add support for shell completion

replace set-cursor with cursor which can now get/set cursor position

CHANGELOG.md

@@ -5,17 +5,103 @@ All notable changes to this project will be documented in this file.
 The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
 and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
 
-# [0.9.0]
+# [0.17.0] - 2026-01-09
 
 ### Added
 
--   --version/-v option. See [VersionFlag](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#versionflag)
+-   media command group, see [MediaCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#mediacmd)
+
+# [0.16.2] - 2026-01-08
+
+### Added
+
+-   new subcommands added to input, see [InputCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#inputcmd)
+-   settings command group, see [SettingsCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#settingscmd)
+
+# [0.14.1] - 2025-07-14
+
+### Added
+
+-   text command group, see [TextCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#textcmd)
+
+# [0.13.3] - 2025-06-27
+
+### Changed
+
+-   usage is now printed on errors.
+-   help is printed in compact mode. This should make it easier to page through help on the root command.
+
+### Fixed
+
+-   Item ID alignment in sceneitem list table.
+
+# [0.13.0] - 2025-06-23
+
+### Added
+
+-   record split and record chapter commands, see [RecordCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#recordcmd)
+    -   As of OBS 30.2.0, the only file format supporting *record chapter* is Hybrid MP4.
+
+# [0.12.1] - 2025-06-21
+
+### Added
+
+-   Various colouring styles, see [Style](https://github.com/onyx-and-iris/gobs-cli/tree/main?tab=readme-ov-file#style)
+    -   colouring is applied to list tables as well as highlighted information in stdout/stderr output.
+    -   table border styling may be optionally disabled with the --no-border flag.
+
+### Changed
+
+-   if an itemName is passed to a sceneitem command that's in a group, without the --group flag, a friendlier error message is displayed.
+    -   it will suggest using *gobs-cli si ls* to list sources in the scene.
+-   if an invalid --monitor-index is passed to projector open a friendlier error message is displayed.
+    -   it will suggest using *gobs-cli prj ls-m* to list available monitors.
+
+
+# [0.11.0] - 2025-06-20
+
+### Added
+
+-   input list, scene list and sceneitem list now accept --uuid flag.
+-   Active column added to scene list table.
+
+### Changed
+
+-   scene list no longer prints the UUIDs by default, enable it with the --uuid flag.
+
+# [0.10.3] - 2025-06-07
+
+### Added
+
+-   filter list:
+    -   --ffmpeg, --vlc flags
+    -   Muted column to list table
+
+# [0.10.2] - 2025-06-04
+
+### Added
+
+-   screenshot save command, see [ScreenshotCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#screenshotcmd)
+
+### Fixed
+
+-   filter list:
+    -   sourceName arg now defaults to current scene. 
+    -   defaults are printed for any unmodified values.
+-   sceneitem list:
+    -   prints enabled mark instead of true/false
+
+# [0.9.0] - 2025-06-02
+
+### Added
+
+-   --version/-v option. See [Flags](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#flags)
 
 ### Changed
 
 -   version command renamed to obs-version
 
-# [0.8.2]
+# [0.8.2] - 2025-05-29
 
 ### Added
 

README.md

@@ -4,6 +4,17 @@ A command line interface for OBS Websocket v5
 
 For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)
 
+-----
+
+## Table of Contents
+
+- [Installation](#installation)
+- [Configuration](#configuration)
+- [Style](#style)
+- [Commands](#commands)
+- [Shell Completion](#shell-completion)
+- [License](#license)
+
 ## Installation
 
 ```console
@@ -40,6 +51,36 @@ OBS_PASSWORD=<websocket password>
 OBS_TIMEOUT=5
 ```
 
+## Style
+
+Styling is opt-in, by default you will get a colourless output:
+
+![colourless](./img/colourless.png)
+
+You may enable styling with the --style/-s flag:
+
+```console
+gobs-cli --style="red" sceneitem list
+```
+
+Available styles: _red, magenta, purple, blue, cyan, green, yellow, orange, white, grey, navy, black_
+
+![coloured](./img/coloured-border.png)
+
+Optionally you may disable border colouring with the --no-border flag:
+
+![coloured-no-border](./img/coloured-no-border.png)
+
+```console
+gobs-cli --style="red" --no-border sceneitem list
+```
+
+Or with environment variables:
+
+```env
+GOBS_STYLE=red
+GOBS_STYLE_NO_BORDER=true
+```
 
 ## Commands
 
@@ -54,6 +95,10 @@ gobs-cli obs-version
 ### SceneCmd
 
 -   list: List all scenes.
+    -   flags:
+
+        *optional*
+        -   --UUID: Display UUIDs of scenes.
 
 ```console
 gobs-cli scene list
@@ -87,6 +132,10 @@ gobs-cli scene switch --preview LIVE
 ### SceneItemCmd
 
 -   list: List all scene items.
+    -   flags:
+
+        *optional*
+        -   --UUID: Display UUIDs of scene items.
 
     *optional*
     -   args: SceneName
@@ -216,6 +265,20 @@ gobs-cli group status START "test_group"
 
 ### InputCmd
 
+-   create: Create input.
+    -   args: Name Kind
+
+```console
+gobs-cli input create 'stream mix' 'wasapi_input_capture'
+```
+
+-   remove: Remove input.
+    -   args: Name
+
+```console
+gobs-cli input remove 'stream mix'
+```
+
 -   list: List all inputs.
     -   flags:
 
@@ -223,6 +286,9 @@ gobs-cli group status START "test_group"
         -   --input: List all inputs.
         -   --output: List all outputs.
         -   --colour: List all colour sources.
+        -   --ffmpeg: List all ffmpeg sources.
+        -   --vlc: List all VLC sources.
+        -   --uuid: Display UUIDs of inputs.
 
 ```console
 gobs-cli input list
@@ -230,6 +296,12 @@ gobs-cli input list
 gobs-cli input list --input --colour
 ```
 
+-   list-kinds: List input kinds.
+
+```console
+gobs-cli input list-kinds
+```
+
 -   mute: Mute input.
     -   args: InputName
 
@@ -251,6 +323,50 @@ gobs-cli input unmute "Mic/Aux"
 gobs-cli input toggle "Mic/Aux"
 ```
 
+-   volume: Set input volume.
+    -   args: InputName Volume
+
+```console
+gobs-cli input volume -- 'Mic/Aux' -30.6
+```
+
+-   show: Show input details.
+    -   args: Name
+    -   flags:
+
+        *optional*
+        -   --verbose: List all available input devices.
+
+-   update: Update input settings.
+    -   args: InputName DeviceName
+
+```console
+gobs-cli input update 'Mic/Aux' 'Voicemeeter Out B1 (VB-Audio Voicemeeter VAIO)'
+```
+
+-   kind-defaults: Get default settings for an input kind.
+    -   args: Kind
+
+```console
+gobs-cli input kind-defaults 'wasapi_input_capture'
+```
+
+### TextCmd
+
+-   current: Display current text for a text input.
+    -   args: InputName
+
+```console
+gobs-cli text current "My Text Input"
+```
+
+-   update: Update the text of a text input.
+    -   args: InputName NewText
+
+```console
+gobs-cli text update "My Text Input" "hi OBS!"
+```
+
 ### RecordCmd
 
 -   start: Start recording.
@@ -302,6 +418,21 @@ gobs-cli record directory "/home/me/obs-vids/"
 gobs-cli record directory "C:/Users/me/Videos"
 ```
 
+-   split: Split recording.
+
+```console
+gobs-cli record split
+```
+
+-   chapter: Create a chapter in the recording.
+
+    *optional*
+    -   arg: ChapterName
+
+```console
+gobs-cli record chapter "Chapter Name"
+```
+
 ### StreamCmd
 
 -   start: Start streaming.
@@ -513,6 +644,10 @@ gobs-cli hotkey trigger-sequence OBS_KEY_F1 --shift --ctrl
 
 -   list: List all filters.
 
+    *optional*
+    -   args: SourceName
+        -   defaults to current scene
+
 ```console
 gobs-cli filter list
 ```
@@ -561,7 +696,7 @@ gobs-cli projector list-monitors
             -   defaults to 0
 
     *optional*
-    -   args: <source_name>
+    -   args: SourceName
         -   defaults to current scene
 
