mirror of
https://github.com/onyx-and-iris/gobs-cli.git
synced 2026-04-20 08:03:40 +00:00
Compare commits
71 Commits
v0.10.1
...
072afc86dd
| Author | SHA1 | Date | |
|---|---|---|---|
| 072afc86dd | |||
| 6a629ec3e9 | |||
| 7855ce5d54 | |||
| 6e94157c15 | |||
| cbd518ca0f | |||
| 2f0f9bd904 | |||
| 88d41fd700 | |||
| eab9303af7 | |||
| 031d03a625 | |||
| f84e126381 | |||
| cb4898f2d4 | |||
| a652b44992 | |||
| f6fbf3c81f | |||
| f84908f668 | |||
| 3ffdf668ff | |||
| 6e37c2c6c7 | |||
| bc6cf46b98 | |||
| 51224583c8 | |||
| 6cdc12790a | |||
| 8a5ce67ba0 | |||
| 474693e0f7 | |||
| a960c9ffa5 | |||
| 8ce8727a0a | |||
|
|
fba7c4ce20 | ||
| 1cf983a647 | |||
| dbc26bf6ff | |||
|
|
c5e7bb4e1a | ||
|
|
e087fdefe3 | ||
|
|
bd4a6cad4b | ||
|
|
72fc7d4092 | ||
|
|
cb735cd666 | ||
|
|
db70f8766d | ||
| 101c7552b2 | |||
| 1c0ef025c1 | |||
| 2b7b8e0bd5 | |||
| 040ece840c | |||
| c6406888a9 | |||
| f65af8298d | |||
| 1dfb6f87ac | |||
| 866aedde7c | |||
| 9eb6c8a282 | |||
| eb30cae5b7 | |||
| e6c03a2c92 | |||
| f6b82383f9 | |||
| 55f3b0c981 | |||
| 7da80a1ad2 | |||
| ea4ca2aeb9 | |||
| d2f0a64180 | |||
| f01fd0ca84 | |||
| 10d50df445 | |||
| 06cefe58ed | |||
| 7cd1c78f6a | |||
| 842d98edd3 | |||
| 930b387b85 | |||
| 2ab1c5bfc3 | |||
| 08f23fe47d | |||
| bbc6aec230 | |||
| 5d0ed2a166 | |||
| 62579b1c5e | |||
| 9ed00cd67c | |||
| 69bfaf694d | |||
| 7147c3f1ca | |||
| d699939298 | |||
| 82c0756dde | |||
| 4395c981c6 | |||
| dc043b5847 | |||
| c8a055fa28 | |||
| d9c0e40d8f | |||
| 42ab45b9fb | |||
| 27c3c5369b | |||
| 0a0c75ae51 |
30
.github/workflows/update-go-modules.yml
vendored
Normal file
30
.github/workflows/update-go-modules.yml
vendored
Normal file
@@ -0,0 +1,30 @@
|
||||
name: Auto-Update Go Modules
|
||||
|
||||
on:
|
||||
schedule:
|
||||
- cron: '0 0 * * 1' # Runs every Monday at midnight
|
||||
|
||||
jobs:
|
||||
update-go-modules:
|
||||
runs-on: ubuntu-latest
|
||||
permissions:
|
||||
contents: write
|
||||
|
||||
steps:
|
||||
- name: Checkout Code
|
||||
uses: actions/checkout@v4
|
||||
|
||||
- name: Set up Go
|
||||
uses: actions/setup-go@v5
|
||||
with:
|
||||
go-version: stable
|
||||
|
||||
- name: Update Dependencies
|
||||
run: |
|
||||
go get -u ./...
|
||||
go mod tidy
|
||||
git config user.name "github-actions[bot]"
|
||||
git config user.email "github-actions[bot]@users.noreply.github.com"
|
||||
git add go.mod go.sum
|
||||
git commit -m "chore: auto-update Go modules"
|
||||
git push
|
||||
88
CHANGELOG.md
88
CHANGELOG.md
@@ -5,7 +5,89 @@ All notable changes to this project will be documented in this file.
|
||||
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
||||
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
||||
|
||||
# [0.10.1] - 2025-06-04
|
||||
# [0.18.2] - 2026-01-23
|
||||
|
||||
### Added
|
||||
|
||||
- support for shell completion, see [Shell Completion](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#shell-completion)
|
||||
|
||||
### Changed
|
||||
|
||||
- emoji-style ✅, ❌ replaced with cleaner ●, ○. See [Style](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#style)
|
||||
|
||||
# [0.17.0] - 2026-01-09
|
||||
|
||||
### Added
|
||||
|
||||
- media command group, see [MediaCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#mediacmd)
|
||||
|
||||
# [0.16.2] - 2026-01-08
|
||||
|
||||
### Added
|
||||
|
||||
- new subcommands added to input, see [InputCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#inputcmd)
|
||||
- settings command group, see [SettingsCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#settingscmd)
|
||||
|
||||
# [0.14.1] - 2025-07-14
|
||||
|
||||
### Added
|
||||
|
||||
- text command group, see [TextCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#textcmd)
|
||||
|
||||
# [0.13.3] - 2025-06-27
|
||||
|
||||
### Changed
|
||||
|
||||
- usage is now printed on errors.
|
||||
- help is printed in compact mode. This should make it easier to page through help on the root command.
|
||||
|
||||
### Fixed
|
||||
|
||||
- Item ID alignment in sceneitem list table.
|
||||
|
||||
# [0.13.0] - 2025-06-23
|
||||
|
||||
### Added
|
||||
|
||||
- record split and record chapter commands, see [RecordCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#recordcmd)
|
||||
- As of OBS 30.2.0, the only file format supporting *record chapter* is Hybrid MP4.
|
||||
|
||||
# [0.12.1] - 2025-06-21
|
||||
|
||||
### Added
|
||||
|
||||
- Various colouring styles, see [Style](https://github.com/onyx-and-iris/gobs-cli/tree/main?tab=readme-ov-file#style)
|
||||
- colouring is applied to list tables as well as highlighted information in stdout/stderr output.
|
||||
- table border styling may be optionally disabled with the --no-border flag.
|
||||
|
||||
### Changed
|
||||
|
||||
- if an itemName is passed to a sceneitem command that's in a group, without the --group flag, a friendlier error message is displayed.
|
||||
- it will suggest using *gobs-cli si ls* to list sources in the scene.
|
||||
- if an invalid --monitor-index is passed to projector open a friendlier error message is displayed.
|
||||
- it will suggest using *gobs-cli prj ls-m* to list available monitors.
|
||||
|
||||
|
||||
# [0.11.0] - 2025-06-20
|
||||
|
||||
### Added
|
||||
|
||||
- input list, scene list and sceneitem list now accept --uuid flag.
|
||||
- Active column added to scene list table.
|
||||
|
||||
### Changed
|
||||
|
||||
- scene list no longer prints the UUIDs by default, enable it with the --uuid flag.
|
||||
|
||||
# [0.10.3] - 2025-06-07
|
||||
|
||||
### Added
|
||||
|
||||
- filter list:
|
||||
- --ffmpeg, --vlc flags
|
||||
- Muted column to list table
|
||||
|
||||
# [0.10.2] - 2025-06-04
|
||||
|
||||
### Added
|
||||
|
||||
@@ -15,7 +97,9 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
|
||||
|
||||
- filter list:
|
||||
- sourceName arg now defaults to current scene.
|
||||
- defaults are printed for any unmodified values.
|
||||
- defaults are printed for any unmodified values.
|
||||
- sceneitem list:
|
||||
- prints enabled mark instead of true/false
|
||||
|
||||
# [0.9.0] - 2025-06-02
|
||||
|
||||
|
||||
247
README.md
247
README.md
@@ -4,6 +4,17 @@ A command line interface for OBS Websocket v5
|
||||
|
||||
For an outline of past/future changes refer to: [CHANGELOG](CHANGELOG.md)
|
||||
|
||||
-----
|
||||
|
||||
## Table of Contents
|
||||
|
||||
- [Installation](#installation)
|
||||
- [Configuration](#configuration)
|
||||
- [Style](#style)
|
||||
- [Commands](#commands)
|
||||
- [Shell Completion](#shell-completion)
|
||||
- [License](#license)
|
||||
|
||||
## Installation
|
||||
|
||||
```console
|
||||
@@ -40,6 +51,36 @@ OBS_PASSWORD=<websocket password>
|
||||
OBS_TIMEOUT=5
|
||||
```
|
||||
|
||||
## Style
|
||||
|
||||
Styling is opt-in, by default you will get a colourless output:
|
||||
|
||||

|
||||
|
||||
You may enable styling with the --style/-s flag:
|
||||
|
||||
```console
|
||||
gobs-cli --style="red" sceneitem list
|
||||
```
|
||||
|
||||
Available styles: _red, magenta, purple, blue, cyan, green, yellow, orange, white, grey, navy, black_
|
||||
|
||||

|
||||
|
||||
Optionally you may disable border colouring with the --no-border flag:
|
||||
|
||||

|
||||
|
||||
```console
|
||||
gobs-cli --style="red" --no-border sceneitem list
|
||||
```
|
||||
|
||||
Or with environment variables:
|
||||
|
||||
```env
|
||||
GOBS_STYLE=red
|
||||
GOBS_STYLE_NO_BORDER=true
|
||||
```
|
||||
|
||||
## Commands
|
||||
|
||||
@@ -54,6 +95,10 @@ gobs-cli obs-version
|
||||
### SceneCmd
|
||||
|
||||
- list: List all scenes.
|
||||
- flags:
|
||||
|
||||
*optional*
|
||||
- --UUID: Display UUIDs of scenes.
|
||||
|
||||
```console
|
||||
gobs-cli scene list
|
||||
@@ -87,6 +132,10 @@ gobs-cli scene switch --preview LIVE
|
||||
### SceneItemCmd
|
||||
|
||||
- list: List all scene items.
|
||||
- flags:
|
||||
|
||||
*optional*
|
||||
- --UUID: Display UUIDs of scene items.
|
||||
|
||||
*optional*
|
||||
- args: SceneName
|
||||
@@ -216,6 +265,20 @@ gobs-cli group status START "test_group"
|
||||
|
||||
### InputCmd
|
||||
|
||||
- create: Create input.
|
||||
- args: Name Kind
|
||||
|
||||
```console
|
||||
gobs-cli input create 'stream mix' 'wasapi_input_capture'
|
||||
```
|
||||
|
||||
- remove: Remove input.
|
||||
- args: Name
|
||||
|
||||
```console
|
||||
gobs-cli input remove 'stream mix'
|
||||
```
|
||||
|
||||
- list: List all inputs.
|
||||
- flags:
|
||||
|
||||
@@ -223,6 +286,9 @@ gobs-cli group status START "test_group"
|
||||
- --input: List all inputs.
|
||||
- --output: List all outputs.
|
||||
- --colour: List all colour sources.
|
||||
- --ffmpeg: List all ffmpeg sources.
|
||||
- --vlc: List all VLC sources.
|
||||
- --uuid: Display UUIDs of inputs.
|
||||
|
||||
```console
|
||||
gobs-cli input list
|
||||
@@ -230,6 +296,12 @@ gobs-cli input list
|
||||
gobs-cli input list --input --colour
|
||||
```
|
||||
|
||||
- list-kinds: List input kinds.
|
||||
|
||||
```console
|
||||
gobs-cli input list-kinds
|
||||
```
|
||||
|
||||
- mute: Mute input.
|
||||
- args: InputName
|
||||
|
||||
@@ -251,6 +323,50 @@ gobs-cli input unmute "Mic/Aux"
|
||||
gobs-cli input toggle "Mic/Aux"
|
||||
```
|
||||
|
||||
- volume: Set input volume.
|
||||
- args: InputName Volume
|
||||
|
||||
```console
|
||||
gobs-cli input volume -- 'Mic/Aux' -30.6
|
||||
```
|
||||
|
||||
- show: Show input details.
|
||||
- args: Name
|
||||
- flags:
|
||||
|
||||
*optional*
|
||||
- --verbose: List all available input devices.
|
||||
|
||||
- update: Update input settings.
|
||||
- args: InputName DeviceName
|
||||
|
||||
```console
|
||||
gobs-cli input update 'Mic/Aux' 'Voicemeeter Out B1 (VB-Audio Voicemeeter VAIO)'
|
||||
```
|
||||
|
||||
- kind-defaults: Get default settings for an input kind.
|
||||
- args: Kind
|
||||
|
||||
```console
|
||||
gobs-cli input kind-defaults 'wasapi_input_capture'
|
||||
```
|
||||
|
||||
### TextCmd
|
||||
|
||||
- current: Display current text for a text input.
|
||||
- args: InputName
|
||||
|
||||
```console
|
||||
gobs-cli text current "My Text Input"
|
||||
```
|
||||
|
||||
- update: Update the text of a text input.
|
||||
- args: InputName NewText
|
||||
|
||||
```console
|
||||
gobs-cli text update "My Text Input" "hi OBS!"
|
||||
```
|
||||
|
||||
### RecordCmd
|
||||
|
||||
- start: Start recording.
|
||||
@@ -302,6 +418,21 @@ gobs-cli record directory "/home/me/obs-vids/"
|
||||
gobs-cli record directory "C:/Users/me/Videos"
|
||||
```
|
||||
|
||||
- split: Split recording.
|
||||
|
||||
```console
|
||||
gobs-cli record split
|
||||
```
|
||||
|
||||
- chapter: Create a chapter in the recording.
|
||||
|
||||
*optional*
|
||||
- arg: ChapterName
|
||||
|
||||
```console
|
||||
gobs-cli record chapter "Chapter Name"
|
||||
```
|
||||
|
||||
### StreamCmd
|
||||
|
||||
- start: Start streaming.
|
||||
@@ -595,6 +726,120 @@ gobs-cli projector open --monitor-index=1 "test_group"
|
||||
gobs-cli screenshot save --width=2560 --height=1440 "Scene" "C:\Users\me\Videos\screenshot.png"
|
||||
```
|
||||
|
||||
### SettingsCmd
|
||||
|
||||
- show: Show settings.
|
||||
- flags:
|
||||
|
||||
*optional*
|
||||
- --video: Show video settings.
|
||||
- --record: Show record directory.
|
||||
- --profile: Show profile parameters.
|
||||
|
||||
```console
|
||||
gobs-cli settings show --video --record
|
||||
```
|
||||
|
||||
- profile: Get/Set profile parameter setting.
|
||||
- args: Category Name Value
|
||||
|
||||
```console
|
||||
gobs-cli settings profile SimpleOutput VBitrate
|
||||
|
||||
gobs-cli settings profile SimpleOutput VBitrate 6000
|
||||
```
|
||||
|
||||
- stream-service: Get/Set stream service setting.
|
||||
- flags:
|
||||
- --key: Stream key.
|
||||
- --server: Stream server URL.
|
||||
|
||||
*optional*
|
||||
- args: Type
|
||||
|
||||
```console
|
||||
gobs-cli settings stream-service
|
||||
|
||||
gobs-cli settings stream-service --key='live_xyzxyzxyzxyz' rtmp_common
|
||||
```
|
||||
|
||||
- video: Get/Set video setting.
|
||||
- flags:
|
||||
|
||||
*optional*
|
||||
- --base-width: Base (canvas) width.
|
||||
- --base-height: Base (canvas) height.
|
||||
- --output-width: Output (scaled) width.
|
||||
- --output-height: Output (scaled) height.
|
||||
- --fps-num: Frames per second numerator.
|
||||
- --fps-den: Frames per second denominator.
|
||||
|
||||
```console
|
||||
gobs-cli settings video
|
||||
|
||||
gobs-cli settings video --base-width=1920 --base-height=1080
|
||||
```
|
||||
|
||||
### MediaCmd
|
||||
|
||||
- cursor: Get/set the cursor position of a media input.
|
||||
- args: InputName
|
||||
|
||||
*optional*
|
||||
- TimeString
|
||||
|
||||
```console
|
||||
gobs-cli media cursor "Media"
|
||||
|
||||
gobs-cli media cursor "Media" "00:08:30"
|
||||
```
|
||||
|
||||
- play: Plays a media input.
|
||||
|
||||
```console
|
||||
gobs-cli media play "Media"
|
||||
```
|
||||
|
||||
- pause: Pauses a media input.
|
||||
|
||||
```console
|
||||
gobs-cli media pause "Media"
|
||||
```
|
||||
|
||||
- stop: Stops a media input.
|
||||
|
||||
```console
|
||||
gobs-cli media stop "Media"
|
||||
```
|
||||
|
||||
- restart: Restarts a media input.
|
||||
|
||||
```console
|
||||
gobs-cli media restart "Media"
|
||||
```
|
||||
|
||||
|
||||
## Shell Completion
|
||||
|
||||
- completion:
|
||||
|
||||
*optional*
|
||||
- args: Shell
|
||||
|
||||
```console
|
||||
gobs-cli completion
|
||||
|
||||
gobs-cli completion bash
|
||||
```
|
||||
|
||||
Currently supported shells: *bash* *zsh* *fish*. If no shell is passed completion will attempt to detect the current user shell.
|
||||
|
||||
|
||||
## License
|
||||
|
||||
`gobs-cli` is distributed under the terms of the [MIT](https://spdx.org/licenses/MIT.html) license.
|
||||
|
||||
|
||||
[userconfigdir]: https://pkg.go.dev/os#UserConfigDir
|
||||
[obs-keyids]: https://github.com/obsproject/obs-studio/blob/master/libobs/obs-hotkeys.h
|
||||
[obs-keyids]: https://github.com/obsproject/obs-studio/blob/master/libobs/obs-hotkeys.h
|
||||
[no-colour]: https://no-color.org/
|
||||
|
||||
@@ -22,6 +22,7 @@ tasks:
|
||||
cmds:
|
||||
- task: build-windows
|
||||
- task: build-linux
|
||||
- task: build-macos
|
||||
|
||||
vet:
|
||||
desc: Vet the code
|
||||
@@ -46,6 +47,12 @@ tasks:
|
||||
- GOOS=linux GOARCH=amd64 go build -ldflags "-X 'main.version={{.VERSION}}'" -o {{.BIN_DIR}}/{{.PROGRAM}}_linux_amd64
|
||||
internal: true
|
||||
|
||||
build-macos:
|
||||
desc: Build the gobs-cli project for macOS
|
||||
cmds:
|
||||
- GOOS=darwin GOARCH=amd64 go build -ldflags "-X 'main.version={{.VERSION}}'" -o {{.BIN_DIR}}/{{.PROGRAM}}_darwin_amd64
|
||||
internal: true
|
||||
|
||||
test:
|
||||
desc: Run tests
|
||||
cmds:
|
||||
|
||||
63
filter.go
63
filter.go
@@ -7,7 +7,8 @@ import (
|
||||
"strings"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/filters"
|
||||
"github.com/aquasecurity/table"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// FilterCmd provides commands to manage filters in OBS Studio.
|
||||
@@ -25,6 +26,7 @@ type FilterListCmd struct {
|
||||
}
|
||||
|
||||
// Run executes the command to list all filters in a scene.
