`
|
||||||
Input InputCmd `help:"Manage inputs." cmd:"" aliases:"i"`
|
Input InputCmd `help:"Manage inputs." cmd:"" aliases:"i" group:"Input"`
|
||||||
Record RecordCmd `help:"Manage recording." cmd:"" aliases:"rec"`
|
Text TextCmd `help:"Manage text inputs." cmd:"" aliases:"t" group:"Text Input"`
|
||||||
Stream StreamCmd `help:"Manage streaming." cmd:"" aliases:"st"`
|
Record RecordCmd `help:"Manage recording." cmd:"" aliases:"rec" group:"Recording"`
|
||||||
Scenecollection SceneCollectionCmd `help:"Manage scene collections." cmd:"" aliases:"scn"`
|
Stream StreamCmd `help:"Manage streaming." cmd:"" aliases:"st" group:"Streaming"`
|
||||||
Profile ProfileCmd `help:"Manage profiles." cmd:"" aliases:"p"`
|
Scenecollection SceneCollectionCmd `help:"Manage scene collections." cmd:"" aliases:"scn" group:"Scene Collection"`
|
||||||
Replaybuffer ReplayBufferCmd `help:"Manage replay buffer." cmd:"" aliases:"rb"`
|
Profile ProfileCmd `help:"Manage profiles." cmd:"" aliases:"p" group:"Profile"`
|
||||||
Studiomode StudioModeCmd `help:"Manage studio mode." cmd:"" aliases:"sm"`
|
Replaybuffer ReplayBufferCmd `help:"Manage replay buffer." cmd:"" aliases:"rb" group:"Replay Buffer"`
|
||||||
Virtualcam VirtualCamCmd `help:"Manage virtual camera." cmd:"" aliases:"vc"`
|
Studiomode StudioModeCmd `help:"Manage studio mode." cmd:"" aliases:"sm" group:"Studio Mode"`
|
||||||
Hotkey HotkeyCmd `help:"Manage hotkeys." cmd:"" aliases:"hk"`
|
Virtualcam VirtualCamCmd `help:"Manage virtual camera." cmd:"" aliases:"vc" group:"Virtual Camera"`
|
||||||
Filter FilterCmd `help:"Manage filters." cmd:"" aliases:"f"`
|
Hotkey HotkeyCmd `help:"Manage hotkeys." cmd:"" aliases:"hk" group:"Hotkey"`
|
||||||
|
Filter FilterCmd `help:"Manage filters." cmd:"" aliases:"f" group:"Filter"`
|
||||||
|
Projector ProjectorCmd `help:"Manage projectors." cmd:"" aliases:"prj" group:"Projector"`
|
||||||
|
Screenshot ScreenshotCmd `help:"Take screenshots." cmd:"" aliases:"ss" group:"Screenshot"`
|
||||||
}
|
}
|
||||||
|
|
||||||
type context struct {
|
type context struct {
|
||||||
Client *goobs.Client
|
Client *goobs.Client
|
||||||
Out io.Writer
|
Out io.Writer
|
||||||
|
Style *Style
|
||||||
|
}
|
||||||
|
|
||||||
|
func newContext(client *goobs.Client, out io.Writer, styleCfg StyleConfig) *context {
|
||||||
|
return &context{
|
||||||
|
Client: client,
|
||||||
|
Out: out,
|
||||||
|
Style: styleFromFlag(styleCfg),
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
func main() {
|
func main() {
|
||||||
@ -62,18 +97,30 @@ func main() {
|
|||||||
var cli CLI
|
var cli CLI
|
||||||
ctx := kong.Parse(
|
ctx := kong.Parse(
|
||||||
&cli,
|
&cli,
|
||||||
kong.Name("GOBS-CLI"),
|
kong.Name("gobs-cli"),
|
||||||
kong.Description("A command line tool to interact with OBS Websocket."),
|
kong.Description("A command line tool to interact with OBS Websocket."),
|
||||||
kong.Configuration(kongdotenv.ENVFileReader, ".env", filepath.Join(userConfigDir, "gobs-cli", "config.env")),
|
kong.Configuration(kongdotenv.ENVFileReader, ".env", filepath.Join(userConfigDir, "gobs-cli", "config.env")),
|
||||||
)
|
kong.UsageOnError(),
|
||||||
|
kong.ConfigureHelp(kong.HelpOptions{
|
||||||
|
Compact: true,
|
||||||
|
}),
|
||||||
|
kong.Vars{
|
||||||
|
"version": func() string {
|
||||||
|
if version == "" {
|
||||||
|
info, ok := debug.ReadBuildInfo()
|
||||||
|
if !ok {
|
||||||
|
return "(unable to read build info)"
|
||||||
|
}
|
||||||
|
version = strings.Split(info.Main.Version, "-")[0]
|
||||||
|
}
|
||||||
|
return version
|
||||||
|
}(),
|
||||||
|
})
|
||||||
|
|
||||||
client, err := connectObs(cli.ObsConfig)
|
client, err := connectObs(cli.ObsConfig)
|
||||||
ctx.FatalIfErrorf(err)
|
ctx.FatalIfErrorf(err)
|
||||||
|
|
||||||
ctx.Bind(&context{
|
ctx.Bind(newContext(client, os.Stdout, cli.StyleConfig))
|
||||||
Client: client,
|
|
||||||
Out: os.Stdout,
|
|
||||||
})
|
|
||||||
|
|
||||||
ctx.FatalIfErrorf(run(ctx, client))
|
ctx.FatalIfErrorf(run(ctx, client))
|
||||||
}
|
}
|
||||||
|
|||||||
95
main_test.go
95
main_test.go
@ -2,12 +2,16 @@ package main
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"os"
|
"os"
|
||||||
|
"runtime"
|
||||||
"testing"
|
"testing"
|
||||||
|
"time"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs"
|
"github.com/andreykaipov/goobs"
|
||||||
"github.com/andreykaipov/goobs/api/requests/config"
|
"github.com/andreykaipov/goobs/api/requests/config"
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/filters"
|
||||||
"github.com/andreykaipov/goobs/api/requests/inputs"
|
"github.com/andreykaipov/goobs/api/requests/inputs"
|
||||||
"github.com/andreykaipov/goobs/api/requests/scenes"
|
"github.com/andreykaipov/goobs/api/requests/scenes"
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/ui"
|
||||||
typedefs "github.com/andreykaipov/goobs/api/typedefs"
|
typedefs "github.com/andreykaipov/goobs/api/typedefs"
|
||||||
)
|
)
|
||||||
|
|
||||||
@ -60,13 +64,23 @@ func setup(client *goobs.Client) {
|
|||||||
Key: os.Getenv("OBS_STREAM_KEY"),
|
Key: os.Getenv("OBS_STREAM_KEY"),
|
||||||
}))
|
}))
|
||||||
|
|
||||||
client.Config.SetCurrentSceneCollection(config.NewSetCurrentSceneCollectionParams().
|
client.Config.CreateProfile(config.NewCreateProfileParams().
|
||||||
WithSceneCollectionName("test-collection"))
|
WithProfileName("gobs-test-profile"))
|
||||||
|
time.Sleep(100 * time.Millisecond) // Wait for the profile to be created
|
||||||
|
client.Config.SetProfileParameter(config.NewSetProfileParameterParams().
|
||||||
|
WithParameterCategory("SimpleOutput").
|
||||||
|
WithParameterName("RecRB").
|
||||||
|
WithParameterValue("true"))
|
||||||
|
// hack to ensure the Replay Buffer setting is applied
|
||||||
|
client.Config.SetCurrentProfile(config.NewSetCurrentProfileParams().
|
||||||
|
WithProfileName("Untitled"))
|
||||||
|
client.Config.SetCurrentProfile(config.NewSetCurrentProfileParams().
|
||||||
|
WithProfileName("gobs-test-profile"))
|
||||||
|
|
||||||
client.Scenes.CreateScene(scenes.NewCreateSceneParams().
|
client.Scenes.CreateScene(scenes.NewCreateSceneParams().
|
||||||
WithSceneName("gobs-test"))
|
WithSceneName("gobs-test-scene"))
|
||||||
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
||||||
WithSceneName("gobs-test").
|
WithSceneName("gobs-test-scene").
|
||||||
WithInputName("gobs-test-input").
|
WithInputName("gobs-test-input").
|
||||||
WithInputKind("color_source_v3").
|
WithInputKind("color_source_v3").
|
||||||
WithInputSettings(map[string]any{
|
WithInputSettings(map[string]any{
|
||||||
@ -77,7 +91,7 @@ func setup(client *goobs.Client) {
|
|||||||
}).
|
}).
|
||||||
WithSceneItemEnabled(true))
|
WithSceneItemEnabled(true))
|
||||||
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
||||||
WithSceneName("gobs-test").
|
WithSceneName("gobs-test-scene").
|
||||||
WithInputName("gobs-test-input-2").
|
WithInputName("gobs-test-input-2").
|
||||||
WithInputKind("color_source_v3").
|
WithInputKind("color_source_v3").
|
||||||
WithInputSettings(map[string]any{
|
WithInputSettings(map[string]any{
|
||||||
@ -87,15 +101,82 @@ func setup(client *goobs.Client) {
|
|||||||
"visible": true,
|
"visible": true,
|
||||||
}).
|
}).
|
||||||
WithSceneItemEnabled(true))
|
WithSceneItemEnabled(true))
|
||||||
|
|
||||||
|
// ensure Desktop Audio input is created
|
||||||
|
desktopAudioKinds := map[string]string{
|
||||||
|
"windows": "wasapi_output_capture",
|
||||||
|
"linux": "pulse_output_capture",
|
||||||
|
"darwin": "coreaudio_output_capture",
|
||||||
|
}
|
||||||
|
platform := os.Getenv("GOBS_TEST_PLATFORM")
|
||||||
|
if platform == "" {
|
||||||
|
platform = runtime.GOOS
|
||||||
|
}
|
||||||
|
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
||||||
|
WithSceneName("gobs-test-scene").
|
||||||
|
WithInputName("Desktop Audio").
|
||||||
|
WithInputKind(desktopAudioKinds[platform]).
|
||||||
|
WithInputSettings(map[string]any{
|
||||||
|
"device_id": "default",
|
||||||
|
}))
|
||||||
|
// ensure Mic/Aux input is created
|
||||||
|
micKinds := map[string]string{
|
||||||
|
"windows": "wasapi_input_capture",
|
||||||
|
"linux": "pulse_input_capture",
|
||||||
|
"darwin": "coreaudio_input_capture",
|
||||||
|
}
|
||||||
|
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
||||||
|
WithSceneName("gobs-test-scene").
|
||||||
|
WithInputName("Mic/Aux").
|
||||||
|
WithInputKind(micKinds[platform]).
|
||||||
|
WithInputSettings(map[string]any{
|
||||||
|
"device_id": "default",
|
||||||
|
}))
|
||||||
|
|
||||||
|
// Create source filter on an audio input
|
||||||
|
client.Filters.CreateSourceFilter(filters.NewCreateSourceFilterParams().
|
||||||
|
WithSourceName("Mic/Aux").
|
||||||
|
WithFilterName("test_filter").
|
||||||
|
WithFilterKind("compressor_filter").
|
||||||
|
WithFilterSettings(map[string]any{
|
||||||
|
"threshold": -20,
|
||||||
|
"ratio": 4,
|
||||||
|
"attack_time": 10,
|
||||||
|
"release_time": 100,
|
||||||
|
"output_gain": -3.6,
|
||||||
|
"sidechain_source": nil,
|
||||||
|
}))
|
||||||
|
|
||||||
|
// Create source filter on a scene
|
||||||
|
client.Filters.CreateSourceFilter(filters.NewCreateSourceFilterParams().