 ```console
@@ -572,6 +707,139 @@ gobs-cli projector open --monitor-index=1 "test_scene"
 gobs-cli projector open --monitor-index=1 "test_group"
 ```
 
+### ScreenshotCmd
+
+-   save: Take a screenshot and save it to a file.
+    -   flags:
+
+        *optional*
+        -   --width:
+            -   defaults to 1920
+        -   --height:
+            -   defaults to 1080
+        -   --quality:
+            -   defaults to -1
+
+    -   args: SourceName FilePath
+
+```console
+gobs-cli screenshot save --width=2560 --height=1440 "Scene" "C:\Users\me\Videos\screenshot.png"
+```
+
+### SettingsCmd
+
+-   show: Show settings.
+    -   flags:
+
+        *optional*
+        -   --video: Show video settings.
+        -   --record: Show record directory.
+        -   --profile: Show profile parameters.
+
+```console
+gobs-cli settings show --video --record
+```
+
+-   profile: Get/Set profile parameter setting.
+    -   args: Category Name Value
+
+```console
+gobs-cli settings profile SimpleOutput VBitrate
+
+gobs-cli settings profile SimpleOutput VBitrate 6000
+```
+
+-   stream-service: Get/Set stream service setting.
+    -   flags:
+        -   --key: Stream key.
+        -   --server: Stream server URL.
+
+    *optional*
+    -   args: Type
+
+```console
+gobs-cli settings stream-service
+
+gobs-cli settings stream-service --key='live_xyzxyzxyzxyz' rtmp_common
+```
+
+-   video: Get/Set video setting.
+    -   flags:
+
+        *optional*
+        -   --base-width: Base (canvas) width.
+        -   --base-height: Base (canvas) height.
+        -   --output-width: Output (scaled) width.
+        -   --output-height: Output (scaled) height.
+        -   --fps-num: Frames per second numerator.
+        -   --fps-den: Frames per second denominator.
+
+```console
+gobs-cli settings video
+
+gobs-cli settings video --base-width=1920 --base-height=1080
+```
+
+### MediaCmd
+
+-   cursor: Get/set the cursor position of a media input.
+    -   args: InputName
+
+        *optional*
+        -   TimeString
+
+```console
+gobs-cli media cursor "Media"
+
+gobs-cli media cursor "Media" "00:08:30"
+```
+
+-   play: Plays a media input.
+
+```console
+gobs-cli media play "Media"
+```
+
+-   pause: Pauses a media input.
+
+```console
+gobs-cli media pause "Media"
+```
+
+-   stop: Stops a media input.
+
+```console
+gobs-cli media stop "Media"
+```
+
+-   restart: Restarts a media input.
+
+```console
+gobs-cli media restart "Media"
+```
+
+
+## Shell Completion
+
+-   completion:
+
+    *optional*
+    -   args: Shell
+
+```console
+gobs-cli completion
+
+gobs-cli completion bash
+```
+
+Currently supported shells: *bash* *zsh* *fish*. If no shell is passed completion will attempt to detect the current user shell.
+
+
+## License
+
+`gobs-cli` is distributed under the terms of the [MIT](https://spdx.org/licenses/MIT.html) license.
+
 
 [userconfigdir]: https://pkg.go.dev/os#UserConfigDir
-[obs-keyids]: https://github.com/obsproject/obs-studio/blob/master/libobs/obs-hotkeys.h
+[obs-keyids]: https://github.com/obsproject/obs-studio/blob/master/libobs/obs-hotkeys.h
+[no-colour]: https://no-color.org/

Taskfile.yaml

@@ -7,6 +7,8 @@ vars:
   PROGRAM: gobs-cli
   SHELL: '{{if eq .OS "Windows_NT"}}powershell{{end}}'
   BIN_DIR: bin
+  VERSION:
+    sh: 'git describe --tags $(git rev-list --tags --max-count=1)'
 
 tasks:
   default:
@@ -20,6 +22,7 @@ tasks:
     cmds:
       - task: build-windows
       - task: build-linux
+      - task: build-macos
 
   vet:
     desc: Vet the code
@@ -35,13 +38,19 @@ tasks:
   build-windows:
     desc: Build the gobs-cli project for Windows
     cmds:
-      - GOOS=windows GOARCH=amd64 go build -ldflags "-X 'main.version=debug'" -o {{.BIN_DIR}}/{{.PROGRAM}}_windows_amd64.exe
+      - GOOS=windows GOARCH=amd64 go build -ldflags "-X 'main.version={{.VERSION}}'" -o {{.BIN_DIR}}/{{.PROGRAM}}_windows_amd64.exe
     internal: true
 
   build-linux:
     desc: Build the gobs-cli project for Linux
     cmds:
-      - GOOS=linux GOARCH=amd64 go build -ldflags "-X 'main.version=debug'" -o {{.BIN_DIR}}/{{.PROGRAM}}_linux_amd64
+      - GOOS=linux GOARCH=amd64 go build -ldflags "-X 'main.version={{.VERSION}}'" -o {{.BIN_DIR}}/{{.PROGRAM}}_linux_amd64
+    internal: true
+
+  build-macos:
+    desc: Build the gobs-cli project for macOS
+    cmds:
+      - GOOS=darwin GOARCH=amd64 go build -ldflags "-X 'main.version={{.VERSION}}'" -o {{.BIN_DIR}}/{{.PROGRAM}}_darwin_amd64
     internal: true
 
   test:

filter.go

@@ -2,11 +2,13 @@ package main
 
 import (
 	"fmt"
+	"maps"
 	"sort"
 	"strings"
 
 	"github.com/andreykaipov/goobs/api/requests/filters"
-	"github.com/aquasecurity/table"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
 )
 
 // FilterCmd provides commands to manage filters in OBS Studio.
@@ -20,45 +22,85 @@ type FilterCmd struct {
 
 // FilterListCmd provides a command to list all filters in a scene.
 type FilterListCmd struct {
-	SourceName string `arg:"" help:"Name of the source to list filters from."`
+	SourceName string `arg:"" help:"Name of the source to list filters from." default:""`
 }
 
 // Run executes the command to list all filters in a scene.
+// nolint: misspell
 func (cmd *FilterListCmd) Run(ctx *context) error {
-	filters, err := ctx.Client.Filters.GetSourceFilterList(
+	if cmd.SourceName == "" {
+		currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
+		if err != nil {
+			return fmt.Errorf("failed to get current program scene: %w", err)
+		}
+		cmd.SourceName = currentScene.SceneName
+	}
+
+	sourceFilters, err := ctx.Client.Filters.GetSourceFilterList(
 		filters.NewGetSourceFilterListParams().WithSourceName(cmd.SourceName),
 	)
 	if err != nil {
 		return err
 	}
 
-	if len(filters.Filters) == 0 {
+	if len(sourceFilters.Filters) == 0 {
-		fmt.Fprintf(ctx.Out, "No filters found for source %s.\n", cmd.SourceName)
+		fmt.Fprintf(ctx.Out, "No filters found for source %s.\n", ctx.Style.Highlight(cmd.SourceName))
 		return nil
 	}
 
-	t := table.New(ctx.Out)
+	t := table.New().Border(lipgloss.RoundedBorder()).
-	t.SetPadding(3)
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
-	t.SetAlignment(table.AlignLeft, table.AlignLeft, table.AlignCenter, table.AlignLeft)
+		Headers("Filter Name", "Kind", "Enabled", "Settings").
-	t.SetHeaders("Filter Name", "Kind", "Enabled", "Settings")
+		StyleFunc(func(row, col int) lipgloss.Style {
+			style := lipgloss.NewStyle().Padding(0, 3)
+			switch col {
+			case 0:
+				style = style.Align(lipgloss.Left)
+			case 1:
+				style = style.Align(lipgloss.Left)
+			case 2:
+				style = style.Align(lipgloss.Center)
+			case 3:
+				style = style.Align(lipgloss.Left)
+			}
+			switch {
+			case row == table.HeaderRow:
+				style = style.Bold(true).Align(lipgloss.Center)
+			case row%2 == 0:
+				style = style.Foreground(ctx.Style.evenRows)
+			default:
+				style = style.Foreground(ctx.Style.oddRows)
+			}
+			return style
+		})
+
+	for _, filter := range sourceFilters.Filters {
+		defaultSettings, err := ctx.Client.Filters.GetSourceFilterDefaultSettings(
+			filters.NewGetSourceFilterDefaultSettingsParams().
+				WithFilterKind(filter.FilterKind),
+		)
+		if err != nil {
+			return fmt.Errorf("failed to get default settings for filter %s: %w",
+				ctx.Style.Error(filter.FilterName), err)
+		}
+		maps.Insert(defaultSettings.DefaultFilterSettings, maps.All(filter.FilterSettings))
 
-	for _, filter := range filters.Filters {
 		var lines []string
-		for k, v := range filter.FilterSettings {
+		for k, v := range defaultSettings.DefaultFilterSettings {
-			lines = append(lines, fmt.Sprintf("%s %v", k, v))
+			lines = append(lines, fmt.Sprintf("%s: %v", snakeCaseToTitleCase(k), v))
 		}
 		sort.Slice(lines, func(i, j int) bool {
 			return strings.ToLower(lines[i]) < strings.ToLower(lines[j])
 		})
 
-		t.AddRow(
+		t.Row(
 			filter.FilterName,
 			snakeCaseToTitleCase(filter.FilterKind),
 			getEnabledMark(filter.FilterEnabled),
 			strings.Join(lines, "\n"),
 		)
 	}
-	t.Render()
+	fmt.Fprintln(ctx.Out, t.Render())
 	return nil
 }
 
@@ -78,10 +120,10 @@ func (cmd *FilterEnableCmd) Run(ctx *context) error {
 	)
 	if err != nil {
 		return fmt.Errorf("failed to enable filter %s on source %s: %w",
-			cmd.FilterName, cmd.SourceName, err)
+			ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
 	}
 	fmt.Fprintf(ctx.Out, "Filter %s enabled on source %s.\n",
-		cmd.FilterName, cmd.SourceName)
+		ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
 	return nil
 }
 
@@ -101,10 +143,10 @@ func (cmd *FilterDisableCmd) Run(ctx *context) error {
 	)
 	if err != nil {
 		return fmt.Errorf("failed to disable filter %s on source %s: %w",
-			cmd.FilterName, cmd.SourceName, err)
+			ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
 	}
 	fmt.Fprintf(ctx.Out, "Filter %s disabled on source %s.\n",
-		cmd.FilterName, cmd.SourceName)
+		ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
 	return nil
 }
 
@@ -123,7 +165,7 @@ func (cmd *FilterToggleCmd) Run(ctx *context) error {
 	)
 	if err != nil {
 		return fmt.Errorf("failed to get filter %s on source %s: %w",
-			cmd.FilterName, cmd.SourceName, err)
+			ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
 	}
 
 	newStatus := !filter.FilterEnabled
@@ -135,15 +177,15 @@ func (cmd *FilterToggleCmd) Run(ctx *context) error {
 	)
 	if err != nil {
 		return fmt.Errorf("failed to toggle filter %s on source %s: %w",
-			cmd.FilterName, cmd.SourceName, err)
+			ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
 	}
 
 	if newStatus {
 		fmt.Fprintf(ctx.Out, "Filter %s on source %s is now enabled.\n",
-			cmd.FilterName, cmd.SourceName)
+			ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
 	} else {
 		fmt.Fprintf(ctx.Out, "Filter %s on source %s is now disabled.\n",
-			cmd.FilterName, cmd.SourceName)
+			ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
 	}
 	return nil
 }
@@ -163,14 +205,14 @@ func (cmd *FilterStatusCmd) Run(ctx *context) error {
 	)
 	if err != nil {
 		return fmt.Errorf("failed to get status of filter %s on source %s: %w",
-			cmd.FilterName, cmd.SourceName, err)
+			ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
 	}
 	if filter.FilterEnabled {
 		fmt.Fprintf(ctx.Out, "Filter %s on source %s is enabled.\n",
-			cmd.FilterName, cmd.SourceName)
+			ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
 	} else {
 		fmt.Fprintf(ctx.Out, "Filter %s on source %s is disabled.\n",
-			cmd.FilterName, cmd.SourceName)
+			ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
 	}
 	return nil
 }

filter_test.go

@@ -11,10 +11,7 @@ func TestFilterList(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmd := &FilterListCmd{
 		SourceName: "Mic/Aux",
@@ -33,13 +30,10 @@ func TestFilterListScene(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmd := &FilterListCmd{
-		SourceName: "gobs-test",
+		SourceName: "gobs-test-scene",
 	}
 	err := cmd.Run(context)
 	if err != nil {
@@ -55,10 +49,7 @@ func TestFilterListEmpty(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmd := &FilterListCmd{
 		SourceName: "NonExistentSource",

go.mod

@@ -1,27 +1,40 @@
 module github.com/onyx-and-iris/gobs-cli
 
-go 1.24.0
+go 1.25
 
 require (
-	github.com/alecthomas/kong v1.10.0
+	github.com/alecthomas/kong v1.13.0
 	github.com/alecthomas/mango-kong v0.1.0
 	github.com/andreykaipov/goobs v1.5.6
-	github.com/aquasecurity/table v1.10.0
+	github.com/charmbracelet/lipgloss v1.1.0
+	github.com/jotaen/kong-completion v0.0.9
 	github.com/titusjaka/kong-dotenv-go v0.1.0
 )
 
 require (
+	github.com/aymanbagabas/go-osc52/v2 v2.0.1 // indirect
 	github.com/buger/jsonparser v1.1.1 // indirect
+	github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc // indirect
+	github.com/charmbracelet/x/ansi v0.8.0 // indirect
+	github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd // indirect
+	github.com/charmbracelet/x/term v0.2.1 // indirect
 	github.com/gorilla/websocket v1.5.3 // indirect
+	github.com/hashicorp/errwrap v1.1.0 // indirect
+	github.com/hashicorp/go-multierror v1.1.1 // indirect
 	github.com/hashicorp/logutils v1.0.0 // indirect
 	github.com/joho/godotenv v1.5.1 // indirect
-	github.com/mattn/go-runewidth v0.0.13 // indirect
+	github.com/lucasb-eyer/go-colorful v1.2.0 // indirect
+	github.com/mattn/go-isatty v0.0.20 // indirect
+	github.com/mattn/go-runewidth v0.0.16 // indirect
 	github.com/mitchellh/mapstructure v1.5.0 // indirect
 	github.com/mmcloughlin/profile v0.1.1 // indirect
 	github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab // indirect
 	github.com/muesli/roff v0.1.0 // indirect
+	github.com/muesli/termenv v0.16.0 // indirect
 	github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d // indirect
-	github.com/rivo/uniseg v0.2.0 // indirect
+	github.com/posener/complete v1.2.3 // indirect
-	golang.org/x/sys v0.1.0 // indirect
+	github.com/rivo/uniseg v0.4.7 // indirect
-	golang.org/x/term v0.0.0-20220526004731-065cf7ba2467 // indirect
+	github.com/riywo/loginshell v0.0.0-20200815045211-7d26008be1ab // indirect
+	github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e // indirect
+	golang.org/x/sys v0.30.0 // indirect
 )

go.sum

@@ -1,29 +1,56 @@
 github.com/alecthomas/assert/v2 v2.11.0 h1:2Q9r3ki8+JYXvGsDyBXwH3LcJ+WK5D0gc5E8vS6K3D0=
 github.com/alecthomas/assert/v2 v2.11.0/go.mod h1:Bze95FyfUr7x34QZrjL+XP+0qgp/zg8yS+TtBj1WA3k=
-github.com/alecthomas/kong v1.10.0 h1:8K4rGDpT7Iu+jEXCIJUeKqvpwZHbsFRoebLbnzlmrpw=
+github.com/alecthomas/kong v1.13.0 h1:5e/7XC3ugvhP1DQBmTS+WuHtCbcv44hsohMgcvVxSrA=
-github.com/alecthomas/kong v1.10.0/go.mod h1:p2vqieVMeTAnaC83txKtXe8FLke2X07aruPWXyMPQrU=
+github.com/alecthomas/kong v1.13.0/go.mod h1:wrlbXem1CWqUV5Vbmss5ISYhsVPkBb1Yo7YKJghju2I=
 github.com/alecthomas/mango-kong v0.1.0 h1:iFVfP1k1K4qpml3JUQmD5I8MCQYfIvsD9mRdrw7jJC4=
 github.com/alecthomas/mango-kong v0.1.0/go.mod h1:t+TYVdsONUolf/BwVcm+15eqcdAj15h4Qe9MMFAwwT4=
-github.com/alecthomas/repr v0.4.0 h1:GhI2A8MACjfegCPVq9f1FLvIBS+DrQ2KQBFZP1iFzXc=
+github.com/alecthomas/repr v0.5.2 h1:SU73FTI9D1P5UNtvseffFSGmdNci/O6RsqzeXJtP0Qs=
-github.com/alecthomas/repr v0.4.0/go.mod h1:Fr0507jx4eOXV7AlPV6AVZLYrLIuIeSOWtW57eE/O/4=
+github.com/alecthomas/repr v0.5.2/go.mod h1:Fr0507jx4eOXV7AlPV6AVZLYrLIuIeSOWtW57eE/O/4=
 github.com/andreykaipov/goobs v1.5.6 h1:eIkEqYN99+2VJvmlY/56Ah60nkRKS6efMQvpM3oUgPQ=
 github.com/andreykaipov/goobs v1.5.6/go.mod h1:iSZP93FJ4d9X/U1x4DD4IyILLtig+vViqZWBGjLywcY=
-github.com/aquasecurity/table v1.10.0 h1:gPWV28qp9XSlvXdT3ku8yKQoZE6II0vsmegKpW+dB08=
+github.com/aymanbagabas/go-osc52/v2 v2.0.1 h1:HwpRHbFMcZLEVr42D4p7XBqjyuxQH5SMiErDT4WkJ2k=
-github.com/aquasecurity/table v1.10.0/go.mod h1:eqOmvjjB7AhXFgFqpJUEE/ietg7RrMSJZXyTN8E/wZw=
+github.com/aymanbagabas/go-osc52/v2 v2.0.1/go.mod h1:uYgXzlJ7ZpABp8OJ+exZzJJhRNQ2ASbcXHWsFqH8hp8=
+github.com/aymanbagabas/go-udiff v0.2.0 h1:TK0fH4MteXUDspT88n8CKzvK0X9O2xu9yQjWpi6yML8=
+github.com/aymanbagabas/go-udiff v0.2.0/go.mod h1:RE4Ex0qsGkTAJoQdQQCA0uG+nAzJO/pI/QwceO5fgrA=
 github.com/buger/jsonparser v1.1.1 h1:2PnMjfWD7wBILjqQbt530v576A/cAbQvEW9gGIpYMUs=
 github.com/buger/jsonparser v1.1.1/go.mod h1:6RYKKt7H4d4+iWqouImQ9R2FZql3VbhNgx27UK13J/0=
+github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc h1:4pZI35227imm7yK2bGPcfpFEmuY1gc2YSTShr4iJBfs=
+github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc/go.mod h1:X4/0JoqgTIPSFcRA/P6INZzIuyqdFY5rm8tb41s9okk=
+github.com/charmbracelet/lipgloss v1.1.0 h1:vYXsiLHVkK7fp74RkV7b2kq9+zDLoEU4MZoFqR/noCY=
+github.com/charmbracelet/lipgloss v1.1.0/go.mod h1:/6Q8FR2o+kj8rz4Dq0zQc3vYf7X+B0binUUBwA0aL30=
+github.com/charmbracelet/x/ansi v0.8.0 h1:9GTq3xq9caJW8ZrBTe0LIe2fvfLR/bYXKTx2llXn7xE=
+github.com/charmbracelet/x/ansi v0.8.0/go.mod h1:wdYl/ONOLHLIVmQaxbIYEC/cRKOQyjTkowiI4blgS9Q=
+github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd h1:vy0GVL4jeHEwG5YOXDmi86oYw2yuYUGqz6a8sLwg0X8=
+github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd/go.mod h1:xe0nKWGd3eJgtqZRaN9RjMtK7xUYchjzPr7q6kcvCCs=
+github.com/charmbracelet/x/exp/golden v0.0.0-20240806155701-69247e0abc2a h1:G99klV19u0QnhiizODirwVksQB91TJKV/UaTnACcG30=
+github.com/charmbracelet/x/exp/golden v0.0.0-20240806155701-69247e0abc2a/go.mod h1:wDlXFlCrmJ8J+swcL/MnGUuYnqgQdW9rhSD61oNMb6U=
+github.com/charmbracelet/x/term v0.2.1 h1:AQeHeLZ1OqSXhrAWpYUtZyX1T3zVxfpZuEQMIQaGIAQ=
+github.com/charmbracelet/x/term v0.2.1/go.mod h1:oQ4enTYFV7QN4m0i9mzHrViD7TQKvNEEkHUMCmsxdUg=
+github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
 github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
 github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
 github.com/gorilla/websocket v1.5.3 h1:saDtZ6Pbx/0u+bgYQ3q96pZgCzfhKXGPqt7kZ72aNNg=
 github.com/gorilla/websocket v1.5.3/go.mod h1:YR8l580nyteQvAITg2hZ9XVh4b55+EU/adAjf1fMHhE=
+github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4=
+github.com/hashicorp/errwrap v1.1.0 h1:OxrOeh75EUXMY8TBjag2fzXGZ40LB6IKw45YeGUDY2I=
+github.com/hashicorp/errwrap v1.1.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4=
+github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk=
+github.com/hashicorp/go-multierror v1.1.1 h1:H5DkEtf6CXdFp0N0Em5UCwQpXMWke8IA0+lD48awMYo=
+github.com/hashicorp/go-multierror v1.1.1/go.mod h1:iw975J/qwKPdAO1clOe2L8331t/9/fmwbPZ6JB6eMoM=
 github.com/hashicorp/logutils v1.0.0 h1:dLEQVugN8vlakKOUE3ihGLTZJRB4j+M2cdTm/ORI65Y=
 github.com/hashicorp/logutils v1.0.0/go.mod h1:QIAnNjmIWmVIIkWDTG1z5v++HQmx9WQRO+LraFDTW64=
 github.com/hexops/gotextdiff v1.0.3 h1:gitA9+qJrrTCsiCl7+kh75nPqQt1cx4ZkudSTLoUqJM=
 github.com/hexops/gotextdiff v1.0.3/go.mod h1:pSWU5MAI3yDq+fZBTazCSJysOMbxWL1BSow5/V2vxeg=
 github.com/joho/godotenv v1.5.1 h1:7eLL/+HRGLY0ldzfGMeQkb7vMd0as4CfYvUVzLqw0N0=
 github.com/joho/godotenv v1.5.1/go.mod h1:f4LDr5Voq0i2e/R5DDNOoa2zzDfwtkZa6DnEwAbqwq4=