|
||||
// nolint: misspell
|
||||
func (cmd *FilterListCmd) Run(ctx *context) error {
|
||||
if cmd.SourceName == "" {
|
||||
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||
@@ -42,14 +44,35 @@ func (cmd *FilterListCmd) Run(ctx *context) error {
|
||||
}
|
||||
|
||||
if len(sourceFilters.Filters) == 0 {
|
||||
fmt.Fprintf(ctx.Out, "No filters found for source %s.\n", cmd.SourceName)
|
||||
fmt.Fprintf(ctx.Out, "No filters found for source %s.\n", ctx.Style.Highlight(cmd.SourceName))
|
||||
return nil
|
||||
}
|
||||
|
||||
t := table.New(ctx.Out)
|
||||
t.SetPadding(3)
|
||||
t.SetAlignment(table.AlignLeft, table.AlignLeft, table.AlignCenter, table.AlignLeft)
|
||||
t.SetHeaders("Filter Name", "Kind", "Enabled", "Settings")
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||
Headers("Filter Name", "Kind", "Enabled", "Settings").
|
||||
StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 1:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 2:
|
||||
style = style.Align(lipgloss.Center)
|
||||
case 3:
|
||||
style = style.Align(lipgloss.Left)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
for _, filter := range sourceFilters.Filters {
|
||||
defaultSettings, err := ctx.Client.Filters.GetSourceFilterDefaultSettings(
|
||||
@@ -58,7 +81,7 @@ func (cmd *FilterListCmd) Run(ctx *context) error {
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get default settings for filter %s: %w",
|
||||
filter.FilterName, err)
|
||||
ctx.Style.Error(filter.FilterName), err)
|
||||
}
|
||||
maps.Insert(defaultSettings.DefaultFilterSettings, maps.All(filter.FilterSettings))
|
||||
|
||||
@@ -70,14 +93,14 @@ func (cmd *FilterListCmd) Run(ctx *context) error {
|
||||
return strings.ToLower(lines[i]) < strings.ToLower(lines[j])
|
||||
})
|
||||
|
||||
t.AddRow(
|
||||
t.Row(
|
||||
filter.FilterName,
|
||||
snakeCaseToTitleCase(filter.FilterKind),
|
||||
getEnabledMark(filter.FilterEnabled),
|
||||
strings.Join(lines, "\n"),
|
||||
)
|
||||
}
|
||||
t.Render()
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -97,10 +120,10 @@ func (cmd *FilterEnableCmd) Run(ctx *context) error {
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to enable filter %s on source %s: %w",
|
||||
cmd.FilterName, cmd.SourceName, err)
|
||||
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||
}
|
||||
fmt.Fprintf(ctx.Out, "Filter %s enabled on source %s.\n",
|
||||
cmd.FilterName, cmd.SourceName)
|
||||
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -120,10 +143,10 @@ func (cmd *FilterDisableCmd) Run(ctx *context) error {
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to disable filter %s on source %s: %w",
|
||||
cmd.FilterName, cmd.SourceName, err)
|
||||
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||
}
|
||||
fmt.Fprintf(ctx.Out, "Filter %s disabled on source %s.\n",
|
||||
cmd.FilterName, cmd.SourceName)
|
||||
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -142,7 +165,7 @@ func (cmd *FilterToggleCmd) Run(ctx *context) error {
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get filter %s on source %s: %w",
|
||||
cmd.FilterName, cmd.SourceName, err)
|
||||
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||
}
|
||||
|
||||
newStatus := !filter.FilterEnabled
|
||||
@@ -154,15 +177,15 @@ func (cmd *FilterToggleCmd) Run(ctx *context) error {
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to toggle filter %s on source %s: %w",
|
||||
cmd.FilterName, cmd.SourceName, err)
|
||||
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||
}
|
||||
|
||||
if newStatus {
|
||||
fmt.Fprintf(ctx.Out, "Filter %s on source %s is now enabled.\n",
|
||||
cmd.FilterName, cmd.SourceName)
|
||||
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Filter %s on source %s is now disabled.\n",
|
||||
cmd.FilterName, cmd.SourceName)
|
||||
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||
}
|
||||
return nil
|
||||
}
|
||||
@@ -182,14 +205,14 @@ func (cmd *FilterStatusCmd) Run(ctx *context) error {
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get status of filter %s on source %s: %w",
|
||||
cmd.FilterName, cmd.SourceName, err)
|
||||
ctx.Style.Error(cmd.FilterName), ctx.Style.Error(cmd.SourceName), err)
|
||||
}
|
||||
if filter.FilterEnabled {
|
||||
fmt.Fprintf(ctx.Out, "Filter %s on source %s is enabled.\n",
|
||||
cmd.FilterName, cmd.SourceName)
|
||||
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Filter %s on source %s is disabled.\n",
|
||||
cmd.FilterName, cmd.SourceName)
|
||||
ctx.Style.Highlight(cmd.FilterName), ctx.Style.Highlight(cmd.SourceName))
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -11,10 +11,7 @@ func TestFilterList(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &FilterListCmd{
|
||||
SourceName: "Mic/Aux",
|
||||
@@ -33,13 +30,10 @@ func TestFilterListScene(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &FilterListCmd{
|
||||
SourceName: "gobs-test",
|
||||
SourceName: "gobs-test-scene",
|
||||
}
|
||||
err := cmd.Run(context)
|
||||
if err != nil {
|
||||
@@ -55,10 +49,7 @@ func TestFilterListEmpty(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &FilterListCmd{
|
||||
SourceName: "NonExistentSource",
|
||||
|
||||
27
go.mod
27
go.mod
@@ -1,27 +1,40 @@
|
||||
module github.com/onyx-and-iris/gobs-cli
|
||||
|
||||
go 1.24.0
|
||||
go 1.25
|
||||
|
||||
require (
|
||||
github.com/alecthomas/kong v1.10.0
|
||||
github.com/alecthomas/kong v1.13.0
|
||||
github.com/alecthomas/mango-kong v0.1.0
|
||||
github.com/andreykaipov/goobs v1.5.6
|
||||
github.com/aquasecurity/table v1.10.0
|
||||
github.com/charmbracelet/lipgloss v1.1.0
|
||||
github.com/jotaen/kong-completion v0.0.9
|
||||
github.com/titusjaka/kong-dotenv-go v0.1.0
|
||||
)
|
||||
|
||||
require (
|
||||
github.com/aymanbagabas/go-osc52/v2 v2.0.1 // indirect
|
||||
github.com/buger/jsonparser v1.1.1 // indirect
|
||||
github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc // indirect
|
||||
github.com/charmbracelet/x/ansi v0.8.0 // indirect
|
||||
github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd // indirect
|
||||
github.com/charmbracelet/x/term v0.2.1 // indirect
|
||||
github.com/gorilla/websocket v1.5.3 // indirect
|
||||
github.com/hashicorp/errwrap v1.1.0 // indirect
|
||||
github.com/hashicorp/go-multierror v1.1.1 // indirect
|
||||
github.com/hashicorp/logutils v1.0.0 // indirect
|
||||
github.com/joho/godotenv v1.5.1 // indirect
|
||||
github.com/mattn/go-runewidth v0.0.13 // indirect
|
||||
github.com/lucasb-eyer/go-colorful v1.2.0 // indirect
|
||||
github.com/mattn/go-isatty v0.0.20 // indirect
|
||||
github.com/mattn/go-runewidth v0.0.16 // indirect
|
||||
github.com/mitchellh/mapstructure v1.5.0 // indirect
|
||||
github.com/mmcloughlin/profile v0.1.1 // indirect
|
||||
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab // indirect
|
||||
github.com/muesli/roff v0.1.0 // indirect
|
||||
github.com/muesli/termenv v0.16.0 // indirect
|
||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d // indirect
|
||||
github.com/rivo/uniseg v0.2.0 // indirect
|
||||
golang.org/x/sys v0.1.0 // indirect
|
||||
golang.org/x/term v0.0.0-20220526004731-065cf7ba2467 // indirect
|
||||
github.com/posener/complete v1.2.3 // indirect
|
||||
github.com/rivo/uniseg v0.4.7 // indirect
|
||||
github.com/riywo/loginshell v0.0.0-20200815045211-7d26008be1ab // indirect
|
||||
github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e // indirect
|
||||
golang.org/x/sys v0.30.0 // indirect
|
||||
)
|
||||
|
||||
71
go.sum
71
go.sum
@@ -1,29 +1,56 @@
|
||||
github.com/alecthomas/assert/v2 v2.11.0 h1:2Q9r3ki8+JYXvGsDyBXwH3LcJ+WK5D0gc5E8vS6K3D0=
|
||||
github.com/alecthomas/assert/v2 v2.11.0/go.mod h1:Bze95FyfUr7x34QZrjL+XP+0qgp/zg8yS+TtBj1WA3k=
|
||||
github.com/alecthomas/kong v1.10.0 h1:8K4rGDpT7Iu+jEXCIJUeKqvpwZHbsFRoebLbnzlmrpw=
|
||||
github.com/alecthomas/kong v1.10.0/go.mod h1:p2vqieVMeTAnaC83txKtXe8FLke2X07aruPWXyMPQrU=
|
||||
github.com/alecthomas/kong v1.13.0 h1:5e/7XC3ugvhP1DQBmTS+WuHtCbcv44hsohMgcvVxSrA=
|
||||
github.com/alecthomas/kong v1.13.0/go.mod h1:wrlbXem1CWqUV5Vbmss5ISYhsVPkBb1Yo7YKJghju2I=
|
||||
github.com/alecthomas/mango-kong v0.1.0 h1:iFVfP1k1K4qpml3JUQmD5I8MCQYfIvsD9mRdrw7jJC4=
|
||||
github.com/alecthomas/mango-kong v0.1.0/go.mod h1:t+TYVdsONUolf/BwVcm+15eqcdAj15h4Qe9MMFAwwT4=
|
||||
github.com/alecthomas/repr v0.4.0 h1:GhI2A8MACjfegCPVq9f1FLvIBS+DrQ2KQBFZP1iFzXc=
|
||||
github.com/alecthomas/repr v0.4.0/go.mod h1:Fr0507jx4eOXV7AlPV6AVZLYrLIuIeSOWtW57eE/O/4=
|
||||
github.com/alecthomas/repr v0.5.2 h1:SU73FTI9D1P5UNtvseffFSGmdNci/O6RsqzeXJtP0Qs=
|
||||
github.com/alecthomas/repr v0.5.2/go.mod h1:Fr0507jx4eOXV7AlPV6AVZLYrLIuIeSOWtW57eE/O/4=
|
||||
github.com/andreykaipov/goobs v1.5.6 h1:eIkEqYN99+2VJvmlY/56Ah60nkRKS6efMQvpM3oUgPQ=
|
||||
github.com/andreykaipov/goobs v1.5.6/go.mod h1:iSZP93FJ4d9X/U1x4DD4IyILLtig+vViqZWBGjLywcY=
|
||||
github.com/aquasecurity/table v1.10.0 h1:gPWV28qp9XSlvXdT3ku8yKQoZE6II0vsmegKpW+dB08=
|
||||
github.com/aquasecurity/table v1.10.0/go.mod h1:eqOmvjjB7AhXFgFqpJUEE/ietg7RrMSJZXyTN8E/wZw=
|
||||
github.com/aymanbagabas/go-osc52/v2 v2.0.1 h1:HwpRHbFMcZLEVr42D4p7XBqjyuxQH5SMiErDT4WkJ2k=
|
||||
github.com/aymanbagabas/go-osc52/v2 v2.0.1/go.mod h1:uYgXzlJ7ZpABp8OJ+exZzJJhRNQ2ASbcXHWsFqH8hp8=
|
||||
github.com/aymanbagabas/go-udiff v0.2.0 h1:TK0fH4MteXUDspT88n8CKzvK0X9O2xu9yQjWpi6yML8=
|
||||
github.com/aymanbagabas/go-udiff v0.2.0/go.mod h1:RE4Ex0qsGkTAJoQdQQCA0uG+nAzJO/pI/QwceO5fgrA=
|
||||
github.com/buger/jsonparser v1.1.1 h1:2PnMjfWD7wBILjqQbt530v576A/cAbQvEW9gGIpYMUs=
|
||||
github.com/buger/jsonparser v1.1.1/go.mod h1:6RYKKt7H4d4+iWqouImQ9R2FZql3VbhNgx27UK13J/0=
|
||||
github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc h1:4pZI35227imm7yK2bGPcfpFEmuY1gc2YSTShr4iJBfs=
|
||||
github.com/charmbracelet/colorprofile v0.2.3-0.20250311203215-f60798e515dc/go.mod h1:X4/0JoqgTIPSFcRA/P6INZzIuyqdFY5rm8tb41s9okk=
|
||||
github.com/charmbracelet/lipgloss v1.1.0 h1:vYXsiLHVkK7fp74RkV7b2kq9+zDLoEU4MZoFqR/noCY=
|
||||
github.com/charmbracelet/lipgloss v1.1.0/go.mod h1:/6Q8FR2o+kj8rz4Dq0zQc3vYf7X+B0binUUBwA0aL30=
|
||||
github.com/charmbracelet/x/ansi v0.8.0 h1:9GTq3xq9caJW8ZrBTe0LIe2fvfLR/bYXKTx2llXn7xE=
|
||||
github.com/charmbracelet/x/ansi v0.8.0/go.mod h1:wdYl/ONOLHLIVmQaxbIYEC/cRKOQyjTkowiI4blgS9Q=
|
||||
github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd h1:vy0GVL4jeHEwG5YOXDmi86oYw2yuYUGqz6a8sLwg0X8=
|
||||
github.com/charmbracelet/x/cellbuf v0.0.13-0.20250311204145-2c3ea96c31dd/go.mod h1:xe0nKWGd3eJgtqZRaN9RjMtK7xUYchjzPr7q6kcvCCs=
|
||||
github.com/charmbracelet/x/exp/golden v0.0.0-20240806155701-69247e0abc2a h1:G99klV19u0QnhiizODirwVksQB91TJKV/UaTnACcG30=
|
||||
github.com/charmbracelet/x/exp/golden v0.0.0-20240806155701-69247e0abc2a/go.mod h1:wDlXFlCrmJ8J+swcL/MnGUuYnqgQdW9rhSD61oNMb6U=
|
||||
github.com/charmbracelet/x/term v0.2.1 h1:AQeHeLZ1OqSXhrAWpYUtZyX1T3zVxfpZuEQMIQaGIAQ=
|
||||
github.com/charmbracelet/x/term v0.2.1/go.mod h1:oQ4enTYFV7QN4m0i9mzHrViD7TQKvNEEkHUMCmsxdUg=
|
||||
github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/gorilla/websocket v1.5.3 h1:saDtZ6Pbx/0u+bgYQ3q96pZgCzfhKXGPqt7kZ72aNNg=
|
||||
github.com/gorilla/websocket v1.5.3/go.mod h1:YR8l580nyteQvAITg2hZ9XVh4b55+EU/adAjf1fMHhE=
|
||||
github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4=
|
||||
github.com/hashicorp/errwrap v1.1.0 h1:OxrOeh75EUXMY8TBjag2fzXGZ40LB6IKw45YeGUDY2I=
|
||||
github.com/hashicorp/errwrap v1.1.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4=
|
||||
github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk=
|
||||
github.com/hashicorp/go-multierror v1.1.1 h1:H5DkEtf6CXdFp0N0Em5UCwQpXMWke8IA0+lD48awMYo=
|
||||
github.com/hashicorp/go-multierror v1.1.1/go.mod h1:iw975J/qwKPdAO1clOe2L8331t/9/fmwbPZ6JB6eMoM=
|
||||
github.com/hashicorp/logutils v1.0.0 h1:dLEQVugN8vlakKOUE3ihGLTZJRB4j+M2cdTm/ORI65Y=
|
||||
github.com/hashicorp/logutils v1.0.0/go.mod h1:QIAnNjmIWmVIIkWDTG1z5v++HQmx9WQRO+LraFDTW64=
|
||||
github.com/hexops/gotextdiff v1.0.3 h1:gitA9+qJrrTCsiCl7+kh75nPqQt1cx4ZkudSTLoUqJM=
|
||||
github.com/hexops/gotextdiff v1.0.3/go.mod h1:pSWU5MAI3yDq+fZBTazCSJysOMbxWL1BSow5/V2vxeg=
|
||||
github.com/joho/godotenv v1.5.1 h1:7eLL/+HRGLY0ldzfGMeQkb7vMd0as4CfYvUVzLqw0N0=
|
||||
github.com/joho/godotenv v1.5.1/go.mod h1:f4LDr5Voq0i2e/R5DDNOoa2zzDfwtkZa6DnEwAbqwq4=
|
||||
github.com/mattn/go-runewidth v0.0.13 h1:lTGmDsbAYt5DmK6OnoV7EuIF1wEIFAcxld6ypU4OSgU=
|
||||
github.com/mattn/go-runewidth v0.0.13/go.mod h1:Jdepj2loyihRzMpdS35Xk/zdY8IAYHsh153qUoGf23w=
|
||||
github.com/jotaen/kong-completion v0.0.9 h1:yXKSRvjWuuZlTGpPMpvo96sFjh5PEh/skrcK4DjJnfg=
|
||||
github.com/jotaen/kong-completion v0.0.9/go.mod h1:dyIG20e3qq128SUBtF8jzI7YtkfzjWMlgbqkAJd6xHQ=
|
||||
github.com/lucasb-eyer/go-colorful v1.2.0 h1:1nnpGOrhyZZuNyfu1QjKiUICQ74+3FNCN69Aj6K7nkY=
|
||||
github.com/lucasb-eyer/go-colorful v1.2.0/go.mod h1:R4dSotOR9KMtayYi1e77YzuveK+i7ruzyGqttikkLy0=
|
||||
github.com/mattn/go-isatty v0.0.20 h1:xfD0iDuEKnDkl03q4limB+vH+GxLEtL/jb4xVJSWWEY=
|
||||
github.com/mattn/go-isatty v0.0.20/go.mod h1:W+V8PltTTMOvKvAeJH7IuucS94S2C6jfK/D7dTCTo3Y=
|
||||
github.com/mattn/go-runewidth v0.0.16 h1:E5ScNMtiwvlvB5paMFdw9p4kSQzbXFikJ5SQO6TULQc=
|
||||
github.com/mattn/go-runewidth v0.0.16/go.mod h1:Jdepj2loyihRzMpdS35Xk/zdY8IAYHsh153qUoGf23w=
|
||||
github.com/mitchellh/mapstructure v1.5.0 h1:jeMsZIYE/09sWLaz43PL7Gy6RuMjD2eJVyuac5Z2hdY=
|
||||
github.com/mitchellh/mapstructure v1.5.0/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo=
|
||||
github.com/mmcloughlin/profile v0.1.1 h1:jhDmAqPyebOsVDOCICJoINoLb/AnLBaUw58nFzxWS2w=
|
||||
@@ -32,19 +59,33 @@ github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab h1:m7QFONkzLK0fVXCj
|
||||
github.com/muesli/mango v0.1.1-0.20220205060214-77e2058169ab/go.mod h1:5XFpbC8jY5UUv89YQciiXNlbi+iJgt29VDC5xbzrLL4=
|
||||
github.com/muesli/roff v0.1.0 h1:YD0lalCotmYuF5HhZliKWlIx7IEhiXeSfq7hNjFqGF8=
|
||||
github.com/muesli/roff v0.1.0/go.mod h1:pjAHQM9hdUUwm/krAfrLGgJkXJ+YuhtsfZ42kieB2Ig=
|
||||
github.com/muesli/termenv v0.16.0 h1:S5AlUN9dENB57rsbnkPyfdGuWIlkmzJjbFf0Tf5FWUc=
|
||||
github.com/muesli/termenv v0.16.0/go.mod h1:ZRfOIKPFDYQoDFF4Olj7/QJbW60Ol/kL1pU3VfY/Cnk=
|
||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d h1:VhgPp6v9qf9Agr/56bj7Y/xa04UccTW04VP0Qed4vnQ=
|
||||
github.com/nu7hatch/gouuid v0.0.0-20131221200532-179d4d0c4d8d/go.mod h1:YUTz3bUH2ZwIWBy3CJBeOBEugqcmXREj14T+iG/4k4U=
|
||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||
github.com/rivo/uniseg v0.2.0 h1:S1pD9weZBuJdFmowNwbpi7BJ8TNftyUImj/0WQi72jY=
|
||||
github.com/posener/complete v1.2.3 h1:NP0eAhjcjImqslEwo/1hq7gpajME0fTLTezBKDqfXqo=
|
||||
github.com/posener/complete v1.2.3/go.mod h1:WZIdtGGp+qx0sLrYKtIRAruyNpv6hFCicSgv7Sy7s/s=
|
||||
github.com/rivo/uniseg v0.2.0/go.mod h1:J6wj4VEh+S6ZtnVlnTBMWIodfgj8LQOQFoIToxlJtxc=
|
||||
github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA=
|
||||
github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
|
||||
github.com/rivo/uniseg v0.4.7 h1:WUdvkW8uEhrYfLC4ZzdpI2ztxP1I582+49Oc5Mq64VQ=
|
||||
github.com/rivo/uniseg v0.4.7/go.mod h1:FN3SvrM+Zdj16jyLfmOkMNblXMcoc8DfTHruCPUcx88=
|
||||
github.com/riywo/loginshell v0.0.0-20200815045211-7d26008be1ab h1:ZjX6I48eZSFetPb41dHudEyVr5v953N15TsNZXlkcWY=
|
||||
github.com/riywo/loginshell v0.0.0-20200815045211-7d26008be1ab/go.mod h1:/PfPXh0EntGc3QAAyUaviy4S9tzy4Zp0e2ilq4voC6E=
|
||||
github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||
github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4=
|
||||
github.com/stretchr/testify v1.11.1 h1:7s2iGBzp5EwR7/aIZr8ao5+dra3wiQyKjjFuvgVKu7U=
|
||||
github.com/stretchr/testify v1.11.1/go.mod h1:wZwfW3scLgRK+23gO65QZefKpKQRnfz6sD981Nm4B6U=
|
||||
github.com/titusjaka/kong-dotenv-go v0.1.0 h1:TmUjP/sXoNiKLr6oR7n9xrB5XyXi/Ssuebzfz5nxZj4=
|
||||
github.com/titusjaka/kong-dotenv-go v0.1.0/go.mod h1:pBgLjcu82oqUgb7+bngK9+Ch7jg49E0YADP8Wnj2MXU=
|
||||
golang.org/x/sys v0.1.0 h1:kunALQeHf1/185U1i0GOB/fy1IPRDDpuoOOqRReG57U=
|
||||
golang.org/x/sys v0.1.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||
golang.org/x/term v0.0.0-20220526004731-065cf7ba2467 h1:CBpWXWQpIRjzmkkA+M7q9Fqnwd2mZr3AFqexg8YTfoM=
|
||||
golang.org/x/term v0.0.0-20220526004731-065cf7ba2467/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8=
|
||||
github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e h1:JVG44RsyaB9T2KIHavMF/ppJZNG9ZpyihvCd0w101no=
|
||||
github.com/xo/terminfo v0.0.0-20220910002029-abceb7e1c41e/go.mod h1:RbqR21r5mrJuqunuUZ/Dhy/avygyECGrLceyNeo4LiM=
|
||||
golang.org/x/exp v0.0.0-20220909182711-5c715a9e8561 h1:MDc5xs78ZrZr3HMQugiXOAkSZtfTpbJLDr/lwfgO53E=
|
||||
golang.org/x/exp v0.0.0-20220909182711-5c715a9e8561/go.mod h1:cyybsKvd6eL0RnXn6p/Grxp8F5bW7iYuBgsNCOHpMYE=
|
||||
golang.org/x/sys v0.6.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||
golang.org/x/sys v0.30.0 h1:QjkSwP/36a20jFYWkSue1YwXzLmsV5Gfq7Eiy72C1uc=
|
||||
golang.org/x/sys v0.30.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA=
|
||||
gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
|
||||
gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
||||
|
||||
75
group.go
75
group.go
@@ -4,7 +4,8 @@ import (
|
||||
"fmt"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
||||
"github.com/aquasecurity/table"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// GroupCmd provides commands to manage groups in OBS Studio.