|
||||||
|
WithSourceName("gobs-test-scene").
|
||||||
|
WithFilterName("test_filter").
|
||||||
|
WithFilterKind("luma_key_filter_v2").
|
||||||
|
WithFilterSettings(map[string]any{
|
||||||
|
"luma": 0.5,
|
||||||
|
}))
|
||||||
}
|
}
|
||||||
|
|
||||||
func teardown(client *goobs.Client) {
|
func teardown(client *goobs.Client) {
|
||||||
|
client.Config.RemoveProfile(config.NewRemoveProfileParams().
|
||||||
|
WithProfileName("gobs-test-profile"))
|
||||||
|
|
||||||
|
client.Filters.RemoveSourceFilter(filters.NewRemoveSourceFilterParams().
|
||||||
|
WithSourceName("Mic/Aux").
|
||||||
|
WithFilterName("test_filter"))
|
||||||
|
client.Filters.RemoveSourceFilter(filters.NewRemoveSourceFilterParams().
|
||||||
|
WithSourceName("gobs-test-scene").
|
||||||
|
WithFilterName("test_filter"))
|
||||||
|
|
||||||
client.Scenes.RemoveScene(scenes.NewRemoveSceneParams().
|
client.Scenes.RemoveScene(scenes.NewRemoveSceneParams().
|
||||||
WithSceneName("gobs-test"))
|
WithSceneName("gobs-test-scene"))
|
||||||
|
|
||||||
client.Config.SetCurrentSceneCollection(config.NewSetCurrentSceneCollectionParams().
|
client.Config.SetCurrentSceneCollection(config.NewSetCurrentSceneCollectionParams().
|
||||||
WithSceneCollectionName("default"))
|
WithSceneCollectionName("Untitled"))
|
||||||
|
|
||||||
client.Stream.StopStream()
|
client.Stream.StopStream()
|
||||||
client.Record.StopRecord()
|
client.Record.StopRecord()
|
||||||
|
client.Outputs.StopReplayBuffer()
|
||||||
|
client.Ui.SetStudioModeEnabled(ui.NewSetStudioModeEnabledParams().
|
||||||
|
WithStudioModeEnabled(false))
|
||||||
}
|
}
|
||||||
|
|||||||
62
profile.go
62
profile.go
@ -5,7 +5,8 @@ import (
|
|||||||
"slices"
|
"slices"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/config"
|
"github.com/andreykaipov/goobs/api/requests/config"
|
||||||
"github.com/aquasecurity/table"
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// ProfileCmd provides commands to manage profiles in OBS Studio.
|
// ProfileCmd provides commands to manage profiles in OBS Studio.
|
||||||
@ -21,16 +22,34 @@ type ProfileCmd struct {
|
|||||||
type ProfileListCmd struct{} // size = 0x0
|
type ProfileListCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to list all profiles.
|
// Run executes the command to list all profiles.
|
||||||
|
// nolint: misspell
|
||||||
func (cmd *ProfileListCmd) Run(ctx *context) error {
|
func (cmd *ProfileListCmd) Run(ctx *context) error {
|
||||||
profiles, err := ctx.Client.Config.GetProfileList()
|
profiles, err := ctx.Client.Config.GetProfileList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
t := table.New(ctx.Out)
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
t.SetPadding(3)
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||||
t.SetAlignment(table.AlignLeft, table.AlignCenter)
|
Headers("Profile Name", "Current").
|
||||||
t.SetHeaders("Profile Name", "Current")
|
StyleFunc(func(row, col int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch col {
|
||||||
|
case 0:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
case 1:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
}
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center)
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
for _, profile := range profiles.Profiles {
|
for _, profile := range profiles.Profiles {
|
||||||
var enabledMark string
|
var enabledMark string
|
||||||
@ -38,9 +57,9 @@ func (cmd *ProfileListCmd) Run(ctx *context) error {
|
|||||||
enabledMark = getEnabledMark(true)
|
enabledMark = getEnabledMark(true)
|
||||||
}
|
}
|
||||||
|
|
||||||
t.AddRow(profile, enabledMark)
|
t.Row(profile, enabledMark)
|
||||||
}
|
}
|
||||||
t.Render()
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -53,7 +72,7 @@ func (cmd *ProfileCurrentCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
fmt.Fprintf(ctx.Out, "Current profile: %s\n", profiles.CurrentProfileName)
|
fmt.Fprintf(ctx.Out, "Current profile: %s\n", ctx.Style.Highlight(profiles.CurrentProfileName))
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@ -72,15 +91,20 @@ func (cmd *ProfileSwitchCmd) Run(ctx *context) error {
|
|||||||
current := profiles.CurrentProfileName
|
current := profiles.CurrentProfileName
|
||||||
|
|
||||||
if current == cmd.Name {
|
if current == cmd.Name {
|
||||||
return nil
|
return fmt.Errorf("already using profile %s", ctx.Style.Error(cmd.Name))
|
||||||
}
|
}
|
||||||
|
|
||||||
_, err = ctx.Client.Config.SetCurrentProfile(config.NewSetCurrentProfileParams().WithProfileName(cmd.Name))
|
_, err = ctx.Client.Config.SetCurrentProfile(config.NewSetCurrentProfileParams().WithProfileName(cmd.Name))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return fmt.Errorf("failed to switch to profile %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintf(ctx.Out, "Switched from profile %s to %s\n", current, cmd.Name)
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"Switched from profile %s to %s\n",
|
||||||
|
ctx.Style.Highlight(current),
|
||||||
|
ctx.Style.Highlight(cmd.Name),
|
||||||
|
)
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@ -98,15 +122,15 @@ func (cmd *ProfileCreateCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if slices.Contains(profiles.Profiles, cmd.Name) {
|
if slices.Contains(profiles.Profiles, cmd.Name) {
|
||||||
return fmt.Errorf("profile %s already exists", cmd.Name)
|
return fmt.Errorf("profile %s already exists", ctx.Style.Error(cmd.Name))
|
||||||
}
|
}
|
||||||
|
|
||||||
_, err = ctx.Client.Config.CreateProfile(config.NewCreateProfileParams().WithProfileName(cmd.Name))
|
_, err = ctx.Client.Config.CreateProfile(config.NewCreateProfileParams().WithProfileName(cmd.Name))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return fmt.Errorf("failed to create profile %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintf(ctx.Out, "Created profile: %s\n", cmd.Name)
|
fmt.Fprintf(ctx.Out, "Created profile: %s\n", ctx.Style.Highlight(cmd.Name))
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@ -124,19 +148,21 @@ func (cmd *ProfileRemoveCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if !slices.Contains(profiles.Profiles, cmd.Name) {
|
if !slices.Contains(profiles.Profiles, cmd.Name) {
|
||||||
return fmt.Errorf("profile %s does not exist", cmd.Name)
|
return fmt.Errorf("profile %s does not exist", ctx.Style.Error(cmd.Name))
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Prevent deletion of the current profile
|
||||||
|
// This is allowed in OBS Studio (with a confirmation prompt), but we want to prevent it here
|
||||||
if profiles.CurrentProfileName == cmd.Name {
|
if profiles.CurrentProfileName == cmd.Name {
|
||||||
return fmt.Errorf("cannot delete current profile %s", cmd.Name)
|
return fmt.Errorf("cannot delete current profile %s", ctx.Style.Error(cmd.Name))
|
||||||
}
|
}
|
||||||
|
|
||||||
_, err = ctx.Client.Config.RemoveProfile(config.NewRemoveProfileParams().WithProfileName(cmd.Name))
|
_, err = ctx.Client.Config.RemoveProfile(config.NewRemoveProfileParams().WithProfileName(cmd.Name))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return fmt.Errorf("failed to delete profile %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintf(ctx.Out, "Deleted profile: %s\n", cmd.Name)
|
fmt.Fprintf(ctx.Out, "Deleted profile: %s\n", ctx.Style.Highlight(cmd.Name))
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
111
projector.go
Normal file
111
projector.go
Normal file
@ -0,0 +1,111 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/ui"
|
||||||
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
|
)
|
||||||
|
|
||||||
|
// ProjectorCmd provides a command to manage projectors in OBS.
|
||||||
|
type ProjectorCmd struct {
|
||||||
|
ListMonitors ProjectorListMonitorsCmd `cmd:"" help:"List available monitors." aliases:"ls-m"`
|
||||||
|
Open ProjectorOpenCmd `cmd:"" help:"Open a fullscreen projector for a source on a specific monitor." aliases:"o"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// ProjectorListMonitorsCmd provides a command to list all monitors available for projectors.
|
||||||
|
type ProjectorListMonitorsCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to list all monitors available for projectors.
|
||||||
|
// nolint: misspell
|
||||||
|
func (cmd *ProjectorListMonitorsCmd) Run(ctx *context) error {
|
||||||
|
monitors, err := ctx.Client.Ui.GetMonitorList()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if len(monitors.Monitors) == 0 {
|
||||||
|
fmt.Fprintf(ctx.Out, "No monitors found.\n")
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||||
|
Headers("Monitor ID", "Monitor Name").
|
||||||
|
StyleFunc(func(row, col int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch col {
|
||||||
|
case 0:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
case 1:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
}
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center)
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
|
for _, monitor := range monitors.Monitors {
|
||||||
|
t.Row(fmt.Sprintf("%d", monitor.MonitorIndex), monitor.MonitorName)
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// ProjectorOpenCmd provides a command to open a fullscreen projector for a specific source.
|
||||||
|
type ProjectorOpenCmd struct {
|
||||||
|
MonitorIndex int `flag:"" help:"Index of the monitor to open the projector on." default:"0"`
|
||||||
|
SourceName string ` help:"Name of the source to project." default:"" arg:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to show details of a specific projector.
|
||||||
|
func (cmd *ProjectorOpenCmd) Run(ctx *context) error {
|
||||||
|
if cmd.SourceName == "" {
|
||||||
|
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get current program scene: %w", err)
|
||||||
|
}
|
||||||
|
cmd.SourceName = currentScene.SceneName
|
||||||
|
}
|
||||||
|
|
||||||
|
monitors, err := ctx.Client.Ui.GetMonitorList()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
var monitorName string
|
||||||
|
for _, monitor := range monitors.Monitors {
|
||||||
|
if monitor.MonitorIndex == cmd.MonitorIndex {
|
||||||
|
monitorName = monitor.MonitorName
|
||||||
|
break
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if monitorName == "" {
|
||||||
|
return fmt.Errorf(
|
||||||
|
"monitor with index %s not found. use %s to list available monitors",
|
||||||
|
ctx.Style.Error(fmt.Sprintf("%d", cmd.MonitorIndex)),
|
||||||
|
ctx.Style.Error("gobs-cli prj ls-m"),
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
ctx.Client.Ui.OpenSourceProjector(ui.NewOpenSourceProjectorParams().
|
||||||
|
WithSourceName(cmd.SourceName).
|
||||||
|
WithMonitorIndex(cmd.MonitorIndex))
|
||||||
|
|
||||||
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"Opened projector for source %s on monitor %s.\n",
|
||||||
|
ctx.Style.Highlight(cmd.SourceName),
|
||||||
|
ctx.Style.Highlight(monitorName),
|
||||||
|
)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
141
record.go
141
record.go
@ -2,16 +2,22 @@ package main
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"fmt"
|
"fmt"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/config"
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/record"
|
||||||
)
|
)
|
||||||
|
|
||||||
// RecordCmd handles the recording commands.
|
// RecordCmd handles the recording commands.