-github.com/mattn/go-runewidth v0.0.13 h1:lTGmDsbAYt5DmK6OnoV7EuIF1wEIFAcxld6ypU4OSgU=
+github.com/jotaen/kong-completion v0.0.9 h1:yXKSRvjWuuZlTGpPMpvo96sFjh5PEh/skrcK4DjJnfg=
-github.com/mattn/go-runewidth v0.0.13/go.mod h1:Jdepj2loyihRzMpdS35Xk/zdY8IAYHsh153qUoGf23w=
+github.com/jotaen/kong-completion v0.0.9/go.mod h1:dyIG20e3qq128SUBtF8jzI7YtkfzjWMlgbqkAJd6xHQ=
+github.com/lucasb-eyer/go-colorful v1.2.0 h1:1nnpGOrhyZZuNyfu1QjKiUICQ74+3FNCN69Aj6K7nkY=
+github.com/lucasb-eyer/go-colorful v1.2.0/go.mod h1:R4dSotOR9KMtayYi1e77YzuveK+i7ruzyGqttikkLy0=
+github.com/mattn/go-isatty v0.0.20 h1:xfD0iDuEKnDkl03q4limB+vH+GxLEtL/jb4xVJSWWEY=
+github.com/mattn/go-isatty v0.0.20/go.mod h1:W+V8PltTTMOvKvAeJH7IuucS94S2C6jfK/D7dTCTo3Y=
+github.com/mattn/go-runewidth v0.0.16 h1:E5ScNMtiwvlvB5paMFdw9p4kSQzbXFikJ5SQO6TULQc=
+github.com/mattn/go-runewidth v0.0.16/go.mod h1:Jdepj2loyihRzMpdS35Xk/zdY8IAYHsh153qUoGf23w=
 github.com/mitchellh/mapstructure v1.5.0 h1:jeMsZIYE/09sWLaz43PL7Gy6RuMjD2eJVyuac5Z2hdY=
 github.com/mitchellh/mapstructure v1.5.0/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo=
 github.com/mmcloughlin/profile v0.1.1 h1:jhDmAqPyebOsVDOCICJoINoLb/AnLBaUw58nFzxWS2w=
@@ -32,19 +59,33 @@ github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab h1:m7QFONkzLK0fVXCj
 github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab/go.mod h1:5XFpbC8jY5UUv89YQciiXNlbi+iJgt29VDC5xbzrLL4=
 github.com/muesli/roff v0.1.0 h1:YD0lalCotmYuF5HhZliKWlIx7IEhiXeSfq7hNjFqGF8=
 github.com/muesli/roff v0.1.0/go.mod h1:pjAHQM9hdUUwm/krAfrLGgJkXJ+YuhtsfZ42kieB2Ig=
+github.com/muesli/termenv v0.16.0 h1:S5AlUN9dENB57rsbnkPyfdGuWIlkmzJjbFf0Tf5FWUc=
+github.com/muesli/termenv v0.16.0/go.mod h1:ZRfOIKPFDYQoDFF4Olj7/QJbW60Ol/kL1pU3VfY/Cnk=
 github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d h1:VhgPp6v9qf9Agr/56bj7Y/xa04UccTW04VP0Qed4vnQ=
 github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d/go.mod h1:YUTz3bUH2ZwIWBy3CJBeOBEugqcmXREj14T+iG/4k4U=
 github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
 github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
-github.com/rivo/uniseg v0.2.0 h1:S1pD9weZBuJdFmowNwbpi7BJ8TNftyUImj/0WQi72jY=
+github.com/posener/complete v1.2.3 h1:NP0eAhjcjImqslEwo/1hq7gpajME0fTLTezBKDqfXqo=
+github.com/posener/complete v1.2.3/go.mod h1:WZIdtGGp+qx0sLrYKtIRAruyNpv6hFCicSgv7Sy7s/s=
 github.com/rivo/uniseg v0.2.0/go.mod h1:J6wj4VEh+S6ZtnVlnTBMWIodfgj8LQOQFoIToxlJtxc=
-github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA=
+github.com/rivo/uniseg v0.4.7 h1:WUdvkW8uEhrYfLC4ZzdpI2ztxP1I582+49Oc5Mq64VQ=
-github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
+github.com/rivo/uniseg v0.4.7/go.mod h1:FN3SvrM+Zdj16jyLfmOkMNblXMcoc8DfTHruCPUcx88=
+github.com/riywo/loginshell v0.0.0-20200815045211-7d26008be1ab h1:ZjX6I48eZSFetPb41dHudEyVr5v953N15TsNZXlkcWY=
+github.com/riywo/loginshell v0.0.0-20200815045211-7d26008be1ab/go.mod h1:/PfPXh0EntGc3QAAyUaviy4S9tzy4Zp0e2ilq4voC6E=
+github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
+github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4=
+github.com/stretchr/testify v1.11.1 h1:7s2iGBzp5EwR7/aIZr8ao5+dra3wiQyKjjFuvgVKu7U=
+github.com/stretchr/testify v1.11.1/go.mod h1:wZwfW3scLgRK+23gO65QZefKpKQRnfz6sD981Nm4B6U=
 github.com/titusjaka/kong-dotenv-go v0.1.0 h1:TmUjP/sXoNiKLr6oR7n9xrB5XyXi/Ssuebzfz5nxZj4=
 github.com/titusjaka/kong-dotenv-go v0.1.0/go.mod h1:pBgLjcu82oqUgb7+bngK9+Ch7jg49E0YADP8Wnj2MXU=
-golang.org/x/sys v0.1.0 h1:kunALQeHf1/185U1i0GOB/fy1IPRDDpuoOOqRReG57U=
+github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e h1:JVG44RsyaB9T2KIHavMF/ppJZNG9ZpyihvCd0w101no=
-golang.org/x/sys v0.1.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e/go.mod h1:RbqR21r5mrJuqunuUZ/Dhy/avygyECGrLceyNeo4LiM=
-golang.org/x/term v0.0.0-20220526004731-065cf7ba2467 h1:CBpWXWQpIRjzmkkA+M7q9Fqnwd2mZr3AFqexg8YTfoM=
+golang.org/x/exp v0.0.0-20220909182711-5c715a9e8561 h1:MDc5xs78ZrZr3HMQugiXOAkSZtfTpbJLDr/lwfgO53E=
-golang.org/x/term v0.0.0-20220526004731-065cf7ba2467/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8=
+golang.org/x/exp v0.0.0-20220909182711-5c715a9e8561/go.mod h1:cyybsKvd6eL0RnXn6p/Grxp8F5bW7iYuBgsNCOHpMYE=
+golang.org/x/sys v0.6.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.30.0 h1:QjkSwP/36a20jFYWkSue1YwXzLmsV5Gfq7Eiy72C1uc=
+golang.org/x/sys v0.30.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA=
+gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
+gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
 gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
 gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=

group.go

@@ -4,7 +4,8 @@ import (
 	"fmt"
 
 	"github.com/andreykaipov/goobs/api/requests/sceneitems"
-	"github.com/aquasecurity/table"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
 )
 
 // GroupCmd provides commands to manage groups in OBS Studio.
@@ -22,6 +23,7 @@ type GroupListCmd struct {
 }
 
 // Run executes the command to list all groups in a scene.
+// nolint: misspell
 func (cmd *GroupListCmd) Run(ctx *context) error {
 	if cmd.SceneName == "" {
 		currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
@@ -37,17 +39,44 @@ func (cmd *GroupListCmd) Run(ctx *context) error {
 		return fmt.Errorf("failed to get scene item list: %w", err)
 	}
 
-	t := table.New(ctx.Out)
+	t := table.New().Border(lipgloss.RoundedBorder()).
-	t.SetPadding(3)
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
-	t.SetAlignment(table.AlignCenter, table.AlignLeft, table.AlignCenter)
+		Headers("ID", "Group Name", "Enabled").
-	t.SetHeaders("ID", "Group Name", "Enabled")
+		StyleFunc(func(row, col int) lipgloss.Style {
+			style := lipgloss.NewStyle().Padding(0, 3)
+			switch col {
+			case 0:
+				style = style.Align(lipgloss.Center)
+			case 1:
+				style = style.Align(lipgloss.Left)
+			case 2:
+				style = style.Align(lipgloss.Center)
+			}
+			switch {
+			case row == table.HeaderRow:
+				style = style.Bold(true).Align(lipgloss.Center)
+			case row%2 == 0:
+				style = style.Foreground(ctx.Style.evenRows)
+			default:
+				style = style.Foreground(ctx.Style.oddRows)
+			}
+			return style
+		})
 
+	var found bool
 	for _, item := range resp.SceneItems {
 		if item.IsGroup {
-			t.AddRow(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, getEnabledMark(item.SceneItemEnabled))
+			t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, getEnabledMark(item.SceneItemEnabled))
+			found = true
 		}
 	}
-	t.Render()
+
+	if !found {
+		fmt.Fprintf(ctx.Out, "No groups found in scene %s.\n", ctx.Style.Highlight(cmd.SceneName))
+		return nil
+	}
+
+	fmt.Fprintln(ctx.Out, t.Render())
 	return nil
 }
 
@@ -75,13 +104,17 @@ func (cmd *GroupShowCmd) Run(ctx *context) error {
 			if err != nil {
 				return fmt.Errorf("failed to set scene item enabled: %w", err)
 			}
-			fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", cmd.GroupName)
+			fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", ctx.Style.Highlight(cmd.GroupName))
 			found = true
 			break
 		}
 	}
 	if !found {
-		return fmt.Errorf("group '%s' not found", cmd.GroupName)
+		return fmt.Errorf(
+			"group %s not found in scene %s",
+			ctx.Style.Error(cmd.GroupName),
+			ctx.Style.Error(cmd.SceneName),
+		)
 	}
 	return nil
 }
@@ -110,13 +143,17 @@ func (cmd *GroupHideCmd) Run(ctx *context) error {
 			if err != nil {
 				return fmt.Errorf("failed to set scene item enabled: %w", err)
 			}
-			fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", cmd.GroupName)
+			fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", ctx.Style.Highlight(cmd.GroupName))
 			found = true
 			break
 		}
 	}
 	if !found {
-		return fmt.Errorf("group '%s' not found", cmd.GroupName)
+		return fmt.Errorf(
+			"group %s not found in scene %s",
+			ctx.Style.Error(cmd.GroupName),
+			ctx.Style.Error(cmd.SceneName),
+		)
 	}
 	return nil
 }
@@ -147,16 +184,20 @@ func (cmd *GroupToggleCmd) Run(ctx *context) error {
 				return fmt.Errorf("failed to set scene item enabled: %w", err)
 			}
 			if newState {
-				fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", cmd.GroupName)
+				fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", ctx.Style.Highlight(cmd.GroupName))
 			} else {
-				fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", cmd.GroupName)
+				fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", ctx.Style.Highlight(cmd.GroupName))
 			}
 			found = true
 			break
 		}
 	}
 	if !found {
-		return fmt.Errorf("group '%s' not found", cmd.GroupName)
+		return fmt.Errorf(
+			"group %s not found in scene %s",
+			ctx.Style.Error(cmd.GroupName),
+			ctx.Style.Error(cmd.SceneName),
+		)
 	}
 
 	return nil
@@ -178,12 +219,12 @@ func (cmd *GroupStatusCmd) Run(ctx *context) error {
 	for _, item := range resp.SceneItems {
 		if item.IsGroup && item.SourceName == cmd.GroupName {
 			if item.SceneItemEnabled {
-				fmt.Fprintf(ctx.Out, "Group %s is shown.\n", cmd.GroupName)
+				fmt.Fprintf(ctx.Out, "Group %s is shown.\n", ctx.Style.Highlight(cmd.GroupName))
 			} else {
-				fmt.Fprintf(ctx.Out, "Group %s is hidden.\n", cmd.GroupName)
+				fmt.Fprintf(ctx.Out, "Group %s is hidden.\n", ctx.Style.Highlight(cmd.GroupName))
 			}
 			return nil
 		}
 	}
-	return fmt.Errorf("group '%s' not found", cmd.GroupName)
+	return fmt.Errorf("group %s not found in scene %s", ctx.Style.Error(cmd.GroupName), ctx.Style.Error(cmd.SceneName))
 }

group_test.go

@@ -2,19 +2,25 @@ package main
 
 import (
 	"bytes"
+	"os"
 	"strings"
 	"testing"
 )
 
+func skipIfSkipGroupTests(t *testing.T) {
+	if os.Getenv("GOBS_TEST_SKIP_GROUP_TESTS") != "" {
+		t.Skip("Skipping group tests due to GOBS_TEST_SKIP_GROUP_TESTS environment variable")
+	}
+}
+
 func TestGroupList(t *testing.T) {
+	skipIfSkipGroupTests(t)
+
 	client, disconnect := getClient(t)
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmd := &GroupListCmd{
 		SceneName: "Scene",
@@ -29,14 +35,13 @@ func TestGroupList(t *testing.T) {
 }
 
 func TestGroupShow(t *testing.T) {
+	skipIfSkipGroupTests(t)
+
 	client, disconnect := getClient(t)
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmd := &GroupShowCmd{
 		SceneName: "Scene",
@@ -52,14 +57,13 @@ func TestGroupShow(t *testing.T) {
 }
 
 func TestGroupToggle(t *testing.T) {
+	skipIfSkipGroupTests(t)
+
 	client, disconnect := getClient(t)
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmdStatus := &GroupStatusCmd{
 		SceneName: "Scene",
@@ -96,14 +100,13 @@ func TestGroupToggle(t *testing.T) {
 }
 
 func TestGroupStatus(t *testing.T) {
+	skipIfSkipGroupTests(t)
+
 	client, disconnect := getClient(t)
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmdShow := &GroupShowCmd{
 		SceneName: "Scene",

hotkey.go

@@ -1,9 +1,12 @@
 package main
 
 import (
+	"fmt"
+
 	"github.com/andreykaipov/goobs/api/requests/general"
 	"github.com/andreykaipov/goobs/api/typedefs"
-	"github.com/aquasecurity/table"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
 )
 
 // HotkeyCmd provides commands to manage hotkeys in OBS Studio.
@@ -23,15 +26,26 @@ func (cmd *HotkeyListCmd) Run(ctx *context) error {
 		return err
 	}
 
-	t := table.New(ctx.Out)
+	t := table.New().Border(lipgloss.RoundedBorder()).
-	t.SetPadding(3)
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
-	t.SetAlignment(table.AlignLeft)
+		Headers("Hotkey Name").
-	t.SetHeaders("Hotkey Name")
+		StyleFunc(func(row, _ int) lipgloss.Style {
+			style := lipgloss.NewStyle().Padding(0, 3)
+			switch {
+			case row == table.HeaderRow:
+				style = style.Bold(true).Align(lipgloss.Center) // nolint: misspell
+			case row%2 == 0:
+				style = style.Foreground(ctx.Style.evenRows)
+			default:
+				style = style.Foreground(ctx.Style.oddRows)
+			}
+			return style
+		})
 
 	for _, hotkey := range resp.Hotkeys {
-		t.AddRow(hotkey)
+		t.Row(hotkey)
 	}
-	t.Render()
+	fmt.Fprintln(ctx.Out, t.Render())
 	return nil
 }
 

input.go

@@ -1,19 +1,76 @@
+// nolint: misspell
 package main
 
 import (
 	"fmt"
+	"maps"
+	"sort"
 	"strings"
 
 	"github.com/andreykaipov/goobs/api/requests/inputs"
-	"github.com/aquasecurity/table"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
 )
 
 // InputCmd provides commands to manage inputs in OBS Studio.
 type InputCmd struct {
-	List   InputListCmd   `cmd:"" help:"List all inputs." aliases:"ls"`
+	Create       InputCreateCmd       `cmd:"" help:"Create input."                           aliases:"c"`
-	Mute   InputMuteCmd   `cmd:"" help:"Mute input."      aliases:"m"`
+	Remove       InputRemoveCmd       `cmd:"" help:"Remove input."                           aliases:"d"`
-	Unmute InputUnmuteCmd `cmd:"" help:"Unmute input."    aliases:"um"`
+	List         InputListCmd         `cmd:"" help:"List all inputs."                        aliases:"ls"`
-	Toggle InputToggleCmd `cmd:"" help:"Toggle input."    aliases:"tg"`
+	ListKinds    InputListKindsCmd    `cmd:"" help:"List input kinds."                       aliases:"k"`
+	Mute         InputMuteCmd         `cmd:"" help:"Mute input."                             aliases:"m"`
+	Unmute       InputUnmuteCmd       `cmd:"" help:"Unmute input."                           aliases:"um"`
+	Toggle       InputToggleCmd       `cmd:"" help:"Toggle input."                           aliases:"tg"`
+	Volume       InputVolumeCmd       `cmd:"" help:"Set input volume."                       aliases:"v"`
+	Show         InputShowCmd         `cmd:"" help:"Show input details."                     aliases:"s"`
+	Update       InputUpdateCmd       `cmd:"" help:"Update input settings."                  aliases:"up"`
+	KindDefaults InputKindDefaultsCmd `cmd:"" help:"Get default settings for an input kind." aliases:"df"`
+}
+
+// InputCreateCmd provides a command to create an input.
+type InputCreateCmd struct {
+	Name string `arg:"" help:"Name for the input."                                          required:""`
+	Kind string `arg:"" help:"Input kind (e.g., coreaudio_input_capture, macos-avcapture)." required:""`
+}
+
+// Run executes the command to create an input.
+func (cmd *InputCreateCmd) Run(ctx *context) error {
+	currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
+	if err != nil {
+		return err
+	}
+
+	_, err = ctx.Client.Inputs.CreateInput(
+		inputs.NewCreateInputParams().
+			WithInputKind(cmd.Kind).
+			WithInputName(cmd.Name).
+			WithSceneName(currentScene.CurrentProgramSceneName),
+	)
+	if err != nil {
+		return err
+	}
+
+	fmt.Fprintf(ctx.Out, "Created input: %s (%s) in scene %s\n",
+		ctx.Style.Highlight(cmd.Name), cmd.Kind, ctx.Style.Highlight(currentScene.CurrentProgramSceneName))
+	return nil
+}
+
+// InputRemoveCmd provides a command to remove an input.
+type InputRemoveCmd struct {
+	Name string `arg:"" help:"Name of the input to remove." required:""`
+}
+
+// Run executes the command to remove an input.
+func (cmd *InputRemoveCmd) Run(ctx *context) error {
+	_, err := ctx.Client.Inputs.RemoveInput(
+		inputs.NewRemoveInputParams().WithInputName(cmd.Name),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to delete input: %w", err)
+	}
+
+	fmt.Fprintf(ctx.Out, "Deleted %s\n", ctx.Style.Highlight(cmd.Name))
+	return nil
 }
 
 // InputListCmd provides a command to list all inputs.
@@ -21,6 +78,9 @@ type InputListCmd struct {
 	Input  bool `flag:"" help:"List all inputs."         aliases:"i"`
 	Output bool `flag:"" help:"List all outputs."        aliases:"o"`
 	Colour bool `flag:"" help:"List all colour sources." aliases:"c"`
+	Ffmpeg bool `flag:"" help:"List all ffmpeg sources." aliases:"f"`
+	Vlc    bool `flag:"" help:"List all VLC sources."    aliases:"v"`
+	UUID   bool `flag:"" help:"Display UUIDs of inputs." aliases:"u"`
 }
 
 // Run executes the command to list all inputs.
@@ -30,27 +90,130 @@ func (cmd *InputListCmd) Run(ctx *context) error {
 		return err
 	}
 
-	t := table.New(ctx.Out)
+	t := table.New().Border(lipgloss.RoundedBorder()).
-	t.SetPadding(3)
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
-	t.SetAlignment(table.AlignLeft, table.AlignLeft)
+	if cmd.UUID {
-	t.SetHeaders("Input Name", "Kind")
+		t.Headers("Input Name", "Kind", "Muted", "UUID")
+	} else {
+		t.Headers("Input Name", "Kind", "Muted")
+	}
+	t.StyleFunc(func(row, col int) lipgloss.Style {
+		style := lipgloss.NewStyle().Padding(0, 3)
+		switch col {
+		case 0:
+			style = style.Align(lipgloss.Left)
+		case 1:
+			style = style.Align(lipgloss.Left)
+		case 2:
+			style = style.Align(lipgloss.Center)
+		case 3:
+			style = style.Align(lipgloss.Left)
+		}
+		switch {
+		case row == table.HeaderRow:
+			style = style.Bold(true).Align(lipgloss.Center)
+		case row%2 == 0:
+			style = style.Foreground(ctx.Style.evenRows)
+		default:
+			style = style.Foreground(ctx.Style.oddRows)
+		}
+		return style
+	})
+
+	sort.Slice(resp.Inputs, func(i, j int) bool {
+		return resp.Inputs[i].InputName < resp.Inputs[j].InputName
+	})
 
 	for _, input := range resp.Inputs {
-		if cmd.Input && strings.Contains(input.InputKind, "input") {
+		var muteMark string
-			t.AddRow(input.InputName, input.InputKind)
+		resp, err := ctx.Client.Inputs.GetInputMute(
-		}
+			inputs.NewGetInputMuteParams().WithInputName(input.InputName),
-		if cmd.Output && strings.Contains(input.InputKind, "output") {
+		)
-			t.AddRow(input.InputName, input.InputKind)
+		if err != nil {
-		}
+			if err.Error() == "request GetInputMute: InvalidResourceState (604): The specified input does not support audio." {
-		if cmd.Colour && strings.Contains(input.InputKind, "color") { // nolint
+				muteMark = "N/A"
-			t.AddRow(input.InputName, input.InputKind)
+			} else {
+				return fmt.Errorf("failed to get input mute state: %w", err)
+			}
+		} else {
+			muteMark = getEnabledMark(resp.InputMuted)
 		}
 
-		if !cmd.Input && !cmd.Output && !cmd.Colour {
+		type filter struct {
-			t.AddRow(input.InputName, input.InputKind)
+			enabled bool
+			keyword string
+		}