|
||||
@@ -22,6 +23,7 @@ type GroupListCmd struct {
|
||||
}
|
||||
|
||||
// Run executes the command to list all groups in a scene.
|
||||
// nolint: misspell
|
||||
func (cmd *GroupListCmd) Run(ctx *context) error {
|
||||
if cmd.SceneName == "" {
|
||||
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||
@@ -37,17 +39,44 @@ func (cmd *GroupListCmd) Run(ctx *context) error {
|
||||
return fmt.Errorf("failed to get scene item list: %w", err)
|
||||
}
|
||||
|
||||
t := table.New(ctx.Out)
|
||||
t.SetPadding(3)
|
||||
t.SetAlignment(table.AlignCenter, table.AlignLeft, table.AlignCenter)
|
||||
t.SetHeaders("ID", "Group Name", "Enabled")
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||
Headers("ID", "Group Name", "Enabled").
|
||||
StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Center)
|
||||
case 1:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 2:
|
||||
style = style.Align(lipgloss.Center)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
var found bool
|
||||
for _, item := range resp.SceneItems {
|
||||
if item.IsGroup {
|
||||
t.AddRow(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, getEnabledMark(item.SceneItemEnabled))
|
||||
t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, getEnabledMark(item.SceneItemEnabled))
|
||||
found = true
|
||||
}
|
||||
}
|
||||
t.Render()
|
||||
|
||||
if !found {
|
||||
fmt.Fprintf(ctx.Out, "No groups found in scene %s.\n", ctx.Style.Highlight(cmd.SceneName))
|
||||
return nil
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -75,13 +104,17 @@ func (cmd *GroupShowCmd) Run(ctx *context) error {
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
||||
}
|
||||
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", cmd.GroupName)
|
||||
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||
found = true
|
||||
break
|
||||
}
|
||||
}
|
||||
if !found {
|
||||
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
||||
return fmt.Errorf(
|
||||
"group %s not found in scene %s",
|
||||
ctx.Style.Error(cmd.GroupName),
|
||||
ctx.Style.Error(cmd.SceneName),
|
||||
)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
@@ -110,13 +143,17 @@ func (cmd *GroupHideCmd) Run(ctx *context) error {
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
||||
}
|
||||
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", cmd.GroupName)
|
||||
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||
found = true
|
||||
break
|
||||
}
|
||||
}
|
||||
if !found {
|
||||
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
||||
return fmt.Errorf(
|
||||
"group %s not found in scene %s",
|
||||
ctx.Style.Error(cmd.GroupName),
|
||||
ctx.Style.Error(cmd.SceneName),
|
||||
)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
@@ -147,16 +184,20 @@ func (cmd *GroupToggleCmd) Run(ctx *context) error {
|
||||
return fmt.Errorf("failed to set scene item enabled: %w", err)
|
||||
}
|
||||
if newState {
|
||||
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", cmd.GroupName)
|
||||
fmt.Fprintf(ctx.Out, "Group %s is now shown.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", cmd.GroupName)
|
||||
fmt.Fprintf(ctx.Out, "Group %s is now hidden.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||
}
|
||||
found = true
|
||||
break
|
||||
}
|
||||
}
|
||||
if !found {
|
||||
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
||||
return fmt.Errorf(
|
||||
"group %s not found in scene %s",
|
||||
ctx.Style.Error(cmd.GroupName),
|
||||
ctx.Style.Error(cmd.SceneName),
|
||||
)
|
||||
}
|
||||
|
||||
return nil
|
||||
@@ -178,12 +219,12 @@ func (cmd *GroupStatusCmd) Run(ctx *context) error {
|
||||
for _, item := range resp.SceneItems {
|
||||
if item.IsGroup && item.SourceName == cmd.GroupName {
|
||||
if item.SceneItemEnabled {
|
||||
fmt.Fprintf(ctx.Out, "Group %s is shown.\n", cmd.GroupName)
|
||||
fmt.Fprintf(ctx.Out, "Group %s is shown.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Group %s is hidden.\n", cmd.GroupName)
|
||||
fmt.Fprintf(ctx.Out, "Group %s is hidden.\n", ctx.Style.Highlight(cmd.GroupName))
|
||||
}
|
||||
return nil
|
||||
}
|
||||
}
|
||||
return fmt.Errorf("group '%s' not found", cmd.GroupName)
|
||||
return fmt.Errorf("group %s not found in scene %s", ctx.Style.Error(cmd.GroupName), ctx.Style.Error(cmd.SceneName))
|
||||
}
|
||||
|
||||
@@ -2,19 +2,25 @@ package main
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"os"
|
||||
"strings"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func skipIfSkipGroupTests(t *testing.T) {
|
||||
if os.Getenv("GOBS_TEST_SKIP_GROUP_TESTS") != "" {
|
||||
t.Skip("Skipping group tests due to GOBS_TEST_SKIP_GROUP_TESTS environment variable")
|
||||
}
|
||||
}
|
||||
|
||||
func TestGroupList(t *testing.T) {
|
||||
skipIfSkipGroupTests(t)
|
||||
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &GroupListCmd{
|
||||
SceneName: "Scene",
|
||||
@@ -29,14 +35,13 @@ func TestGroupList(t *testing.T) {
|
||||
}
|
||||
|
||||
func TestGroupShow(t *testing.T) {
|
||||
skipIfSkipGroupTests(t)
|
||||
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &GroupShowCmd{
|
||||
SceneName: "Scene",
|
||||
@@ -52,14 +57,13 @@ func TestGroupShow(t *testing.T) {
|
||||
}
|
||||
|
||||
func TestGroupToggle(t *testing.T) {
|
||||
skipIfSkipGroupTests(t)
|
||||
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdStatus := &GroupStatusCmd{
|
||||
SceneName: "Scene",
|
||||
@@ -96,14 +100,13 @@ func TestGroupToggle(t *testing.T) {
|
||||
}
|
||||
|
||||
func TestGroupStatus(t *testing.T) {
|
||||
skipIfSkipGroupTests(t)
|
||||
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdShow := &GroupShowCmd{
|
||||
SceneName: "Scene",
|
||||
|
||||
28
hotkey.go
28
hotkey.go
@@ -1,9 +1,12 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/general"
|
||||
"github.com/andreykaipov/goobs/api/typedefs"
|
||||
"github.com/aquasecurity/table"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// HotkeyCmd provides commands to manage hotkeys in OBS Studio.
|
||||
@@ -23,15 +26,26 @@ func (cmd *HotkeyListCmd) Run(ctx *context) error {
|
||||
return err
|
||||
}
|
||||
|
||||
t := table.New(ctx.Out)
|
||||
t.SetPadding(3)
|
||||
t.SetAlignment(table.AlignLeft)
|
||||
t.SetHeaders("Hotkey Name")
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||
Headers("Hotkey Name").
|
||||
StyleFunc(func(row, _ int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center) // nolint: misspell
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
for _, hotkey := range resp.Hotkeys {
|
||||
t.AddRow(hotkey)
|
||||
t.Row(hotkey)
|
||||
}
|
||||
t.Render()
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
|
||||
BIN
img/coloured-border.png
Normal file
BIN
img/coloured-border.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 5.4 KiB |
BIN
img/coloured-no-border.png
Normal file
BIN
img/coloured-no-border.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 5.4 KiB |
BIN
img/colourless.png
Executable file
BIN
img/colourless.png
Executable file
Binary file not shown.
|
After Width: | Height: | Size: 4.6 KiB |
481
input.go
481
input.go
@@ -1,19 +1,76 @@
|
||||
// nolint: misspell
|
||||
package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"maps"
|
||||
"sort"
|
||||
"strings"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/inputs"
|
||||
"github.com/aquasecurity/table"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// InputCmd provides commands to manage inputs in OBS Studio.
|
||||
type InputCmd struct {
|
||||
List InputListCmd `cmd:"" help:"List all inputs." aliases:"ls"`
|
||||
Mute InputMuteCmd `cmd:"" help:"Mute input." aliases:"m"`
|
||||
Unmute InputUnmuteCmd `cmd:"" help:"Unmute input." aliases:"um"`
|
||||
Toggle InputToggleCmd `cmd:"" help:"Toggle input." aliases:"tg"`
|
||||
Create InputCreateCmd `cmd:"" help:"Create input." aliases:"c"`
|
||||
Remove InputRemoveCmd `cmd:"" help:"Remove input." aliases:"d"`
|
||||
List InputListCmd `cmd:"" help:"List all inputs." aliases:"ls"`
|
||||
ListKinds InputListKindsCmd `cmd:"" help:"List input kinds." aliases:"k"`
|
||||
Mute InputMuteCmd `cmd:"" help:"Mute input." aliases:"m"`
|
||||
Unmute InputUnmuteCmd `cmd:"" help:"Unmute input." aliases:"um"`
|
||||
Toggle InputToggleCmd `cmd:"" help:"Toggle input." aliases:"tg"`
|
||||
Volume InputVolumeCmd `cmd:"" help:"Set input volume." aliases:"v"`
|
||||
Show InputShowCmd `cmd:"" help:"Show input details." aliases:"s"`
|
||||
Update InputUpdateCmd `cmd:"" help:"Update input settings." aliases:"up"`
|
||||
KindDefaults InputKindDefaultsCmd `cmd:"" help:"Get default settings for an input kind." aliases:"df"`
|
||||
}
|
||||
|
||||
// InputCreateCmd provides a command to create an input.
|
||||
type InputCreateCmd struct {
|
||||
Name string `arg:"" help:"Name for the input." required:""`
|
||||
Kind string `arg:"" help:"Input kind (e.g., coreaudio_input_capture, macos-avcapture)." required:""`
|
||||
}
|
||||
|
||||
// Run executes the command to create an input.
|
||||
func (cmd *InputCreateCmd) Run(ctx *context) error {
|
||||
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Inputs.CreateInput(
|
||||
inputs.NewCreateInputParams().
|
||||
WithInputKind(cmd.Kind).
|
||||
WithInputName(cmd.Name).
|
||||
WithSceneName(currentScene.CurrentProgramSceneName),
|
||||
)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Created input: %s (%s) in scene %s\n",
|
||||
ctx.Style.Highlight(cmd.Name), cmd.Kind, ctx.Style.Highlight(currentScene.CurrentProgramSceneName))
|
||||
return nil
|
||||
}
|
||||
|
||||
// InputRemoveCmd provides a command to remove an input.
|
||||
type InputRemoveCmd struct {
|
||||
Name string `arg:"" help:"Name of the input to remove." required:""`
|
||||
}
|
||||
|
||||
// Run executes the command to remove an input.
|
||||
func (cmd *InputRemoveCmd) Run(ctx *context) error {
|
||||
_, err := ctx.Client.Inputs.RemoveInput(
|
||||
inputs.NewRemoveInputParams().WithInputName(cmd.Name),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to delete input: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Deleted %s\n", ctx.Style.Highlight(cmd.Name))
|
||||
return nil
|
||||
}
|
||||
|
||||
// InputListCmd provides a command to list all inputs.
|
||||
@@ -21,6 +78,9 @@ type InputListCmd struct {
|
||||
Input bool `flag:"" help:"List all inputs." aliases:"i"`
|
||||
Output bool `flag:"" help:"List all outputs." aliases:"o"`
|
||||
Colour bool `flag:"" help:"List all colour sources." aliases:"c"`
|
||||
Ffmpeg bool `flag:"" help:"List all ffmpeg sources." aliases:"f"`
|
||||
Vlc bool `flag:"" help:"List all VLC sources." aliases:"v"`
|
||||
UUID bool `flag:"" help:"Display UUIDs of inputs." aliases:"u"`
|
||||
}
|
||||
|
||||
// Run executes the command to list all inputs.
|
||||
@@ -30,27 +90,130 @@ func (cmd *InputListCmd) Run(ctx *context) error {
|
||||
return err
|
||||
}
|
||||
|
||||
t := table.New(ctx.Out)
|
||||
t.SetPadding(3)
|
||||
t.SetAlignment(table.AlignLeft, table.AlignLeft)
|
||||
t.SetHeaders("Input Name", "Kind")
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
|
||||
if cmd.UUID {
|
||||
t.Headers("Input Name", "Kind", "Muted", "UUID")
|
||||
} else {
|
||||
t.Headers("Input Name", "Kind", "Muted")
|
||||
}
|
||||
t.StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 1:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 2:
|
||||
style = style.Align(lipgloss.Center)
|
||||
case 3:
|
||||
style = style.Align(lipgloss.Left)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
sort.Slice(resp.Inputs, func(i, j int) bool {
|
||||
return resp.Inputs[i].InputName < resp.Inputs[j].InputName
|
||||
})
|
||||
|
||||
for _, input := range resp.Inputs {
|
||||
if cmd.Input && strings.Contains(input.InputKind, "input") {
|
||||
t.AddRow(input.InputName, input.InputKind)
|
||||
}
|
||||
if cmd.Output && strings.Contains(input.InputKind, "output") {
|
||||
t.AddRow(input.InputName, input.InputKind)
|
||||
}
|
||||
if cmd.Colour && strings.Contains(input.InputKind, "color") { // nolint
|
||||
t.AddRow(input.InputName, input.InputKind)
|
||||
var muteMark string
|
||||
resp, err := ctx.Client.Inputs.GetInputMute(
|
||||
inputs.NewGetInputMuteParams().WithInputName(input.InputName),
|
||||
)
|
||||
if err != nil {
|
||||
if err.Error() == "request GetInputMute: InvalidResourceState (604): The specified input does not support audio." {
|
||||
muteMark = "—"
|
||||
} else {
|
||||
return fmt.Errorf("failed to get input mute state: %w", err)
|
||||
}
|
||||
} else {
|
||||
muteMark = getEnabledMark(resp.InputMuted)
|
||||
}
|
||||
|
||||
if !cmd.Input && !cmd.Output && !cmd.Colour {
|
||||
t.AddRow(input.InputName, input.InputKind)
|
||||
type filter struct {
|
||||
enabled bool
|
||||
keyword string
|
||||
}
|
||||
filters := []filter{
|
||||
{cmd.Input, "input"},
|
||||
{cmd.Output, "output"},
|
||||
{cmd.Colour, "color"}, // nolint: misspell
|
||||
{cmd.Ffmpeg, "ffmpeg"},
|
||||
{cmd.Vlc, "vlc"},
|
||||
}
|
||||
|
||||
var added bool
|
||||
for _, f := range filters {
|
||||
if f.enabled && strings.Contains(input.InputKind, f.keyword) {
|
||||
if cmd.UUID {
|
||||
t.Row(input.InputName, input.InputKind, muteMark, input.InputUuid)
|
||||
} else {
|
||||
t.Row(input.InputName, input.InputKind, muteMark)
|
||||
}
|
||||
added = true
|
||||
break
|
||||
}
|
||||
}
|
||||
|
||||
if !added && (!cmd.Input && !cmd.Output && !cmd.Colour && !cmd.Ffmpeg && !cmd.Vlc) {
|
||||
if cmd.UUID {
|
||||
t.Row(input.InputName, snakeCaseToTitleCase(input.InputKind), muteMark, input.InputUuid)
|
||||
} else {
|
||||
t.Row(input.InputName, snakeCaseToTitleCase(input.InputKind), muteMark)
|
||||
}
|
||||
}
|
||||
}
|
||||
t.Render()
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
// InputListKindsCmd provides a command to list all input kinds.