|
||||||
type RecordCmd struct {
|
type RecordCmd struct {
|
||||||
Start RecordStartCmd `cmd:"" help:"Start recording." aliases:"s"`
|
Start RecordStartCmd `cmd:"" help:"Start recording." aliases:"s"`
|
||||||
Stop RecordStopCmd `cmd:"" help:"Stop recording." aliases:"st"`
|
Stop RecordStopCmd `cmd:"" help:"Stop recording." aliases:"st"`
|
||||||
Toggle RecordToggleCmd `cmd:"" help:"Toggle recording." aliases:"tg"`
|
Toggle RecordToggleCmd `cmd:"" help:"Toggle recording." aliases:"tg"`
|
||||||
Status RecordStatusCmd `cmd:"" help:"Show recording status." aliases:"ss"`
|
Status RecordStatusCmd `cmd:"" help:"Show recording status." aliases:"ss"`
|
||||||
Pause RecordPauseCmd `cmd:"" help:"Pause recording." aliases:"p"`
|
Pause RecordPauseCmd `cmd:"" help:"Pause recording." aliases:"p"`
|
||||||
Resume RecordResumeCmd `cmd:"" help:"Resume recording." aliases:"r"`
|
Resume RecordResumeCmd `cmd:"" help:"Resume recording." aliases:"r"`
|
||||||
|
Directory RecordDirectoryCmd `cmd:"" help:"Get/Set recording directory." aliases:"d"`
|
||||||
|
Split RecordSplitCmd `cmd:"" help:"Split recording." aliases:"sp"`
|
||||||
|
Chapter RecordChapterCmd `cmd:"" help:"Create a chapter in the recording." aliases:"c"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// RecordStartCmd starts the recording.
|
// RecordStartCmd starts the recording.
|
||||||
@ -19,7 +25,19 @@ type RecordStartCmd struct{} // size = 0x0
|
|||||||
|
|
||||||
// Run executes the command to start recording.
|
// Run executes the command to start recording.
|
||||||
func (cmd *RecordStartCmd) Run(ctx *context) error {
|
func (cmd *RecordStartCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Record.StartRecord()
|
status, err := ctx.Client.Record.GetRecordStatus()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if status.OutputActive {
|
||||||
|
if status.OutputPaused {
|
||||||
|
return fmt.Errorf("recording is already in progress and paused")
|
||||||
|
}
|
||||||
|
return fmt.Errorf("recording is already in progress")
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Record.StartRecord()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@ -32,11 +50,24 @@ type RecordStopCmd struct{} // size = 0x0
|
|||||||
|
|
||||||
// Run executes the command to stop recording.
|
// Run executes the command to stop recording.
|
||||||
func (cmd *RecordStopCmd) Run(ctx *context) error {
|
func (cmd *RecordStopCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Record.StopRecord()
|
status, err := ctx.Client.Record.GetRecordStatus()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
fmt.Fprintln(ctx.Out, "Recording stopped successfully.")
|
|
||||||
|
if !status.OutputActive {
|
||||||
|
return fmt.Errorf("recording is not in progress")
|
||||||
|
}
|
||||||
|
|
||||||
|
resp, err := ctx.Client.Record.StopRecord()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"%s",
|
||||||
|
fmt.Sprintf("Recording stopped successfully. Output file: %s\n", ctx.Style.Highlight(resp.OutputPath)),
|
||||||
|
)
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -132,3 +163,95 @@ func (cmd *RecordResumeCmd) Run(ctx *context) error {
|
|||||||
fmt.Fprintln(ctx.Out, "Recording resumed successfully.")
|
fmt.Fprintln(ctx.Out, "Recording resumed successfully.")
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// RecordDirectoryCmd sets the recording directory.
|
||||||
|
type RecordDirectoryCmd struct {
|
||||||
|
RecordDirectory string `arg:"" help:"Directory to save recordings." default:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to set the recording directory.
|
||||||
|
func (cmd *RecordDirectoryCmd) Run(ctx *context) error {
|
||||||
|
if cmd.RecordDirectory == "" {
|
||||||
|
resp, err := ctx.Client.Config.GetRecordDirectory()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
fmt.Fprintf(ctx.Out, "Current recording directory: %s\n", ctx.Style.Highlight(resp.RecordDirectory))
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err := ctx.Client.Config.SetRecordDirectory(
|
||||||
|
config.NewSetRecordDirectoryParams().WithRecordDirectory(cmd.RecordDirectory),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintf(ctx.Out, "Recording directory set to: %s\n", ctx.Style.Highlight(cmd.RecordDirectory))
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// RecordSplitCmd splits the current recording.
|
||||||
|
type RecordSplitCmd struct{} // size = 0x0
|
||||||
|
|
||||||
|
// Run executes the command to split the recording.
|
||||||
|
func (cmd *RecordSplitCmd) Run(ctx *context) error {
|
||||||
|
status, err := ctx.Client.Record.GetRecordStatus()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if !status.OutputActive {
|
||||||
|
return fmt.Errorf("recording is not in progress")
|
||||||
|
}
|
||||||
|
if status.OutputPaused {
|
||||||
|
return fmt.Errorf("recording is paused, cannot split")
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Record.SplitRecordFile()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintln(ctx.Out, "Recording split successfully.")
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// RecordChapterCmd creates a chapter in the recording.
|
||||||
|
type RecordChapterCmd struct {
|
||||||
|
ChapterName string `arg:"" help:"Name of the chapter to create." default:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to create a chapter in the recording.
|
||||||
|
func (cmd *RecordChapterCmd) Run(ctx *context) error {
|
||||||
|
status, err := ctx.Client.Record.GetRecordStatus()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if !status.OutputActive {
|
||||||
|
return fmt.Errorf("recording is not in progress")
|
||||||
|
}
|
||||||
|
if status.OutputPaused {
|
||||||
|
return fmt.Errorf("recording is paused, cannot create chapter")
|
||||||
|
}
|
||||||
|
|
||||||
|
var params *record.CreateRecordChapterParams
|
||||||
|
if cmd.ChapterName == "" {
|
||||||
|
params = record.NewCreateRecordChapterParams()
|
||||||
|
} else {
|
||||||
|
params = record.NewCreateRecordChapterParams().WithChapterName(cmd.ChapterName)
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = ctx.Client.Record.CreateRecordChapter(params)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if cmd.ChapterName == "" {
|
||||||
|
cmd.ChapterName = "unnamed"
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintf(ctx.Out, "Chapter %s created successfully.\n", ctx.Style.Highlight(cmd.ChapterName))
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|||||||
@ -2,65 +2,89 @@ package main
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"bytes"
|
"bytes"
|
||||||
|
"strings"
|
||||||
"testing"
|
"testing"
|
||||||
"time"
|
"time"
|
||||||
)
|
)
|
||||||
|
|
||||||
func TestRecordStartStatusStop(t *testing.T) {
|
func TestRecordStart(t *testing.T) {
|
||||||
client, disconnect := getClient(t)
|
client, disconnect := getClient(t)
|
||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdStart := &RecordStartCmd{}
|
cmdStatus := &RecordStatusCmd{}
|
||||||
err := cmdStart.Run(context)
|
err := cmdStatus.Run(context)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatalf("Failed to start recording: %v", err)
|
t.Fatalf("Failed to get recording status: %v", err)
|
||||||
}
|
}
|
||||||
if out.String() != "Recording started successfully.\n" {
|
var active bool
|
||||||
t.Fatalf("Expected output to be 'Recording started successfully.', got '%s'", out.String())
|
if out.String() == "Recording is in progress.\n" {
|
||||||
|
active = true
|
||||||
}
|
}
|
||||||
// Reset output buffer for the next command
|
// Reset output buffer for the next command
|
||||||
out.Reset()
|
out.Reset()
|
||||||
|
|
||||||
time.Sleep(1 * time.Second) // Wait for a second to ensure recording has started
|
cmdStart := &RecordStartCmd{}
|
||||||
|
err = cmdStart.Run(context)
|
||||||
|
if active {
|
||||||
|
if err == nil {
|
||||||
|
t.Fatalf("Expected error when starting recording while active, got nil")
|
||||||
|
}
|
||||||
|
if !strings.Contains(err.Error(), "recording is already in progress") {
|
||||||
|
t.Fatalf("Expected error message to contain 'recording is already in progress', got '%s'", err.Error())
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to start recording: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Recording started successfully.\n" {
|
||||||
|
t.Fatalf("Expected output to contain 'Recording started successfully.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
time.Sleep(500 * time.Millisecond) // Wait for the recording to start
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestRecordStop(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := newContext(client, &out, StyleConfig{})
|
||||||
|
|
||||||
cmdStatus := &RecordStatusCmd{}
|
cmdStatus := &RecordStatusCmd{}
|
||||||
err = cmdStatus.Run(context)
|
err := cmdStatus.Run(context)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatalf("Failed to get recording status: %v", err)
|
t.Fatalf("Failed to get recording status: %v", err)
|
||||||
}
|
}
|
||||||
if out.String() != "Recording is in progress.\n" {
|
var active bool
|
||||||
t.Fatalf("Expected output to be 'Recording is in progress.', got '%s'", out.String())
|
if out.String() == "Recording is in progress.\n" {
|
||||||
|
active = true
|
||||||
}
|
}
|
||||||
// Reset output buffer for the next command
|
// Reset output buffer for the next command
|
||||||
out.Reset()
|
out.Reset()
|
||||||
|
|
||||||
cmdStop := &RecordStopCmd{}
|
cmdStop := &RecordStopCmd{}
|
||||||
err = cmdStop.Run(context)
|
err = cmdStop.Run(context)
|
||||||
|
if !active {
|
||||||
|
if err == nil {
|
||||||
|
t.Fatalf("Expected error when stopping recording while inactive, got nil")
|
||||||
|
}
|
||||||
|
if !strings.Contains(err.Error(), "recording is not in progress") {
|
||||||
|
t.Fatalf("Expected error message to contain 'recording is not in progress', got '%s'", err.Error())
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatalf("Failed to stop recording: %v", err)
|
t.Fatalf("Failed to stop recording: %v", err)
|
||||||
}
|
}
|
||||||
if out.String() != "Recording stopped successfully.\n" {
|
if !strings.Contains(out.String(), "Recording stopped successfully. Output file: ") {
|
||||||
t.Fatalf("Expected output to be 'Recording stopped successfully.', got '%s'", out.String())
|
t.Fatalf("Expected output to contain 'Recording stopped successfully. Output file: ', got '%s'", out.String())
|
||||||
}
|
|
||||||
// Reset output buffer for the next command
|
|
||||||
out.Reset()
|
|
||||||
|
|
||||||
time.Sleep(1 * time.Second) // Wait for a second to ensure recording has stopped
|
|
||||||
|
|
||||||
cmdStatus = &RecordStatusCmd{}
|
|
||||||
err = cmdStatus.Run(context)
|
|
||||||
if err != nil {
|
|
||||||
t.Fatalf("Failed to get recording status: %v", err)
|
|
||||||
}
|
|
||||||
if out.String() != "Recording is not in progress.\n" {
|
|
||||||
t.Fatalf("Expected output to be 'Recording is not in progress.', got '%s'", out.String())
|
|
||||||
}
|
}
|
||||||
|
time.Sleep(500 * time.Millisecond) // Wait for the recording to stop
|
||||||
}
|
}
|
||||||
|
|
||||||
func TestRecordToggle(t *testing.T) {
|
func TestRecordToggle(t *testing.T) {
|
||||||
@ -68,10 +92,7 @@ func TestRecordToggle(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdStatus := &RecordStatusCmd{}
|
cmdStatus := &RecordStatusCmd{}
|
||||||
err := cmdStatus.Run(context)
|
err := cmdStatus.Run(context)
|
||||||
@ -91,8 +112,6 @@ func TestRecordToggle(t *testing.T) {
|
|||||||
t.Fatalf("Failed to toggle recording: %v", err)
|
t.Fatalf("Failed to toggle recording: %v", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
time.Sleep(1 * time.Second) // Wait for a second to ensure toggle has taken effect
|
|
||||||
|
|
||||||
if active {
|
if active {
|
||||||
if out.String() != "Recording stopped successfully.\n" {
|
if out.String() != "Recording stopped successfully.\n" {
|
||||||
t.Fatalf("Expected output to be 'Recording stopped successfully.', got '%s'", out.String())
|
t.Fatalf("Expected output to be 'Recording stopped successfully.', got '%s'", out.String())
|
||||||
@ -102,4 +121,5 @@ func TestRecordToggle(t *testing.T) {
|
|||||||
t.Fatalf("Expected output to be 'Recording started successfully.', got '%s'", out.String())
|
t.Fatalf("Expected output to be 'Recording started successfully.', got '%s'", out.String())
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
time.Sleep(500 * time.Millisecond) // Wait for the toggle to take effect
|
||||||
}
|
}
|
||||||
|
|||||||
@ -19,7 +19,11 @@ type ReplayBufferStartCmd struct{} // size = 0x0
|
|||||||
// Run executes the command to start the replay buffer.