+		filters := []filter{
+			{cmd.Input, "input"},
+			{cmd.Output, "output"},
+			{cmd.Colour, "color"}, // nolint: misspell
+			{cmd.Ffmpeg, "ffmpeg"},
+			{cmd.Vlc, "vlc"},
+		}
+
+		var added bool
+		for _, f := range filters {
+			if f.enabled && strings.Contains(input.InputKind, f.keyword) {
+				if cmd.UUID {
+					t.Row(input.InputName, input.InputKind, muteMark, input.InputUuid)
+				} else {
+					t.Row(input.InputName, input.InputKind, muteMark)
+				}
+				added = true
+				break
+			}
+		}
+
+		if !added && (!cmd.Input && !cmd.Output && !cmd.Colour && !cmd.Ffmpeg && !cmd.Vlc) {
+			if cmd.UUID {
+				t.Row(input.InputName, snakeCaseToTitleCase(input.InputKind), muteMark, input.InputUuid)
+			} else {
+				t.Row(input.InputName, snakeCaseToTitleCase(input.InputKind), muteMark)
+			}
 		}
 	}
-	t.Render()
+	fmt.Fprintln(ctx.Out, t.Render())
+	return nil
+}
+
+// InputListKindsCmd provides a command to list all input kinds.
+type InputListKindsCmd struct{}
+
+// Run executes the command to list all input kinds.
+func (cmd *InputListKindsCmd) Run(ctx *context) error {
+	resp, err := ctx.Client.Inputs.GetInputKindList(
+		inputs.NewGetInputKindListParams().WithUnversioned(false),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to get input kinds: %w", err)
+	}
+
+	t := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
+	t.Headers("Kind")
+	t.StyleFunc(func(row, col int) lipgloss.Style {
+		style := lipgloss.NewStyle().Padding(0, 3)
+		switch col {
+		case 0:
+			style = style.Align(lipgloss.Left)
+		}
+		switch {
+		case row == table.HeaderRow:
+			style = style.Bold(true).Align(lipgloss.Center)
+		case row%2 == 0:
+			style = style.Foreground(ctx.Style.evenRows)
+		default:
+			style = style.Foreground(ctx.Style.oddRows)
+		}
+		return style
+	})
+
+	for _, kind := range resp.InputKinds {
+		t.Row(kind)
+	}
+
+	fmt.Fprintln(ctx.Out, t.Render())
+
 	return nil
 }
 
@@ -68,7 +231,7 @@ func (cmd *InputMuteCmd) Run(ctx *context) error {
 		return fmt.Errorf("failed to mute input: %w", err)
 	}
 
-	fmt.Fprintf(ctx.Out, "Muted input: %s\n", cmd.InputName)
+	fmt.Fprintf(ctx.Out, "Muted input: %s\n", ctx.Style.Highlight(cmd.InputName))
 	return nil
 }
 
@@ -86,7 +249,7 @@ func (cmd *InputUnmuteCmd) Run(ctx *context) error {
 		return fmt.Errorf("failed to unmute input: %w", err)
 	}
 
-	fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", cmd.InputName)
+	fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", ctx.Style.Highlight(cmd.InputName))
 	return nil
 }
 
@@ -114,9 +277,279 @@ func (cmd *InputToggleCmd) Run(ctx *context) error {
 	}
 
 	if newMuteState {
-		fmt.Fprintf(ctx.Out, "Muted input: %s\n", cmd.InputName)
+		fmt.Fprintf(ctx.Out, "Muted input: %s\n", ctx.Style.Highlight(cmd.InputName))
 	} else {
-		fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", cmd.InputName)
+		fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", ctx.Style.Highlight(cmd.InputName))
 	}
 	return nil
 }
+
+// InputVolumeCmd provides a command to set the volume of an input.
+type InputVolumeCmd struct {
+	InputName string  `arg:"" help:"Name of the input to set volume for." required:""`
+	Volume    float64 `arg:"" help:"Volume level (-90.0 to 0.0)."         required:""`
+}
+
+// Run executes the command to set the volume of an input.
+// accepts values between -90.0 and 0.0 representing decibels (dB).
+func (cmd *InputVolumeCmd) Run(ctx *context) error {
+	if cmd.Volume < -90.0 || cmd.Volume > 0.0 {
+		return fmt.Errorf("volume must be between -90.0 and 0.0 dB")
+	}
+
+	_, err := ctx.Client.Inputs.SetInputVolume(
+		inputs.NewSetInputVolumeParams().
+			WithInputName(cmd.InputName).
+			WithInputVolumeDb(cmd.Volume),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to set input volume: %w", err)
+	}
+
+	fmt.Fprintf(ctx.Out, "Set volume of input %s to %.1f dB\n",
+		ctx.Style.Highlight(cmd.InputName), cmd.Volume)
+	return nil
+}
+
+// InputShowCmd provides a command to show input details.
+type InputShowCmd struct {
+	Name    string `arg:"" help:"Name of the input to show."        required:""`
+	Verbose bool   `       help:"List all available input devices."             flag:""`
+}
+
+// Run executes the command to show input details.
+func (cmd *InputShowCmd) Run(ctx *context) error {
+	lresp, err := ctx.Client.Inputs.GetInputList(inputs.NewGetInputListParams())
+	if err != nil {
+		return fmt.Errorf("failed to get input list: %w", err)
+	}
+
+	var inputKind string
+	var found bool
+	for _, input := range lresp.Inputs {
+		if input.InputName == cmd.Name {
+			inputKind = input.InputKind
+			found = true
+			break
+		}
+	}
+
+	if !found {
+		return fmt.Errorf("input '%s' not found", cmd.Name)
+	}
+
+	prop, name := device(ctx, cmd.Name)
+	if prop == "" {
+		return fmt.Errorf("no device property found for input '%s'", cmd.Name)
+	}
+
+	t := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
+	t.Headers("Input Name", "Kind", "Device")
+	t.StyleFunc(func(row, col int) lipgloss.Style {
+		style := lipgloss.NewStyle().Padding(0, 3)
+		switch col {
+		case 0:
+			style = style.Align(lipgloss.Left)
+		case 1:
+			style = style.Align(lipgloss.Left)
+		case 2:
+			style = style.Align(lipgloss.Center)
+		}
+		switch {
+		case row == table.HeaderRow:
+			style = style.Bold(true).Align(lipgloss.Center)
+		case row%2 == 0:
+			style = style.Foreground(ctx.Style.evenRows)
+		default:
+			style = style.Foreground(ctx.Style.oddRows)
+		}
+		return style
+	})
+	t.Row(cmd.Name, snakeCaseToTitleCase(inputKind), name)
+
+	fmt.Fprintln(ctx.Out, t.Render())
+
+	if cmd.Verbose {
+		deviceListResp, err := ctx.Client.Inputs.GetInputPropertiesListPropertyItems(
+			inputs.NewGetInputPropertiesListPropertyItemsParams().
+				WithInputName(cmd.Name).
+				WithPropertyName(prop),
+		)
+		if err != nil {
+			return fmt.Errorf("failed to get device list: %w", err)
+		}
+
+		t := table.New().Border(lipgloss.RoundedBorder()).
+			BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
+		t.StyleFunc(func(row, col int) lipgloss.Style {
+			style := lipgloss.NewStyle().Padding(0, 3)
+			switch col {
+			case 0:
+				style = style.Align(lipgloss.Left)
+			}
+			switch {
+			case row == table.HeaderRow:
+				style = style.Bold(true).Align(lipgloss.Center)
+			case row%2 == 0:
+				style = style.Foreground(ctx.Style.evenRows)
+			default:
+				style = style.Foreground(ctx.Style.oddRows)
+			}
+			return style
+		})
+
+		t.Headers("Devices")
+
+		for _, item := range deviceListResp.PropertyItems {
+			if item.ItemName != "" {
+				t.Row(item.ItemName)
+			}
+		}
+
+		fmt.Fprintln(ctx.Out, t.Render())
+	}
+
+	return nil
+}
+
+func device(ctx *context, inputName string) (string, string) {
+	settings, err := ctx.Client.Inputs.GetInputSettings(
+		inputs.NewGetInputSettingsParams().WithInputName(inputName),
+	)
+	if err != nil {
+		return "", ""
+	}
+
+	for _, propName := range []string{"device", "device_id"} {
+		deviceListResp, err := ctx.Client.Inputs.GetInputPropertiesListPropertyItems(
+			inputs.NewGetInputPropertiesListPropertyItemsParams().
+				WithInputName(inputName).
+				WithPropertyName(propName),
+		)
+		if err == nil && len(deviceListResp.PropertyItems) > 0 {
+			for _, item := range deviceListResp.PropertyItems {
+				if item.ItemValue == settings.InputSettings[propName] {
+					return propName, item.ItemName
+				}
+			}
+		}
+	}
+
+	return "", ""
+}
+
+// InputUpdateCmd provides a command to update input settings.
+type InputUpdateCmd struct {
+	InputName  string `arg:"" help:"Name of the input to update." required:""`
+	DeviceName string `arg:"" help:"Name of the device to set."   required:""`
+}
+
+// Run executes the command to update input settings.
+func (cmd *InputUpdateCmd) Run(ctx *context) error {
+	// Use the device helper to find the correct device property name
+	prop, _ := device(ctx, cmd.InputName)
+	if prop == "" {
+		return fmt.Errorf("no device property found for input '%s'", cmd.InputName)
+	}
+
+	resp, err := ctx.Client.Inputs.GetInputPropertiesListPropertyItems(
+		inputs.NewGetInputPropertiesListPropertyItemsParams().
+			WithInputName(cmd.InputName).
+			WithPropertyName(prop),
+	)
+	if err != nil {
+		return err
+	}
+
+	var deviceValue any
+	var found bool
+	for _, item := range resp.PropertyItems {
+		if item.ItemName == cmd.DeviceName {
+			deviceValue = item.ItemValue
+			found = true
+			break
+		}
+	}
+
+	if !found {
+		return fmt.Errorf("device '%s' not found for input '%s'", cmd.DeviceName, cmd.InputName)
+	}
+
+	sresp, err := ctx.Client.Inputs.GetInputSettings(
+		inputs.NewGetInputSettingsParams().WithInputName(cmd.InputName),
+	)
+	if err != nil {
+		return err
+	}
+
+	settings := make(map[string]any)
+	maps.Copy(settings, sresp.InputSettings)
+	settings[prop] = deviceValue
+
+	_, err = ctx.Client.Inputs.SetInputSettings(
+		inputs.NewSetInputSettingsParams().
+			WithInputName(cmd.InputName).
+			WithInputSettings(settings),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to update input settings: %w", err)
+	}
+
+	fmt.Fprintf(ctx.Out, "Input %s %s set to %s\n",
+		ctx.Style.Highlight(cmd.InputName), prop, ctx.Style.Highlight(cmd.DeviceName))
+
+	return nil
+}
+
+// InputKindDefaultsCmd provides a command to get default settings for an input kind.
+type InputKindDefaultsCmd struct {
+	Kind string `arg:"" help:"Input kind to get default settings for." required:""`
+}
+
+// Run executes the command to get default settings for an input kind.
+func (cmd *InputKindDefaultsCmd) Run(ctx *context) error {
+	resp, err := ctx.Client.Inputs.GetInputDefaultSettings(
+		inputs.NewGetInputDefaultSettingsParams().
+			WithInputKind(cmd.Kind),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to get default settings for input kind '%s': %w", cmd.Kind, err)
+	}
+
+	t := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
+	t.Headers("Setting", "Value")
+	t.StyleFunc(func(row, col int) lipgloss.Style {
+		style := lipgloss.NewStyle().Padding(0, 3)
+		switch col {
+		case 0:
+			style = style.Align(lipgloss.Left)
+		case 1:
+			style = style.Align(lipgloss.Center)
+		}
+		switch {
+		case row == table.HeaderRow:
+			style = style.Bold(true).Align(lipgloss.Center)
+		case row%2 == 0:
+			style = style.Foreground(ctx.Style.evenRows)
+		default:
+			style = style.Foreground(ctx.Style.oddRows)
+		}
+		return style
+	})
+
+	keys := make([]string, 0, len(resp.DefaultInputSettings))
+	for k := range resp.DefaultInputSettings {
+		keys = append(keys, k)
+	}
+	sort.Strings(keys)
+
+	for _, key := range keys {
+		value := resp.DefaultInputSettings[key]
+		t.Row(key, fmt.Sprintf("%v", value))
+	}
+
+	fmt.Fprintln(ctx.Out, t.Render())
+	return nil
+}

input_test.go

@@ -11,10 +11,7 @@ func TestInputList(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmd := &InputListCmd{}
 	err := cmd.Run(context)
@@ -25,9 +22,8 @@ func TestInputList(t *testing.T) {
 	expectedInputs := []string{
 		"Desktop Audio",
 		"Mic/Aux",
-		"Colour Source",
+		"gobs-test-input",
-		"Colour Source 2",
+		"gobs-test-input-2",
-		"Colour Source 3",
 	}
 	output := out.String()
 	for _, input := range expectedInputs {
@@ -42,10 +38,7 @@ func TestInputListFilterInput(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmd := &InputListCmd{Input: true}
 	err := cmd.Run(context)
@@ -58,9 +51,8 @@ func TestInputListFilterInput(t *testing.T) {
 	}
 	expectedFilteredOut := []string{
 		"Desktop Audio",
-		"Colour Source",
+		"gobs-test-input",
-		"Colour Source 2",
+		"gobs-test-input-2",
-		"Colour Source 3",
 	}
 	for _, input := range expectedInputs {
 		if !strings.Contains(out.String(), input) {
@@ -79,10 +71,7 @@ func TestInputListFilterOutput(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmd := &InputListCmd{Output: true}
 	err := cmd.Run(context)
@@ -95,9 +84,8 @@ func TestInputListFilterOutput(t *testing.T) {
 	}
 	expectedFilteredOut := []string{
 		"Mic/Aux",
-		"Colour Source",
+		"gobs-test-input",
-		"Colour Source 2",
+		"gobs-test-input-2",
-		"Colour Source 3",
 	}
 	for _, input := range expectedInputs {
 		if !strings.Contains(out.String(), input) {
@@ -116,10 +104,7 @@ func TestInputListFilterColour(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmd := &InputListCmd{Colour: true}
 	err := cmd.Run(context)
@@ -128,9 +113,8 @@ func TestInputListFilterColour(t *testing.T) {
 	}
 
 	expectedInputs := []string{
-		"Colour Source",
+		"gobs-test-input",
-		"Colour Source 2",
+		"gobs-test-input-2",
-		"Colour Source 3",
 	}
 	for _, input := range expectedInputs {
 		if !strings.Contains(out.String(), input) {

main.go

@@ -8,14 +8,30 @@ import (
 	"io"
 	"os"
 	"path/filepath"
+	"runtime/debug"
+	"strings"
 	"time"
 
 	"github.com/alecthomas/kong"
 	mangokong "github.com/alecthomas/mango-kong"
 	"github.com/andreykaipov/goobs"
+	kongcompletion "github.com/jotaen/kong-completion"
 	kongdotenv "github.com/titusjaka/kong-dotenv-go"
 )
 
+var version string // Version of the CLI, set at build time.
+
+// VersionFlag is a custom flag type that prints the version and exits.
+type VersionFlag string
+
+func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil }  // nolint: revive
+func (v VersionFlag) IsBool() bool                       { return true } // nolint: revive
+func (v VersionFlag) BeforeApply(app *kong.Kong, vars kong.Vars) error { // nolint: revive, unparam
+	fmt.Printf("gobs-cli version: %s\n", vars["version"])
+	app.Exit(0)
+	return nil
+}
+
 // ObsConfig holds the configuration for connecting to the OBS WebSocket server.
 type ObsConfig struct {
 	Host     string `flag:"host"     help:"Host to connect to."          default:"localhost" env:"OBS_HOST"     short:"H"`
@@ -24,34 +40,56 @@ type ObsConfig struct {
 	Timeout  int    `flag:"timeout"  help:"Timeout in seconds."          default:"5"         env:"OBS_TIMEOUT"  short:"T"`
 }
 
+// StyleConfig holds the configuration for styling the CLI output.
+type StyleConfig struct {
+	Style    string `help:"Style used in output."                   flag:"style"     default:""      env:"GOBS_STYLE"           short:"s" enum:",red,magenta,purple,blue,cyan,green,yellow,orange,white,grey,navy,black"`
+	NoBorder bool   `help:"Disable table border styling in output." flag:"no-border" default:"false" env:"GOBS_STYLE_NO_BORDER" short:"b"`
+}
+
 // CLI is the main command line interface structure.
-// It embeds the ObsConfig struct to inherit its fields and flags.
+// It embeds ObsConfig and StyleConfig to provide configuration options.
 type CLI struct {
-	ObsConfig `embed:"" help:"OBS WebSocket configuration."`
+	ObsConfig   `embed:"" help:"OBS WebSocket configuration."`
+	StyleConfig `embed:"" help:"Style configuration."`
 
 	Man     mangokong.ManFlag `help:"Print man page."`
 	Version VersionFlag       `help:"Print gobs-cli version information and quit" name:"version" short:"v"`
 
+	Completion kongcompletion.Completion `help:"Generate shell completion scripts." cmd:"" aliases:"c"`
+
 	ObsVersion      ObsVersionCmd      `help:"Print OBS client and websocket version." cmd:"" aliases:"v"`
-	Scene           SceneCmd           `help:"Manage scenes."                          cmd:"" aliases:"sc"`
+	Scene           SceneCmd           `help:"Manage scenes."                          cmd:"" aliases:"sc"  group:"Scene"`
-	Sceneitem       SceneItemCmd       `help:"Manage scene items."                     cmd:"" aliases:"si"`
+	Sceneitem       SceneItemCmd       `help:"Manage scene items."                     cmd:"" aliases:"si"  group:"Scene Item"`
-	Group           GroupCmd           `help:"Manage groups."                          cmd:"" aliases:"g"`
+	Group           GroupCmd           `help:"Manage groups."                          cmd:"" aliases:"g"   group:"Group"`
-	Input           InputCmd           `help:"Manage inputs."                          cmd:"" aliases:"i"`
+	Input           InputCmd           `help:"Manage inputs."                          cmd:"" aliases:"i"   group:"Input"`
-	Record          RecordCmd          `help:"Manage recording."                       cmd:"" aliases:"rec"`
+	Text            TextCmd            `help:"Manage text inputs."                     cmd:"" aliases:"t"   group:"Text Input"`
-	Stream          StreamCmd          `help:"Manage streaming."                       cmd:"" aliases:"st"`
+	Record          RecordCmd          `help:"Manage recording."                       cmd:"" aliases:"rec" group:"Recording"`
-	Scenecollection SceneCollectionCmd `help:"Manage scene collections."               cmd:"" aliases:"scn"`
+	Stream          StreamCmd          `help:"Manage streaming."                       cmd:"" aliases:"st"  group:"Streaming"`
-	Profile         ProfileCmd         `help:"Manage profiles."                        cmd:"" aliases:"p"`
+	Scenecollection SceneCollectionCmd `help:"Manage scene collections."               cmd:"" aliases:"scn" group:"Scene Collection"`
-	Replaybuffer    ReplayBufferCmd    `help:"Manage replay buffer."                   cmd:"" aliases:"rb"`
+	Profile         ProfileCmd         `help:"Manage profiles."                        cmd:"" aliases:"p"   group:"Profile"`
-	Studiomode      StudioModeCmd      `help:"Manage studio mode."                     cmd:"" aliases:"sm"`
+	Replaybuffer    ReplayBufferCmd    `help:"Manage replay buffer."                   cmd:"" aliases:"rb"  group:"Replay Buffer"`
-	Virtualcam      VirtualCamCmd      `help:"Manage virtual camera."                  cmd:"" aliases:"vc"`
+	Studiomode      StudioModeCmd      `help:"Manage studio mode."                     cmd:"" aliases:"sm"  group:"Studio Mode"`
-	Hotkey          HotkeyCmd          `help:"Manage hotkeys."                         cmd:"" aliases:"hk"`
+	Virtualcam      VirtualCamCmd      `help:"Manage virtual camera."                  cmd:"" aliases:"vc"  group:"Virtual Camera"`