|
||||
type InputListKindsCmd struct{}
|
||||
|
||||
// Run executes the command to list all input kinds.
|
||||
func (cmd *InputListKindsCmd) Run(ctx *context) error {
|
||||
resp, err := ctx.Client.Inputs.GetInputKindList(
|
||||
inputs.NewGetInputKindListParams().WithUnversioned(false),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get input kinds: %w", err)
|
||||
}
|
||||
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
|
||||
t.Headers("Kind")
|
||||
t.StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Left)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
for _, kind := range resp.InputKinds {
|
||||
t.Row(kind)
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -68,7 +231,7 @@ func (cmd *InputMuteCmd) Run(ctx *context) error {
|
||||
return fmt.Errorf("failed to mute input: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Muted input: %s\n", cmd.InputName)
|
||||
fmt.Fprintf(ctx.Out, "Muted input: %s\n", ctx.Style.Highlight(cmd.InputName))
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -86,7 +249,7 @@ func (cmd *InputUnmuteCmd) Run(ctx *context) error {
|
||||
return fmt.Errorf("failed to unmute input: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", cmd.InputName)
|
||||
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", ctx.Style.Highlight(cmd.InputName))
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -114,9 +277,279 @@ func (cmd *InputToggleCmd) Run(ctx *context) error {
|
||||
}
|
||||
|
||||
if newMuteState {
|
||||
fmt.Fprintf(ctx.Out, "Muted input: %s\n", cmd.InputName)
|
||||
fmt.Fprintf(ctx.Out, "Muted input: %s\n", ctx.Style.Highlight(cmd.InputName))
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", cmd.InputName)
|
||||
fmt.Fprintf(ctx.Out, "Unmuted input: %s\n", ctx.Style.Highlight(cmd.InputName))
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// InputVolumeCmd provides a command to set the volume of an input.
|
||||
type InputVolumeCmd struct {
|
||||
InputName string `arg:"" help:"Name of the input to set volume for." required:""`
|
||||
Volume float64 `arg:"" help:"Volume level (-90.0 to 0.0)." required:""`
|
||||
}
|
||||
|
||||
// Run executes the command to set the volume of an input.
|
||||
// accepts values between -90.0 and 0.0 representing decibels (dB).
|
||||
func (cmd *InputVolumeCmd) Run(ctx *context) error {
|
||||
if cmd.Volume < -90.0 || cmd.Volume > 0.0 {
|
||||
return fmt.Errorf("volume must be between -90.0 and 0.0 dB")
|
||||
}
|
||||
|
||||
_, err := ctx.Client.Inputs.SetInputVolume(
|
||||
inputs.NewSetInputVolumeParams().
|
||||
WithInputName(cmd.InputName).
|
||||
WithInputVolumeDb(cmd.Volume),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to set input volume: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Set volume of input %s to %.1f dB\n",
|
||||
ctx.Style.Highlight(cmd.InputName), cmd.Volume)
|
||||
return nil
|
||||
}
|
||||
|
||||
// InputShowCmd provides a command to show input details.
|
||||
type InputShowCmd struct {
|
||||
Name string `arg:"" help:"Name of the input to show." required:""`
|
||||
Verbose bool ` help:"List all available input devices." flag:""`
|
||||
}
|
||||
|
||||
// Run executes the command to show input details.
|
||||
func (cmd *InputShowCmd) Run(ctx *context) error {
|
||||
lresp, err := ctx.Client.Inputs.GetInputList(inputs.NewGetInputListParams())
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get input list: %w", err)
|
||||
}
|
||||
|
||||
var inputKind string
|
||||
var found bool
|
||||
for _, input := range lresp.Inputs {
|
||||
if input.InputName == cmd.Name {
|
||||
inputKind = input.InputKind
|
||||
found = true
|
||||
break
|
||||
}
|
||||
}
|
||||
|
||||
if !found {
|
||||
return fmt.Errorf("input '%s' not found", cmd.Name)
|
||||
}
|
||||
|
||||
prop, name := device(ctx, cmd.Name)
|
||||
if prop == "" {
|
||||
return fmt.Errorf("no device property found for input '%s'", cmd.Name)
|
||||
}
|
||||
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
|
||||
t.Headers("Input Name", "Kind", "Device")
|
||||
t.StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 1:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 2:
|
||||
style = style.Align(lipgloss.Center)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
t.Row(cmd.Name, snakeCaseToTitleCase(inputKind), name)
|
||||
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
|
||||
if cmd.Verbose {
|
||||
deviceListResp, err := ctx.Client.Inputs.GetInputPropertiesListPropertyItems(
|
||||
inputs.NewGetInputPropertiesListPropertyItemsParams().
|
||||
WithInputName(cmd.Name).
|
||||
WithPropertyName(prop),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get device list: %w", err)
|
||||
}
|
||||
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
|
||||
t.StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Left)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
t.Headers("Devices")
|
||||
|
||||
for _, item := range deviceListResp.PropertyItems {
|
||||
if item.ItemName != "" {
|
||||
t.Row(item.ItemName)
|
||||
}
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func device(ctx *context, inputName string) (string, string) {
|
||||
settings, err := ctx.Client.Inputs.GetInputSettings(
|
||||
inputs.NewGetInputSettingsParams().WithInputName(inputName),
|
||||
)
|
||||
if err != nil {
|
||||
return "", ""
|
||||
}
|
||||
|
||||
for _, propName := range []string{"device", "device_id"} {
|
||||
deviceListResp, err := ctx.Client.Inputs.GetInputPropertiesListPropertyItems(
|
||||
inputs.NewGetInputPropertiesListPropertyItemsParams().
|
||||
WithInputName(inputName).
|
||||
WithPropertyName(propName),
|
||||
)
|
||||
if err == nil && len(deviceListResp.PropertyItems) > 0 {
|
||||
for _, item := range deviceListResp.PropertyItems {
|
||||
if item.ItemValue == settings.InputSettings[propName] {
|
||||
return propName, item.ItemName
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return "", ""
|
||||
}
|
||||
|
||||
// InputUpdateCmd provides a command to update input settings.
|
||||
type InputUpdateCmd struct {
|
||||
InputName string `arg:"" help:"Name of the input to update." required:""`
|
||||
DeviceName string `arg:"" help:"Name of the device to set." required:""`
|
||||
}
|
||||
|
||||
// Run executes the command to update input settings.
|
||||
func (cmd *InputUpdateCmd) Run(ctx *context) error {
|
||||
// Use the device helper to find the correct device property name
|
||||
prop, _ := device(ctx, cmd.InputName)
|
||||
if prop == "" {
|
||||
return fmt.Errorf("no device property found for input '%s'", cmd.InputName)
|
||||
}
|
||||
|
||||
resp, err := ctx.Client.Inputs.GetInputPropertiesListPropertyItems(
|
||||
inputs.NewGetInputPropertiesListPropertyItemsParams().
|
||||
WithInputName(cmd.InputName).
|
||||
WithPropertyName(prop),
|
||||
)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
var deviceValue any
|
||||
var found bool
|
||||
for _, item := range resp.PropertyItems {
|
||||
if item.ItemName == cmd.DeviceName {
|
||||
deviceValue = item.ItemValue
|
||||
found = true
|
||||
break
|
||||
}
|
||||
}
|
||||
|
||||
if !found {
|
||||
return fmt.Errorf("device '%s' not found for input '%s'", cmd.DeviceName, cmd.InputName)
|
||||
}
|
||||
|
||||
sresp, err := ctx.Client.Inputs.GetInputSettings(
|
||||
inputs.NewGetInputSettingsParams().WithInputName(cmd.InputName),
|
||||
)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
settings := make(map[string]any)
|
||||
maps.Copy(settings, sresp.InputSettings)
|
||||
settings[prop] = deviceValue
|
||||
|
||||
_, err = ctx.Client.Inputs.SetInputSettings(
|
||||
inputs.NewSetInputSettingsParams().
|
||||
WithInputName(cmd.InputName).
|
||||
WithInputSettings(settings),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to update input settings: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Input %s %s set to %s\n",
|
||||
ctx.Style.Highlight(cmd.InputName), prop, ctx.Style.Highlight(cmd.DeviceName))
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// InputKindDefaultsCmd provides a command to get default settings for an input kind.
|
||||
type InputKindDefaultsCmd struct {
|
||||
Kind string `arg:"" help:"Input kind to get default settings for." required:""`
|
||||
}
|
||||
|
||||
// Run executes the command to get default settings for an input kind.
|
||||
func (cmd *InputKindDefaultsCmd) Run(ctx *context) error {
|
||||
resp, err := ctx.Client.Inputs.GetInputDefaultSettings(
|
||||
inputs.NewGetInputDefaultSettingsParams().
|
||||
WithInputKind(cmd.Kind),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get default settings for input kind '%s': %w", cmd.Kind, err)
|
||||
}
|
||||
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
|
||||
t.Headers("Setting", "Value")
|
||||
t.StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 1:
|
||||
style = style.Align(lipgloss.Center)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
keys := make([]string, 0, len(resp.DefaultInputSettings))
|
||||
for k := range resp.DefaultInputSettings {
|
||||
keys = append(keys, k)
|
||||
}
|
||||
sort.Strings(keys)
|
||||
|
||||
for _, key := range keys {
|
||||
value := resp.DefaultInputSettings[key]
|
||||
t.Row(key, fmt.Sprintf("%v", value))
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -11,10 +11,7 @@ func TestInputList(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &InputListCmd{}
|
||||
err := cmd.Run(context)
|
||||
@@ -25,9 +22,8 @@ func TestInputList(t *testing.T) {
|
||||
expectedInputs := []string{
|
||||
"Desktop Audio",
|
||||
"Mic/Aux",
|
||||
"Colour Source",
|
||||
"Colour Source 2",
|
||||
"Colour Source 3",
|
||||
"gobs-test-input",
|
||||
"gobs-test-input-2",
|
||||
}
|
||||
output := out.String()
|
||||
for _, input := range expectedInputs {
|
||||
@@ -42,10 +38,7 @@ func TestInputListFilterInput(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &InputListCmd{Input: true}
|
||||
err := cmd.Run(context)
|
||||
@@ -58,9 +51,8 @@ func TestInputListFilterInput(t *testing.T) {
|
||||
}
|
||||
expectedFilteredOut := []string{
|
||||
"Desktop Audio",
|
||||
"Colour Source",
|
||||
"Colour Source 2",
|
||||
"Colour Source 3",
|
||||
"gobs-test-input",
|
||||
"gobs-test-input-2",
|
||||
}
|
||||
for _, input := range expectedInputs {
|
||||
if !strings.Contains(out.String(), input) {
|
||||
@@ -79,10 +71,7 @@ func TestInputListFilterOutput(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &InputListCmd{Output: true}
|
||||
err := cmd.Run(context)
|
||||
@@ -95,9 +84,8 @@ func TestInputListFilterOutput(t *testing.T) {
|
||||
}
|
||||
expectedFilteredOut := []string{
|
||||
"Mic/Aux",
|
||||
"Colour Source",
|
||||
"Colour Source 2",
|
||||
"Colour Source 3",
|
||||
"gobs-test-input",
|
||||
"gobs-test-input-2",
|
||||
}
|
||||
for _, input := range expectedInputs {
|
||||
if !strings.Contains(out.String(), input) {
|
||||
@@ -116,10 +104,7 @@ func TestInputListFilterColour(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &InputListCmd{Colour: true}
|
||||
err := cmd.Run(context)
|
||||
@@ -128,9 +113,8 @@ func TestInputListFilterColour(t *testing.T) {
|
||||
}
|
||||
|
||||
expectedInputs := []string{
|
||||
"Colour Source",
|
||||
"Colour Source 2",
|
||||
"Colour Source 3",
|
||||
"gobs-test-input",
|
||||
"gobs-test-input-2",
|
||||
}
|
||||
for _, input := range expectedInputs {
|
||||
if !strings.Contains(out.String(), input) {
|
||||
|
||||
117
main.go
117
main.go
@@ -8,14 +8,30 @@ import (
|
||||
"io"
|
||||
"os"
|
||||
"path/filepath"
|
||||
"runtime/debug"
|
||||
"strings"
|
||||
"time"
|
||||
|
||||
"github.com/alecthomas/kong"
|
||||
mangokong "github.com/alecthomas/mango-kong"
|
||||
"github.com/andreykaipov/goobs"
|
||||
kongcompletion "github.com/jotaen/kong-completion"
|
||||
kongdotenv "github.com/titusjaka/kong-dotenv-go"
|
||||
)
|
||||
|
||||
var version string // Version of the CLI, set at build time.
|
||||
|
||||
// VersionFlag is a custom flag type that prints the version and exits.
|
||||
type VersionFlag string
|
||||
|
||||
func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil } // nolint: revive
|
||||
func (v VersionFlag) IsBool() bool { return true } // nolint: revive
|
||||
func (v VersionFlag) BeforeApply(app *kong.Kong, vars kong.Vars) error { // nolint: revive, unparam
|
||||
fmt.Printf("gobs-cli version: %s\n", vars["version"])
|
||||
app.Exit(0)
|
||||
return nil
|
||||
}
|
||||
|
||||
// ObsConfig holds the configuration for connecting to the OBS WebSocket server.
|
||||
type ObsConfig struct {
|
||||
Host string `flag:"host" help:"Host to connect to." default:"localhost" env:"OBS_HOST" short:"H"`
|
||||
@@ -24,35 +40,56 @@ type ObsConfig struct {
|
||||
Timeout int `flag:"timeout" help:"Timeout in seconds." default:"5" env:"OBS_TIMEOUT" short:"T"`
|
||||
}
|
||||
|
||||
// StyleConfig holds the configuration for styling the CLI output.
|
||||
type StyleConfig struct {
|
||||
Style string `help:"Style used in output." flag:"style" default:"" env:"GOBS_STYLE" short:"s" enum:",red,magenta,purple,blue,cyan,green,yellow,orange,white,grey,navy,black"`
|
||||
NoBorder bool `help:"Disable table border styling in output." flag:"no-border" default:"false" env:"GOBS_STYLE_NO_BORDER" short:"b"`
|
||||
}
|
||||
|
||||
// CLI is the main command line interface structure.
|
||||
// It embeds the ObsConfig struct to inherit its fields and flags.
|
||||
// It embeds ObsConfig and StyleConfig to provide configuration options.
|
||||
type CLI struct {
|
||||
ObsConfig `embed:"" help:"OBS WebSocket configuration."`
|
||||
ObsConfig `embed:"" help:"OBS WebSocket configuration."`
|
||||
StyleConfig `embed:"" help:"Style configuration."`
|
||||
|
||||
Man mangokong.ManFlag `help:"Print man page."`
|
||||
Version VersionFlag `help:"Print gobs-cli version information and quit" name:"version" short:"v"`
|
||||
|
||||
Completion kongcompletion.Completion `help:"Generate shell completion scripts." cmd:"" aliases:"c"`
|
||||
|
||||
ObsVersion ObsVersionCmd `help:"Print OBS client and websocket version." cmd:"" aliases:"v"`
|
||||
Scene SceneCmd `help:"Manage scenes." cmd:"" aliases:"sc"`
|
||||
Sceneitem SceneItemCmd `help:"Manage scene items." cmd:"" aliases:"si"`
|
||||
Group GroupCmd `help:"Manage groups." cmd:"" aliases:"g"`
|
||||
Input InputCmd `help:"Manage inputs." cmd:"" aliases:"i"`
|
||||
Record RecordCmd `help:"Manage recording." cmd:"" aliases:"rec"`
|
||||
Stream StreamCmd `help:"Manage streaming." cmd:"" aliases:"st"`
|
||||
Scenecollection SceneCollectionCmd `help:"Manage scene collections." cmd:"" aliases:"scn"`
|
||||
Profile ProfileCmd `help:"Manage profiles." cmd:"" aliases:"p"`
|
||||
Replaybuffer ReplayBufferCmd `help:"Manage replay buffer." cmd:"" aliases:"rb"`
|
||||
Studiomode StudioModeCmd `help:"Manage studio mode." cmd:"" aliases:"sm"`
|
||||
Virtualcam VirtualCamCmd `help:"Manage virtual camera." cmd:"" aliases:"vc"`
|
||||
Hotkey HotkeyCmd `help:"Manage hotkeys." cmd:"" aliases:"hk"`
|
||||
Filter FilterCmd `help:"Manage filters." cmd:"" aliases:"f"`
|
||||
Projector ProjectorCmd `help:"Manage projectors." cmd:"" aliases:"prj"`
|
||||
Screenshot ScreenshotCmd `help:"Take screenshots." cmd:"" aliases:"ss"`
|
||||
Scene SceneCmd `help:"Manage scenes." cmd:"" aliases:"sc" group:"Scene"`
|
||||
Sceneitem SceneItemCmd `help:"Manage scene items." cmd:"" aliases:"si" group:"Scene Item"`
|
||||
Group GroupCmd `help:"Manage groups." cmd:"" aliases:"g" group:"Group"`
|
||||
Input InputCmd `help:"Manage inputs." cmd:"" aliases:"i" group:"Input"`
|
||||
Text TextCmd `help:"Manage text inputs." cmd:"" aliases:"t" group:"Text Input"`
|
||||
Record RecordCmd `help:"Manage recording." cmd:"" aliases:"rec" group:"Recording"`
|
||||
Stream StreamCmd `help:"Manage streaming." cmd:"" aliases:"st" group:"Streaming"`
|
||||
Scenecollection SceneCollectionCmd `help:"Manage scene collections." cmd:"" aliases:"scn" group:"Scene Collection"`
|
||||
Profile ProfileCmd `help:"Manage profiles." cmd:"" aliases:"p" group:"Profile"`
|
||||
Replaybuffer ReplayBufferCmd `help:"Manage replay buffer." cmd:"" aliases:"rb" group:"Replay Buffer"`
|
||||
Studiomode StudioModeCmd `help:"Manage studio mode." cmd:"" aliases:"sm" group:"Studio Mode"`
|
||||
Virtualcam VirtualCamCmd `help:"Manage virtual camera." cmd:"" aliases:"vc" group:"Virtual Camera"`
|
||||
Hotkey HotkeyCmd `help:"Manage hotkeys." cmd:"" aliases:"hk" group:"Hotkey"`
|
||||
Filter FilterCmd `help:"Manage filters." cmd:"" aliases:"f" group:"Filter"`
|
||||
Projector ProjectorCmd `help:"Manage projectors." cmd:"" aliases:"prj" group:"Projector"`
|
||||
Screenshot ScreenshotCmd `help:"Take screenshots." cmd:"" aliases:"ss" group:"Screenshot"`
|
||||
Settings SettingsCmd `help:"Manage video and profile settings." cmd:"" aliases:"set" group:"Settings"`
|
||||
Media MediaCmd `help:"Manage media inputs." cmd:"" aliases:"mi" group:"Media Input"`
|
||||
}
|
||||
|
||||
type context struct {
|
||||
Client *goobs.Client
|
||||
Out io.Writer
|
||||
Style *Style
|
||||
}
|
||||
|
||||
func newContext(client *goobs.Client, out io.Writer, styleCfg StyleConfig) *context {
|
||||
return &context{
|
||||
Client: client,
|
||||
Out: out,
|
||||
Style: styleFromFlag(styleCfg),
|
||||
}
|
||||
}
|
||||
|
||||
func main() {
|
||||
@@ -63,22 +100,30 @@ func main() {
|
||||
}
|
||||
|
||||
var cli CLI
|
||||
kongcompletion.Register(kong.Must(&cli))
|
||||
ctx := kong.Parse(
|
||||
&cli,
|
||||
kong.Name("GOBS-CLI"),
|
||||
kong.Name("gobs-cli"),
|
||||
kong.Description("A command line tool to interact with OBS Websocket."),
|
||||
kong.Configuration(kongdotenv.ENVFileReader, ".env", filepath.Join(userConfigDir, "gobs-cli", "config.env")),
|
||||
)
|
||||
kong.UsageOnError(),
|
||||
kong.ConfigureHelp(kong.HelpOptions{
|
||||
Compact: true,
|
||||
}),
|
||||
kong.Vars{
|
||||
"version": func() string {
|
||||
if version == "" {
|
||||
info, ok := debug.ReadBuildInfo()
|
||||
if !ok {
|
||||
return "(unable to read build info)"
|
||||
}
|
||||
version = strings.Split(info.Main.Version, "-")[0]
|
||||
}
|
||||
return version
|
||||
}(),
|
||||
})
|
||||
|
||||
client, err := connectObs(cli.ObsConfig)
|
||||
ctx.FatalIfErrorf(err)
|
||||
|
||||
ctx.Bind(&context{
|
||||
Client: client,
|
||||
Out: os.Stdout,
|
||||
})
|
||||
|
||||
ctx.FatalIfErrorf(run(ctx, client))
|
||||
ctx.FatalIfErrorf(run(ctx, cli.ObsConfig, cli.StyleConfig))
|
||||
}
|
||||
|
||||
// connectObs creates a new OBS client and connects to the OBS WebSocket server.