|
// Run executes the command to start the replay buffer.
|
||||||
func (cmd *ReplayBufferStartCmd) Run(ctx *context) error {
|
func (cmd *ReplayBufferStartCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Outputs.StartReplayBuffer()
|
_, err := ctx.Client.Outputs.StartReplayBuffer()
|
||||||
return err
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to start replay buffer: %w", err)
|
||||||
|
}
|
||||||
|
fmt.Fprintln(ctx.Out, "Replay buffer started.")
|
||||||
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// ReplayBufferStopCmd stops the replay buffer.
|
// ReplayBufferStopCmd stops the replay buffer.
|
||||||
@ -28,7 +32,11 @@ type ReplayBufferStopCmd struct{} // size = 0x0
|
|||||||
// Run executes the command to stop the replay buffer.
|
// Run executes the command to stop the replay buffer.
|
||||||
func (cmd *ReplayBufferStopCmd) Run(ctx *context) error {
|
func (cmd *ReplayBufferStopCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Outputs.StopReplayBuffer()
|
_, err := ctx.Client.Outputs.StopReplayBuffer()
|
||||||
return err
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to stop replay buffer: %w", err)
|
||||||
|
}
|
||||||
|
fmt.Fprintln(ctx.Out, "Replay buffer stopped.")
|
||||||
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// ReplayBufferToggleCmd toggles the replay buffer state.
|
// ReplayBufferToggleCmd toggles the replay buffer state.
|
||||||
@ -42,9 +50,9 @@ func (cmd *ReplayBufferToggleCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if status.OutputActive {
|
if status.OutputActive {
|
||||||
fmt.Fprintln(ctx.Out, "Replay buffer started successfully.")
|
fmt.Fprintln(ctx.Out, "Replay buffer started.")
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintln(ctx.Out, "Replay buffer stopped successfully.")
|
fmt.Fprintln(ctx.Out, "Replay buffer stopped.")
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
93
replaybuffer_test.go
Normal file
93
replaybuffer_test.go
Normal file
@ -0,0 +1,93 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"os"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
"time"
|
||||||
|
)
|
||||||
|
|
||||||
|
func skipIfSkipReplayBufferTests(t *testing.T) {
|
||||||
|
if os.Getenv("GOBS_TEST_SKIP_REPLAYBUFFER_TESTS") != "" {
|
||||||
|
t.Skip("Skipping replay buffer tests due to GOBS_TEST_SKIP_REPLAYBUFFER_TESTS environment variable")
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestReplayBufferStart(t *testing.T) {
|
||||||
|
skipIfSkipReplayBufferTests(t)
|
||||||
|
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := newContext(client, &out, StyleConfig{})
|
||||||
|
|
||||||
|
cmd := &ReplayBufferStartCmd{}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to start replay buffer: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Replay buffer started.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Replay buffer started', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
time.Sleep(500 * time.Millisecond) // Wait for the replay buffer to start
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestReplayBufferStop(t *testing.T) {
|
||||||
|
skipIfSkipReplayBufferTests(t)
|
||||||
|
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := newContext(client, &out, StyleConfig{})
|
||||||
|
|
||||||
|
cmd := &ReplayBufferStopCmd{}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to stop replay buffer: %v", err)
|
||||||
|
}
|
||||||
|
if out.String() != "Replay buffer stopped.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Replay buffer stopped.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
time.Sleep(500 * time.Millisecond) // Wait for the replay buffer to stop
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestReplayBufferToggle(t *testing.T) {
|
||||||
|
skipIfSkipReplayBufferTests(t)
|
||||||
|
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := newContext(client, &out, StyleConfig{})
|
||||||
|
|
||||||
|
cmdStatus := &ReplayBufferStatusCmd{}
|
||||||
|
err := cmdStatus.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get replay buffer status: %v", err)
|
||||||
|
}
|
||||||
|
var active bool
|
||||||
|
if strings.Contains(out.String(), "Replay buffer is active") {
|
||||||
|
active = true
|
||||||
|
}
|
||||||
|
// Reset output buffer for the next command
|
||||||
|
out.Reset()
|
||||||
|
|
||||||
|
cmdToggle := &ReplayBufferToggleCmd{}
|
||||||
|
err = cmdToggle.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to toggle replay buffer: %v", err)
|
||||||
|
}
|
||||||
|
if active {
|
||||||
|
if out.String() != "Replay buffer stopped.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Replay buffer stopped.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
if out.String() != "Replay buffer started.\n" {
|
||||||
|
t.Fatalf("Expected output to be 'Replay buffer started.', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
time.Sleep(500 * time.Millisecond) // Wait for the toggle to take effect
|
||||||
|
}
|
||||||
64
scene.go
64
scene.go
@ -5,7 +5,8 @@ import (
|
|||||||
"slices"
|
"slices"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/scenes"
|
"github.com/andreykaipov/goobs/api/requests/scenes"
|
||||||
"github.com/aquasecurity/table"
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// SceneCmd provides commands to manage scenes in OBS Studio.
|
// SceneCmd provides commands to manage scenes in OBS Studio.
|
||||||
@ -16,25 +17,64 @@ type SceneCmd struct {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// SceneListCmd provides a command to list all scenes.
|
// SceneListCmd provides a command to list all scenes.
|
||||||
type SceneListCmd struct{} // size = 0x0
|
type SceneListCmd struct {
|
||||||
|
UUID bool `flag:"" help:"Display UUIDs of scenes."`
|
||||||
|
}
|
||||||
|
|
||||||
// Run executes the command to list all scenes.
|
// Run executes the command to list all scenes.
|
||||||
|
// nolint: misspell
|
||||||
func (cmd *SceneListCmd) Run(ctx *context) error {
|
func (cmd *SceneListCmd) Run(ctx *context) error {
|
||||||
scenes, err := ctx.Client.Scenes.GetSceneList()
|
scenes, err := ctx.Client.Scenes.GetSceneList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
t := table.New(ctx.Out)
|
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||||
t.SetPadding(3)
|
if err != nil {
|
||||||
t.SetAlignment(table.AlignLeft, table.AlignLeft)
|
return err
|
||||||
t.SetHeaders("Scene Name", "UUID")
|
}
|
||||||
|
|
||||||
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
|
||||||
|
if cmd.UUID {
|
||||||
|
t.Headers("Scene Name", "Active", "UUID")
|
||||||
|
} else {
|
||||||
|
t.Headers("Scene Name", "Active")
|
||||||
|
}
|
||||||
|
t.StyleFunc(func(row, col int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch col {
|
||||||
|
case 0:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
case 1:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
case 2:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
}
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center)
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
slices.Reverse(scenes.Scenes)
|
slices.Reverse(scenes.Scenes)
|
||||||
for _, scene := range scenes.Scenes {
|
for _, scene := range scenes.Scenes {
|
||||||
t.AddRow(scene.SceneName, scene.SceneUuid)
|
var activeMark string
|
||||||
|
if scene.SceneName == currentScene.SceneName {
|
||||||
|
activeMark = getEnabledMark(true)
|
||||||
|
}
|
||||||
|
if cmd.UUID {
|
||||||
|
t.Row(scene.SceneName, activeMark, scene.SceneUuid)
|
||||||
|
} else {
|
||||||
|
t.Row(scene.SceneName, activeMark)
|
||||||
|
}
|
||||||
}
|
}
|
||||||
t.Render()
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -50,13 +90,13 @@ func (cmd *SceneCurrentCmd) Run(ctx *context) error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
fmt.Fprintln(ctx.Out, scene.SceneName)
|
fmt.Fprintf(ctx.Out, "Current preview scene: %s\n", ctx.Style.Highlight(scene.SceneName))
|
||||||
} else {
|
} else {
|
||||||
scene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
scene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
fmt.Fprintln(ctx.Out, scene.SceneName)
|
fmt.Fprintf(ctx.Out, "Current program scene: %s\n", ctx.Style.Highlight(scene.SceneName))
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@ -76,7 +116,7 @@ func (cmd *SceneSwitchCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintln(ctx.Out, "Switched to preview scene:", cmd.NewScene)
|
fmt.Fprintf(ctx.Out, "Switched to preview scene: %s\n", ctx.Style.Highlight(cmd.NewScene))
|
||||||
} else {
|
} else {
|
||||||
_, err := ctx.Client.Scenes.SetCurrentProgramScene(scenes.NewSetCurrentProgramSceneParams().
|
_, err := ctx.Client.Scenes.SetCurrentProgramScene(scenes.NewSetCurrentProgramSceneParams().
|
||||||
WithSceneName(cmd.NewScene))
|
WithSceneName(cmd.NewScene))
|
||||||
@ -84,7 +124,7 @@ func (cmd *SceneSwitchCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintln(ctx.Out, "Switched to program scene:", cmd.NewScene)
|
fmt.Fprintf(ctx.Out, "Switched to program scene: %s\n", ctx.Style.Highlight(cmd.NewScene))
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
@ -2,7 +2,6 @@ package main
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"bytes"
|
"bytes"
|
||||||
"strings"
|
|
||||||
"testing"
|
"testing"
|
||||||
)
|
)
|
||||||
|
|
||||||
@ -11,18 +10,15 @@ func TestSceneList(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &SceneListCmd{}
|
cmd := &SceneListCmd{}
|
||||||
err := cmd.Run(context)
|
err := cmd.Run(context)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatalf("Failed to list scenes: %v", err)
|
t.Fatalf("Failed to list scenes: %v", err)
|
||||||
}
|
}
|
||||||
if !strings.Contains(out.String(), "gobs-test") {
|
if out.String() == "Current program scene: gobs-test-scene\n" {
|
||||||
t.Fatalf("Expected output to contain 'gobs-test', got '%s'", out.String())
|
t.Fatalf("Expected output to be 'Current program scene: gobs-test-scene', got '%s'", out.String())
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -31,14 +27,11 @@ func TestSceneCurrent(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
// Set the current scene to "gobs-test"
|
// Set the current scene to "gobs-test-scene"
|
||||||
cmdSwitch := &SceneSwitchCmd{
|
cmdSwitch := &SceneSwitchCmd{
|
||||||
NewScene: "gobs-test",
|
NewScene: "gobs-test-scene",
|
||||||
}
|
}
|
||||||
err := cmdSwitch.Run(context)
|
err := cmdSwitch.Run(context)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
@ -52,7 +45,7 @@ func TestSceneCurrent(t *testing.T) {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatalf("Failed to get current scene: %v", err)
|
t.Fatalf("Failed to get current scene: %v", err)
|
||||||
}
|
}
|
||||||
if out.String() != "gobs-test\n" {
|
if out.String() != "Current program scene: gobs-test-scene\n" {
|
||||||
t.Fatalf("Expected output to contain 'gobs-test', got '%s'", out.String())
|
t.Fatalf("Expected output to be 'Current program scene: gobs-test-scene', got '%s'", out.String())
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@ -4,7 +4,8 @@ import (
|
|||||||
"fmt"
|
"fmt"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs/api/requests/config"
|
"github.com/andreykaipov/goobs/api/requests/config"
|
||||||
"github.com/aquasecurity/table"
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// SceneCollectionCmd provides commands to manage scene collections in OBS Studio.