-	Filter          FilterCmd          `help:"Manage filters."                         cmd:"" aliases:"f"`
+	Hotkey          HotkeyCmd          `help:"Manage hotkeys."                         cmd:"" aliases:"hk"  group:"Hotkey"`
-	Projector       ProjectorCmd       `help:"Manage projectors."                      cmd:"" aliases:"prj"`
+	Filter          FilterCmd          `help:"Manage filters."                         cmd:"" aliases:"f"   group:"Filter"`
+	Projector       ProjectorCmd       `help:"Manage projectors."                      cmd:"" aliases:"prj" group:"Projector"`
+	Screenshot      ScreenshotCmd      `help:"Take screenshots."                       cmd:"" aliases:"ss"  group:"Screenshot"`
+	Settings        SettingsCmd        `help:"Manage video and profile settings."      cmd:"" aliases:"set" group:"Settings"`
+	Media           MediaCmd           `help:"Manage media inputs."                    cmd:"" aliases:"mi"  group:"Media Input"`
 }
 
 type context struct {
 	Client *goobs.Client
 	Out    io.Writer
+	Style  *Style
+}
+
+func newContext(client *goobs.Client, out io.Writer, styleCfg StyleConfig) *context {
+	return &context{
+		Client: client,
+		Out:    out,
+		Style:  styleFromFlag(styleCfg),
+	}
 }
 
 func main() {
@@ -62,20 +100,33 @@ func main() {
 	}
 
 	var cli CLI
+	kongcompletion.Register(kong.Must(&cli))
 	ctx := kong.Parse(
 		&cli,
-		kong.Name("GOBS-CLI"),
+		kong.Name("gobs-cli"),
 		kong.Description("A command line tool to interact with OBS Websocket."),
 		kong.Configuration(kongdotenv.ENVFileReader, ".env", filepath.Join(userConfigDir, "gobs-cli", "config.env")),
-	)
+		kong.UsageOnError(),
+		kong.ConfigureHelp(kong.HelpOptions{
+			Compact: true,
+		}),
+		kong.Vars{
+			"version": func() string {
+				if version == "" {
+					info, ok := debug.ReadBuildInfo()
+					if !ok {
+						return "(unable to read build info)"
+					}
+					version = strings.Split(info.Main.Version, "-")[0]
+				}
+				return version
+			}(),
+		})
 
 	client, err := connectObs(cli.ObsConfig)
 	ctx.FatalIfErrorf(err)
 
-	ctx.Bind(&context{
+	ctx.Bind(newContext(client, os.Stdout, cli.StyleConfig))
-		Client: client,
-		Out:    os.Stdout,
-	})
 
 	ctx.FatalIfErrorf(run(ctx, client))
 }

main_test.go

@@ -2,7 +2,9 @@ package main
 
 import (
 	"os"
+	"runtime"
 	"testing"
+	"time"
 
 	"github.com/andreykaipov/goobs"
 	"github.com/andreykaipov/goobs/api/requests/config"
@@ -62,13 +64,23 @@ func setup(client *goobs.Client) {
 			Key:    os.Getenv("OBS_STREAM_KEY"),
 		}))
 
-	client.Config.SetCurrentSceneCollection(config.NewSetCurrentSceneCollectionParams().
+	client.Config.CreateProfile(config.NewCreateProfileParams().
-		WithSceneCollectionName("test-collection"))
+		WithProfileName("gobs-test-profile"))
+	time.Sleep(100 * time.Millisecond) // Wait for the profile to be created
+	client.Config.SetProfileParameter(config.NewSetProfileParameterParams().
+		WithParameterCategory("SimpleOutput").
+		WithParameterName("RecRB").
+		WithParameterValue("true"))
+	// hack to ensure the Replay Buffer setting is applied
+	client.Config.SetCurrentProfile(config.NewSetCurrentProfileParams().
+		WithProfileName("Untitled"))
+	client.Config.SetCurrentProfile(config.NewSetCurrentProfileParams().
+		WithProfileName("gobs-test-profile"))
 
 	client.Scenes.CreateScene(scenes.NewCreateSceneParams().
-		WithSceneName("gobs-test"))
+		WithSceneName("gobs-test-scene"))
 	client.Inputs.CreateInput(inputs.NewCreateInputParams().
-		WithSceneName("gobs-test").
+		WithSceneName("gobs-test-scene").
 		WithInputName("gobs-test-input").
 		WithInputKind("color_source_v3").
 		WithInputSettings(map[string]any{
@@ -79,7 +91,7 @@ func setup(client *goobs.Client) {
 		}).
 		WithSceneItemEnabled(true))
 	client.Inputs.CreateInput(inputs.NewCreateInputParams().
-		WithSceneName("gobs-test").
+		WithSceneName("gobs-test-scene").
 		WithInputName("gobs-test-input-2").
 		WithInputKind("color_source_v3").
 		WithInputSettings(map[string]any{
@@ -90,6 +102,37 @@ func setup(client *goobs.Client) {
 		}).
 		WithSceneItemEnabled(true))
 
+	// ensure Desktop Audio input is created
+	desktopAudioKinds := map[string]string{
+		"windows": "wasapi_output_capture",
+		"linux":   "pulse_output_capture",
+		"darwin":  "coreaudio_output_capture",
+	}
+	platform := os.Getenv("GOBS_TEST_PLATFORM")
+	if platform == "" {
+		platform = runtime.GOOS
+	}
+	client.Inputs.CreateInput(inputs.NewCreateInputParams().
+		WithSceneName("gobs-test-scene").
+		WithInputName("Desktop Audio").
+		WithInputKind(desktopAudioKinds[platform]).
+		WithInputSettings(map[string]any{
+			"device_id": "default",
+		}))
+	// ensure Mic/Aux input is created
+	micKinds := map[string]string{
+		"windows": "wasapi_input_capture",
+		"linux":   "pulse_input_capture",
+		"darwin":  "coreaudio_input_capture",
+	}
+	client.Inputs.CreateInput(inputs.NewCreateInputParams().
+		WithSceneName("gobs-test-scene").
+		WithInputName("Mic/Aux").
+		WithInputKind(micKinds[platform]).
+		WithInputSettings(map[string]any{
+			"device_id": "default",
+		}))
+
 	// Create source filter on an audio input
 	client.Filters.CreateSourceFilter(filters.NewCreateSourceFilterParams().
 		WithSourceName("Mic/Aux").
@@ -106,7 +149,7 @@ func setup(client *goobs.Client) {
 
 	// Create source filter on a scene
 	client.Filters.CreateSourceFilter(filters.NewCreateSourceFilterParams().
-		WithSourceName("gobs-test").
+		WithSourceName("gobs-test-scene").
 		WithFilterName("test_filter").
 		WithFilterKind("luma_key_filter_v2").
 		WithFilterSettings(map[string]any{
@@ -115,18 +158,21 @@ func setup(client *goobs.Client) {
 }
 
 func teardown(client *goobs.Client) {
+	client.Config.RemoveProfile(config.NewRemoveProfileParams().
+		WithProfileName("gobs-test-profile"))
+
 	client.Filters.RemoveSourceFilter(filters.NewRemoveSourceFilterParams().
 		WithSourceName("Mic/Aux").
 		WithFilterName("test_filter"))
 	client.Filters.RemoveSourceFilter(filters.NewRemoveSourceFilterParams().
-		WithSourceName("gobs-test").
+		WithSourceName("gobs-test-scene").
 		WithFilterName("test_filter"))
 
 	client.Scenes.RemoveScene(scenes.NewRemoveSceneParams().
-		WithSceneName("gobs-test"))
+		WithSceneName("gobs-test-scene"))
 
 	client.Config.SetCurrentSceneCollection(config.NewSetCurrentSceneCollectionParams().
-		WithSceneCollectionName("default"))
+		WithSceneCollectionName("Untitled"))
 
 	client.Stream.StopStream()
 	client.Record.StopRecord()

media.go

@@ -0,0 +1,140 @@
+package main
+
+import (
+	"fmt"
+
+	"github.com/andreykaipov/goobs/api/requests/mediainputs"
+)
+
+// MediaCmd represents a collection of commands to control media inputs.
+type MediaCmd struct {
+	Cursor  MediaCursorCmd  `cmd:"" help:"Get/set the cursor position of a media input." aliases:"c"`
+	Play    MediaPlayCmd    `cmd:"" help:"Plays a media input."                          aliases:"p"`
+	Pause   MediaPauseCmd   `cmd:"" help:"Pauses a media input."                         aliases:"pa"`
+	Stop    MediaStopCmd    `cmd:"" help:"Stops a media input."                          aliases:"s"`
+	Restart MediaRestartCmd `cmd:"" help:"Restarts a media input."                       aliases:"r"`
+}
+
+// MediaCursorCmd represents the command to get or set the cursor position of a media input.
+type MediaCursorCmd struct {
+	InputName  string `arg:"" help:"Name of the media input."`
+	TimeString string `arg:"" help:"Time position to set the cursor to (e.g., '00:01:30' for 1 minute 30 seconds). If not provided, the current cursor position will be displayed." optional:""`
+}
+
+// Run executes the command to set the cursor position of the media input.
+func (cmd *MediaCursorCmd) Run(ctx *context) error {
+	if cmd.TimeString == "" {
+		resp, err := ctx.Client.MediaInputs.GetMediaInputStatus(
+			mediainputs.NewGetMediaInputStatusParams().
+				WithInputName(cmd.InputName))
+		if err != nil {
+			return fmt.Errorf("failed to get media input cursor: %w", err)
+		}
+
+		fmt.Fprintf(
+			ctx.Out,
+			"%s cursor position: %s\n",
+			ctx.Style.Highlight(cmd.InputName),
+			formatMillisecondsToTimeString(resp.MediaCursor),
+		)
+		return nil
+	}
+
+	position, err := parseTimeStringToMilliseconds(cmd.TimeString)
+	if err != nil {
+		return fmt.Errorf("failed to parse time string: %w", err)
+	}
+
+	_, err = ctx.Client.MediaInputs.SetMediaInputCursor(
+		mediainputs.NewSetMediaInputCursorParams().
+			WithInputName(cmd.InputName).
+			WithMediaCursor(position))
+	if err != nil {
+		return fmt.Errorf("failed to set media input cursor: %w", err)
+	}
+
+	fmt.Fprintf(
+		ctx.Out,
+		"Set %s cursor to %s (%.0f ms)\n",
+		ctx.Style.Highlight(cmd.InputName),
+		ctx.Style.Highlight(cmd.TimeString),
+		position,
+	)
+	return nil
+}
+
+// MediaPlayCmd represents the command to play a media input.
+type MediaPlayCmd struct {
+	InputName string `arg:"" help:"Name of the media input."`
+}
+
+// Run executes the command to play the media input.
+func (cmd *MediaPlayCmd) Run(ctx *context) error {
+	_, err := ctx.Client.MediaInputs.TriggerMediaInputAction(
+		mediainputs.NewTriggerMediaInputActionParams().
+			WithInputName(cmd.InputName).
+			WithMediaAction("OBS_WEBSOCKET_MEDIA_INPUT_ACTION_PLAY"))
+	if err != nil {
+		return fmt.Errorf("failed to play media input: %w", err)
+	}
+
+	fmt.Fprintln(ctx.Out, "Playing media input:", cmd.InputName)
+	return nil
+}
+
+// MediaPauseCmd represents the command to pause a media input.
+type MediaPauseCmd struct {
+	InputName string `arg:"" help:"Name of the media input."`
+}
+
+// Run executes the command to pause the media input.
+func (cmd *MediaPauseCmd) Run(ctx *context) error {
+	_, err := ctx.Client.MediaInputs.TriggerMediaInputAction(
+		mediainputs.NewTriggerMediaInputActionParams().
+			WithInputName(cmd.InputName).
+			WithMediaAction("OBS_WEBSOCKET_MEDIA_INPUT_ACTION_PAUSE"))
+	if err != nil {
+		return fmt.Errorf("failed to pause media input: %w", err)
+	}
+
+	fmt.Fprintln(ctx.Out, "Pausing media input:", cmd.InputName)
+	return nil
+}
+
+// MediaStopCmd represents the command to stop a media input.
+type MediaStopCmd struct {
+	InputName string `arg:"" help:"Name of the media input."`
+}
+
+// Run executes the command to stop the media input.
+func (cmd *MediaStopCmd) Run(ctx *context) error {
+	_, err := ctx.Client.MediaInputs.TriggerMediaInputAction(
+		mediainputs.NewTriggerMediaInputActionParams().
+			WithInputName(cmd.InputName).
+			WithMediaAction("OBS_WEBSOCKET_MEDIA_INPUT_ACTION_STOP"))
+	if err != nil {
+		return fmt.Errorf("failed to stop media input: %w", err)
+	}
+
+	fmt.Fprintln(ctx.Out, "Stopping media input:", cmd.InputName)
+	return nil
+}
+
+// MediaRestartCmd represents the command to restart a media input.
+type MediaRestartCmd struct {
+	InputName string `arg:"" help:"Name of the media input."`
+}
+
+// Run executes the command to restart the media input.
+func (cmd *MediaRestartCmd) Run(ctx *context) error {
+	_, err := ctx.Client.MediaInputs.TriggerMediaInputAction(
+		mediainputs.NewTriggerMediaInputActionParams().
+			WithInputName(cmd.InputName).
+			WithMediaAction("OBS_WEBSOCKET_MEDIA_INPUT_ACTION_RESTART"))
+	if err != nil {
+		return fmt.Errorf("failed to restart media input: %w", err)
+	}
+
+	fmt.Fprintln(ctx.Out, "Restarting media input:", cmd.InputName)
+	return nil
+}

profile.go

@@ -5,7 +5,8 @@ import (
 	"slices"
 
 	"github.com/andreykaipov/goobs/api/requests/config"
-	"github.com/aquasecurity/table"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
 )
 
 // ProfileCmd provides commands to manage profiles in OBS Studio.
@@ -21,16 +22,34 @@ type ProfileCmd struct {
 type ProfileListCmd struct{} // size = 0x0
 
 // Run executes the command to list all profiles.
+// nolint: misspell
 func (cmd *ProfileListCmd) Run(ctx *context) error {
 	profiles, err := ctx.Client.Config.GetProfileList()
 	if err != nil {
 		return err
 	}
 
-	t := table.New(ctx.Out)
+	t := table.New().Border(lipgloss.RoundedBorder()).
-	t.SetPadding(3)
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
-	t.SetAlignment(table.AlignLeft, table.AlignCenter)
+		Headers("Profile Name", "Current").
-	t.SetHeaders("Profile Name", "Current")
+		StyleFunc(func(row, col int) lipgloss.Style {
+			style := lipgloss.NewStyle().Padding(0, 3)
+			switch col {
+			case 0:
+				style = style.Align(lipgloss.Left)
+			case 1:
+				style = style.Align(lipgloss.Center)
+			}
+			switch {
+			case row == table.HeaderRow:
+				style = style.Bold(true).Align(lipgloss.Center)
+			case row%2 == 0:
+				style = style.Foreground(ctx.Style.evenRows)
+			default:
+				style = style.Foreground(ctx.Style.oddRows)
+			}
+			return style
+		})
 
 	for _, profile := range profiles.Profiles {
 		var enabledMark string
@@ -38,9 +57,9 @@ func (cmd *ProfileListCmd) Run(ctx *context) error {
 			enabledMark = getEnabledMark(true)
 		}
 
-		t.AddRow(profile, enabledMark)
+		t.Row(profile, enabledMark)
 	}
-	t.Render()
+	fmt.Fprintln(ctx.Out, t.Render())
 	return nil
 }
 
@@ -53,7 +72,7 @@ func (cmd *ProfileCurrentCmd) Run(ctx *context) error {
 	if err != nil {
 		return err
 	}
-	fmt.Fprintf(ctx.Out, "Current profile: %s\n", profiles.CurrentProfileName)
+	fmt.Fprintf(ctx.Out, "Current profile: %s\n", ctx.Style.Highlight(profiles.CurrentProfileName))
 
 	return nil
 }
@@ -72,15 +91,20 @@ func (cmd *ProfileSwitchCmd) Run(ctx *context) error {
 	current := profiles.CurrentProfileName
 
 	if current == cmd.Name {
-		return nil
+		return fmt.Errorf("already using profile %s", ctx.Style.Error(cmd.Name))
 	}
 
 	_, err = ctx.Client.Config.SetCurrentProfile(config.NewSetCurrentProfileParams().WithProfileName(cmd.Name))
 	if err != nil {
-		return err
+		return fmt.Errorf("failed to switch to profile %s: %w", ctx.Style.Error(cmd.Name), err)
 	}
 
-	fmt.Fprintf(ctx.Out, "Switched from profile %s to %s\n", current, cmd.Name)
+	fmt.Fprintf(
+		ctx.Out,
+		"Switched from profile %s to %s\n",
+		ctx.Style.Highlight(current),
+		ctx.Style.Highlight(cmd.Name),
+	)
 
 	return nil
 }
@@ -98,15 +122,15 @@ func (cmd *ProfileCreateCmd) Run(ctx *context) error {
 	}
 
 	if slices.Contains(profiles.Profiles, cmd.Name) {
-		return fmt.Errorf("profile %s already exists", cmd.Name)
+		return fmt.Errorf("profile %s already exists", ctx.Style.Error(cmd.Name))
 	}
 
 	_, err = ctx.Client.Config.CreateProfile(config.NewCreateProfileParams().WithProfileName(cmd.Name))
 	if err != nil {
-		return err
+		return fmt.Errorf("failed to create profile %s: %w", ctx.Style.Error(cmd.Name), err)
 	}
 
-	fmt.Fprintf(ctx.Out, "Created profile: %s\n", cmd.Name)
+	fmt.Fprintf(ctx.Out, "Created profile: %s\n", ctx.Style.Highlight(cmd.Name))
 
 	return nil
 }
@@ -124,19 +148,21 @@ func (cmd *ProfileRemoveCmd) Run(ctx *context) error {
 	}
 
 	if !slices.Contains(profiles.Profiles, cmd.Name) {
-		return fmt.Errorf("profile %s does not exist", cmd.Name)
+		return fmt.Errorf("profile %s does not exist", ctx.Style.Error(cmd.Name))
 	}
 
+	// Prevent deletion of the current profile
+	// This is allowed in OBS Studio (with a confirmation prompt), but we want to prevent it here
 	if profiles.CurrentProfileName == cmd.Name {
-		return fmt.Errorf("cannot delete current profile %s", cmd.Name)
+		return fmt.Errorf("cannot delete current profile %s", ctx.Style.Error(cmd.Name))
 	}
 
 	_, err = ctx.Client.Config.RemoveProfile(config.NewRemoveProfileParams().WithProfileName(cmd.Name))
 	if err != nil {
-		return err
+		return fmt.Errorf("failed to delete profile %s: %w", ctx.Style.Error(cmd.Name), err)
 	}
 
-	fmt.Fprintf(ctx.Out, "Deleted profile: %s\n", cmd.Name)
+	fmt.Fprintf(ctx.Out, "Deleted profile: %s\n", ctx.Style.Highlight(cmd.Name))
 
 	return nil
 }

projector.go

@@ -4,7 +4,8 @@ import (
 	"fmt"
 
 	"github.com/andreykaipov/goobs/api/requests/ui"
-	"github.com/aquasecurity/table"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
 )
 
 // ProjectorCmd provides a command to manage projectors in OBS.
@@ -17,6 +18,7 @@ type ProjectorCmd struct {
 type ProjectorListMonitorsCmd struct{} // size = 0x0
 
 // Run executes the command to list all monitors available for projectors.
+// nolint: misspell
 func (cmd *ProjectorListMonitorsCmd) Run(ctx *context) error {
 	monitors, err := ctx.Client.Ui.GetMonitorList()
 	if err != nil {
@@ -24,20 +26,37 @@ func (cmd *ProjectorListMonitorsCmd) Run(ctx *context) error {
 	}
 
 	if len(monitors.Monitors) == 0 {
-		ctx.Out.Write([]byte("No monitors found for projectors.\n"))
+		fmt.Fprintf(ctx.Out, "No monitors found.\n")
 		return nil
 	}
 
-	t := table.New(ctx.Out)
+	t := table.New().Border(lipgloss.RoundedBorder()).
-	t.SetPadding(3)
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
-	t.SetAlignment(table.AlignCenter, table.AlignLeft)
+		Headers("Monitor ID", "Monitor Name").
-	t.SetHeaders("Monitor ID", "Monitor Name")
+		StyleFunc(func(row, col int) lipgloss.Style {
+			style := lipgloss.NewStyle().Padding(0, 3)
+			switch col {
+			case 0:
+				style = style.Align(lipgloss.Center)
+			case 1:
+				style = style.Align(lipgloss.Left)
+			}
+			switch {
+			case row == table.HeaderRow:
+				style = style.Bold(true).Align(lipgloss.Center)
+			case row%2 == 0:
+				style = style.Foreground(ctx.Style.evenRows)
+			default:
+				style = style.Foreground(ctx.Style.oddRows)
+			}
+			return style
+		})
 
 	for _, monitor := range monitors.Monitors {
-		t.AddRow(fmt.Sprintf("%d", monitor.MonitorIndex), monitor.MonitorName)
+		t.Row(fmt.Sprintf("%d", monitor.MonitorIndex), monitor.MonitorName)
 	}
 
-	t.Render()
+	fmt.Fprintln(ctx.Out, t.Render())
 	return nil
 }
 
@@ -57,10 +76,36 @@ func (cmd *ProjectorOpenCmd) Run(ctx *context) error {
 		cmd.SourceName = currentScene.SceneName
 	}
 
+	monitors, err := ctx.Client.Ui.GetMonitorList()
+	if err != nil {
+		return err
+	}
+
+	var monitorName string
+	for _, monitor := range monitors.Monitors {