|
||||
@@ -95,8 +140,18 @@ func connectObs(cfg ObsConfig) (*goobs.Client, error) {
|
||||
}
|
||||
|
||||
// run executes the command line interface.
|
||||
// It disconnects the OBS client after the command is executed.
|
||||
func run(ctx *kong.Context, client *goobs.Client) error {
|
||||
// It connects to the OBS WebSocket server and binds the context to the selected command.
|
||||
// It also handles the "completion" command separately to avoid unnecessary connections.
|
||||
func run(ctx *kong.Context, obsCfg ObsConfig, styleCfg StyleConfig) error {
|
||||
if ctx.Selected().Name == "completion" {
|
||||
return ctx.Run()
|
||||
}
|
||||
|
||||
client, err := connectObs(obsCfg)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
defer func() error {
|
||||
if err := client.Disconnect(); err != nil {
|
||||
return fmt.Errorf("failed to disconnect from OBS: %w", err)
|
||||
@@ -104,5 +159,7 @@ func run(ctx *kong.Context, client *goobs.Client) error {
|
||||
return nil
|
||||
}()
|
||||
|
||||
ctx.Bind(newContext(client, os.Stdout, styleCfg))
|
||||
|
||||
return ctx.Run()
|
||||
}
|
||||
|
||||
64
main_test.go
64
main_test.go
@@ -2,7 +2,9 @@ package main
|
||||
|
||||
import (
|
||||
"os"
|
||||
"runtime"
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
"github.com/andreykaipov/goobs"
|
||||
"github.com/andreykaipov/goobs/api/requests/config"
|
||||
@@ -62,13 +64,23 @@ func setup(client *goobs.Client) {
|
||||
Key: os.Getenv("OBS_STREAM_KEY"),
|
||||
}))
|
||||
|
||||
client.Config.SetCurrentSceneCollection(config.NewSetCurrentSceneCollectionParams().
|
||||
WithSceneCollectionName("test-collection"))
|
||||
client.Config.CreateProfile(config.NewCreateProfileParams().
|
||||
WithProfileName("gobs-test-profile"))
|
||||
time.Sleep(100 * time.Millisecond) // Wait for the profile to be created
|
||||
client.Config.SetProfileParameter(config.NewSetProfileParameterParams().
|
||||
WithParameterCategory("SimpleOutput").
|
||||
WithParameterName("RecRB").
|
||||
WithParameterValue("true"))
|
||||
// hack to ensure the Replay Buffer setting is applied
|
||||
client.Config.SetCurrentProfile(config.NewSetCurrentProfileParams().
|
||||
WithProfileName("Untitled"))
|
||||
client.Config.SetCurrentProfile(config.NewSetCurrentProfileParams().
|
||||
WithProfileName("gobs-test-profile"))
|
||||
|
||||
client.Scenes.CreateScene(scenes.NewCreateSceneParams().
|
||||
WithSceneName("gobs-test"))
|
||||
WithSceneName("gobs-test-scene"))
|
||||
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
||||
WithSceneName("gobs-test").
|
||||
WithSceneName("gobs-test-scene").
|
||||
WithInputName("gobs-test-input").
|
||||
WithInputKind("color_source_v3").
|
||||
WithInputSettings(map[string]any{
|
||||
@@ -79,7 +91,7 @@ func setup(client *goobs.Client) {
|
||||
}).
|
||||
WithSceneItemEnabled(true))
|
||||
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
||||
WithSceneName("gobs-test").
|
||||
WithSceneName("gobs-test-scene").
|
||||
WithInputName("gobs-test-input-2").
|
||||
WithInputKind("color_source_v3").
|
||||
WithInputSettings(map[string]any{
|
||||
@@ -90,6 +102,37 @@ func setup(client *goobs.Client) {
|
||||
}).
|
||||
WithSceneItemEnabled(true))
|
||||
|
||||
// ensure Desktop Audio input is created
|
||||
desktopAudioKinds := map[string]string{
|
||||
"windows": "wasapi_output_capture",
|
||||
"linux": "pulse_output_capture",
|
||||
"darwin": "coreaudio_output_capture",
|
||||
}
|
||||
platform := os.Getenv("GOBS_TEST_PLATFORM")
|
||||
if platform == "" {
|
||||
platform = runtime.GOOS
|
||||
}
|
||||
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
||||
WithSceneName("gobs-test-scene").
|
||||
WithInputName("Desktop Audio").
|
||||
WithInputKind(desktopAudioKinds[platform]).
|
||||
WithInputSettings(map[string]any{
|
||||
"device_id": "default",
|
||||
}))
|
||||
// ensure Mic/Aux input is created
|
||||
micKinds := map[string]string{
|
||||
"windows": "wasapi_input_capture",
|
||||
"linux": "pulse_input_capture",
|
||||
"darwin": "coreaudio_input_capture",
|
||||
}
|
||||
client.Inputs.CreateInput(inputs.NewCreateInputParams().
|
||||
WithSceneName("gobs-test-scene").
|
||||
WithInputName("Mic/Aux").
|
||||
WithInputKind(micKinds[platform]).
|
||||
WithInputSettings(map[string]any{
|
||||
"device_id": "default",
|
||||
}))
|
||||
|
||||
// Create source filter on an audio input
|
||||
client.Filters.CreateSourceFilter(filters.NewCreateSourceFilterParams().
|
||||
WithSourceName("Mic/Aux").
|
||||
@@ -106,7 +149,7 @@ func setup(client *goobs.Client) {
|
||||
|
||||
// Create source filter on a scene
|
||||
client.Filters.CreateSourceFilter(filters.NewCreateSourceFilterParams().
|
||||
WithSourceName("gobs-test").
|
||||
WithSourceName("gobs-test-scene").
|
||||
WithFilterName("test_filter").
|
||||
WithFilterKind("luma_key_filter_v2").
|
||||
WithFilterSettings(map[string]any{
|
||||
@@ -115,18 +158,21 @@ func setup(client *goobs.Client) {
|
||||
}
|
||||
|
||||
func teardown(client *goobs.Client) {
|
||||
client.Config.RemoveProfile(config.NewRemoveProfileParams().
|
||||
WithProfileName("gobs-test-profile"))
|
||||
|
||||
client.Filters.RemoveSourceFilter(filters.NewRemoveSourceFilterParams().
|
||||
WithSourceName("Mic/Aux").
|
||||
WithFilterName("test_filter"))
|
||||
client.Filters.RemoveSourceFilter(filters.NewRemoveSourceFilterParams().
|
||||
WithSourceName("gobs-test").
|
||||
WithSourceName("gobs-test-scene").
|
||||
WithFilterName("test_filter"))
|
||||
|
||||
client.Scenes.RemoveScene(scenes.NewRemoveSceneParams().
|
||||
WithSceneName("gobs-test"))
|
||||
WithSceneName("gobs-test-scene"))
|
||||
|
||||
client.Config.SetCurrentSceneCollection(config.NewSetCurrentSceneCollectionParams().
|
||||
WithSceneCollectionName("default"))
|
||||
WithSceneCollectionName("Untitled"))
|
||||
|
||||
client.Stream.StopStream()
|
||||
client.Record.StopRecord()
|
||||
|
||||
140
media.go
Normal file
140
media.go
Normal file
@@ -0,0 +1,140 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/mediainputs"
|
||||
)
|
||||
|
||||
// MediaCmd represents a collection of commands to control media inputs.
|
||||
type MediaCmd struct {
|
||||
Cursor MediaCursorCmd `cmd:"" help:"Get/set the cursor position of a media input." aliases:"c"`
|
||||
Play MediaPlayCmd `cmd:"" help:"Plays a media input." aliases:"p"`
|
||||
Pause MediaPauseCmd `cmd:"" help:"Pauses a media input." aliases:"pa"`
|
||||
Stop MediaStopCmd `cmd:"" help:"Stops a media input." aliases:"s"`
|
||||
Restart MediaRestartCmd `cmd:"" help:"Restarts a media input." aliases:"r"`
|
||||
}
|
||||
|
||||
// MediaCursorCmd represents the command to get or set the cursor position of a media input.
|
||||
type MediaCursorCmd struct {
|
||||
InputName string `arg:"" help:"Name of the media input."`
|
||||
TimeString string `arg:"" help:"Time position to set the cursor to (e.g., '00:01:30' for 1 minute 30 seconds). If not provided, the current cursor position will be displayed." optional:""`
|
||||
}
|
||||
|
||||
// Run executes the command to set the cursor position of the media input.
|
||||
func (cmd *MediaCursorCmd) Run(ctx *context) error {
|
||||
if cmd.TimeString == "" {
|
||||
resp, err := ctx.Client.MediaInputs.GetMediaInputStatus(
|
||||
mediainputs.NewGetMediaInputStatusParams().
|
||||
WithInputName(cmd.InputName))
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get media input cursor: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"%s cursor position: %s\n",
|
||||
ctx.Style.Highlight(cmd.InputName),
|
||||
formatMillisecondsToTimeString(resp.MediaCursor),
|
||||
)
|
||||
return nil
|
||||
}
|
||||
|
||||
position, err := parseTimeStringToMilliseconds(cmd.TimeString)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to parse time string: %w", err)
|
||||
}
|
||||
|
||||
_, err = ctx.Client.MediaInputs.SetMediaInputCursor(
|
||||
mediainputs.NewSetMediaInputCursorParams().
|
||||
WithInputName(cmd.InputName).
|
||||
WithMediaCursor(position))
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to set media input cursor: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"Set %s cursor to %s (%.0f ms)\n",
|
||||
ctx.Style.Highlight(cmd.InputName),
|
||||
ctx.Style.Highlight(cmd.TimeString),
|
||||
position,
|
||||
)
|
||||
return nil
|
||||
}
|
||||
|
||||
// MediaPlayCmd represents the command to play a media input.
|
||||
type MediaPlayCmd struct {
|
||||
InputName string `arg:"" help:"Name of the media input."`
|
||||
}
|
||||
|
||||
// Run executes the command to play the media input.
|
||||
func (cmd *MediaPlayCmd) Run(ctx *context) error {
|
||||
_, err := ctx.Client.MediaInputs.TriggerMediaInputAction(
|
||||
mediainputs.NewTriggerMediaInputActionParams().
|
||||
WithInputName(cmd.InputName).
|
||||
WithMediaAction("OBS_WEBSOCKET_MEDIA_INPUT_ACTION_PLAY"))
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to play media input: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, "Playing media input:", cmd.InputName)
|
||||
return nil
|
||||
}
|
||||
|
||||
// MediaPauseCmd represents the command to pause a media input.
|
||||
type MediaPauseCmd struct {
|
||||
InputName string `arg:"" help:"Name of the media input."`
|
||||
}
|
||||
|
||||
// Run executes the command to pause the media input.
|
||||
func (cmd *MediaPauseCmd) Run(ctx *context) error {
|
||||
_, err := ctx.Client.MediaInputs.TriggerMediaInputAction(
|
||||
mediainputs.NewTriggerMediaInputActionParams().
|
||||
WithInputName(cmd.InputName).
|
||||
WithMediaAction("OBS_WEBSOCKET_MEDIA_INPUT_ACTION_PAUSE"))
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to pause media input: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, "Pausing media input:", cmd.InputName)
|
||||
return nil
|
||||
}
|
||||
|
||||
// MediaStopCmd represents the command to stop a media input.
|
||||
type MediaStopCmd struct {
|
||||
InputName string `arg:"" help:"Name of the media input."`
|
||||
}
|
||||
|
||||
// Run executes the command to stop the media input.
|
||||
func (cmd *MediaStopCmd) Run(ctx *context) error {
|
||||
_, err := ctx.Client.MediaInputs.TriggerMediaInputAction(
|
||||
mediainputs.NewTriggerMediaInputActionParams().
|
||||
WithInputName(cmd.InputName).
|
||||
WithMediaAction("OBS_WEBSOCKET_MEDIA_INPUT_ACTION_STOP"))
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to stop media input: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, "Stopping media input:", cmd.InputName)
|
||||
return nil
|
||||
}
|
||||
|
||||
// MediaRestartCmd represents the command to restart a media input.
|
||||
type MediaRestartCmd struct {
|
||||
InputName string `arg:"" help:"Name of the media input."`
|
||||
}
|
||||
|
||||
// Run executes the command to restart the media input.
|
||||
func (cmd *MediaRestartCmd) Run(ctx *context) error {
|
||||
_, err := ctx.Client.MediaInputs.TriggerMediaInputAction(
|
||||
mediainputs.NewTriggerMediaInputActionParams().
|
||||
WithInputName(cmd.InputName).
|
||||
WithMediaAction("OBS_WEBSOCKET_MEDIA_INPUT_ACTION_RESTART"))
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to restart media input: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, "Restarting media input:", cmd.InputName)
|
||||
return nil
|
||||
}
|
||||
62
profile.go
62
profile.go
@@ -5,7 +5,8 @@ import (
|
||||
"slices"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/config"
|
||||
"github.com/aquasecurity/table"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// ProfileCmd provides commands to manage profiles in OBS Studio.
|
||||
@@ -21,16 +22,34 @@ type ProfileCmd struct {
|
||||
type ProfileListCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to list all profiles.
|
||||
// nolint: misspell
|
||||
func (cmd *ProfileListCmd) Run(ctx *context) error {
|
||||
profiles, err := ctx.Client.Config.GetProfileList()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
t := table.New(ctx.Out)
|
||||
t.SetPadding(3)
|
||||
t.SetAlignment(table.AlignLeft, table.AlignCenter)
|
||||
t.SetHeaders("Profile Name", "Current")
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||
Headers("Profile Name", "Current").
|
||||
StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 1:
|
||||
style = style.Align(lipgloss.Center)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
for _, profile := range profiles.Profiles {
|
||||
var enabledMark string
|
||||
@@ -38,9 +57,9 @@ func (cmd *ProfileListCmd) Run(ctx *context) error {
|
||||
enabledMark = getEnabledMark(true)
|
||||
}
|
||||
|
||||
t.AddRow(profile, enabledMark)
|
||||
t.Row(profile, enabledMark)
|
||||
}
|
||||
t.Render()
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -53,7 +72,7 @@ func (cmd *ProfileCurrentCmd) Run(ctx *context) error {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
fmt.Fprintf(ctx.Out, "Current profile: %s\n", profiles.CurrentProfileName)
|
||||
fmt.Fprintf(ctx.Out, "Current profile: %s\n", ctx.Style.Highlight(profiles.CurrentProfileName))
|
||||
|
||||
return nil
|
||||
}
|
||||
@@ -72,15 +91,20 @@ func (cmd *ProfileSwitchCmd) Run(ctx *context) error {
|
||||
current := profiles.CurrentProfileName
|
||||
|
||||
if current == cmd.Name {
|
||||
return nil
|
||||
return fmt.Errorf("already using profile %s", ctx.Style.Error(cmd.Name))
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Config.SetCurrentProfile(config.NewSetCurrentProfileParams().WithProfileName(cmd.Name))
|
||||
if err != nil {
|
||||
return err
|
||||
return fmt.Errorf("failed to switch to profile %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Switched from profile %s to %s\n", current, cmd.Name)
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"Switched from profile %s to %s\n",
|
||||
ctx.Style.Highlight(current),
|
||||
ctx.Style.Highlight(cmd.Name),
|
||||
)
|
||||
|
||||
return nil
|
||||
}
|
||||
@@ -98,15 +122,15 @@ func (cmd *ProfileCreateCmd) Run(ctx *context) error {
|
||||
}
|
||||
|
||||
if slices.Contains(profiles.Profiles, cmd.Name) {
|
||||
return fmt.Errorf("profile %s already exists", cmd.Name)
|
||||
return fmt.Errorf("profile %s already exists", ctx.Style.Error(cmd.Name))
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Config.CreateProfile(config.NewCreateProfileParams().WithProfileName(cmd.Name))
|
||||
if err != nil {
|
||||
return err
|
||||
return fmt.Errorf("failed to create profile %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Created profile: %s\n", cmd.Name)
|
||||
fmt.Fprintf(ctx.Out, "Created profile: %s\n", ctx.Style.Highlight(cmd.Name))
|
||||
|
||||
return nil
|
||||
}
|
||||
@@ -124,19 +148,21 @@ func (cmd *ProfileRemoveCmd) Run(ctx *context) error {
|
||||
}
|
||||
|
||||
if !slices.Contains(profiles.Profiles, cmd.Name) {
|
||||
return fmt.Errorf("profile %s does not exist", cmd.Name)
|
||||
return fmt.Errorf("profile %s does not exist", ctx.Style.Error(cmd.Name))
|
||||
}
|
||||
|
||||
// Prevent deletion of the current profile
|
||||
// This is allowed in OBS Studio (with a confirmation prompt), but we want to prevent it here
|
||||
if profiles.CurrentProfileName == cmd.Name {
|
||||
return fmt.Errorf("cannot delete current profile %s", cmd.Name)
|
||||
return fmt.Errorf("cannot delete current profile %s", ctx.Style.Error(cmd.Name))
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Config.RemoveProfile(config.NewRemoveProfileParams().WithProfileName(cmd.Name))
|
||||
if err != nil {
|
||||
return err
|
||||
return fmt.Errorf("failed to delete profile %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Deleted profile: %s\n", cmd.Name)
|
||||
fmt.Fprintf(ctx.Out, "Deleted profile: %s\n", ctx.Style.Highlight(cmd.Name))
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
63
projector.go
63
projector.go
@@ -4,7 +4,8 @@ import (
|
||||
"fmt"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/ui"
|
||||
"github.com/aquasecurity/table"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// ProjectorCmd provides a command to manage projectors in OBS.