|
// SceneCollectionCmd provides commands to manage scene collections in OBS Studio.
|
||||||
@ -19,21 +20,37 @@ type SceneCollectionCmd struct {
|
|||||||
type SceneCollectionListCmd struct{} // size = 0x0
|
type SceneCollectionListCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to list all scene collections.
|
// Run executes the command to list all scene collections.
|
||||||
|
// nolint: misspell
|
||||||
func (cmd *SceneCollectionListCmd) Run(ctx *context) error {
|
func (cmd *SceneCollectionListCmd) Run(ctx *context) error {
|
||||||
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to get scene collection list: %w", err)
|
return fmt.Errorf("failed to get scene collection list: %w", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
t := table.New(ctx.Out)
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
t.SetPadding(3)
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||||
t.SetAlignment(table.AlignLeft)
|
Headers("Scene Collection Name").
|
||||||
t.SetHeaders("Scene Collection Name")
|
StyleFunc(func(row, col int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch col {
|
||||||
|
case 0:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
}
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center)
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
for _, collection := range collections.SceneCollections {
|
for _, collection := range collections.SceneCollections {
|
||||||
t.AddRow(collection)
|
t.Row(collection)
|
||||||
}
|
}
|
||||||
t.Render()
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -65,17 +82,17 @@ func (cmd *SceneCollectionSwitchCmd) Run(ctx *context) error {
|
|||||||
current := collections.CurrentSceneCollectionName
|
current := collections.CurrentSceneCollectionName
|
||||||
|
|
||||||
if current == cmd.Name {
|
if current == cmd.Name {
|
||||||
return fmt.Errorf("scene collection %s is already active", cmd.Name)
|
return fmt.Errorf("scene collection %s is already active", ctx.Style.Error(cmd.Name))
|
||||||
}
|
}
|
||||||
|
|
||||||
_, err = ctx.Client.Config.SetCurrentSceneCollection(
|
_, err = ctx.Client.Config.SetCurrentSceneCollection(
|
||||||
config.NewSetCurrentSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
config.NewSetCurrentSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
||||||
)
|
)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to switch scene collection: %w", err)
|
return fmt.Errorf("failed to switch scene collection %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintf(ctx.Out, "Switched to scene collection: %s\n", cmd.Name)
|
fmt.Fprintf(ctx.Out, "Switched to scene collection: %s\n", ctx.Style.Highlight(cmd.Name))
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@ -91,9 +108,9 @@ func (cmd *SceneCollectionCreateCmd) Run(ctx *context) error {
|
|||||||
config.NewCreateSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
config.NewCreateSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
||||||
)
|
)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to create scene collection: %w", err)
|
return fmt.Errorf("failed to create scene collection %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintf(ctx.Out, "Created scene collection: %s\n", cmd.Name)
|
fmt.Fprintf(ctx.Out, "Created scene collection: %s\n", ctx.Style.Highlight(cmd.Name))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
190
sceneitem.go
190
sceneitem.go
@ -1,11 +1,14 @@
|
|||||||
|
// nolint: misspell
|
||||||
package main
|
package main
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"fmt"
|
"fmt"
|
||||||
|
"sort"
|
||||||
|
|
||||||
"github.com/andreykaipov/goobs"
|
"github.com/andreykaipov/goobs"
|
||||||
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
||||||
"github.com/aquasecurity/table"
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
"github.com/charmbracelet/lipgloss/table"
|
||||||
)
|
)
|
||||||
|
|
||||||
// SceneItemCmd provides commands to manage scene items in OBS Studio.
|
// SceneItemCmd provides commands to manage scene items in OBS Studio.
|
||||||
@ -20,7 +23,8 @@ type SceneItemCmd struct {
|
|||||||
|
|
||||||
// SceneItemListCmd provides a command to list all scene items in a scene.
|
// SceneItemListCmd provides a command to list all scene items in a scene.
|
||||||
type SceneItemListCmd struct {
|
type SceneItemListCmd struct {
|
||||||
SceneName string `arg:"" help:"Name of the scene to list items from." default:""`
|
UUID bool `flag:"" help:"Display UUIDs of scene items."`
|
||||||
|
SceneName string ` help:"Name of the scene to list items from." arg:"" default:""`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run executes the command to list all scene items in a scene.
|
// Run executes the command to list all scene items in a scene.
|
||||||
@ -40,46 +44,127 @@ func (cmd *SceneItemListCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if len(resp.SceneItems) == 0 {
|
if len(resp.SceneItems) == 0 {
|
||||||
fmt.Fprintf(ctx.Out, "No scene items found in scene '%s'.\n", cmd.SceneName)
|
fmt.Fprintf(ctx.Out, "No scene items found in scene %s.\n", ctx.Style.Highlight(cmd.SceneName))
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
t := table.New(ctx.Out)
|
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||||
t.SetPadding(3)
|
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
|
||||||
t.SetAlignment(table.AlignLeft)
|
if cmd.UUID {
|
||||||
t.SetHeaders("Item Name")
|
t.Headers("Item ID", "Item Name", "In Group", "Enabled", "UUID")
|
||||||
|
} else {
|
||||||
|
t.Headers("Item ID", "Item Name", "In Group", "Enabled")
|
||||||
|
}
|
||||||
|
t.StyleFunc(func(row, col int) lipgloss.Style {
|
||||||
|
style := lipgloss.NewStyle().Padding(0, 3)
|
||||||
|
switch col {
|
||||||
|
case 0:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
case 1:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
case 2:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
case 3:
|
||||||
|
style = style.Align(lipgloss.Center)
|
||||||
|
case 4:
|
||||||
|
style = style.Align(lipgloss.Left)
|
||||||
|
}
|
||||||
|
switch {
|
||||||
|
case row == table.HeaderRow:
|
||||||
|
style = style.Bold(true).Align(lipgloss.Center)
|
||||||
|
case row%2 == 0:
|
||||||
|
style = style.Foreground(ctx.Style.evenRows)
|
||||||
|
default:
|
||||||
|
style = style.Foreground(ctx.Style.oddRows)
|
||||||
|
}
|
||||||
|
return style
|
||||||
|
})
|
||||||
|
|
||||||
|
sort.Slice(resp.SceneItems, func(i, j int) bool {
|
||||||
|
return resp.SceneItems[i].SceneItemID < resp.SceneItems[j].SceneItemID
|
||||||
|
})
|
||||||
|
|
||||||
for _, item := range resp.SceneItems {
|
for _, item := range resp.SceneItems {
|
||||||
t.AddRow(item.SourceName)
|
if item.IsGroup {
|
||||||
|
resp, err := ctx.Client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
|
||||||
|
WithSceneName(item.SourceName))
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf(
|
||||||
|
"failed to get group scene item list for group %s: %w",
|
||||||
|
ctx.Style.Error(item.SourceName),
|
||||||
|
err,
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
sort.Slice(resp.SceneItems, func(i, j int) bool {
|
||||||
|
return resp.SceneItems[i].SceneItemID < resp.SceneItems[j].SceneItemID
|
||||||
|
})
|
||||||
|
|
||||||
|
for _, groupItem := range resp.SceneItems {
|
||||||
|
if cmd.UUID {
|
||||||
|
t.Row(
|
||||||
|
fmt.Sprintf("%d", groupItem.SceneItemID),
|
||||||
|
groupItem.SourceName,
|
||||||
|
item.SourceName,
|
||||||
|
getEnabledMark(item.SceneItemEnabled && groupItem.SceneItemEnabled),
|
||||||
|
groupItem.SourceUuid,
|
||||||
|
)
|
||||||
|
} else {
|
||||||
|
t.Row(
|
||||||
|
fmt.Sprintf("%d", groupItem.SceneItemID),
|
||||||
|
groupItem.SourceName,
|
||||||
|
item.SourceName,
|
||||||
|
getEnabledMark(item.SceneItemEnabled && groupItem.SceneItemEnabled),
|
||||||
|
)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
if cmd.UUID {
|
||||||
|
t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, "",
|
||||||
|
getEnabledMark(item.SceneItemEnabled), item.SourceUuid)
|
||||||
|
} else {
|
||||||
|
t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, "", getEnabledMark(item.SceneItemEnabled))
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
t.Render()
|
fmt.Fprintln(ctx.Out, t.Render())
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// getSceneNameAndItemID retrieves the scene name and item ID for a given item in a scene or group.
|
||||||
func getSceneNameAndItemID(
|
func getSceneNameAndItemID(
|
||||||
client *goobs.Client,
|
ctx *context,
|
||||||
sceneName string,
|
sceneName string,
|
||||||
itemName string,
|
itemName string,
|
||||||
parent string,
|
group string,
|
||||||
) (string, int, error) {
|
) (string, int, error) {
|
||||||
if parent != "" {
|
if group != "" {
|
||||||
resp, err := client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
|
resp, err := ctx.Client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
|
||||||
WithSceneName(parent))
|
WithSceneName(group))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return "", 0, err
|
return "", 0, err
|
||||||
}
|
}
|
||||||
for _, item := range resp.SceneItems {
|
for _, item := range resp.SceneItems {
|
||||||
if item.SourceName == itemName {
|
if item.SourceName == itemName {
|
||||||
return parent, int(item.SceneItemID), nil
|
return group, int(item.SceneItemID), nil
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return "", 0, fmt.Errorf("item '%s' not found in scene '%s'", itemName, sceneName)
|
return "", 0, fmt.Errorf("item %s not found in scene %s", ctx.Style.Error(itemName), ctx.Style.Error(sceneName))
|
||||||
}
|
}
|
||||||
|
|
||||||
itemID, err := client.SceneItems.GetSceneItemId(sceneitems.NewGetSceneItemIdParams().
|
itemID, err := ctx.Client.SceneItems.GetSceneItemId(sceneitems.NewGetSceneItemIdParams().
|
||||||
WithSceneName(sceneName).
|
WithSceneName(sceneName).
|
||||||
WithSourceName(itemName))
|
WithSourceName(itemName))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
if err.Error() == "request GetSceneItemId: ResourceNotFound (600): No scene items were found in the specified scene by that name or offset." {
|
||||||
|
return "", 0, fmt.Errorf(
|
||||||
|
"item %s not found in scene %s. is it in a group? if so use the %s flag to specify the parent group\nuse %s for a list of items in the scene",
|
||||||
|
ctx.Style.Error(itemName),
|
||||||
|
ctx.Style.Error(sceneName),
|
||||||
|
ctx.Style.Error("--group"),
|
||||||
|
ctx.Style.Error("gobs-cli si ls"),
|
||||||
|
)
|
||||||
|
}
|
||||||
return "", 0, err
|
return "", 0, err
|
||||||
}
|
}
|
||||||
return sceneName, int(itemID.SceneItemId), nil
|
return sceneName, int(itemID.SceneItemId), nil
|
||||||
@ -87,7 +172,7 @@ func getSceneNameAndItemID(
|
|||||||
|
|
||||||
// SceneItemShowCmd provides a command to show a scene item.
|
// SceneItemShowCmd provides a command to show a scene item.