+		if monitor.MonitorIndex == cmd.MonitorIndex {
+			monitorName = monitor.MonitorName
+			break
+		}
+	}
+
+	if monitorName == "" {
+		return fmt.Errorf(
+			"monitor with index %s not found. use %s to list available monitors",
+			ctx.Style.Error(fmt.Sprintf("%d", cmd.MonitorIndex)),
+			ctx.Style.Error("gobs-cli prj ls-m"),
+		)
+	}
+
 	ctx.Client.Ui.OpenSourceProjector(ui.NewOpenSourceProjectorParams().
 		WithSourceName(cmd.SourceName).
 		WithMonitorIndex(cmd.MonitorIndex))
 
-	fmt.Fprintf(ctx.Out, "Opened projector for source '%s' on monitor index %d.\n", cmd.SourceName, cmd.MonitorIndex)
+	fmt.Fprintf(
+		ctx.Out,
+		"Opened projector for source %s on monitor %s.\n",
+		ctx.Style.Highlight(cmd.SourceName),
+		ctx.Style.Highlight(monitorName),
+	)
 	return nil
 }

record.go

@@ -4,17 +4,20 @@ import (
 	"fmt"
 
 	"github.com/andreykaipov/goobs/api/requests/config"
+	"github.com/andreykaipov/goobs/api/requests/record"
 )
 
 // RecordCmd handles the recording commands.
 type RecordCmd struct {
-	Start     RecordStartCmd     `cmd:"" help:"Start recording."             aliases:"s"`
+	Start     RecordStartCmd     `cmd:"" help:"Start recording."                   aliases:"s"`
-	Stop      RecordStopCmd      `cmd:"" help:"Stop recording."              aliases:"st"`
+	Stop      RecordStopCmd      `cmd:"" help:"Stop recording."                    aliases:"st"`
-	Toggle    RecordToggleCmd    `cmd:"" help:"Toggle recording."            aliases:"tg"`
+	Toggle    RecordToggleCmd    `cmd:"" help:"Toggle recording."                  aliases:"tg"`
-	Status    RecordStatusCmd    `cmd:"" help:"Show recording status."       aliases:"ss"`
+	Status    RecordStatusCmd    `cmd:"" help:"Show recording status."             aliases:"ss"`
-	Pause     RecordPauseCmd     `cmd:"" help:"Pause recording."             aliases:"p"`
+	Pause     RecordPauseCmd     `cmd:"" help:"Pause recording."                   aliases:"p"`
-	Resume    RecordResumeCmd    `cmd:"" help:"Resume recording."            aliases:"r"`
+	Resume    RecordResumeCmd    `cmd:"" help:"Resume recording."                  aliases:"r"`
-	Directory RecordDirectoryCmd `cmd:"" help:"Get/Set recording directory." aliases:"d"`
+	Directory RecordDirectoryCmd `cmd:"" help:"Get/Set recording directory."       aliases:"d"`
+	Split     RecordSplitCmd     `cmd:"" help:"Split recording."                   aliases:"sp"`
+	Chapter   RecordChapterCmd   `cmd:"" help:"Create a chapter in the recording." aliases:"c"`
 }
 
 // RecordStartCmd starts the recording.
@@ -60,7 +63,11 @@ func (cmd *RecordStopCmd) Run(ctx *context) error {
 	if err != nil {
 		return err
 	}
-	fmt.Fprintf(ctx.Out, "%s", fmt.Sprintf("Recording stopped successfully. Output file: %s\n", resp.OutputPath))
+	fmt.Fprintf(
+		ctx.Out,
+		"%s",
+		fmt.Sprintf("Recording stopped successfully. Output file: %s\n", ctx.Style.Highlight(resp.OutputPath)),
+	)
 	return nil
 }
 
@@ -169,7 +176,7 @@ func (cmd *RecordDirectoryCmd) Run(ctx *context) error {
 		if err != nil {
 			return err
 		}
-		fmt.Fprintf(ctx.Out, "Current recording directory: %s\n", resp.RecordDirectory)
+		fmt.Fprintf(ctx.Out, "Current recording directory: %s\n", ctx.Style.Highlight(resp.RecordDirectory))
 		return nil
 	}
 
@@ -180,6 +187,71 @@ func (cmd *RecordDirectoryCmd) Run(ctx *context) error {
 		return err
 	}
 
-	fmt.Fprintf(ctx.Out, "Recording directory set to: %s\n", cmd.RecordDirectory)
+	fmt.Fprintf(ctx.Out, "Recording directory set to: %s\n", ctx.Style.Highlight(cmd.RecordDirectory))
+	return nil
+}
+
+// RecordSplitCmd splits the current recording.
+type RecordSplitCmd struct{} // size = 0x0
+
+// Run executes the command to split the recording.
+func (cmd *RecordSplitCmd) Run(ctx *context) error {
+	status, err := ctx.Client.Record.GetRecordStatus()
+	if err != nil {
+		return err
+	}
+
+	if !status.OutputActive {
+		return fmt.Errorf("recording is not in progress")
+	}
+	if status.OutputPaused {
+		return fmt.Errorf("recording is paused, cannot split")
+	}
+
+	_, err = ctx.Client.Record.SplitRecordFile()
+	if err != nil {
+		return err
+	}
+
+	fmt.Fprintln(ctx.Out, "Recording split successfully.")
+	return nil
+}
+
+// RecordChapterCmd creates a chapter in the recording.
+type RecordChapterCmd struct {
+	ChapterName string `arg:"" help:"Name of the chapter to create." default:""`
+}
+
+// Run executes the command to create a chapter in the recording.
+func (cmd *RecordChapterCmd) Run(ctx *context) error {
+	status, err := ctx.Client.Record.GetRecordStatus()
+	if err != nil {
+		return err
+	}
+
+	if !status.OutputActive {
+		return fmt.Errorf("recording is not in progress")
+	}
+	if status.OutputPaused {
+		return fmt.Errorf("recording is paused, cannot create chapter")
+	}
+
+	var params *record.CreateRecordChapterParams
+	if cmd.ChapterName == "" {
+		params = record.NewCreateRecordChapterParams()
+	} else {
+		params = record.NewCreateRecordChapterParams().WithChapterName(cmd.ChapterName)
+	}
+
+	_, err = ctx.Client.Record.CreateRecordChapter(params)
+	if err != nil {
+		return err
+	}
+
+	if cmd.ChapterName == "" {
+		cmd.ChapterName = "unnamed"
+	}
+
+	fmt.Fprintf(ctx.Out, "Chapter %s created successfully.\n", ctx.Style.Highlight(cmd.ChapterName))
 	return nil
 }

record_test.go

@@ -12,10 +12,7 @@ func TestRecordStart(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmdStatus := &RecordStatusCmd{}
 	err := cmdStatus.Run(context)
@@ -47,7 +44,7 @@ func TestRecordStart(t *testing.T) {
 	if out.String() != "Recording started successfully.\n" {
 		t.Fatalf("Expected output to contain 'Recording started successfully.', got '%s'", out.String())
 	}
-	time.Sleep(1 * time.Second) // Wait for the recording to start
+	time.Sleep(500 * time.Millisecond) // Wait for the recording to start
 }
 
 func TestRecordStop(t *testing.T) {
@@ -55,10 +52,7 @@ func TestRecordStop(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmdStatus := &RecordStatusCmd{}
 	err := cmdStatus.Run(context)
@@ -90,7 +84,7 @@ func TestRecordStop(t *testing.T) {
 	if !strings.Contains(out.String(), "Recording stopped successfully. Output file: ") {
 		t.Fatalf("Expected output to contain 'Recording stopped successfully. Output file: ', got '%s'", out.String())
 	}
-	time.Sleep(1 * time.Second) // Wait for the recording to stop
+	time.Sleep(500 * time.Millisecond) // Wait for the recording to stop
 }
 
 func TestRecordToggle(t *testing.T) {
@@ -98,10 +92,7 @@ func TestRecordToggle(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmdStatus := &RecordStatusCmd{}
 	err := cmdStatus.Run(context)
@@ -121,8 +112,6 @@ func TestRecordToggle(t *testing.T) {
 		t.Fatalf("Failed to toggle recording: %v", err)
 	}
 
-	time.Sleep(1 * time.Second) // Wait for a second to ensure toggle has taken effect
-
 	if active {
 		if out.String() != "Recording stopped successfully.\n" {
 			t.Fatalf("Expected output to be 'Recording stopped successfully.', got '%s'", out.String())
@@ -132,4 +121,5 @@ func TestRecordToggle(t *testing.T) {
 			t.Fatalf("Expected output to be 'Recording started successfully.', got '%s'", out.String())
 		}
 	}
+	time.Sleep(500 * time.Millisecond) // Wait for the toggle to take effect
 }

replaybuffer_test.go

@@ -2,19 +2,26 @@ package main
 
 import (
 	"bytes"
+	"os"
 	"strings"
 	"testing"
+	"time"
 )
 
+func skipIfSkipReplayBufferTests(t *testing.T) {
+	if os.Getenv("GOBS_TEST_SKIP_REPLAYBUFFER_TESTS") != "" {
+		t.Skip("Skipping replay buffer tests due to GOBS_TEST_SKIP_REPLAYBUFFER_TESTS environment variable")
+	}
+}
+
 func TestReplayBufferStart(t *testing.T) {
+	skipIfSkipReplayBufferTests(t)
+
 	client, disconnect := getClient(t)
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmd := &ReplayBufferStartCmd{}
 	err := cmd.Run(context)
@@ -24,17 +31,17 @@ func TestReplayBufferStart(t *testing.T) {
 	if out.String() != "Replay buffer started.\n" {
 		t.Fatalf("Expected output to be 'Replay buffer started', got '%s'", out.String())
 	}
+	time.Sleep(500 * time.Millisecond) // Wait for the replay buffer to start
 }
 
 func TestReplayBufferStop(t *testing.T) {
+	skipIfSkipReplayBufferTests(t)
+
 	client, disconnect := getClient(t)
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmd := &ReplayBufferStopCmd{}
 	err := cmd.Run(context)
@@ -44,17 +51,17 @@ func TestReplayBufferStop(t *testing.T) {
 	if out.String() != "Replay buffer stopped.\n" {
 		t.Fatalf("Expected output to be 'Replay buffer stopped.', got '%s'", out.String())
 	}
+	time.Sleep(500 * time.Millisecond) // Wait for the replay buffer to stop
 }
 
 func TestReplayBufferToggle(t *testing.T) {
+	skipIfSkipReplayBufferTests(t)
+
 	client, disconnect := getClient(t)
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmdStatus := &ReplayBufferStatusCmd{}
 	err := cmdStatus.Run(context)
@@ -82,4 +89,5 @@ func TestReplayBufferToggle(t *testing.T) {
 			t.Fatalf("Expected output to be 'Replay buffer started.', got '%s'", out.String())
 		}
 	}
+	time.Sleep(500 * time.Millisecond) // Wait for the toggle to take effect
 }

scene.go

@@ -5,7 +5,8 @@ import (
 	"slices"
 
 	"github.com/andreykaipov/goobs/api/requests/scenes"
-	"github.com/aquasecurity/table"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
 )
 
 // SceneCmd provides commands to manage scenes in OBS Studio.
@@ -16,25 +17,64 @@ type SceneCmd struct {
 }
 
 // SceneListCmd provides a command to list all scenes.
-type SceneListCmd struct{} // size = 0x0
+type SceneListCmd struct {
+	UUID bool `flag:"" help:"Display UUIDs of scenes."`
+}
 
 // Run executes the command to list all scenes.
+// nolint: misspell
 func (cmd *SceneListCmd) Run(ctx *context) error {
 	scenes, err := ctx.Client.Scenes.GetSceneList()
 	if err != nil {
 		return err
 	}
 
-	t := table.New(ctx.Out)
+	currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
-	t.SetPadding(3)
+	if err != nil {
-	t.SetAlignment(table.AlignLeft, table.AlignLeft)
+		return err
-	t.SetHeaders("Scene Name", "UUID")
+	}
+
+	t := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
+	if cmd.UUID {
+		t.Headers("Scene Name", "Active", "UUID")
+	} else {
+		t.Headers("Scene Name", "Active")
+	}
+	t.StyleFunc(func(row, col int) lipgloss.Style {
+		style := lipgloss.NewStyle().Padding(0, 3)
+		switch col {
+		case 0:
+			style = style.Align(lipgloss.Left)
+		case 1:
+			style = style.Align(lipgloss.Center)
+		case 2:
+			style = style.Align(lipgloss.Left)
+		}
+		switch {
+		case row == table.HeaderRow:
+			style = style.Bold(true).Align(lipgloss.Center)
+		case row%2 == 0:
+			style = style.Foreground(ctx.Style.evenRows)
+		default:
+			style = style.Foreground(ctx.Style.oddRows)
+		}
+		return style
+	})
 
 	slices.Reverse(scenes.Scenes)
 	for _, scene := range scenes.Scenes {
-		t.AddRow(scene.SceneName, scene.SceneUuid)
+		var activeMark string
+		if scene.SceneName == currentScene.SceneName {
+			activeMark = getEnabledMark(true)
+		}
+		if cmd.UUID {
+			t.Row(scene.SceneName, activeMark, scene.SceneUuid)
+		} else {
+			t.Row(scene.SceneName, activeMark)
+		}
 	}
-	t.Render()
+	fmt.Fprintln(ctx.Out, t.Render())
 	return nil
 }
 
@@ -50,13 +90,13 @@ func (cmd *SceneCurrentCmd) Run(ctx *context) error {
 		if err != nil {
 			return err
 		}
-		fmt.Fprintln(ctx.Out, scene.SceneName)
+		fmt.Fprintf(ctx.Out, "Current preview scene: %s\n", ctx.Style.Highlight(scene.SceneName))
 	} else {
 		scene, err := ctx.Client.Scenes.GetCurrentProgramScene()
 		if err != nil {
 			return err
 		}
-		fmt.Fprintln(ctx.Out, scene.SceneName)
+		fmt.Fprintf(ctx.Out, "Current program scene: %s\n", ctx.Style.Highlight(scene.SceneName))
 	}
 	return nil
 }
@@ -76,7 +116,7 @@ func (cmd *SceneSwitchCmd) Run(ctx *context) error {
 			return err
 		}
 
-		fmt.Fprintln(ctx.Out, "Switched to preview scene:", cmd.NewScene)
+		fmt.Fprintf(ctx.Out, "Switched to preview scene: %s\n", ctx.Style.Highlight(cmd.NewScene))
 	} else {
 		_, err := ctx.Client.Scenes.SetCurrentProgramScene(scenes.NewSetCurrentProgramSceneParams().
 			WithSceneName(cmd.NewScene))
@@ -84,7 +124,7 @@ func (cmd *SceneSwitchCmd) Run(ctx *context) error {
 			return err
 		}
 
-		fmt.Fprintln(ctx.Out, "Switched to program scene:", cmd.NewScene)
+		fmt.Fprintf(ctx.Out, "Switched to program scene: %s\n", ctx.Style.Highlight(cmd.NewScene))
 	}
 	return nil
 }

scene_test.go

@@ -2,7 +2,6 @@ package main
 
 import (
 	"bytes"
-	"strings"
 	"testing"
 )
 
@@ -11,18 +10,15 @@ func TestSceneList(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmd := &SceneListCmd{}
 	err := cmd.Run(context)
 	if err != nil {
 		t.Fatalf("Failed to list scenes: %v", err)
 	}
-	if !strings.Contains(out.String(), "gobs-test") {
+	if out.String() == "Current program scene: gobs-test-scene\n" {
-		t.Fatalf("Expected output to contain 'gobs-test', got '%s'", out.String())
+		t.Fatalf("Expected output to be 'Current program scene: gobs-test-scene', got '%s'", out.String())
 	}
 }
 
@@ -31,14 +27,11 @@ func TestSceneCurrent(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
-	// Set the current scene to "gobs-test"
+	// Set the current scene to "gobs-test-scene"
 	cmdSwitch := &SceneSwitchCmd{
-		NewScene: "gobs-test",
+		NewScene: "gobs-test-scene",
 	}
 	err := cmdSwitch.Run(context)
 	if err != nil {
@@ -52,7 +45,7 @@ func TestSceneCurrent(t *testing.T) {
 	if err != nil {
 		t.Fatalf("Failed to get current scene: %v", err)
 	}
-	if out.String() != "gobs-test\n" {
+	if out.String() != "Current program scene: gobs-test-scene\n" {
-		t.Fatalf("Expected output to contain 'gobs-test', got '%s'", out.String())
+		t.Fatalf("Expected output to be 'Current program scene: gobs-test-scene', got '%s'", out.String())
 	}
 }

scenecollection.go

@@ -4,7 +4,8 @@ import (
 	"fmt"
 
 	"github.com/andreykaipov/goobs/api/requests/config"
-	"github.com/aquasecurity/table"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
 )
 
 // SceneCollectionCmd provides commands to manage scene collections in OBS Studio.
@@ -19,21 +20,37 @@ type SceneCollectionCmd struct {
 type SceneCollectionListCmd struct{} // size = 0x0
 
 // Run executes the command to list all scene collections.
+// nolint: misspell
 func (cmd *SceneCollectionListCmd) Run(ctx *context) error {
 	collections, err := ctx.Client.Config.GetSceneCollectionList()
 	if err != nil {
 		return fmt.Errorf("failed to get scene collection list: %w", err)
 	}
 
-	t := table.New(ctx.Out)
+	t := table.New().Border(lipgloss.RoundedBorder()).
-	t.SetPadding(3)
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
-	t.SetAlignment(table.AlignLeft)
+		Headers("Scene Collection Name").
-	t.SetHeaders("Scene Collection Name")
+		StyleFunc(func(row, col int) lipgloss.Style {
+			style := lipgloss.NewStyle().Padding(0, 3)
+			switch col {
+			case 0:
+				style = style.Align(lipgloss.Left)
+			}
+			switch {
+			case row == table.HeaderRow:
+				style = style.Bold(true).Align(lipgloss.Center)
+			case row%2 == 0:
+				style = style.Foreground(ctx.Style.evenRows)
+			default:
+				style = style.Foreground(ctx.Style.oddRows)
+			}
+			return style
+		})
 
 	for _, collection := range collections.SceneCollections {
-		t.AddRow(collection)
+		t.Row(collection)
 	}
-	t.Render()
+	fmt.Fprintln(ctx.Out, t.Render())
 	return nil
 }
 
@@ -65,17 +82,17 @@ func (cmd *SceneCollectionSwitchCmd) Run(ctx *context) error {
 	current := collections.CurrentSceneCollectionName
 
 	if current == cmd.Name {
-		return fmt.Errorf("scene collection %s is already active", cmd.Name)
+		return fmt.Errorf("scene collection %s is already active", ctx.Style.Error(cmd.Name))
 	}
 
 	_, err = ctx.Client.Config.SetCurrentSceneCollection(
 		config.NewSetCurrentSceneCollectionParams().WithSceneCollectionName(cmd.Name),
 	)
 	if err != nil {
-		return fmt.Errorf("failed to switch scene collection: %w", err)
+		return fmt.Errorf("failed to switch scene collection %s: %w", ctx.Style.Error(cmd.Name), err)
 	}
 
-	fmt.Fprintf(ctx.Out, "Switched to scene collection: %s\n", cmd.Name)
+	fmt.Fprintf(ctx.Out, "Switched to scene collection: %s\n", ctx.Style.Highlight(cmd.Name))
 
 	return nil
 }
@@ -91,9 +108,9 @@ func (cmd *SceneCollectionCreateCmd) Run(ctx *context) error {
 		config.NewCreateSceneCollectionParams().WithSceneCollectionName(cmd.Name),
 	)
 	if err != nil {
-		return fmt.Errorf("failed to create scene collection: %w", err)
+		return fmt.Errorf("failed to create scene collection %s: %w", ctx.Style.Error(cmd.Name), err)
 	}
 
-	fmt.Fprintf(ctx.Out, "Created scene collection: %s\n", cmd.Name)
+	fmt.Fprintf(ctx.Out, "Created scene collection: %s\n", ctx.Style.Highlight(cmd.Name))
 	return nil
 }

sceneitem.go

@@ -1,3 +1,4 @@
+// nolint: misspell
 package main
 
 import (
@@ -6,7 +7,8 @@ import (
 
 	"github.com/andreykaipov/goobs"
 	"github.com/andreykaipov/goobs/api/requests/sceneitems"
-	"github.com/aquasecurity/table"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
 )
 
 // SceneItemCmd provides commands to manage scene items in OBS Studio.
@@ -21,7 +23,8 @@ type SceneItemCmd struct {
 
 // SceneItemListCmd provides a command to list all scene items in a scene.
 type SceneItemListCmd struct {
-	SceneName string `arg:"" help:"Name of the scene to list items from." default:""`
+	UUID      bool   `flag:"" help:"Display UUIDs of scene items."`
+	SceneName string `        help:"Name of the scene to list items from." arg:"" default:""`
 }
 
 // Run executes the command to list all scene items in a scene.
@@ -41,14 +44,41 @@ func (cmd *SceneItemListCmd) Run(ctx *context) error {
 	}
 
 	if len(resp.SceneItems) == 0 {
-		fmt.Fprintf(ctx.Out, "No scene items found in scene '%s'.\n", cmd.SceneName)
+		fmt.Fprintf(ctx.Out, "No scene items found in scene %s.\n", ctx.Style.Highlight(cmd.SceneName))
 		return nil
 	}
 
-	t := table.New(ctx.Out)
+	t := table.New().Border(lipgloss.RoundedBorder()).
-	t.SetPadding(3)
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