|
||||
@@ -17,6 +18,7 @@ type ProjectorCmd struct {
|
||||
type ProjectorListMonitorsCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to list all monitors available for projectors.
|
||||
// nolint: misspell
|
||||
func (cmd *ProjectorListMonitorsCmd) Run(ctx *context) error {
|
||||
monitors, err := ctx.Client.Ui.GetMonitorList()
|
||||
if err != nil {
|
||||
@@ -24,20 +26,37 @@ func (cmd *ProjectorListMonitorsCmd) Run(ctx *context) error {
|
||||
}
|
||||
|
||||
if len(monitors.Monitors) == 0 {
|
||||
ctx.Out.Write([]byte("No monitors found for projectors.\n"))
|
||||
fmt.Fprintf(ctx.Out, "No monitors found.\n")
|
||||
return nil
|
||||
}
|
||||
|
||||
t := table.New(ctx.Out)
|
||||
t.SetPadding(3)
|
||||
t.SetAlignment(table.AlignCenter, table.AlignLeft)
|
||||
t.SetHeaders("Monitor ID", "Monitor Name")
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||
Headers("Monitor ID", "Monitor Name").
|
||||
StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Center)
|
||||
case 1:
|
||||
style = style.Align(lipgloss.Left)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
for _, monitor := range monitors.Monitors {
|
||||
t.AddRow(fmt.Sprintf("%d", monitor.MonitorIndex), monitor.MonitorName)
|
||||
t.Row(fmt.Sprintf("%d", monitor.MonitorIndex), monitor.MonitorName)
|
||||
}
|
||||
|
||||
t.Render()
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -57,10 +76,36 @@ func (cmd *ProjectorOpenCmd) Run(ctx *context) error {
|
||||
cmd.SourceName = currentScene.SceneName
|
||||
}
|
||||
|
||||
monitors, err := ctx.Client.Ui.GetMonitorList()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
var monitorName string
|
||||
for _, monitor := range monitors.Monitors {
|
||||
if monitor.MonitorIndex == cmd.MonitorIndex {
|
||||
monitorName = monitor.MonitorName
|
||||
break
|
||||
}
|
||||
}
|
||||
|
||||
if monitorName == "" {
|
||||
return fmt.Errorf(
|
||||
"monitor with index %s not found. use %s to list available monitors",
|
||||
ctx.Style.Error(fmt.Sprintf("%d", cmd.MonitorIndex)),
|
||||
ctx.Style.Error("gobs-cli prj ls-m"),
|
||||
)
|
||||
}
|
||||
|
||||
ctx.Client.Ui.OpenSourceProjector(ui.NewOpenSourceProjectorParams().
|
||||
WithSourceName(cmd.SourceName).
|
||||
WithMonitorIndex(cmd.MonitorIndex))
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Opened projector for source '%s' on monitor index %d.\n", cmd.SourceName, cmd.MonitorIndex)
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"Opened projector for source %s on monitor %s.\n",
|
||||
ctx.Style.Highlight(cmd.SourceName),
|
||||
ctx.Style.Highlight(monitorName),
|
||||
)
|
||||
return nil
|
||||
}
|
||||
|
||||
92
record.go
92
record.go
@@ -4,17 +4,20 @@ import (
|
||||
"fmt"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/config"
|
||||
"github.com/andreykaipov/goobs/api/requests/record"
|
||||
)
|
||||
|
||||
// RecordCmd handles the recording commands.
|
||||
type RecordCmd struct {
|
||||
Start RecordStartCmd `cmd:"" help:"Start recording." aliases:"s"`
|
||||
Stop RecordStopCmd `cmd:"" help:"Stop recording." aliases:"st"`
|
||||
Toggle RecordToggleCmd `cmd:"" help:"Toggle recording." aliases:"tg"`
|
||||
Status RecordStatusCmd `cmd:"" help:"Show recording status." aliases:"ss"`
|
||||
Pause RecordPauseCmd `cmd:"" help:"Pause recording." aliases:"p"`
|
||||
Resume RecordResumeCmd `cmd:"" help:"Resume recording." aliases:"r"`
|
||||
Directory RecordDirectoryCmd `cmd:"" help:"Get/Set recording directory." aliases:"d"`
|
||||
Start RecordStartCmd `cmd:"" help:"Start recording." aliases:"s"`
|
||||
Stop RecordStopCmd `cmd:"" help:"Stop recording." aliases:"st"`
|
||||
Toggle RecordToggleCmd `cmd:"" help:"Toggle recording." aliases:"tg"`
|
||||
Status RecordStatusCmd `cmd:"" help:"Show recording status." aliases:"ss"`
|
||||
Pause RecordPauseCmd `cmd:"" help:"Pause recording." aliases:"p"`
|
||||
Resume RecordResumeCmd `cmd:"" help:"Resume recording." aliases:"r"`
|
||||
Directory RecordDirectoryCmd `cmd:"" help:"Get/Set recording directory." aliases:"d"`
|
||||
Split RecordSplitCmd `cmd:"" help:"Split recording." aliases:"sp"`
|
||||
Chapter RecordChapterCmd `cmd:"" help:"Create a chapter in the recording." aliases:"c"`
|
||||
}
|
||||
|
||||
// RecordStartCmd starts the recording.
|
||||
@@ -60,7 +63,11 @@ func (cmd *RecordStopCmd) Run(ctx *context) error {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
fmt.Fprintf(ctx.Out, "%s", fmt.Sprintf("Recording stopped successfully. Output file: %s\n", resp.OutputPath))
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"%s",
|
||||
fmt.Sprintf("Recording stopped successfully. Output file: %s\n", ctx.Style.Highlight(resp.OutputPath)),
|
||||
)
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -169,7 +176,7 @@ func (cmd *RecordDirectoryCmd) Run(ctx *context) error {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
fmt.Fprintf(ctx.Out, "Current recording directory: %s\n", resp.RecordDirectory)
|
||||
fmt.Fprintf(ctx.Out, "Current recording directory: %s\n", ctx.Style.Highlight(resp.RecordDirectory))
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -180,6 +187,71 @@ func (cmd *RecordDirectoryCmd) Run(ctx *context) error {
|
||||
return err
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Recording directory set to: %s\n", cmd.RecordDirectory)
|
||||
fmt.Fprintf(ctx.Out, "Recording directory set to: %s\n", ctx.Style.Highlight(cmd.RecordDirectory))
|
||||
return nil
|
||||
}
|
||||
|
||||
// RecordSplitCmd splits the current recording.
|
||||
type RecordSplitCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to split the recording.
|
||||
func (cmd *RecordSplitCmd) Run(ctx *context) error {
|
||||
status, err := ctx.Client.Record.GetRecordStatus()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if !status.OutputActive {
|
||||
return fmt.Errorf("recording is not in progress")
|
||||
}
|
||||
if status.OutputPaused {
|
||||
return fmt.Errorf("recording is paused, cannot split")
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Record.SplitRecordFile()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, "Recording split successfully.")
|
||||
return nil
|
||||
}
|
||||
|
||||
// RecordChapterCmd creates a chapter in the recording.
|
||||
type RecordChapterCmd struct {
|
||||
ChapterName string `arg:"" help:"Name of the chapter to create." default:""`
|
||||
}
|
||||
|
||||
// Run executes the command to create a chapter in the recording.
|
||||
func (cmd *RecordChapterCmd) Run(ctx *context) error {
|
||||
status, err := ctx.Client.Record.GetRecordStatus()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if !status.OutputActive {
|
||||
return fmt.Errorf("recording is not in progress")
|
||||
}
|
||||
if status.OutputPaused {
|
||||
return fmt.Errorf("recording is paused, cannot create chapter")
|
||||
}
|
||||
|
||||
var params *record.CreateRecordChapterParams
|
||||
if cmd.ChapterName == "" {
|
||||
params = record.NewCreateRecordChapterParams()
|
||||
} else {
|
||||
params = record.NewCreateRecordChapterParams().WithChapterName(cmd.ChapterName)
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Record.CreateRecordChapter(params)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if cmd.ChapterName == "" {
|
||||
cmd.ChapterName = "unnamed"
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Chapter %s created successfully.\n", ctx.Style.Highlight(cmd.ChapterName))
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -12,10 +12,7 @@ func TestRecordStart(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdStatus := &RecordStatusCmd{}
|
||||
err := cmdStatus.Run(context)
|
||||
@@ -47,7 +44,7 @@ func TestRecordStart(t *testing.T) {
|
||||
if out.String() != "Recording started successfully.\n" {
|
||||
t.Fatalf("Expected output to contain 'Recording started successfully.', got '%s'", out.String())
|
||||
}
|
||||
time.Sleep(1 * time.Second) // Wait for the recording to start
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the recording to start
|
||||
}
|
||||
|
||||
func TestRecordStop(t *testing.T) {
|
||||
@@ -55,10 +52,7 @@ func TestRecordStop(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdStatus := &RecordStatusCmd{}
|
||||
err := cmdStatus.Run(context)
|
||||
@@ -90,7 +84,7 @@ func TestRecordStop(t *testing.T) {
|
||||
if !strings.Contains(out.String(), "Recording stopped successfully. Output file: ") {
|
||||
t.Fatalf("Expected output to contain 'Recording stopped successfully. Output file: ', got '%s'", out.String())
|
||||
}
|
||||
time.Sleep(1 * time.Second) // Wait for the recording to stop
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the recording to stop
|
||||
}
|
||||
|
||||
func TestRecordToggle(t *testing.T) {
|
||||
@@ -98,10 +92,7 @@ func TestRecordToggle(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdStatus := &RecordStatusCmd{}
|
||||
err := cmdStatus.Run(context)
|
||||
@@ -121,8 +112,6 @@ func TestRecordToggle(t *testing.T) {
|
||||
t.Fatalf("Failed to toggle recording: %v", err)
|
||||
}
|
||||
|
||||
time.Sleep(1 * time.Second) // Wait for a second to ensure toggle has taken effect
|
||||
|
||||
if active {
|
||||
if out.String() != "Recording stopped successfully.\n" {
|
||||
t.Fatalf("Expected output to be 'Recording stopped successfully.', got '%s'", out.String())
|
||||
@@ -132,4 +121,5 @@ func TestRecordToggle(t *testing.T) {
|
||||
t.Fatalf("Expected output to be 'Recording started successfully.', got '%s'", out.String())
|
||||
}
|
||||
}
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the toggle to take effect
|
||||
}
|
||||
|
||||
@@ -2,19 +2,26 @@ package main
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"os"
|
||||
"strings"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
func skipIfSkipReplayBufferTests(t *testing.T) {
|
||||
if os.Getenv("GOBS_TEST_SKIP_REPLAYBUFFER_TESTS") != "" {
|
||||
t.Skip("Skipping replay buffer tests due to GOBS_TEST_SKIP_REPLAYBUFFER_TESTS environment variable")
|
||||
}
|
||||
}
|
||||
|
||||
func TestReplayBufferStart(t *testing.T) {
|
||||
skipIfSkipReplayBufferTests(t)
|
||||
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &ReplayBufferStartCmd{}
|
||||
err := cmd.Run(context)
|
||||
@@ -24,17 +31,17 @@ func TestReplayBufferStart(t *testing.T) {
|
||||
if out.String() != "Replay buffer started.\n" {
|
||||
t.Fatalf("Expected output to be 'Replay buffer started', got '%s'", out.String())
|
||||
}
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the replay buffer to start
|
||||
}
|
||||
|
||||
func TestReplayBufferStop(t *testing.T) {
|
||||
skipIfSkipReplayBufferTests(t)
|
||||
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &ReplayBufferStopCmd{}
|
||||
err := cmd.Run(context)
|
||||
@@ -44,17 +51,17 @@ func TestReplayBufferStop(t *testing.T) {
|
||||
if out.String() != "Replay buffer stopped.\n" {
|
||||
t.Fatalf("Expected output to be 'Replay buffer stopped.', got '%s'", out.String())
|
||||
}
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the replay buffer to stop
|
||||
}
|
||||
|
||||
func TestReplayBufferToggle(t *testing.T) {
|
||||
skipIfSkipReplayBufferTests(t)
|
||||
|
||||
client, disconnect := getClient(t)
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdStatus := &ReplayBufferStatusCmd{}
|
||||
err := cmdStatus.Run(context)
|
||||
@@ -82,4 +89,5 @@ func TestReplayBufferToggle(t *testing.T) {
|
||||
t.Fatalf("Expected output to be 'Replay buffer started.', got '%s'", out.String())
|
||||
}
|
||||
}
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the toggle to take effect
|
||||
}
|
||||
|
||||
64
scene.go
64
scene.go
@@ -5,7 +5,8 @@ import (
|
||||
"slices"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/scenes"
|
||||
"github.com/aquasecurity/table"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// SceneCmd provides commands to manage scenes in OBS Studio.
|
||||
@@ -16,25 +17,64 @@ type SceneCmd struct {
|
||||
}
|
||||
|
||||
// SceneListCmd provides a command to list all scenes.
|
||||
type SceneListCmd struct{} // size = 0x0
|
||||
type SceneListCmd struct {
|
||||
UUID bool `flag:"" help:"Display UUIDs of scenes."`
|
||||
}
|
||||
|
||||
// Run executes the command to list all scenes.
|
||||
// nolint: misspell
|
||||
func (cmd *SceneListCmd) Run(ctx *context) error {
|
||||
scenes, err := ctx.Client.Scenes.GetSceneList()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
t := table.New(ctx.Out)
|
||||
t.SetPadding(3)
|
||||
t.SetAlignment(table.AlignLeft, table.AlignLeft)
|
||||
t.SetHeaders("Scene Name", "UUID")
|
||||
currentScene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
|
||||
if cmd.UUID {
|
||||
t.Headers("Scene Name", "Active", "UUID")
|
||||
} else {
|
||||
t.Headers("Scene Name", "Active")
|
||||
}
|
||||
t.StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 1:
|
||||
style = style.Align(lipgloss.Center)
|
||||
case 2:
|
||||
style = style.Align(lipgloss.Left)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
slices.Reverse(scenes.Scenes)
|
||||
for _, scene := range scenes.Scenes {
|
||||
t.AddRow(scene.SceneName, scene.SceneUuid)
|
||||
var activeMark string
|
||||
if scene.SceneName == currentScene.SceneName {
|
||||
activeMark = getEnabledMark(true)
|
||||
}
|
||||
if cmd.UUID {
|
||||
t.Row(scene.SceneName, activeMark, scene.SceneUuid)
|
||||
} else {
|
||||
t.Row(scene.SceneName, activeMark)
|
||||
}
|
||||
}
|
||||
t.Render()
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -50,13 +90,13 @@ func (cmd *SceneCurrentCmd) Run(ctx *context) error {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
fmt.Fprintln(ctx.Out, scene.SceneName)
|
||||
fmt.Fprintf(ctx.Out, "Current preview scene: %s\n", ctx.Style.Highlight(scene.SceneName))
|
||||
} else {
|
||||
scene, err := ctx.Client.Scenes.GetCurrentProgramScene()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
fmt.Fprintln(ctx.Out, scene.SceneName)
|
||||
fmt.Fprintf(ctx.Out, "Current program scene: %s\n", ctx.Style.Highlight(scene.SceneName))
|
||||
}
|
||||
return nil
|
||||
}
|
||||
@@ -76,7 +116,7 @@ func (cmd *SceneSwitchCmd) Run(ctx *context) error {
|
||||
return err
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, "Switched to preview scene:", cmd.NewScene)
|
||||
fmt.Fprintf(ctx.Out, "Switched to preview scene: %s\n", ctx.Style.Highlight(cmd.NewScene))
|
||||
} else {
|
||||
_, err := ctx.Client.Scenes.SetCurrentProgramScene(scenes.NewSetCurrentProgramSceneParams().
|
||||
WithSceneName(cmd.NewScene))
|
||||
@@ -84,7 +124,7 @@ func (cmd *SceneSwitchCmd) Run(ctx *context) error {
|
||||
return err
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, "Switched to program scene:", cmd.NewScene)
|
||||
fmt.Fprintf(ctx.Out, "Switched to program scene: %s\n", ctx.Style.Highlight(cmd.NewScene))
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -2,7 +2,6 @@ package main
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"strings"
|
||||
"testing"
|
||||
)
|
||||
|
||||
@@ -11,18 +10,15 @@ func TestSceneList(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &SceneListCmd{}
|
||||
err := cmd.Run(context)
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to list scenes: %v", err)
|
||||
}
|
||||
if !strings.Contains(out.String(), "gobs-test") {
|
||||
t.Fatalf("Expected output to contain 'gobs-test', got '%s'", out.String())
|
||||
if out.String() == "Current program scene: gobs-test-scene\n" {
|
||||
t.Fatalf("Expected output to be 'Current program scene: gobs-test-scene', got '%s'", out.String())
|
||||
}
|
||||
}
|
||||
|
||||
@@ -31,14 +27,11 @@ func TestSceneCurrent(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
// Set the current scene to "gobs-test"
|
||||
// Set the current scene to "gobs-test-scene"
|
||||
cmdSwitch := &SceneSwitchCmd{
|
||||
NewScene: "gobs-test",
|
||||
NewScene: "gobs-test-scene",
|
||||
}
|
||||
err := cmdSwitch.Run(context)
|
||||
if err != nil {
|
||||
@@ -52,7 +45,7 @@ func TestSceneCurrent(t *testing.T) {
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to get current scene: %v", err)
|
||||
}
|
||||
if out.String() != "gobs-test\n" {
|
||||
t.Fatalf("Expected output to contain 'gobs-test', got '%s'", out.String())
|
||||
if out.String() != "Current program scene: gobs-test-scene\n" {
|
||||
t.Fatalf("Expected output to be 'Current program scene: gobs-test-scene', got '%s'", out.String())
|
||||
}
|
||||
}
|
||||
|
||||
@@ -4,7 +4,8 @@ import (
|
||||
"fmt"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/config"
|
||||
"github.com/aquasecurity/table"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// SceneCollectionCmd provides commands to manage scene collections in OBS Studio.