|
||||||
type SceneItemShowCmd struct {
|
type SceneItemShowCmd struct {
|
||||||
Parent string `flag:"" help:"Parent group name."`
|
Group string `flag:"" help:"Parent group name."`
|
||||||
|
|
||||||
SceneName string `arg:"" help:"Scene name."`
|
SceneName string `arg:"" help:"Scene name."`
|
||||||
ItemName string `arg:"" help:"Item name."`
|
ItemName string `arg:"" help:"Item name."`
|
||||||
@ -95,7 +180,7 @@ type SceneItemShowCmd struct {
|
|||||||
|
|
||||||
// Run executes the command to show a scene item.
|
// Run executes the command to show a scene item.
|
||||||
func (cmd *SceneItemShowCmd) Run(ctx *context) error {
|
func (cmd *SceneItemShowCmd) Run(ctx *context) error {
|
||||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@ -108,10 +193,15 @@ func (cmd *SceneItemShowCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
if cmd.Parent != "" {
|
if cmd.Group != "" {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' is now visible.\n", cmd.ItemName, cmd.Parent)
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"Scene item %s in group %s is now visible.\n",
|
||||||
|
ctx.Style.Highlight(cmd.ItemName),
|
||||||
|
ctx.Style.Highlight(cmd.Group),
|
||||||
|
)
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now visible.\n", cmd.ItemName, cmd.SceneName)
|
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now visible.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||||
}
|
}
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
@ -119,7 +209,7 @@ func (cmd *SceneItemShowCmd) Run(ctx *context) error {
|
|||||||
|
|
||||||
// SceneItemHideCmd provides a command to hide a scene item.
|
// SceneItemHideCmd provides a command to hide a scene item.
|
||||||
type SceneItemHideCmd struct {
|
type SceneItemHideCmd struct {
|
||||||
Parent string `flag:"" help:"Parent group name."`
|
Group string `flag:"" help:"Parent group name."`
|
||||||
|
|
||||||
SceneName string `arg:"" help:"Scene name."`
|
SceneName string `arg:"" help:"Scene name."`
|
||||||
ItemName string `arg:"" help:"Item name."`
|
ItemName string `arg:"" help:"Item name."`
|
||||||
@ -127,7 +217,7 @@ type SceneItemHideCmd struct {
|
|||||||
|
|
||||||
// Run executes the command to hide a scene item.
|
// Run executes the command to hide a scene item.
|
||||||
func (cmd *SceneItemHideCmd) Run(ctx *context) error {
|
func (cmd *SceneItemHideCmd) Run(ctx *context) error {
|
||||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@ -140,10 +230,15 @@ func (cmd *SceneItemHideCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
if cmd.Parent != "" {
|
if cmd.Group != "" {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' is now hidden.\n", cmd.ItemName, cmd.Parent)
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"Scene item %s in group %s is now hidden.\n",
|
||||||
|
ctx.Style.Highlight(cmd.ItemName),
|
||||||
|
ctx.Style.Highlight(cmd.Group),
|
||||||
|
)
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now hidden.\n", cmd.ItemName, cmd.SceneName)
|
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now hidden.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||||
}
|
}
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
@ -162,7 +257,7 @@ func getItemEnabled(client *goobs.Client, sceneName string, itemID int) (bool, e
|
|||||||
|
|
||||||
// SceneItemToggleCmd provides a command to toggle the visibility of a scene item.
|
// SceneItemToggleCmd provides a command to toggle the visibility of a scene item.
|
||||||
type SceneItemToggleCmd struct {
|
type SceneItemToggleCmd struct {
|
||||||
Parent string `flag:"" help:"Parent group name."`
|
Group string `flag:"" help:"Parent group name."`
|
||||||
|
|
||||||
SceneName string `arg:"" help:"Scene name."`
|
SceneName string `arg:"" help:"Scene name."`
|
||||||
ItemName string `arg:"" help:"Item name."`
|
ItemName string `arg:"" help:"Item name."`
|
||||||
@ -170,7 +265,7 @@ type SceneItemToggleCmd struct {
|
|||||||
|
|
||||||
// Run executes the command to toggle the visibility of a scene item.
|
// Run executes the command to toggle the visibility of a scene item.
|
||||||
func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
|
func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
|
||||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@ -189,9 +284,14 @@ func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if itemEnabled {
|
if itemEnabled {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now hidden.\n", cmd.ItemName, cmd.SceneName)
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"Scene item %s in scene %s is now hidden.\n",
|
||||||
|
ctx.Style.Highlight(cmd.ItemName),
|
||||||
|
ctx.Style.Highlight(cmd.SceneName),
|
||||||
|
)
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now visible.\n", cmd.ItemName, cmd.SceneName)
|
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now visible.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||||
}
|
}
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
@ -199,7 +299,7 @@ func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
|
|||||||
|
|
||||||
// SceneItemVisibleCmd provides a command to check the visibility of a scene item.
|
// SceneItemVisibleCmd provides a command to check the visibility of a scene item.
|
||||||
type SceneItemVisibleCmd struct {
|
type SceneItemVisibleCmd struct {
|
||||||
Parent string `flag:"" help:"Parent group name."`
|
Group string `flag:"" help:"Parent group name."`
|
||||||
|
|
||||||
SceneName string `arg:"" help:"Scene name."`
|
SceneName string `arg:"" help:"Scene name."`
|
||||||
ItemName string `arg:"" help:"Item name."`
|
ItemName string `arg:"" help:"Item name."`
|
||||||
@ -207,7 +307,7 @@ type SceneItemVisibleCmd struct {
|
|||||||
|
|
||||||
// Run executes the command to check the visibility of a scene item.
|
// Run executes the command to check the visibility of a scene item.
|
||||||
func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
|
func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
|
||||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@ -218,9 +318,14 @@ func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if itemEnabled {
|
if itemEnabled {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is visible.\n", cmd.ItemName, cmd.SceneName)
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"Scene item %s in scene %s is visible.\n",
|
||||||
|
ctx.Style.Highlight(cmd.ItemName),
|
||||||
|
ctx.Style.Highlight(cmd.SceneName),
|
||||||
|
)
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is hidden.\n", cmd.ItemName, cmd.SceneName)
|
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is hidden.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
@ -230,7 +335,7 @@ type SceneItemTransformCmd struct {
|
|||||||
SceneName string `arg:"" help:"Scene name."`
|
SceneName string `arg:"" help:"Scene name."`
|
||||||
ItemName string `arg:"" help:"Item name."`
|
ItemName string `arg:"" help:"Item name."`
|
||||||
|
|
||||||
Parent string `flag:"" help:"Parent group name."`
|
Group string `flag:"" help:"Parent group name."`
|
||||||
|
|
||||||
Alignment float64 `flag:"" help:"Alignment of the scene item."`
|
Alignment float64 `flag:"" help:"Alignment of the scene item."`
|
||||||
BoundsAlignment float64 `flag:"" help:"Bounds alignment of the scene item."`
|
BoundsAlignment float64 `flag:"" help:"Bounds alignment of the scene item."`
|
||||||
@ -251,7 +356,7 @@ type SceneItemTransformCmd struct {
|
|||||||
|
|
||||||
// Run executes the command to transform a scene item.
|
// Run executes the command to transform a scene item.
|
||||||
func (cmd *SceneItemTransformCmd) Run(ctx *context) error {
|
func (cmd *SceneItemTransformCmd) Run(ctx *context) error {
|
||||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Parent)
|
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@ -323,10 +428,15 @@ func (cmd *SceneItemTransformCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
if cmd.Parent != "" {
|
if cmd.Group != "" {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' transformed.\n", cmd.ItemName, cmd.Parent)
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"Scene item %s in group %s transformed.\n",
|
||||||
|
ctx.Style.Highlight(cmd.ItemName),
|
||||||
|
ctx.Style.Highlight(cmd.Group),
|
||||||
|
)
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' transformed.\n", cmd.ItemName, cmd.SceneName)
|
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s transformed.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||||
}
|
}
|
||||||
|
|
||||||
return nil
|
return nil
|
||||||
|
|||||||
@ -11,13 +11,10 @@ func TestSceneItemList(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmd := &SceneItemListCmd{
|
cmd := &SceneItemListCmd{
|
||||||
SceneName: "gobs-test",
|
SceneName: "gobs-test-scene",
|
||||||
}
|
}
|
||||||
err := cmd.Run(context)
|
err := cmd.Run(context)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
|||||||
41
screenshot.go
Normal file
41
screenshot.go
Normal file
@ -0,0 +1,41 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
"path/filepath"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/sources"
|
||||||
|
)
|
||||||
|
|
||||||
|
// ScreenshotCmd provides commands to manage screenshots in OBS Studio.
|
||||||
|
type ScreenshotCmd struct {
|
||||||
|
Save ScreenshotSaveCmd `cmd:"" help:"Take a screenshot and save it to a file." aliases:"sv"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// ScreenshotSaveCmd represents the command to save a screenshot of a source in OBS.
|
||||||
|
type ScreenshotSaveCmd struct {
|
||||||
|
SourceName string `arg:"" help:"Name of the source to take a screenshot of."`
|
||||||
|
FilePath string `arg:"" help:"Path to the file where the screenshot will be saved."`
|
||||||
|
Width float64 ` help:"Width of the screenshot in pixels." flag:"" default:"1920"`
|
||||||
|
Height float64 ` help:"Height of the screenshot in pixels." flag:"" default:"1080"`
|
||||||
|
Quality float64 ` help:"Quality of the screenshot (1-100)." flag:"" default:"-1"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to take a screenshot and save it to a file.
|
||||||
|
func (cmd *ScreenshotSaveCmd) Run(ctx *context) error {
|
||||||
|
_, err := ctx.Client.Sources.SaveSourceScreenshot(
|
||||||
|
sources.NewSaveSourceScreenshotParams().
|
||||||
|
WithSourceName(cmd.SourceName).
|
||||||
|
WithImageFormat(trimPrefix(filepath.Ext(cmd.FilePath), ".")).
|
||||||
|
WithImageFilePath(cmd.FilePath).
|
||||||
|
WithImageWidth(cmd.Width).
|
||||||
|
WithImageHeight(cmd.Height).
|
||||||
|
WithImageCompressionQuality(cmd.Quality),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to take screenshot: %w", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
fmt.Fprintf(ctx.Out, "Screenshot saved to %s.\n", ctx.Style.Highlight(cmd.FilePath))
|
||||||
|
return nil
|
||||||
|
}
|
||||||
14
stream.go
14
stream.go
@ -23,8 +23,7 @@ func (cmd *StreamStartCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
if status.OutputActive {
|
if status.OutputActive {
|
||||||
fmt.Fprintln(ctx.Out, "Stream is already active.")
|
return fmt.Errorf("stream is already in progress")
|
||||||
return nil
|
|
||||||
}
|
}
|
||||||
|
|
||||||
_, err = ctx.Client.Stream.StartStream()
|
_, err = ctx.Client.Stream.StartStream()
|
||||||
@ -32,7 +31,7 @@ func (cmd *StreamStartCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintln(ctx.Out, "Streaming started successfully.")
|
fmt.Fprintln(ctx.Out, "Stream started successfully.")
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -47,8 +46,7 @@ func (cmd *StreamStopCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
if !status.OutputActive {
|
if !status.OutputActive {
|
||||||
fmt.Fprintln(ctx.Out, "Stream is already inactive.")
|
return fmt.Errorf("stream is not in progress")
|
||||||
return nil
|
|
||||||
}
|
}
|
||||||
|
|
||||||
_, err = ctx.Client.Stream.StopStream()
|
_, err = ctx.Client.Stream.StopStream()
|
||||||
@ -56,7 +54,7 @@ func (cmd *StreamStopCmd) Run(ctx *context) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
fmt.Fprintln(ctx.Out, "Streaming stopped successfully.")
|
fmt.Fprintln(ctx.Out, "Stream stopped successfully.")