-	t.SetAlignment(table.AlignCenter, table.AlignLeft, table.AlignCenter, table.AlignCenter)
+	if cmd.UUID {
-	t.SetHeaders("Item ID", "Item Name", "In Group", "Enabled")
+		t.Headers("Item ID", "Item Name", "In Group", "Enabled", "UUID")
+	} else {
+		t.Headers("Item ID", "Item Name", "In Group", "Enabled")
+	}
+	t.StyleFunc(func(row, col int) lipgloss.Style {
+		style := lipgloss.NewStyle().Padding(0, 3)
+		switch col {
+		case 0:
+			style = style.Align(lipgloss.Center)
+		case 1:
+			style = style.Align(lipgloss.Left)
+		case 2:
+			style = style.Align(lipgloss.Center)
+		case 3:
+			style = style.Align(lipgloss.Center)
+		case 4:
+			style = style.Align(lipgloss.Left)
+		}
+		switch {
+		case row == table.HeaderRow:
+			style = style.Bold(true).Align(lipgloss.Center)
+		case row%2 == 0:
+			style = style.Foreground(ctx.Style.evenRows)
+		default:
+			style = style.Foreground(ctx.Style.oddRows)
+		}
+		return style
+	})
 
 	sort.Slice(resp.SceneItems, func(i, j int) bool {
 		return resp.SceneItems[i].SceneItemID < resp.SceneItems[j].SceneItemID
@@ -59,7 +89,11 @@ func (cmd *SceneItemListCmd) Run(ctx *context) error {
 			resp, err := ctx.Client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
 				WithSceneName(item.SourceName))
 			if err != nil {
-				return fmt.Errorf("failed to get group scene item list for '%s': %w", item.SourceName, err)
+				return fmt.Errorf(
+					"failed to get group scene item list for group %s: %w",
+					ctx.Style.Error(item.SourceName),
+					err,
+				)
 			}
 
 			sort.Slice(resp.SceneItems, func(i, j int) bool {
@@ -67,30 +101,45 @@ func (cmd *SceneItemListCmd) Run(ctx *context) error {
 			})
 
 			for _, groupItem := range resp.SceneItems {
-				t.AddRow(
+				if cmd.UUID {
-					fmt.Sprintf("%d", groupItem.SceneItemID),
+					t.Row(
-					groupItem.SourceName,
+						fmt.Sprintf("%d", groupItem.SceneItemID),
-					item.SourceName,
+						groupItem.SourceName,
-					fmt.Sprintf("%t", item.SceneItemEnabled && groupItem.SceneItemEnabled),
+						item.SourceName,
-				)
+						getEnabledMark(item.SceneItemEnabled && groupItem.SceneItemEnabled),
+						groupItem.SourceUuid,
+					)
+				} else {
+					t.Row(
+						fmt.Sprintf("%d", groupItem.SceneItemID),
+						groupItem.SourceName,
+						item.SourceName,
+						getEnabledMark(item.SceneItemEnabled && groupItem.SceneItemEnabled),
+					)
+				}
 			}
 		} else {
-			t.AddRow(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, "", fmt.Sprintf("%t", item.SceneItemEnabled))
+			if cmd.UUID {
+				t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, "",
+					getEnabledMark(item.SceneItemEnabled), item.SourceUuid)
+			} else {
+				t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, "", getEnabledMark(item.SceneItemEnabled))
+			}
 		}
 	}
-	t.Render()
+	fmt.Fprintln(ctx.Out, t.Render())
 	return nil
 }
 
 // getSceneNameAndItemID retrieves the scene name and item ID for a given item in a scene or group.
 func getSceneNameAndItemID(
-	client *goobs.Client,
+	ctx *context,
 	sceneName string,
 	itemName string,
 	group string,
 ) (string, int, error) {
 	if group != "" {
-		resp, err := client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
+		resp, err := ctx.Client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
 			WithSceneName(group))
 		if err != nil {
 			return "", 0, err
@@ -100,13 +149,22 @@ func getSceneNameAndItemID(
 				return group, int(item.SceneItemID), nil
 			}
 		}
-		return "", 0, fmt.Errorf("item '%s' not found in scene '%s'", itemName, sceneName)
+		return "", 0, fmt.Errorf("item %s not found in scene %s", ctx.Style.Error(itemName), ctx.Style.Error(sceneName))
 	}
 
-	itemID, err := client.SceneItems.GetSceneItemId(sceneitems.NewGetSceneItemIdParams().
+	itemID, err := ctx.Client.SceneItems.GetSceneItemId(sceneitems.NewGetSceneItemIdParams().
 		WithSceneName(sceneName).
 		WithSourceName(itemName))
 	if err != nil {
+		if err.Error() == "request GetSceneItemId: ResourceNotFound (600): No scene items were found in the specified scene by that name or offset." {
+			return "", 0, fmt.Errorf(
+				"item %s not found in scene %s. is it in a group? if so use the %s flag to specify the parent group\nuse %s for a list of items in the scene",
+				ctx.Style.Error(itemName),
+				ctx.Style.Error(sceneName),
+				ctx.Style.Error("--group"),
+				ctx.Style.Error("gobs-cli si ls"),
+			)
+		}
 		return "", 0, err
 	}
 	return sceneName, int(itemID.SceneItemId), nil
@@ -122,7 +180,7 @@ type SceneItemShowCmd struct {
 
 // Run executes the command to show a scene item.
 func (cmd *SceneItemShowCmd) Run(ctx *context) error {
-	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
+	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
 	if err != nil {
 		return err
 	}
@@ -136,9 +194,14 @@ func (cmd *SceneItemShowCmd) Run(ctx *context) error {
 	}
 
 	if cmd.Group != "" {
-		fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' is now visible.\n", cmd.ItemName, cmd.Group)
+		fmt.Fprintf(
+			ctx.Out,
+			"Scene item %s in group %s is now visible.\n",
+			ctx.Style.Highlight(cmd.ItemName),
+			ctx.Style.Highlight(cmd.Group),
+		)
 	} else {
-		fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now visible.\n", cmd.ItemName, cmd.SceneName)
+		fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now visible.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
 	}
 
 	return nil
@@ -154,7 +217,7 @@ type SceneItemHideCmd struct {
 
 // Run executes the command to hide a scene item.
 func (cmd *SceneItemHideCmd) Run(ctx *context) error {
-	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
+	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
 	if err != nil {
 		return err
 	}
@@ -168,9 +231,14 @@ func (cmd *SceneItemHideCmd) Run(ctx *context) error {
 	}
 
 	if cmd.Group != "" {
-		fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' is now hidden.\n", cmd.ItemName, cmd.Group)
+		fmt.Fprintf(
+			ctx.Out,
+			"Scene item %s in group %s is now hidden.\n",
+			ctx.Style.Highlight(cmd.ItemName),
+			ctx.Style.Highlight(cmd.Group),
+		)
 	} else {
-		fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now hidden.\n", cmd.ItemName, cmd.SceneName)
+		fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now hidden.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
 	}
 
 	return nil
@@ -197,7 +265,7 @@ type SceneItemToggleCmd struct {
 
 // Run executes the command to toggle the visibility of a scene item.
 func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
-	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
+	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
 	if err != nil {
 		return err
 	}
@@ -216,9 +284,14 @@ func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
 	}
 
 	if itemEnabled {
-		fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now hidden.\n", cmd.ItemName, cmd.SceneName)
+		fmt.Fprintf(
+			ctx.Out,
+			"Scene item %s in scene %s is now hidden.\n",
+			ctx.Style.Highlight(cmd.ItemName),
+			ctx.Style.Highlight(cmd.SceneName),
+		)
 	} else {
-		fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now visible.\n", cmd.ItemName, cmd.SceneName)
+		fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now visible.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
 	}
 
 	return nil
@@ -234,7 +307,7 @@ type SceneItemVisibleCmd struct {
 
 // Run executes the command to check the visibility of a scene item.
 func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
-	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
+	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
 	if err != nil {
 		return err
 	}
@@ -245,9 +318,14 @@ func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
 	}
 
 	if itemEnabled {
-		fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is visible.\n", cmd.ItemName, cmd.SceneName)
+		fmt.Fprintf(
+			ctx.Out,
+			"Scene item %s in scene %s is visible.\n",
+			ctx.Style.Highlight(cmd.ItemName),
+			ctx.Style.Highlight(cmd.SceneName),
+		)
 	} else {
-		fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is hidden.\n", cmd.ItemName, cmd.SceneName)
+		fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is hidden.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
 	}
 	return nil
 }
@@ -278,7 +356,7 @@ type SceneItemTransformCmd struct {
 
 // Run executes the command to transform a scene item.
 func (cmd *SceneItemTransformCmd) Run(ctx *context) error {
-	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
+	sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
 	if err != nil {
 		return err
 	}
@@ -351,9 +429,14 @@ func (cmd *SceneItemTransformCmd) Run(ctx *context) error {
 	}
 
 	if cmd.Group != "" {
-		fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' transformed.\n", cmd.ItemName, cmd.Group)
+		fmt.Fprintf(
+			ctx.Out,
+			"Scene item %s in group %s transformed.\n",
+			ctx.Style.Highlight(cmd.ItemName),
+			ctx.Style.Highlight(cmd.Group),
+		)
 	} else {
-		fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' transformed.\n", cmd.ItemName, cmd.SceneName)
+		fmt.Fprintf(ctx.Out, "Scene item %s in scene %s transformed.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
 	}
 
 	return nil

sceneitem_test.go

@@ -11,13 +11,10 @@ func TestSceneItemList(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmd := &SceneItemListCmd{
-		SceneName: "gobs-test",
+		SceneName: "gobs-test-scene",
 	}
 	err := cmd.Run(context)
 	if err != nil {

screenshot.go

@@ -0,0 +1,41 @@
+package main
+
+import (
+	"fmt"
+	"path/filepath"
+
+	"github.com/andreykaipov/goobs/api/requests/sources"
+)
+
+// ScreenshotCmd provides commands to manage screenshots in OBS Studio.
+type ScreenshotCmd struct {
+	Save ScreenshotSaveCmd `cmd:"" help:"Take a screenshot and save it to a file." aliases:"sv"`
+}
+
+// ScreenshotSaveCmd represents the command to save a screenshot of a source in OBS.
+type ScreenshotSaveCmd struct {
+	SourceName string  `arg:"" help:"Name of the source to take a screenshot of."`
+	FilePath   string  `arg:"" help:"Path to the file where the screenshot will be saved."`
+	Width      float64 `       help:"Width of the screenshot in pixels."                   flag:"" default:"1920"`
+	Height     float64 `       help:"Height of the screenshot in pixels."                  flag:"" default:"1080"`
+	Quality    float64 `       help:"Quality of the screenshot (1-100)."                   flag:"" default:"-1"`
+}
+
+// Run executes the command to take a screenshot and save it to a file.
+func (cmd *ScreenshotSaveCmd) Run(ctx *context) error {
+	_, err := ctx.Client.Sources.SaveSourceScreenshot(
+		sources.NewSaveSourceScreenshotParams().
+			WithSourceName(cmd.SourceName).
+			WithImageFormat(trimPrefix(filepath.Ext(cmd.FilePath), ".")).
+			WithImageFilePath(cmd.FilePath).
+			WithImageWidth(cmd.Width).
+			WithImageHeight(cmd.Height).
+			WithImageCompressionQuality(cmd.Quality),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to take screenshot: %w", err)
+	}
+
+	fmt.Fprintf(ctx.Out, "Screenshot saved to %s.\n", ctx.Style.Highlight(cmd.FilePath))
+	return nil
+}

settings.go

@@ -0,0 +1,334 @@
+package main
+
+import (
+	"fmt"
+
+	"github.com/andreykaipov/goobs/api/requests/config"
+	"github.com/andreykaipov/goobs/api/typedefs"
+	"github.com/charmbracelet/lipgloss"
+	"github.com/charmbracelet/lipgloss/table"
+)
+
+// SettingsCmd handles settings management.
+type SettingsCmd struct {
+	Show          SettingsShowCmd          `help:"Show settings."                     cmd:"" aliases:"s"`
+	Profile       SettingsProfileCmd       `help:"Get/Set profile parameter setting." cmd:"" aliases:"p"`
+	StreamService SettingsStreamServiceCmd `help:"Get/Set stream service setting."    cmd:"" aliases:"ss"`
+	Video         SettingsVideoCmd         `help:"Get/Set video setting."             cmd:"" aliases:"v"`
+}
+
+// SettingsShowCmd shows the video settings.
+type SettingsShowCmd struct {
+	Video   bool `flag:"" help:"Show video settings."`
+	Record  bool `flag:"" help:"Show record directory."`
+	Profile bool `flag:"" help:"Show profile parameters."`
+}
+
+// Run executes the show command.
+// nolint: misspell
+func (cmd *SettingsShowCmd) Run(ctx *context) error {
+	if !cmd.Video && !cmd.Record && !cmd.Profile {
+		cmd.Video = true
+		cmd.Record = true
+		cmd.Profile = true
+	}
+
+	// Get video settings
+	videoResp, err := ctx.Client.Config.GetVideoSettings()
+	if err != nil {
+		return fmt.Errorf("failed to get video settings: %w", err)
+	}
+
+	vt := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
+		Headers("Video Setting", "Value").
+		StyleFunc(func(row, _ int) lipgloss.Style {
+			style := lipgloss.NewStyle().Padding(0, 3)
+			switch {
+			case row == table.HeaderRow:
+				style = style.Bold(true).Align(lipgloss.Center)
+			case row%2 == 0:
+				style = style.Foreground(ctx.Style.evenRows)
+			default:
+				style = style.Foreground(ctx.Style.oddRows)
+			}
+			return style
+		})
+
+	vt.Row("Base Width", fmt.Sprintf("%.0f", videoResp.BaseWidth))
+	vt.Row("Base Height", fmt.Sprintf("%.0f", videoResp.BaseHeight))
+	vt.Row("Output Width", fmt.Sprintf("%.0f", videoResp.OutputWidth))
+	vt.Row("Output Height", fmt.Sprintf("%.0f", videoResp.OutputHeight))
+	vt.Row("FPS Numerator", fmt.Sprintf("%.0f", videoResp.FpsNumerator))
+	vt.Row("FPS Denominator", fmt.Sprintf("%.0f", videoResp.FpsDenominator))
+
+	// Get record directory
+	dirResp, err := ctx.Client.Config.GetRecordDirectory()
+	if err != nil {
+		return fmt.Errorf("failed to get record directory: %w", err)
+	}
+
+	rt := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
+		Headers("Record Setting", "Value").
+		StyleFunc(func(row, _ int) lipgloss.Style {
+			style := lipgloss.NewStyle().Padding(0, 3)
+			switch {
+			case row == table.HeaderRow:
+				style = style.Bold(true).Align(lipgloss.Center)
+			case row%2 == 0:
+				style = style.Foreground(ctx.Style.evenRows)
+			default:
+				style = style.Foreground(ctx.Style.oddRows)
+			}
+			return style
+		})
+
+	rt.Row("Directory", dirResp.RecordDirectory)
+
+	// Get profile prameters
+	pt := table.New().Border(lipgloss.RoundedBorder()).
+		BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
+		Headers("Profile Parameter", "Value").
+		StyleFunc(func(row, _ int) lipgloss.Style {
+			style := lipgloss.NewStyle().Padding(0, 3)
+			switch {
+			case row == table.HeaderRow:
+				style = style.Bold(true).Align(lipgloss.Center)
+			case row%2 == 0:
+				style = style.Foreground(ctx.Style.evenRows)
+			default:
+				style = style.Foreground(ctx.Style.oddRows)
+			}
+			return style
+		})
+
+	// Common profile parameters to display
+	params := []struct {
+		category string
+		name     string
+		label    string
+	}{
+		{"Output", "Mode", "Output Mode"},
+
+		{"SimpleOutput", "StreamEncoder", "Simple Streaming Encoder"},
+		{"SimpleOutput", "RecEncoder", "Simple Recording Encoder"},
+		{"SimpleOutput", "RecFormat2", "Simple Recording Video Format"},
+		{"SimpleOutput", "RecAudioEncoder", "Simple Recording Audio Format"},
+		{"SimpleOutput", "RecQuality", "Simple Recording Quality"},
+
+		{"AdvOut", "Encoder", "Advanced Streaming Encoder"},
+		{"AdvOut", "RecEncoder", "Advanced Recording Encoder"},
+		{"AdvOut", "RecType", "Advanced Recording Type"},
+		{"AdvOut", "RecFormat2", "Advanced Recording Video Format"},
+		{"AdvOut", "RecAudioEncoder", "Advanced Recording Audio Format"},
+	}
+
+	for _, param := range params {
+		resp, err := ctx.Client.Config.GetProfileParameter(
+			config.NewGetProfileParameterParams().
+				WithParameterCategory(param.category).
+				WithParameterName(param.name),
+		)
+		if err == nil && resp.ParameterValue != "" {
+			pt.Row(param.label, resp.ParameterValue)
+		}
+	}
+
+	if cmd.Video {
+		fmt.Fprintln(ctx.Out, vt.Render())
+	}
+
+	if cmd.Record {
+		fmt.Fprintln(ctx.Out, rt.Render())
+	}
+
+	if cmd.Profile {
+		fmt.Fprintln(ctx.Out, pt.Render())
+	}
+
+	return nil
+}
+
+// SettingsProfileCmd gets/ sets a profile parameter.
+type SettingsProfileCmd struct {
+	Category string `arg:"" help:"Parameter category (e.g., AdvOut, SimpleOutput, Output)." required:""`
+	Name     string `arg:"" help:"Parameter name (e.g., RecFormat2, RecEncoder)."           required:""`
+	Value    string `arg:"" help:"Parameter value to set."                                              optional:""`
+}
+
+// Run executes the set command.
+func (cmd *SettingsProfileCmd) Run(ctx *context) error {
+	if cmd.Value == "" {
+		resp, err := ctx.Client.Config.GetProfileParameter(
+			config.NewGetProfileParameterParams().
+				WithParameterCategory(cmd.Category).
+				WithParameterName(cmd.Name),
+		)
+		if err != nil {
+			return fmt.Errorf("failed to get parameter %s.%s: %w", cmd.Category, cmd.Name, err)
+		}
+
+		fmt.Fprintf(ctx.Out, "%s.%s = %s\n", cmd.Category, cmd.Name, resp.ParameterValue)
+		return nil
+	}
+
+	_, err := ctx.Client.Config.SetProfileParameter(
+		config.NewSetProfileParameterParams().
+			WithParameterCategory(cmd.Category).
+			WithParameterName(cmd.Name).
+			WithParameterValue(cmd.Value),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to set parameter %s.%s: %w", cmd.Category, cmd.Name, err)
+	}
+
+	fmt.Fprintf(ctx.Out, "Set %s.%s = %s\n", cmd.Category, cmd.Name, cmd.Value)
+	return nil
+}
+
+// SettingsStreamServiceCmd gets/ sets stream service settings.
+type SettingsStreamServiceCmd struct {
+	Type   string `arg:"" help:"Stream type (e.g., rtmp_common, rtmp_custom)." optional:""`
+	Key    string `       help:"Stream key."                                               flag:""`
+	Server string `       help:"Stream server URL."                                        flag:""`
+}
+
+// Run executes the set stream service command.
+// nolint: misspell
+func (cmd *SettingsStreamServiceCmd) Run(ctx *context) error {