|
||||
@@ -19,21 +20,37 @@ type SceneCollectionCmd struct {
|
||||
type SceneCollectionListCmd struct{} // size = 0x0
|
||||
|
||||
// Run executes the command to list all scene collections.
|
||||
// nolint: misspell
|
||||
func (cmd *SceneCollectionListCmd) Run(ctx *context) error {
|
||||
collections, err := ctx.Client.Config.GetSceneCollectionList()
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get scene collection list: %w", err)
|
||||
}
|
||||
|
||||
t := table.New(ctx.Out)
|
||||
t.SetPadding(3)
|
||||
t.SetAlignment(table.AlignLeft)
|
||||
t.SetHeaders("Scene Collection Name")
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||
Headers("Scene Collection Name").
|
||||
StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Left)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
for _, collection := range collections.SceneCollections {
|
||||
t.AddRow(collection)
|
||||
t.Row(collection)
|
||||
}
|
||||
t.Render()
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -65,17 +82,17 @@ func (cmd *SceneCollectionSwitchCmd) Run(ctx *context) error {
|
||||
current := collections.CurrentSceneCollectionName
|
||||
|
||||
if current == cmd.Name {
|
||||
return fmt.Errorf("scene collection %s is already active", cmd.Name)
|
||||
return fmt.Errorf("scene collection %s is already active", ctx.Style.Error(cmd.Name))
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Config.SetCurrentSceneCollection(
|
||||
config.NewSetCurrentSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to switch scene collection: %w", err)
|
||||
return fmt.Errorf("failed to switch scene collection %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Switched to scene collection: %s\n", cmd.Name)
|
||||
fmt.Fprintf(ctx.Out, "Switched to scene collection: %s\n", ctx.Style.Highlight(cmd.Name))
|
||||
|
||||
return nil
|
||||
}
|
||||
@@ -91,9 +108,9 @@ func (cmd *SceneCollectionCreateCmd) Run(ctx *context) error {
|
||||
config.NewCreateSceneCollectionParams().WithSceneCollectionName(cmd.Name),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to create scene collection: %w", err)
|
||||
return fmt.Errorf("failed to create scene collection %s: %w", ctx.Style.Error(cmd.Name), err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Created scene collection: %s\n", cmd.Name)
|
||||
fmt.Fprintf(ctx.Out, "Created scene collection: %s\n", ctx.Style.Highlight(cmd.Name))
|
||||
return nil
|
||||
}
|
||||
|
||||
153
sceneitem.go
153
sceneitem.go
@@ -1,3 +1,4 @@
|
||||
// nolint: misspell
|
||||
package main
|
||||
|
||||
import (
|
||||
@@ -6,7 +7,8 @@ import (
|
||||
|
||||
"github.com/andreykaipov/goobs"
|
||||
"github.com/andreykaipov/goobs/api/requests/sceneitems"
|
||||
"github.com/aquasecurity/table"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// SceneItemCmd provides commands to manage scene items in OBS Studio.
|
||||
@@ -21,7 +23,8 @@ type SceneItemCmd struct {
|
||||
|
||||
// SceneItemListCmd provides a command to list all scene items in a scene.
|
||||
type SceneItemListCmd struct {
|
||||
SceneName string `arg:"" help:"Name of the scene to list items from." default:""`
|
||||
UUID bool `flag:"" help:"Display UUIDs of scene items."`
|
||||
SceneName string ` help:"Name of the scene to list items from." arg:"" default:""`
|
||||
}
|
||||
|
||||
// Run executes the command to list all scene items in a scene.
|
||||
@@ -41,14 +44,41 @@ func (cmd *SceneItemListCmd) Run(ctx *context) error {
|
||||
}
|
||||
|
||||
if len(resp.SceneItems) == 0 {
|
||||
fmt.Fprintf(ctx.Out, "No scene items found in scene '%s'.\n", cmd.SceneName)
|
||||
fmt.Fprintf(ctx.Out, "No scene items found in scene %s.\n", ctx.Style.Highlight(cmd.SceneName))
|
||||
return nil
|
||||
}
|
||||
|
||||
t := table.New(ctx.Out)
|
||||
t.SetPadding(3)
|
||||
t.SetAlignment(table.AlignCenter, table.AlignLeft, table.AlignCenter, table.AlignCenter)
|
||||
t.SetHeaders("Item ID", "Item Name", "In Group", "Enabled")
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border))
|
||||
if cmd.UUID {
|
||||
t.Headers("Item ID", "Item Name", "In Group", "Enabled", "UUID")
|
||||
} else {
|
||||
t.Headers("Item ID", "Item Name", "In Group", "Enabled")
|
||||
}
|
||||
t.StyleFunc(func(row, col int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch col {
|
||||
case 0:
|
||||
style = style.Align(lipgloss.Center)
|
||||
case 1:
|
||||
style = style.Align(lipgloss.Left)
|
||||
case 2:
|
||||
style = style.Align(lipgloss.Center)
|
||||
case 3:
|
||||
style = style.Align(lipgloss.Center)
|
||||
case 4:
|
||||
style = style.Align(lipgloss.Left)
|
||||
}
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
sort.Slice(resp.SceneItems, func(i, j int) bool {
|
||||
return resp.SceneItems[i].SceneItemID < resp.SceneItems[j].SceneItemID
|
||||
@@ -59,7 +89,11 @@ func (cmd *SceneItemListCmd) Run(ctx *context) error {
|
||||
resp, err := ctx.Client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
|
||||
WithSceneName(item.SourceName))
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get group scene item list for '%s': %w", item.SourceName, err)
|
||||
return fmt.Errorf(
|
||||
"failed to get group scene item list for group %s: %w",
|
||||
ctx.Style.Error(item.SourceName),
|
||||
err,
|
||||
)
|
||||
}
|
||||
|
||||
sort.Slice(resp.SceneItems, func(i, j int) bool {
|
||||
@@ -67,30 +101,45 @@ func (cmd *SceneItemListCmd) Run(ctx *context) error {
|
||||
})
|
||||
|
||||
for _, groupItem := range resp.SceneItems {
|
||||
t.AddRow(
|
||||
fmt.Sprintf("%d", groupItem.SceneItemID),
|
||||
groupItem.SourceName,
|
||||
item.SourceName,
|
||||
fmt.Sprintf("%t", item.SceneItemEnabled && groupItem.SceneItemEnabled),
|
||||
)
|
||||
if cmd.UUID {
|
||||
t.Row(
|
||||
fmt.Sprintf("%d", groupItem.SceneItemID),
|
||||
groupItem.SourceName,
|
||||
item.SourceName,
|
||||
getEnabledMark(item.SceneItemEnabled && groupItem.SceneItemEnabled),
|
||||
groupItem.SourceUuid,
|
||||
)
|
||||
} else {
|
||||
t.Row(
|
||||
fmt.Sprintf("%d", groupItem.SceneItemID),
|
||||
groupItem.SourceName,
|
||||
item.SourceName,
|
||||
getEnabledMark(item.SceneItemEnabled && groupItem.SceneItemEnabled),
|
||||
)
|
||||
}
|
||||
}
|
||||
} else {
|
||||
t.AddRow(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, "", fmt.Sprintf("%t", item.SceneItemEnabled))
|
||||
if cmd.UUID {
|
||||
t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, "",
|
||||
getEnabledMark(item.SceneItemEnabled), item.SourceUuid)
|
||||
} else {
|
||||
t.Row(fmt.Sprintf("%d", item.SceneItemID), item.SourceName, "", getEnabledMark(item.SceneItemEnabled))
|
||||
}
|
||||
}
|
||||
}
|
||||
t.Render()
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
// getSceneNameAndItemID retrieves the scene name and item ID for a given item in a scene or group.
|
||||
func getSceneNameAndItemID(
|
||||
client *goobs.Client,
|
||||
ctx *context,
|
||||
sceneName string,
|
||||
itemName string,
|
||||
group string,
|
||||
) (string, int, error) {
|
||||
if group != "" {
|
||||
resp, err := client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
|
||||
resp, err := ctx.Client.SceneItems.GetGroupSceneItemList(sceneitems.NewGetGroupSceneItemListParams().
|
||||
WithSceneName(group))
|
||||
if err != nil {
|
||||
return "", 0, err
|
||||
@@ -100,13 +149,22 @@ func getSceneNameAndItemID(
|
||||
return group, int(item.SceneItemID), nil
|
||||
}
|
||||
}
|
||||
return "", 0, fmt.Errorf("item '%s' not found in scene '%s'", itemName, sceneName)
|
||||
return "", 0, fmt.Errorf("item %s not found in scene %s", ctx.Style.Error(itemName), ctx.Style.Error(sceneName))
|
||||
}
|
||||
|
||||
itemID, err := client.SceneItems.GetSceneItemId(sceneitems.NewGetSceneItemIdParams().
|
||||
itemID, err := ctx.Client.SceneItems.GetSceneItemId(sceneitems.NewGetSceneItemIdParams().
|
||||
WithSceneName(sceneName).
|
||||
WithSourceName(itemName))
|
||||
if err != nil {
|
||||
if err.Error() == "request GetSceneItemId: ResourceNotFound (600): No scene items were found in the specified scene by that name or offset." {
|
||||
return "", 0, fmt.Errorf(
|
||||
"item %s not found in scene %s. is it in a group? if so use the %s flag to specify the parent group\nuse %s for a list of items in the scene",
|
||||
ctx.Style.Error(itemName),
|
||||
ctx.Style.Error(sceneName),
|
||||
ctx.Style.Error("--group"),
|
||||
ctx.Style.Error("gobs-cli si ls"),
|
||||
)
|
||||
}
|
||||
return "", 0, err
|
||||
}
|
||||
return sceneName, int(itemID.SceneItemId), nil
|
||||
@@ -122,7 +180,7 @@ type SceneItemShowCmd struct {
|
||||
|
||||
// Run executes the command to show a scene item.
|
||||
func (cmd *SceneItemShowCmd) Run(ctx *context) error {
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
@@ -136,9 +194,14 @@ func (cmd *SceneItemShowCmd) Run(ctx *context) error {
|
||||
}
|
||||
|
||||
if cmd.Group != "" {
|
||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' is now visible.\n", cmd.ItemName, cmd.Group)
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"Scene item %s in group %s is now visible.\n",
|
||||
ctx.Style.Highlight(cmd.ItemName),
|
||||
ctx.Style.Highlight(cmd.Group),
|
||||
)
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now visible.\n", cmd.ItemName, cmd.SceneName)
|
||||
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now visible.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||
}
|
||||
|
||||
return nil
|
||||
@@ -154,7 +217,7 @@ type SceneItemHideCmd struct {
|
||||
|
||||
// Run executes the command to hide a scene item.
|
||||
func (cmd *SceneItemHideCmd) Run(ctx *context) error {
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
@@ -168,9 +231,14 @@ func (cmd *SceneItemHideCmd) Run(ctx *context) error {
|
||||
}
|
||||
|
||||
if cmd.Group != "" {
|
||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' is now hidden.\n", cmd.ItemName, cmd.Group)
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"Scene item %s in group %s is now hidden.\n",
|
||||
ctx.Style.Highlight(cmd.ItemName),
|
||||
ctx.Style.Highlight(cmd.Group),
|
||||
)
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now hidden.\n", cmd.ItemName, cmd.SceneName)
|
||||
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now hidden.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||
}
|
||||
|
||||
return nil
|
||||
@@ -197,7 +265,7 @@ type SceneItemToggleCmd struct {
|
||||
|
||||
// Run executes the command to toggle the visibility of a scene item.
|
||||
func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
@@ -216,9 +284,14 @@ func (cmd *SceneItemToggleCmd) Run(ctx *context) error {
|
||||
}
|
||||
|
||||
if itemEnabled {
|
||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now hidden.\n", cmd.ItemName, cmd.SceneName)
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"Scene item %s in scene %s is now hidden.\n",
|
||||
ctx.Style.Highlight(cmd.ItemName),
|
||||
ctx.Style.Highlight(cmd.SceneName),
|
||||
)
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is now visible.\n", cmd.ItemName, cmd.SceneName)
|
||||
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is now visible.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||
}
|
||||
|
||||
return nil
|
||||
@@ -234,7 +307,7 @@ type SceneItemVisibleCmd struct {
|
||||
|
||||
// Run executes the command to check the visibility of a scene item.
|
||||
func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
@@ -245,9 +318,14 @@ func (cmd *SceneItemVisibleCmd) Run(ctx *context) error {
|
||||
}
|
||||
|
||||
if itemEnabled {
|
||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is visible.\n", cmd.ItemName, cmd.SceneName)
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"Scene item %s in scene %s is visible.\n",
|
||||
ctx.Style.Highlight(cmd.ItemName),
|
||||
ctx.Style.Highlight(cmd.SceneName),
|
||||
)
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' is hidden.\n", cmd.ItemName, cmd.SceneName)
|
||||
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s is hidden.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||
}
|
||||
return nil
|
||||
}
|
||||
@@ -278,7 +356,7 @@ type SceneItemTransformCmd struct {
|
||||
|
||||
// Run executes the command to transform a scene item.
|
||||
func (cmd *SceneItemTransformCmd) Run(ctx *context) error {
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx.Client, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||
sceneName, sceneItemID, err := getSceneNameAndItemID(ctx, cmd.SceneName, cmd.ItemName, cmd.Group)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
@@ -351,9 +429,14 @@ func (cmd *SceneItemTransformCmd) Run(ctx *context) error {
|
||||
}
|
||||
|
||||
if cmd.Group != "" {
|
||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in group '%s' transformed.\n", cmd.ItemName, cmd.Group)
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"Scene item %s in group %s transformed.\n",
|
||||
ctx.Style.Highlight(cmd.ItemName),
|
||||
ctx.Style.Highlight(cmd.Group),
|
||||
)
|
||||
} else {
|
||||
fmt.Fprintf(ctx.Out, "Scene item '%s' in scene '%s' transformed.\n", cmd.ItemName, cmd.SceneName)
|
||||
fmt.Fprintf(ctx.Out, "Scene item %s in scene %s transformed.\n", ctx.Style.Highlight(cmd.ItemName), ctx.Style.Highlight(cmd.SceneName))
|
||||
}
|
||||
|
||||
return nil
|
||||
|
||||
@@ -11,13 +11,10 @@ func TestSceneItemList(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &SceneItemListCmd{
|
||||
SceneName: "gobs-test",
|
||||
SceneName: "gobs-test-scene",
|
||||
}
|
||||
err := cmd.Run(context)
|
||||
if err != nil {
|
||||
|
||||
@@ -36,6 +36,6 @@ func (cmd *ScreenshotSaveCmd) Run(ctx *context) error {
|
||||
return fmt.Errorf("failed to take screenshot: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Screenshot saved to %s.\n", cmd.FilePath)
|
||||
fmt.Fprintf(ctx.Out, "Screenshot saved to %s.\n", ctx.Style.Highlight(cmd.FilePath))
|
||||
return nil
|
||||
}
|
||||
|
||||
334
settings.go
Normal file
334
settings.go
Normal file
@@ -0,0 +1,334 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/config"
|
||||
"github.com/andreykaipov/goobs/api/typedefs"
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
"github.com/charmbracelet/lipgloss/table"
|
||||
)
|
||||
|
||||
// SettingsCmd handles settings management.
|
||||
type SettingsCmd struct {
|
||||
Show SettingsShowCmd `help:"Show settings." cmd:"" aliases:"s"`
|
||||
Profile SettingsProfileCmd `help:"Get/Set profile parameter setting." cmd:"" aliases:"p"`
|
||||
StreamService SettingsStreamServiceCmd `help:"Get/Set stream service setting." cmd:"" aliases:"ss"`
|
||||
Video SettingsVideoCmd `help:"Get/Set video setting." cmd:"" aliases:"v"`
|
||||
}
|
||||
|
||||
// SettingsShowCmd shows the video settings.
|
||||
type SettingsShowCmd struct {
|
||||
Video bool `flag:"" help:"Show video settings."`
|
||||
Record bool `flag:"" help:"Show record directory."`
|
||||
Profile bool `flag:"" help:"Show profile parameters."`
|
||||
}
|
||||
|
||||
// Run executes the show command.
|
||||
// nolint: misspell
|
||||
func (cmd *SettingsShowCmd) Run(ctx *context) error {
|
||||
if !cmd.Video && !cmd.Record && !cmd.Profile {
|
||||
cmd.Video = true
|
||||
cmd.Record = true
|
||||
cmd.Profile = true
|
||||
}
|
||||
|
||||
// Get video settings
|
||||
videoResp, err := ctx.Client.Config.GetVideoSettings()
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get video settings: %w", err)
|
||||
}
|
||||
|
||||
vt := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||
Headers("Video Setting", "Value").
|
||||
StyleFunc(func(row, _ int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
vt.Row("Base Width", fmt.Sprintf("%.0f", videoResp.BaseWidth))
|
||||
vt.Row("Base Height", fmt.Sprintf("%.0f", videoResp.BaseHeight))
|
||||
vt.Row("Output Width", fmt.Sprintf("%.0f", videoResp.OutputWidth))
|
||||
vt.Row("Output Height", fmt.Sprintf("%.0f", videoResp.OutputHeight))
|
||||
vt.Row("FPS Numerator", fmt.Sprintf("%.0f", videoResp.FpsNumerator))
|
||||
vt.Row("FPS Denominator", fmt.Sprintf("%.0f", videoResp.FpsDenominator))
|
||||
|
||||
// Get record directory
|
||||
dirResp, err := ctx.Client.Config.GetRecordDirectory()
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get record directory: %w", err)
|
||||
}
|
||||
|
||||
rt := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||
Headers("Record Setting", "Value").
|
||||
StyleFunc(func(row, _ int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
rt.Row("Directory", dirResp.RecordDirectory)
|
||||
|
||||
// Get profile prameters
|
||||
pt := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||
Headers("Profile Parameter", "Value").