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -71,9 +69,9 @@ func (cmd *StreamToggleCmd) Run(ctx *context) error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if status.OutputActive {
|
if status.OutputActive {
|
||||||
fmt.Fprintln(ctx.Out, "Streaming started successfully.")
|
fmt.Fprintln(ctx.Out, "Stream started successfully.")
|
||||||
} else {
|
} else {
|
||||||
fmt.Fprintln(ctx.Out, "Streaming stopped successfully.")
|
fmt.Fprintln(ctx.Out, "Stream stopped successfully.")
|
||||||
}
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|||||||
@ -12,10 +12,7 @@ func TestStreamStart(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdStatus := &StreamStatusCmd{}
|
cmdStatus := &StreamStatusCmd{}
|
||||||
err := cmdStatus.Run(context)
|
err := cmdStatus.Run(context)
|
||||||
@ -31,21 +28,22 @@ func TestStreamStart(t *testing.T) {
|
|||||||
|
|
||||||
cmdStart := &StreamStartCmd{}
|
cmdStart := &StreamStartCmd{}
|
||||||
err = cmdStart.Run(context)
|
err = cmdStart.Run(context)
|
||||||
|
if active {
|
||||||
|
if err == nil {
|
||||||
|
t.Fatalf("Expected error when starting stream while active, got nil")
|
||||||
|
}
|
||||||
|
if !strings.Contains(err.Error(), "stream is already in progress") {
|
||||||
|
t.Fatalf("Expected error message to contain 'stream is already in progress', got '%s'", err.Error())
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatalf("Failed to start stream: %v", err)
|
t.Fatalf("Failed to start stream: %v", err)
|
||||||
}
|
}
|
||||||
|
if out.String() != "Stream started successfully.\n" {
|
||||||
time.Sleep(1 * time.Second) // Wait for the stream to start
|
t.Fatalf("Expected output to contain 'Stream started successfully.', got '%s'", out.String())
|
||||||
|
|
||||||
if active {
|
|
||||||
if out.String() != "Stream is already active.\n" {
|
|
||||||
t.Fatalf("Expected 'Stream is already active.', got: %s", out.String())
|
|
||||||
}
|
|
||||||
} else {
|
|
||||||
if out.String() != "Streaming started successfully.\n" {
|
|
||||||
t.Fatalf("Expected 'Streaming started successfully.', got: %s", out.String())
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
time.Sleep(500 * time.Millisecond) // Wait for the stream to start
|
||||||
}
|
}
|
||||||
|
|
||||||
func TestStreamStop(t *testing.T) {
|
func TestStreamStop(t *testing.T) {
|
||||||
@ -53,10 +51,7 @@ func TestStreamStop(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdStatus := &StreamStatusCmd{}
|
cmdStatus := &StreamStatusCmd{}
|
||||||
err := cmdStatus.Run(context)
|
err := cmdStatus.Run(context)
|
||||||
@ -72,21 +67,22 @@ func TestStreamStop(t *testing.T) {
|
|||||||
|
|
||||||
cmdStop := &StreamStopCmd{}
|
cmdStop := &StreamStopCmd{}
|
||||||
err = cmdStop.Run(context)
|
err = cmdStop.Run(context)
|
||||||
|
if !active {
|
||||||
|
if err == nil {
|
||||||
|
t.Fatalf("Expected error when stopping stream while inactive, got nil")
|
||||||
|
}
|
||||||
|
if !strings.Contains(err.Error(), "stream is not in progress") {
|
||||||
|
t.Fatalf("Expected error message to contain 'stream is not in progress', got '%s'", err.Error())
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
if err != nil {
|
if err != nil {
|
||||||
t.Fatalf("Failed to stop stream: %v", err)
|
t.Fatalf("Failed to stop stream: %v", err)
|
||||||
}
|
}
|
||||||
|
if out.String() != "Stream stopped successfully.\n" {
|
||||||
time.Sleep(1 * time.Second) // Wait for the stream to stop
|
t.Fatalf("Expected output to contain 'Stream stopped successfully.', got '%s'", out.String())
|
||||||
|
|
||||||
if active {
|
|
||||||
if out.String() != "Streaming stopped successfully.\n" {
|
|
||||||
t.Fatalf("Expected 'Streaming stopped successfully.', got: %s", out.String())
|
|
||||||
}
|
|
||||||
} else {
|
|
||||||
if out.String() != "Stream is already inactive.\n" {
|
|
||||||
t.Fatalf("Expected 'Stream is already inactive.', got: %s", out.String())
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
time.Sleep(500 * time.Millisecond) // Wait for the stream to stop
|
||||||
}
|
}
|
||||||
|
|
||||||
func TestStreamToggle(t *testing.T) {
|
func TestStreamToggle(t *testing.T) {
|
||||||
@ -94,10 +90,7 @@ func TestStreamToggle(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdStatus := &StreamStatusCmd{}
|
cmdStatus := &StreamStatusCmd{}
|
||||||
err := cmdStatus.Run(context)
|
err := cmdStatus.Run(context)
|
||||||
@ -117,15 +110,14 @@ func TestStreamToggle(t *testing.T) {
|
|||||||
t.Fatalf("Failed to toggle stream: %v", err)
|
t.Fatalf("Failed to toggle stream: %v", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
time.Sleep(1 * time.Second) // Wait for the stream to toggle
|
|
||||||
|
|
||||||
if active {
|
if active {
|
||||||
if out.String() != "Streaming stopped successfully.\n" {
|
if out.String() != "Stream stopped successfully.\n" {
|
||||||
t.Fatalf("Expected 'Streaming stopped successfully.', got: %s", out.String())
|
t.Fatalf("Expected 'Stream stopped successfully.', got: %s", out.String())
|
||||||
}
|
}
|
||||||
} else {
|
} else {
|
||||||
if out.String() != "Streaming started successfully.\n" {
|
if out.String() != "Stream started successfully.\n" {
|
||||||
t.Fatalf("Expected 'Streaming started successfully.', got: %s", out.String())
|
t.Fatalf("Expected 'Stream started successfully.', got: %s", out.String())
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
time.Sleep(500 * time.Millisecond) // Wait for the stream to toggle
|
||||||
}
|
}
|
||||||
|
|||||||
@ -10,10 +10,7 @@ func TestStudioModeEnable(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdEnable := &StudioModeEnableCmd{}
|
cmdEnable := &StudioModeEnableCmd{}
|
||||||
err := cmdEnable.Run(context)
|
err := cmdEnable.Run(context)
|
||||||
@ -41,10 +38,7 @@ func TestStudioModeDisable(t *testing.T) {
|
|||||||
defer disconnect()
|
defer disconnect()
|
||||||
|
|
||||||
var out bytes.Buffer
|
var out bytes.Buffer
|
||||||
context := &context{
|
context := newContext(client, &out, StyleConfig{})
|
||||||
Client: client,
|
|
||||||
Out: &out,
|
|
||||||
}
|
|
||||||
|
|
||||||
cmdDisable := &StudioModeDisableCmd{}
|
cmdDisable := &StudioModeDisableCmd{}
|
||||||
err := cmdDisable.Run(context)
|
err := cmdDisable.Run(context)
|
||||||
|
|||||||
192
style.go
Normal file
192
style.go
Normal file
@ -0,0 +1,192 @@
|
|||||||
|
// nolint: misspell
|
||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
"os"
|
||||||
|
|
||||||
|
"github.com/charmbracelet/lipgloss"
|
||||||
|
)
|
||||||
|
|
||||||
|
// Style defines colours for the table styles.
|
||||||
|
type Style struct {
|
||||||
|
name string
|
||||||
|
border lipgloss.Color
|
||||||
|
oddRows lipgloss.Color
|
||||||
|
evenRows lipgloss.Color
|
||||||
|
highlight lipgloss.Color
|
||||||
|
}
|
||||||
|
|
||||||
|
// Highlight applies the highlight style to the given text.
|
||||||
|
func (s *Style) Highlight(text string) string {
|
||||||
|
return lipgloss.NewStyle().Foreground(s.highlight).Render(text)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (s *Style) Error(text string) string {
|
||||||
|
return lipgloss.NewStyle().Foreground(lipgloss.Color("#FF0000")).Render(text) // Red for errors
|
||||||
|
}
|
||||||
|
|
||||||
|
func newRedStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "red",
|
||||||
|
border: lipgloss.Color("#D32F2F"), // Strong red for border
|
||||||
|
oddRows: lipgloss.Color("#FFCDD2"), // Very light red for odd rows
|
||||||
|
evenRows: lipgloss.Color("#EF9A9A"), // Light red for even rows
|
||||||
|
highlight: lipgloss.Color("#EF9A9A"), // Highlight in light red
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newMagentaStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "magenta",
|
||||||
|
border: lipgloss.Color("#C2185B"), // Strong magenta for border
|
||||||
|
oddRows: lipgloss.Color("#F8BBD0"), // Very light magenta/pink for odd rows
|
||||||
|
evenRows: lipgloss.Color("#F48FB1"), // Light magenta/pink for even rows
|
||||||
|
highlight: lipgloss.Color("#F48FB1"), // Highlight in light magenta/pink
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newPurpleStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "purple",
|
||||||
|
border: lipgloss.Color("#7B1FA2"), // Strong purple for border
|
||||||
|
oddRows: lipgloss.Color("#E1BEE7"), // Very light purple for odd rows
|
||||||
|
evenRows: lipgloss.Color("#CE93D8"), // Light purple for even rows
|
||||||
|
highlight: lipgloss.Color("#CE93D8"), // Highlight in light purple
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newBlueStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "blue",
|
||||||
|
border: lipgloss.Color("#1976D2"), // Medium blue for border
|
||||||
|
oddRows: lipgloss.Color("#E3F2FD"), // Very light blue for odd rows
|
||||||
|
evenRows: lipgloss.Color("#BBDEFB"), // Light blue for even rows
|
||||||
|
highlight: lipgloss.Color("#1976D2"), // Highlight in medium blue
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newCyanStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "cyan",
|
||||||
|
border: lipgloss.Color("#00BFCF"), // A strong cyan for border
|
||||||
|
oddRows: lipgloss.Color("#E0F7FA"), // Very light cyan for odd rows
|
||||||
|
evenRows: lipgloss.Color("#B2EBF2"), // Slightly darker light cyan for even rows
|
||||||
|
highlight: lipgloss.Color("#00BFCF"), // Highlight in strong cyan
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newGreenStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "green",
|
||||||
|
border: lipgloss.Color("#43A047"), // Medium green for border
|
||||||
|
oddRows: lipgloss.Color("#E8F5E9"), // Very light green for odd rows
|
||||||
|
evenRows: lipgloss.Color("#C8E6C9"), // Light green for even rows
|
||||||
|
highlight: lipgloss.Color("#43A047"), // Highlight in medium green
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newYellowStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "yellow",
|
||||||
|
border: lipgloss.Color("#FBC02D"), // Strong yellow for border
|
||||||
|
oddRows: lipgloss.Color("#FFF9C4"), // Very light yellow for odd rows
|
||||||
|
evenRows: lipgloss.Color("#FFF59D"), // Light yellow for even rows
|
||||||
|
highlight: lipgloss.Color("#FBC02D"), // Highlight in strong yellow
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newOrangeStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "orange",
|
||||||
|
border: lipgloss.Color("#F57C00"), // Strong orange for border
|
||||||
|
oddRows: lipgloss.Color("#FFF3E0"), // Very light orange for odd rows
|
||||||
|
evenRows: lipgloss.Color("#FFE0B2"), // Light orange for even rows