+	resp, err := ctx.Client.Config.GetStreamServiceSettings()
+	if err != nil {
+		return fmt.Errorf("failed to get stream service settings: %w", err)
+	}
+
+	if cmd.Type == "" {
+		t := table.New().Border(lipgloss.RoundedBorder()).
+			BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
+			Headers("Stream Service Setting", "Value").
+			StyleFunc(func(row, _ int) lipgloss.Style {
+				style := lipgloss.NewStyle().Padding(0, 3)
+				switch {
+				case row == table.HeaderRow:
+					style = style.Bold(true).Align(lipgloss.Center)
+				case row%2 == 0:
+					style = style.Foreground(ctx.Style.evenRows)
+				default:
+					style = style.Foreground(ctx.Style.oddRows)
+				}
+				return style
+			})
+
+		t.Row("Type", resp.StreamServiceType)
+		t.Row("Key", resp.StreamServiceSettings.Key)
+		t.Row("Server", resp.StreamServiceSettings.Server)
+
+		fmt.Fprintln(ctx.Out, t.Render())
+		return nil
+	}
+
+	if cmd.Key == "" {
+		cmd.Key = resp.StreamServiceSettings.Key
+	}
+	if cmd.Server == "" {
+		cmd.Server = resp.StreamServiceSettings.Server
+	}
+
+	_, err = ctx.Client.Config.SetStreamServiceSettings(
+		config.NewSetStreamServiceSettingsParams().
+			WithStreamServiceSettings(&typedefs.StreamServiceSettings{
+				Key:    cmd.Key,
+				Server: cmd.Server,
+			}).
+			WithStreamServiceType(cmd.Type),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to set stream service settings: %w", err)
+	}
+
+	fmt.Fprintln(ctx.Out, "Stream service settings updated successfully.")
+	return nil
+}
+
+// SettingsVideoCmd gets/ sets video settings.
+type SettingsVideoCmd struct {
+	BaseWidth    int `flag:"" help:"Base (canvas) width."           min:"8"`
+	BaseHeight   int `flag:"" help:"Base (canvas) height."          min:"8"`
+	OutputWidth  int `flag:"" help:"Output (scaled) width."         min:"8"`
+	OutputHeight int `flag:"" help:"Output (scaled) height."        min:"8"`
+	FPSNum       int `flag:"" help:"Frames per second numerator."   min:"1"`
+	FPSDen       int `flag:"" help:"Frames per second denominator." min:"1"`
+}
+
+// Run executes the gets/ set video command.
+// nolint: misspell
+func (cmd *SettingsVideoCmd) Run(ctx *context) error {
+	resp, err := ctx.Client.Config.GetVideoSettings()
+	if err != nil {
+		return fmt.Errorf("failed to get video settings: %w", err)
+	}
+
+	if cmd.BaseWidth == 0 && cmd.BaseHeight == 0 && cmd.OutputWidth == 0 &&
+		cmd.OutputHeight == 0 && cmd.FPSNum == 0 && cmd.FPSDen == 0 {
+		t := table.New().Border(lipgloss.RoundedBorder()).
+			BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
+			Headers("Video Setting", "Value").
+			StyleFunc(func(row, _ int) lipgloss.Style {
+				style := lipgloss.NewStyle().Padding(0, 3)
+				switch {
+				case row == table.HeaderRow:
+					style = style.Bold(true).Align(lipgloss.Center)
+				case row%2 == 0:
+					style = style.Foreground(ctx.Style.evenRows)
+				default:
+					style = style.Foreground(ctx.Style.oddRows)
+				}
+				return style
+			})
+
+		t.Row("Base Width", fmt.Sprintf("%.0f", resp.BaseWidth))
+		t.Row("Base Height", fmt.Sprintf("%.0f", resp.BaseHeight))
+		t.Row("Output Width", fmt.Sprintf("%.0f", resp.OutputWidth))
+		t.Row("Output Height", fmt.Sprintf("%.0f", resp.OutputHeight))
+		t.Row("FPS Numerator", fmt.Sprintf("%.0f", resp.FpsNumerator))
+		t.Row("FPS Denominator", fmt.Sprintf("%.0f", resp.FpsDenominator))
+
+		fmt.Fprintln(ctx.Out, t.Render())
+		return nil
+	}
+
+	if cmd.BaseWidth == 0 {
+		cmd.BaseWidth = int(resp.BaseWidth)
+	}
+	if cmd.BaseHeight == 0 {
+		cmd.BaseHeight = int(resp.BaseHeight)
+	}
+	if cmd.OutputWidth == 0 {
+		cmd.OutputWidth = int(resp.OutputWidth)
+	}
+	if cmd.OutputHeight == 0 {
+		cmd.OutputHeight = int(resp.OutputHeight)
+	}
+	if cmd.FPSNum == 0 {
+		cmd.FPSNum = int(resp.FpsNumerator)
+	}
+	if cmd.FPSDen == 0 {
+		cmd.FPSDen = int(resp.FpsDenominator)
+	}
+
+	_, err = ctx.Client.Config.SetVideoSettings(
+		config.NewSetVideoSettingsParams().
+			WithBaseWidth(float64(cmd.BaseWidth)).
+			WithBaseHeight(float64(cmd.BaseHeight)).
+			WithOutputWidth(float64(cmd.OutputWidth)).
+			WithOutputHeight(float64(cmd.OutputHeight)).
+			WithFpsNumerator(float64(cmd.FPSNum)).
+			WithFpsDenominator(float64(cmd.FPSDen)),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to set video settings: %w", err)
+	}
+
+	fmt.Fprintln(ctx.Out, "Video settings updated successfully.")
+	return nil
+}

stream_test.go

@@ -12,10 +12,7 @@ func TestStreamStart(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmdStatus := &StreamStatusCmd{}
 	err := cmdStatus.Run(context)
@@ -46,7 +43,7 @@ func TestStreamStart(t *testing.T) {
 	if out.String() != "Stream started successfully.\n" {
 		t.Fatalf("Expected output to contain 'Stream started successfully.', got '%s'", out.String())
 	}
-	time.Sleep(2 * time.Second) // Wait for the stream to start
+	time.Sleep(500 * time.Millisecond) // Wait for the stream to start
 }
 
 func TestStreamStop(t *testing.T) {
@@ -54,10 +51,7 @@ func TestStreamStop(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmdStatus := &StreamStatusCmd{}
 	err := cmdStatus.Run(context)
@@ -88,7 +82,7 @@ func TestStreamStop(t *testing.T) {
 	if out.String() != "Stream stopped successfully.\n" {
 		t.Fatalf("Expected output to contain 'Stream stopped successfully.', got '%s'", out.String())
 	}
-	time.Sleep(2 * time.Second) // Wait for the stream to stop
+	time.Sleep(500 * time.Millisecond) // Wait for the stream to stop
 }
 
 func TestStreamToggle(t *testing.T) {
@@ -96,10 +90,7 @@ func TestStreamToggle(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmdStatus := &StreamStatusCmd{}
 	err := cmdStatus.Run(context)
@@ -128,5 +119,5 @@ func TestStreamToggle(t *testing.T) {
 			t.Fatalf("Expected 'Stream started successfully.', got: %s", out.String())
 		}
 	}
-	time.Sleep(2 * time.Second) // Wait for the stream to toggle
+	time.Sleep(500 * time.Millisecond) // Wait for the stream to toggle
 }

studiomode_test.go

@@ -10,10 +10,7 @@ func TestStudioModeEnable(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmdEnable := &StudioModeEnableCmd{}
 	err := cmdEnable.Run(context)
@@ -41,10 +38,7 @@ func TestStudioModeDisable(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmdDisable := &StudioModeDisableCmd{}
 	err := cmdDisable.Run(context)

style.go

@@ -0,0 +1,192 @@
+// nolint: misspell
+package main
+
+import (
+	"fmt"
+	"os"
+
+	"github.com/charmbracelet/lipgloss"
+)
+
+// Style defines colours for the table styles.
+type Style struct {
+	name      string
+	border    lipgloss.Color
+	oddRows   lipgloss.Color
+	evenRows  lipgloss.Color
+	highlight lipgloss.Color
+}
+
+// Highlight applies the highlight style to the given text.
+func (s *Style) Highlight(text string) string {
+	return lipgloss.NewStyle().Foreground(s.highlight).Render(text)
+}
+
+func (s *Style) Error(text string) string {
+	return lipgloss.NewStyle().Foreground(lipgloss.Color("#FF0000")).Render(text) // Red for errors
+}
+
+func newRedStyle() Style {
+	return Style{
+		name:      "red",
+		border:    lipgloss.Color("#D32F2F"), // Strong red for border
+		oddRows:   lipgloss.Color("#FFCDD2"), // Very light red for odd rows
+		evenRows:  lipgloss.Color("#EF9A9A"), // Light red for even rows
+		highlight: lipgloss.Color("#EF9A9A"), // Highlight in light red
+	}
+}
+
+func newMagentaStyle() Style {
+	return Style{
+		name:      "magenta",
+		border:    lipgloss.Color("#C2185B"), // Strong magenta for border
+		oddRows:   lipgloss.Color("#F8BBD0"), // Very light magenta/pink for odd rows
+		evenRows:  lipgloss.Color("#F48FB1"), // Light magenta/pink for even rows
+		highlight: lipgloss.Color("#F48FB1"), // Highlight in light magenta/pink
+	}
+}
+
+func newPurpleStyle() Style {
+	return Style{
+		name:      "purple",
+		border:    lipgloss.Color("#7B1FA2"), // Strong purple for border
+		oddRows:   lipgloss.Color("#E1BEE7"), // Very light purple for odd rows
+		evenRows:  lipgloss.Color("#CE93D8"), // Light purple for even rows
+		highlight: lipgloss.Color("#CE93D8"), // Highlight in light purple
+	}
+}
+
+func newBlueStyle() Style {
+	return Style{
+		name:      "blue",
+		border:    lipgloss.Color("#1976D2"), // Medium blue for border
+		oddRows:   lipgloss.Color("#E3F2FD"), // Very light blue for odd rows
+		evenRows:  lipgloss.Color("#BBDEFB"), // Light blue for even rows
+		highlight: lipgloss.Color("#1976D2"), // Highlight in medium blue
+	}
+}
+
+func newCyanStyle() Style {
+	return Style{
+		name:      "cyan",
+		border:    lipgloss.Color("#00BFCF"), // A strong cyan for border
+		oddRows:   lipgloss.Color("#E0F7FA"), // Very light cyan for odd rows
+		evenRows:  lipgloss.Color("#B2EBF2"), // Slightly darker light cyan for even rows
+		highlight: lipgloss.Color("#00BFCF"), // Highlight in strong cyan
+	}
+}
+
+func newGreenStyle() Style {
+	return Style{
+		name:      "green",
+		border:    lipgloss.Color("#43A047"), // Medium green for border
+		oddRows:   lipgloss.Color("#E8F5E9"), // Very light green for odd rows
+		evenRows:  lipgloss.Color("#C8E6C9"), // Light green for even rows
+		highlight: lipgloss.Color("#43A047"), // Highlight in medium green
+	}
+}
+
+func newYellowStyle() Style {
+	return Style{
+		name:      "yellow",
+		border:    lipgloss.Color("#FBC02D"), // Strong yellow for border
+		oddRows:   lipgloss.Color("#FFF9C4"), // Very light yellow for odd rows
+		evenRows:  lipgloss.Color("#FFF59D"), // Light yellow for even rows
+		highlight: lipgloss.Color("#FBC02D"), // Highlight in strong yellow
+	}
+}
+
+func newOrangeStyle() Style {
+	return Style{
+		name:      "orange",
+		border:    lipgloss.Color("#F57C00"), // Strong orange for border
+		oddRows:   lipgloss.Color("#FFF3E0"), // Very light orange for odd rows
+		evenRows:  lipgloss.Color("#FFE0B2"), // Light orange for even rows
+		highlight: lipgloss.Color("#F57C00"), // Highlight in strong orange
+	}
+}
+
+func newWhiteStyle() Style {
+	return Style{
+		name:      "white",
+		border:    lipgloss.Color("#FFFFFF"), // White for border
+		oddRows:   lipgloss.Color("#F0F0F0"), // Very light grey for odd rows
+		evenRows:  lipgloss.Color("#E0E0E0"), // Light grey for even rows
+		highlight: lipgloss.Color("#FFFFFF"), // Highlight in white
+	}
+}
+
+func newGreyStyle() Style {
+	return Style{
+		name:      "grey",
+		border:    lipgloss.Color("#9E9E9E"), // Medium grey for border
+		oddRows:   lipgloss.Color("#F5F5F5"), // Very light grey for odd rows
+		evenRows:  lipgloss.Color("#EEEEEE"), // Light grey for even rows
+		highlight: lipgloss.Color("#9E9E9E"), // Highlight in medium grey
+	}
+}
+
+func newNavyBlueStyle() Style {
+	return Style{
+		name:      "navy",
+		border:    lipgloss.Color("#001F3F"), // Navy blue for border
+		oddRows:   lipgloss.Color("#CFE2F3"), // Very light blue for odd rows
+		evenRows:  lipgloss.Color("#A9CCE3"), // Light blue for even rows
+		highlight: lipgloss.Color("#001F3F"), // Highlight in navy blue
+	}
+}
+
+func newBlackStyle() Style {
+	return Style{
+		name:      "black",
+		border:    lipgloss.Color("#000000"), // Black for border
+		oddRows:   lipgloss.Color("#333333"), // Dark grey for odd rows
+		evenRows:  lipgloss.Color("#444444"), // Slightly lighter dark grey for even rows
+		highlight: lipgloss.Color("#000000"), // Highlight in black
+	}
+}
+
+func styleFromFlag(cfg StyleConfig) *Style {
+	var style Style
+
+	switch cfg.Style {
+	case "red":
+		style = newRedStyle()
+	case "magenta":
+		style = newMagentaStyle()
+	case "purple":
+		style = newPurpleStyle()
+	case "blue":
+		style = newBlueStyle()
+	case "cyan":
+		style = newCyanStyle()
+	case "green":
+		style = newGreenStyle()
+	case "yellow":
+		style = newYellowStyle()
+	case "orange":
+		style = newOrangeStyle()
+	case "white":
+		style = newWhiteStyle()
+	case "grey":
+		style = newGreyStyle()
+	case "navy":
+		style = newNavyBlueStyle()
+	case "black":
+		style = newBlackStyle()
+	default:
+		err := os.Setenv("NO_COLOR", "1") // nolint: misspell
+		if err != nil {
+			// If we can't set NO_COLOR, we just log the error and continue
+			// This is a fallback to ensure that the application can still run
+			fmt.Fprintf(os.Stderr, "Error setting NO_COLOR: %v\n", err)
+		}
+	}
+
+	// If noBorder is true, we disable the border styling
+	if cfg.NoBorder {
+		style.border = ""
+	}
+
+	return &style
+}

text.go

@@ -0,0 +1,85 @@
+package main
+
+import (
+	"fmt"
+	"strings"
+
+	"github.com/andreykaipov/goobs/api/requests/inputs"
+)
+
+// TextCmd provides commands for managing text inputs in OBS.
+type TextCmd struct {
+	Current TextCurrentCmd `cmd:"current" help:"Display current text for a text input." aliases:"c"`
+	Update  TextUpdateCmd  `cmd:"update"  help:"Update the text of a text input."       aliases:"u"`
+}
+
+// TextCurrentCmd provides a command to display the current text of a text input.
+type TextCurrentCmd struct {
+	InputName string `arg:"" help:"Name of the text source."`
+}
+
+// Run executes the command to display the current text of a text input.
+func (cmd *TextCurrentCmd) Run(ctx *context) error {
+	resp, err := ctx.Client.Inputs.GetInputSettings(
+		inputs.NewGetInputSettingsParams().WithInputName(cmd.InputName),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to get input settings: %w", err)
+	}
+
+	// Check if the input is a text input
+	kind := resp.InputKind
+	if !strings.HasPrefix(kind, "text_") {
+		return fmt.Errorf("input %s is of %s", cmd.InputName, kind)
+	}
+
+	currentText, ok := resp.InputSettings["text"]
+	if !ok {
+		return fmt.Errorf("input %s does not have a 'text' setting", cmd.InputName)
+	}
+	if currentText == "" {
+		currentText = "(empty)"
+	}
+	fmt.Fprintf(
+		ctx.Out,
+		"Current text for source %s: %s\n",
+		ctx.Style.Highlight(cmd.InputName),
+		currentText,
+	)
+	return nil
+}
+
+// TextUpdateCmd provides a command to update the text of a text input.
+type TextUpdateCmd struct {
+	InputName string `arg:"" help:"Name of the text source."`
+	NewText   string `arg:"" help:"New text to set for the source." default:""`
+}
+
+// Run executes the command to update the text of a text input.
+func (cmd *TextUpdateCmd) Run(ctx *context) error {
+	resp, err := ctx.Client.Inputs.GetInputSettings(
+		inputs.NewGetInputSettingsParams().WithInputName(cmd.InputName),
+	)
+	if err != nil {
+		return fmt.Errorf("failed to get input settings: %w", err)
+	}
+
+	// Check if the input is a text input
+	kind := resp.InputKind
+	if !strings.HasPrefix(kind, "text_") {
+		return fmt.Errorf("input %s is of %s", cmd.InputName, kind)
+	}
+
+	if _, err := ctx.Client.Inputs.SetInputSettings(&inputs.SetInputSettingsParams{
+		InputName:     &cmd.InputName,
+		InputSettings: map[string]any{"text": &cmd.NewText},
+	}); err != nil {
+		return fmt.Errorf("failed to update text for source %s: %w", cmd.InputName, err)
+	}
+
+	if cmd.NewText == "" {
+		cmd.NewText = "(empty)"
+	}
+	fmt.Fprintf(ctx.Out, "Updated text for source %s to: %s\n", ctx.Style.Highlight(cmd.InputName), cmd.NewText)
+	return nil
+}

util.go

@@ -2,7 +2,12 @@
 
 package main
 
-import "strings"
+import (
+	"fmt"
+	"os"
+	"strings"
+	"time"
+)
 
 func snakeCaseToTitleCase(snake string) string {
 	words := strings.Split(snake, "_")
@@ -16,7 +21,58 @@ func snakeCaseToTitleCase(snake string) string {
 
 func getEnabledMark(enabled bool) string {
 	if enabled {
-		return "\u2713" // green check mark
+		if os.Getenv("NO_COLOR") != "" { // nolint: misspell
+			return "✓"
+		}
+		return "✅"
 	}
-	return "\u274c" // red cross mark
+	if os.Getenv("NO_COLOR") != "" { // nolint: misspell
+		return "✗"
+	}
+	return "❌"
+}
+
+func trimPrefix(s, prefix string) string {
+	if strings.HasPrefix(s, prefix) {
+		return s[len(prefix):]
+	}
+	return s
+}
+
+func parseTimeStringToMilliseconds(timeStr string) (float64, error) {
+	parts := strings.Split(timeStr, ":")
+	var durationStr string
+
+	switch len(parts) {
+	case 1:
+		// Format: SS -> "SSs"
+		durationStr = parts[0] + "s"
+	case 2:
+		// Format: MM:SS -> "MMmSSs"
+		durationStr = parts[0] + "m" + parts[1] + "s"
+	case 3:
+		// Format: HH:MM:SS -> "HHhMMmSSs"
+		durationStr = parts[0] + "h" + parts[1] + "m" + parts[2] + "s"
+	default:
+		return 0, fmt.Errorf("invalid time format: %s", timeStr)
+	}
+
+	duration, err := time.ParseDuration(durationStr)
+	if err != nil {
+		return 0, fmt.Errorf("failed to parse duration: %w", err)
+	}
+
+	return duration.Seconds() * 1000, nil
+}
+
+func formatMillisecondsToTimeString(ms float64) string {
+	totalSeconds := int(ms / 1000)
+	hours := totalSeconds / 3600
+	minutes := (totalSeconds % 3600) / 60
+	seconds := totalSeconds % 60
+
+	if hours > 0 {
+		return fmt.Sprintf("%02d:%02d:%02d", hours, minutes, seconds)
+	}
+	return fmt.Sprintf("%02d:%02d", minutes, seconds)
 }

version.go

@@ -2,28 +2,8 @@ package main
 
 import (
 	"fmt"
-
-	"github.com/alecthomas/kong"
 )
 
-var version = "unknown"
-
-// VersionFlag is a custom flag type for displaying version information.
-type VersionFlag string
-
-// Decode implements the kong.Flag interface for VersionFlag.
-func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil }
-
-// IsBool implements the kong.Flag interface for VersionFlag.
-func (v VersionFlag) IsBool() bool { return true }
-
-// BeforeApply implements the kong.Flag interface for VersionFlag.
-func (v VersionFlag) BeforeApply(app *kong.Kong, _ kong.Vars) error { // nolint: unparam
-	fmt.Printf("gobs-cli version: %s\n", version)
-	app.Exit(0) // Exit the application after printing the version
-	return nil
-}
-
 // ObsVersionCmd handles the version command.
 type ObsVersionCmd struct{} // size = 0x0
 

version_test.go

@@ -11,10 +11,7 @@ func TestVersion(t *testing.T) {
 	defer disconnect()
 
 	var out bytes.Buffer
-	context := &context{
+	context := newContext(client, &out, StyleConfig{})
-		Client: client,
-		Out:    &out,
-	}
 
 	cmd := &ObsVersionCmd{}
 	err := cmd.Run(context)