|
||||||
|
highlight: lipgloss.Color("#F57C00"), // Highlight in strong orange
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newWhiteStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "white",
|
||||||
|
border: lipgloss.Color("#FFFFFF"), // White for border
|
||||||
|
oddRows: lipgloss.Color("#F0F0F0"), // Very light grey for odd rows
|
||||||
|
evenRows: lipgloss.Color("#E0E0E0"), // Light grey for even rows
|
||||||
|
highlight: lipgloss.Color("#FFFFFF"), // Highlight in white
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newGreyStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "grey",
|
||||||
|
border: lipgloss.Color("#9E9E9E"), // Medium grey for border
|
||||||
|
oddRows: lipgloss.Color("#F5F5F5"), // Very light grey for odd rows
|
||||||
|
evenRows: lipgloss.Color("#EEEEEE"), // Light grey for even rows
|
||||||
|
highlight: lipgloss.Color("#9E9E9E"), // Highlight in medium grey
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newNavyBlueStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "navy",
|
||||||
|
border: lipgloss.Color("#001F3F"), // Navy blue for border
|
||||||
|
oddRows: lipgloss.Color("#CFE2F3"), // Very light blue for odd rows
|
||||||
|
evenRows: lipgloss.Color("#A9CCE3"), // Light blue for even rows
|
||||||
|
highlight: lipgloss.Color("#001F3F"), // Highlight in navy blue
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func newBlackStyle() Style {
|
||||||
|
return Style{
|
||||||
|
name: "black",
|
||||||
|
border: lipgloss.Color("#000000"), // Black for border
|
||||||
|
oddRows: lipgloss.Color("#333333"), // Dark grey for odd rows
|
||||||
|
evenRows: lipgloss.Color("#444444"), // Slightly lighter dark grey for even rows
|
||||||
|
highlight: lipgloss.Color("#000000"), // Highlight in black
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func styleFromFlag(cfg StyleConfig) *Style {
|
||||||
|
var style Style
|
||||||
|
|
||||||
|
switch cfg.Style {
|
||||||
|
case "red":
|
||||||
|
style = newRedStyle()
|
||||||
|
case "magenta":
|
||||||
|
style = newMagentaStyle()
|
||||||
|
case "purple":
|
||||||
|
style = newPurpleStyle()
|
||||||
|
case "blue":
|
||||||
|
style = newBlueStyle()
|
||||||
|
case "cyan":
|
||||||
|
style = newCyanStyle()
|
||||||
|
case "green":
|
||||||
|
style = newGreenStyle()
|
||||||
|
case "yellow":
|
||||||
|
style = newYellowStyle()
|
||||||
|
case "orange":
|
||||||
|
style = newOrangeStyle()
|
||||||
|
case "white":
|
||||||
|
style = newWhiteStyle()
|
||||||
|
case "grey":
|
||||||
|
style = newGreyStyle()
|
||||||
|
case "navy":
|
||||||
|
style = newNavyBlueStyle()
|
||||||
|
case "black":
|
||||||
|
style = newBlackStyle()
|
||||||
|
default:
|
||||||
|
err := os.Setenv("NO_COLOR", "1") // nolint: misspell
|
||||||
|
if err != nil {
|
||||||
|
// If we can't set NO_COLOR, we just log the error and continue
|
||||||
|
// This is a fallback to ensure that the application can still run
|
||||||
|
fmt.Fprintf(os.Stderr, "Error setting NO_COLOR: %v\n", err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// If noBorder is true, we disable the border styling
|
||||||
|
if cfg.NoBorder {
|
||||||
|
style.border = ""
|
||||||
|
}
|
||||||
|
|
||||||
|
return &style
|
||||||
|
}
|
||||||
85
text.go
Normal file
85
text.go
Normal file
@ -0,0 +1,85 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
"strings"
|
||||||
|
|
||||||
|
"github.com/andreykaipov/goobs/api/requests/inputs"
|
||||||
|
)
|
||||||
|
|
||||||
|
// TextCmd provides commands for managing text inputs in OBS.
|
||||||
|
type TextCmd struct {
|
||||||
|
Current TextCurrentCmd `cmd:"current" help:"Display current text for a text input." aliases:"c"`
|
||||||
|
Update TextUpdateCmd `cmd:"update" help:"Update the text of a text input." aliases:"u"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// TextCurrentCmd provides a command to display the current text of a text input.
|
||||||
|
type TextCurrentCmd struct {
|
||||||
|
InputName string `arg:"" help:"Name of the text source."`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to display the current text of a text input.
|
||||||
|
func (cmd *TextCurrentCmd) Run(ctx *context) error {
|
||||||
|
resp, err := ctx.Client.Inputs.GetInputSettings(
|
||||||
|
inputs.NewGetInputSettingsParams().WithInputName(cmd.InputName),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get input settings: %w", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Check if the input is a text input
|
||||||
|
kind := resp.InputKind
|
||||||
|
if !strings.HasPrefix(kind, "text_") {
|
||||||
|
return fmt.Errorf("input %s is of %s", cmd.InputName, kind)
|
||||||
|
}
|
||||||
|
|
||||||
|
currentText, ok := resp.InputSettings["text"]
|
||||||
|
if !ok {
|
||||||
|
return fmt.Errorf("input %s does not have a 'text' setting", cmd.InputName)
|
||||||
|
}
|
||||||
|
if currentText == "" {
|
||||||
|
currentText = "(empty)"
|
||||||
|
}
|
||||||
|
fmt.Fprintf(
|
||||||
|
ctx.Out,
|
||||||
|
"Current text for source %s: %s\n",
|
||||||
|
ctx.Style.Highlight(cmd.InputName),
|
||||||
|
currentText,
|
||||||
|
)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// TextUpdateCmd provides a command to update the text of a text input.
|
||||||
|
type TextUpdateCmd struct {
|
||||||
|
InputName string `arg:"" help:"Name of the text source."`
|
||||||
|
NewText string `arg:"" help:"New text to set for the source." default:""`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run executes the command to update the text of a text input.
|
||||||
|
func (cmd *TextUpdateCmd) Run(ctx *context) error {
|
||||||
|
resp, err := ctx.Client.Inputs.GetInputSettings(
|
||||||
|
inputs.NewGetInputSettingsParams().WithInputName(cmd.InputName),
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Errorf("failed to get input settings: %w", err)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Check if the input is a text input
|
||||||
|
kind := resp.InputKind
|
||||||
|
if !strings.HasPrefix(kind, "text_") {
|
||||||
|
return fmt.Errorf("input %s is of %s", cmd.InputName, kind)
|
||||||
|
}
|
||||||
|
|
||||||
|
if _, err := ctx.Client.Inputs.SetInputSettings(&inputs.SetInputSettingsParams{
|
||||||
|
InputName: &cmd.InputName,
|
||||||
|
InputSettings: map[string]any{"text": &cmd.NewText},
|
||||||
|
}); err != nil {
|
||||||
|
return fmt.Errorf("failed to update text for source %s: %w", cmd.InputName, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
if cmd.NewText == "" {
|
||||||
|
cmd.NewText = "(empty)"
|
||||||
|
}
|
||||||
|
fmt.Fprintf(ctx.Out, "Updated text for source %s to: %s\n", ctx.Style.Highlight(cmd.InputName), cmd.NewText)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
22
util.go
22
util.go
@ -2,7 +2,10 @@
|
|||||||
|
|
||||||
package main
|
package main
|
||||||
|
|
||||||
import "strings"
|
import (
|
||||||
|
"os"
|
||||||
|
"strings"
|
||||||
|
)
|
||||||
|
|
||||||
func snakeCaseToTitleCase(snake string) string {
|
func snakeCaseToTitleCase(snake string) string {
|
||||||
words := strings.Split(snake, "_")
|
words := strings.Split(snake, "_")
|
||||||
@ -16,7 +19,20 @@ func snakeCaseToTitleCase(snake string) string {
|
|||||||
|
|
||||||
func getEnabledMark(enabled bool) string {
|
func getEnabledMark(enabled bool) string {
|
||||||
if enabled {
|
if enabled {
|
||||||
return "\u2713" // green check mark
|
if os.Getenv("NO_COLOR") != "" { // nolint: misspell
|
||||||
|
return "✓"
|
||||||
|
}
|
||||||
|
return "✅"
|
||||||
}
|
}
|
||||||
return "\u274c" // red cross mark
|
if os.Getenv("NO_COLOR") != "" { // nolint: misspell
|
||||||
|
return "✗"
|
||||||
|
}
|
||||||
|
return "❌"
|
||||||
|
}
|
||||||
|
|
||||||
|
func trimPrefix(s, prefix string) string {
|
||||||
|
if strings.HasPrefix(s, prefix) {
|
||||||
|
return s[len(prefix):]
|
||||||
|
}
|
||||||
|
return s
|
||||||
}
|
}
|
||||||
|
|||||||
@ -4,11 +4,11 @@ import (
|
|||||||
"fmt"
|
"fmt"
|
||||||
)
|
)
|
||||||
|
|
||||||
// VersionCmd handles the version command.
|
// ObsVersionCmd handles the version command.
|
||||||
type VersionCmd struct{} // size = 0x0
|
type ObsVersionCmd struct{} // size = 0x0
|
||||||
|
|
||||||
// Run executes the command to get the OBS client version.
|
// Run executes the command to get the OBS client version.
|
||||||
func (cmd *VersionCmd) Run(ctx *context) error {
|
func (cmd *ObsVersionCmd) Run(ctx *context) error {
|
||||||
version, err := ctx.Client.General.GetVersion()
|
version, err := ctx.Client.General.GetVersion()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
|
|||||||
27
version_test.go
Normal file
27
version_test.go
Normal file
@ -0,0 +1,27 @@
|
|||||||
|
package main
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"strings"
|
||||||
|
"testing"
|
||||||
|
)
|
||||||
|
|
||||||
|
func TestVersion(t *testing.T) {
|
||||||
|
client, disconnect := getClient(t)
|
||||||
|
defer disconnect()
|
||||||
|
|
||||||
|
var out bytes.Buffer
|
||||||
|
context := newContext(client, &out, StyleConfig{})
|
||||||
|
|
||||||
|
cmd := &ObsVersionCmd{}
|
||||||
|
err := cmd.Run(context)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatalf("Failed to get version: %v", err)
|
||||||
|
}
|
||||||
|
if !strings.Contains(out.String(), "OBS Client Version:") {
|
||||||
|
t.Fatalf("Expected output to contain 'OBS Client Version:', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
if !strings.Contains(out.String(), "with Websocket Version:") {
|
||||||
|
t.Fatalf("Expected output to contain 'with Websocket Version:', got '%s'", out.String())
|
||||||
|
}
|
||||||
|
}
|
||||||
@ -43,10 +43,16 @@ type VirtualCamToggleCmd struct{} // size = 0x0
|
|||||||
|
|
||||||
// Run executes the command to toggle the virtual camera.
|
// Run executes the command to toggle the virtual camera.
|
||||||
func (c *VirtualCamToggleCmd) Run(ctx *context) error {
|
func (c *VirtualCamToggleCmd) Run(ctx *context) error {
|
||||||
_, err := ctx.Client.Outputs.ToggleVirtualCam()
|
resp, err := ctx.Client.Outputs.ToggleVirtualCam()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return fmt.Errorf("failed to toggle virtual camera: %w", err)
|
return fmt.Errorf("failed to toggle virtual camera: %w", err)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
if resp.OutputActive {
|
||||||
|
fmt.Fprintln(ctx.Out, "Virtual camera is now active.")
|
||||||
|
} else {
|
||||||
|
fmt.Fprintln(ctx.Out, "Virtual camera is now inactive.")
|
||||||
|
}
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
Loading…
x
Reference in New Issue
Block a user