|
||||
StyleFunc(func(row, _ int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
// Common profile parameters to display
|
||||
params := []struct {
|
||||
category string
|
||||
name string
|
||||
label string
|
||||
}{
|
||||
{"Output", "Mode", "Output Mode"},
|
||||
|
||||
{"SimpleOutput", "StreamEncoder", "Simple Streaming Encoder"},
|
||||
{"SimpleOutput", "RecEncoder", "Simple Recording Encoder"},
|
||||
{"SimpleOutput", "RecFormat2", "Simple Recording Video Format"},
|
||||
{"SimpleOutput", "RecAudioEncoder", "Simple Recording Audio Format"},
|
||||
{"SimpleOutput", "RecQuality", "Simple Recording Quality"},
|
||||
|
||||
{"AdvOut", "Encoder", "Advanced Streaming Encoder"},
|
||||
{"AdvOut", "RecEncoder", "Advanced Recording Encoder"},
|
||||
{"AdvOut", "RecType", "Advanced Recording Type"},
|
||||
{"AdvOut", "RecFormat2", "Advanced Recording Video Format"},
|
||||
{"AdvOut", "RecAudioEncoder", "Advanced Recording Audio Format"},
|
||||
}
|
||||
|
||||
for _, param := range params {
|
||||
resp, err := ctx.Client.Config.GetProfileParameter(
|
||||
config.NewGetProfileParameterParams().
|
||||
WithParameterCategory(param.category).
|
||||
WithParameterName(param.name),
|
||||
)
|
||||
if err == nil && resp.ParameterValue != "" {
|
||||
pt.Row(param.label, resp.ParameterValue)
|
||||
}
|
||||
}
|
||||
|
||||
if cmd.Video {
|
||||
fmt.Fprintln(ctx.Out, vt.Render())
|
||||
}
|
||||
|
||||
if cmd.Record {
|
||||
fmt.Fprintln(ctx.Out, rt.Render())
|
||||
}
|
||||
|
||||
if cmd.Profile {
|
||||
fmt.Fprintln(ctx.Out, pt.Render())
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// SettingsProfileCmd gets/ sets a profile parameter.
|
||||
type SettingsProfileCmd struct {
|
||||
Category string `arg:"" help:"Parameter category (e.g., AdvOut, SimpleOutput, Output)." required:""`
|
||||
Name string `arg:"" help:"Parameter name (e.g., RecFormat2, RecEncoder)." required:""`
|
||||
Value string `arg:"" help:"Parameter value to set." optional:""`
|
||||
}
|
||||
|
||||
// Run executes the set command.
|
||||
func (cmd *SettingsProfileCmd) Run(ctx *context) error {
|
||||
if cmd.Value == "" {
|
||||
resp, err := ctx.Client.Config.GetProfileParameter(
|
||||
config.NewGetProfileParameterParams().
|
||||
WithParameterCategory(cmd.Category).
|
||||
WithParameterName(cmd.Name),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get parameter %s.%s: %w", cmd.Category, cmd.Name, err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "%s.%s = %s\n", cmd.Category, cmd.Name, resp.ParameterValue)
|
||||
return nil
|
||||
}
|
||||
|
||||
_, err := ctx.Client.Config.SetProfileParameter(
|
||||
config.NewSetProfileParameterParams().
|
||||
WithParameterCategory(cmd.Category).
|
||||
WithParameterName(cmd.Name).
|
||||
WithParameterValue(cmd.Value),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to set parameter %s.%s: %w", cmd.Category, cmd.Name, err)
|
||||
}
|
||||
|
||||
fmt.Fprintf(ctx.Out, "Set %s.%s = %s\n", cmd.Category, cmd.Name, cmd.Value)
|
||||
return nil
|
||||
}
|
||||
|
||||
// SettingsStreamServiceCmd gets/ sets stream service settings.
|
||||
type SettingsStreamServiceCmd struct {
|
||||
Type string `arg:"" help:"Stream type (e.g., rtmp_common, rtmp_custom)." optional:""`
|
||||
Key string ` help:"Stream key." flag:""`
|
||||
Server string ` help:"Stream server URL." flag:""`
|
||||
}
|
||||
|
||||
// Run executes the set stream service command.
|
||||
// nolint: misspell
|
||||
func (cmd *SettingsStreamServiceCmd) Run(ctx *context) error {
|
||||
resp, err := ctx.Client.Config.GetStreamServiceSettings()
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get stream service settings: %w", err)
|
||||
}
|
||||
|
||||
if cmd.Type == "" {
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||
Headers("Stream Service Setting", "Value").
|
||||
StyleFunc(func(row, _ int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
t.Row("Type", resp.StreamServiceType)
|
||||
t.Row("Key", resp.StreamServiceSettings.Key)
|
||||
t.Row("Server", resp.StreamServiceSettings.Server)
|
||||
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
if cmd.Key == "" {
|
||||
cmd.Key = resp.StreamServiceSettings.Key
|
||||
}
|
||||
if cmd.Server == "" {
|
||||
cmd.Server = resp.StreamServiceSettings.Server
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Config.SetStreamServiceSettings(
|
||||
config.NewSetStreamServiceSettingsParams().
|
||||
WithStreamServiceSettings(&typedefs.StreamServiceSettings{
|
||||
Key: cmd.Key,
|
||||
Server: cmd.Server,
|
||||
}).
|
||||
WithStreamServiceType(cmd.Type),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to set stream service settings: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, "Stream service settings updated successfully.")
|
||||
return nil
|
||||
}
|
||||
|
||||
// SettingsVideoCmd gets/ sets video settings.
|
||||
type SettingsVideoCmd struct {
|
||||
BaseWidth int `flag:"" help:"Base (canvas) width." min:"8"`
|
||||
BaseHeight int `flag:"" help:"Base (canvas) height." min:"8"`
|
||||
OutputWidth int `flag:"" help:"Output (scaled) width." min:"8"`
|
||||
OutputHeight int `flag:"" help:"Output (scaled) height." min:"8"`
|
||||
FPSNum int `flag:"" help:"Frames per second numerator." min:"1"`
|
||||
FPSDen int `flag:"" help:"Frames per second denominator." min:"1"`
|
||||
}
|
||||
|
||||
// Run executes the gets/ set video command.
|
||||
// nolint: misspell
|
||||
func (cmd *SettingsVideoCmd) Run(ctx *context) error {
|
||||
resp, err := ctx.Client.Config.GetVideoSettings()
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get video settings: %w", err)
|
||||
}
|
||||
|
||||
if cmd.BaseWidth == 0 && cmd.BaseHeight == 0 && cmd.OutputWidth == 0 &&
|
||||
cmd.OutputHeight == 0 && cmd.FPSNum == 0 && cmd.FPSDen == 0 {
|
||||
t := table.New().Border(lipgloss.RoundedBorder()).
|
||||
BorderStyle(lipgloss.NewStyle().Foreground(ctx.Style.border)).
|
||||
Headers("Video Setting", "Value").
|
||||
StyleFunc(func(row, _ int) lipgloss.Style {
|
||||
style := lipgloss.NewStyle().Padding(0, 3)
|
||||
switch {
|
||||
case row == table.HeaderRow:
|
||||
style = style.Bold(true).Align(lipgloss.Center)
|
||||
case row%2 == 0:
|
||||
style = style.Foreground(ctx.Style.evenRows)
|
||||
default:
|
||||
style = style.Foreground(ctx.Style.oddRows)
|
||||
}
|
||||
return style
|
||||
})
|
||||
|
||||
t.Row("Base Width", fmt.Sprintf("%.0f", resp.BaseWidth))
|
||||
t.Row("Base Height", fmt.Sprintf("%.0f", resp.BaseHeight))
|
||||
t.Row("Output Width", fmt.Sprintf("%.0f", resp.OutputWidth))
|
||||
t.Row("Output Height", fmt.Sprintf("%.0f", resp.OutputHeight))
|
||||
t.Row("FPS Numerator", fmt.Sprintf("%.0f", resp.FpsNumerator))
|
||||
t.Row("FPS Denominator", fmt.Sprintf("%.0f", resp.FpsDenominator))
|
||||
|
||||
fmt.Fprintln(ctx.Out, t.Render())
|
||||
return nil
|
||||
}
|
||||
|
||||
if cmd.BaseWidth == 0 {
|
||||
cmd.BaseWidth = int(resp.BaseWidth)
|
||||
}
|
||||
if cmd.BaseHeight == 0 {
|
||||
cmd.BaseHeight = int(resp.BaseHeight)
|
||||
}
|
||||
if cmd.OutputWidth == 0 {
|
||||
cmd.OutputWidth = int(resp.OutputWidth)
|
||||
}
|
||||
if cmd.OutputHeight == 0 {
|
||||
cmd.OutputHeight = int(resp.OutputHeight)
|
||||
}
|
||||
if cmd.FPSNum == 0 {
|
||||
cmd.FPSNum = int(resp.FpsNumerator)
|
||||
}
|
||||
if cmd.FPSDen == 0 {
|
||||
cmd.FPSDen = int(resp.FpsDenominator)
|
||||
}
|
||||
|
||||
_, err = ctx.Client.Config.SetVideoSettings(
|
||||
config.NewSetVideoSettingsParams().
|
||||
WithBaseWidth(float64(cmd.BaseWidth)).
|
||||
WithBaseHeight(float64(cmd.BaseHeight)).
|
||||
WithOutputWidth(float64(cmd.OutputWidth)).
|
||||
WithOutputHeight(float64(cmd.OutputHeight)).
|
||||
WithFpsNumerator(float64(cmd.FPSNum)).
|
||||
WithFpsDenominator(float64(cmd.FPSDen)),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to set video settings: %w", err)
|
||||
}
|
||||
|
||||
fmt.Fprintln(ctx.Out, "Video settings updated successfully.")
|
||||
return nil
|
||||
}
|
||||
@@ -12,10 +12,7 @@ func TestStreamStart(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdStatus := &StreamStatusCmd{}
|
||||
err := cmdStatus.Run(context)
|
||||
@@ -46,7 +43,7 @@ func TestStreamStart(t *testing.T) {
|
||||
if out.String() != "Stream started successfully.\n" {
|
||||
t.Fatalf("Expected output to contain 'Stream started successfully.', got '%s'", out.String())
|
||||
}
|
||||
time.Sleep(2 * time.Second) // Wait for the stream to start
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the stream to start
|
||||
}
|
||||
|
||||
func TestStreamStop(t *testing.T) {
|
||||
@@ -54,10 +51,7 @@ func TestStreamStop(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdStatus := &StreamStatusCmd{}
|
||||
err := cmdStatus.Run(context)
|
||||
@@ -88,7 +82,7 @@ func TestStreamStop(t *testing.T) {
|
||||
if out.String() != "Stream stopped successfully.\n" {
|
||||
t.Fatalf("Expected output to contain 'Stream stopped successfully.', got '%s'", out.String())
|
||||
}
|
||||
time.Sleep(2 * time.Second) // Wait for the stream to stop
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the stream to stop
|
||||
}
|
||||
|
||||
func TestStreamToggle(t *testing.T) {
|
||||
@@ -96,10 +90,7 @@ func TestStreamToggle(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdStatus := &StreamStatusCmd{}
|
||||
err := cmdStatus.Run(context)
|
||||
@@ -128,5 +119,5 @@ func TestStreamToggle(t *testing.T) {
|
||||
t.Fatalf("Expected 'Stream started successfully.', got: %s", out.String())
|
||||
}
|
||||
}
|
||||
time.Sleep(2 * time.Second) // Wait for the stream to toggle
|
||||
time.Sleep(500 * time.Millisecond) // Wait for the stream to toggle
|
||||
}
|
||||
|
||||
@@ -10,10 +10,7 @@ func TestStudioModeEnable(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdEnable := &StudioModeEnableCmd{}
|
||||
err := cmdEnable.Run(context)
|
||||
@@ -41,10 +38,7 @@ func TestStudioModeDisable(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmdDisable := &StudioModeDisableCmd{}
|
||||
err := cmdDisable.Run(context)
|
||||
|
||||
192
style.go
Normal file
192
style.go
Normal file
@@ -0,0 +1,192 @@
|
||||
// nolint: misspell
|
||||
package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"os"
|
||||
|
||||
"github.com/charmbracelet/lipgloss"
|
||||
)
|
||||
|
||||
// Style defines colours for the table styles.
|
||||
type Style struct {
|
||||
name string
|
||||
border lipgloss.Color
|
||||
oddRows lipgloss.Color
|
||||
evenRows lipgloss.Color
|
||||
highlight lipgloss.Color
|
||||
}
|
||||
|
||||
// Highlight applies the highlight style to the given text.
|
||||
func (s *Style) Highlight(text string) string {
|
||||
return lipgloss.NewStyle().Foreground(s.highlight).Render(text)
|
||||
}
|
||||
|
||||
func (s *Style) Error(text string) string {
|
||||
return lipgloss.NewStyle().Foreground(lipgloss.Color("#FF0000")).Render(text) // Red for errors
|
||||
}
|
||||
|
||||
func newRedStyle() Style {
|
||||
return Style{
|
||||
name: "red",
|
||||
border: lipgloss.Color("#D32F2F"), // Strong red for border
|
||||
oddRows: lipgloss.Color("#FFCDD2"), // Very light red for odd rows
|
||||
evenRows: lipgloss.Color("#EF9A9A"), // Light red for even rows
|
||||
highlight: lipgloss.Color("#EF9A9A"), // Highlight in light red
|
||||
}
|
||||
}
|
||||
|
||||
func newMagentaStyle() Style {
|
||||
return Style{
|
||||
name: "magenta",
|
||||
border: lipgloss.Color("#C2185B"), // Strong magenta for border
|
||||
oddRows: lipgloss.Color("#F8BBD0"), // Very light magenta/pink for odd rows
|
||||
evenRows: lipgloss.Color("#F48FB1"), // Light magenta/pink for even rows
|
||||
highlight: lipgloss.Color("#F48FB1"), // Highlight in light magenta/pink
|
||||
}
|
||||
}
|
||||
|
||||
func newPurpleStyle() Style {
|
||||
return Style{
|
||||
name: "purple",
|
||||
border: lipgloss.Color("#7B1FA2"), // Strong purple for border
|
||||
oddRows: lipgloss.Color("#E1BEE7"), // Very light purple for odd rows
|
||||
evenRows: lipgloss.Color("#CE93D8"), // Light purple for even rows
|
||||
highlight: lipgloss.Color("#CE93D8"), // Highlight in light purple
|
||||
}
|
||||
}
|
||||
|
||||
func newBlueStyle() Style {
|
||||
return Style{
|
||||
name: "blue",
|
||||
border: lipgloss.Color("#1976D2"), // Medium blue for border
|
||||
oddRows: lipgloss.Color("#E3F2FD"), // Very light blue for odd rows
|
||||
evenRows: lipgloss.Color("#BBDEFB"), // Light blue for even rows
|
||||
highlight: lipgloss.Color("#1976D2"), // Highlight in medium blue
|
||||
}
|
||||
}
|
||||
|
||||
func newCyanStyle() Style {
|
||||
return Style{
|
||||
name: "cyan",
|
||||
border: lipgloss.Color("#00BFCF"), // A strong cyan for border
|
||||
oddRows: lipgloss.Color("#E0F7FA"), // Very light cyan for odd rows
|
||||
evenRows: lipgloss.Color("#B2EBF2"), // Slightly darker light cyan for even rows
|
||||
highlight: lipgloss.Color("#00BFCF"), // Highlight in strong cyan
|
||||
}
|
||||
}
|
||||
|
||||
func newGreenStyle() Style {
|
||||
return Style{
|
||||
name: "green",
|
||||
border: lipgloss.Color("#43A047"), // Medium green for border
|
||||
oddRows: lipgloss.Color("#E8F5E9"), // Very light green for odd rows
|
||||
evenRows: lipgloss.Color("#C8E6C9"), // Light green for even rows
|
||||
highlight: lipgloss.Color("#43A047"), // Highlight in medium green
|
||||
}
|
||||
}
|
||||
|
||||
func newYellowStyle() Style {
|
||||
return Style{
|
||||
name: "yellow",
|
||||
border: lipgloss.Color("#FBC02D"), // Strong yellow for border
|
||||
oddRows: lipgloss.Color("#FFF9C4"), // Very light yellow for odd rows
|
||||
evenRows: lipgloss.Color("#FFF59D"), // Light yellow for even rows
|
||||
highlight: lipgloss.Color("#FBC02D"), // Highlight in strong yellow
|
||||
}
|
||||
}
|
||||
|
||||
func newOrangeStyle() Style {
|
||||
return Style{
|
||||
name: "orange",
|
||||
border: lipgloss.Color("#F57C00"), // Strong orange for border
|
||||
oddRows: lipgloss.Color("#FFF3E0"), // Very light orange for odd rows
|
||||
evenRows: lipgloss.Color("#FFE0B2"), // Light orange for even rows
|
||||
highlight: lipgloss.Color("#F57C00"), // Highlight in strong orange
|
||||
}
|
||||
}
|
||||
|
||||
func newWhiteStyle() Style {
|
||||
return Style{
|
||||
name: "white",
|
||||
border: lipgloss.Color("#FFFFFF"), // White for border
|
||||
oddRows: lipgloss.Color("#F0F0F0"), // Very light grey for odd rows
|
||||
evenRows: lipgloss.Color("#E0E0E0"), // Light grey for even rows
|
||||
highlight: lipgloss.Color("#FFFFFF"), // Highlight in white
|
||||
}
|
||||
}
|
||||
|
||||
func newGreyStyle() Style {
|
||||
return Style{
|
||||
name: "grey",
|
||||
border: lipgloss.Color("#9E9E9E"), // Medium grey for border
|
||||
oddRows: lipgloss.Color("#F5F5F5"), // Very light grey for odd rows
|
||||
evenRows: lipgloss.Color("#EEEEEE"), // Light grey for even rows
|
||||
highlight: lipgloss.Color("#9E9E9E"), // Highlight in medium grey
|
||||
}
|
||||
}
|
||||
|
||||
func newNavyBlueStyle() Style {
|
||||
return Style{
|
||||
name: "navy",
|
||||
border: lipgloss.Color("#001F3F"), // Navy blue for border
|
||||
oddRows: lipgloss.Color("#CFE2F3"), // Very light blue for odd rows
|
||||
evenRows: lipgloss.Color("#A9CCE3"), // Light blue for even rows
|
||||
highlight: lipgloss.Color("#001F3F"), // Highlight in navy blue
|
||||
}
|
||||
}
|
||||
|
||||
func newBlackStyle() Style {
|
||||
return Style{
|
||||
name: "black",
|
||||
border: lipgloss.Color("#000000"), // Black for border
|
||||
oddRows: lipgloss.Color("#333333"), // Dark grey for odd rows
|
||||
evenRows: lipgloss.Color("#444444"), // Slightly lighter dark grey for even rows
|
||||
highlight: lipgloss.Color("#000000"), // Highlight in black
|
||||
}
|
||||
}
|
||||
|
||||
func styleFromFlag(cfg StyleConfig) *Style {
|
||||
var style Style
|
||||
|
||||
switch cfg.Style {
|
||||
case "red":
|
||||
style = newRedStyle()
|
||||
case "magenta":
|
||||
style = newMagentaStyle()
|
||||
case "purple":
|
||||
style = newPurpleStyle()
|
||||
case "blue":
|
||||
style = newBlueStyle()
|
||||
case "cyan":
|
||||
style = newCyanStyle()
|
||||
case "green":
|
||||
style = newGreenStyle()
|
||||
case "yellow":
|
||||
style = newYellowStyle()
|
||||
case "orange":
|
||||
style = newOrangeStyle()
|
||||
case "white":
|
||||
style = newWhiteStyle()
|
||||
case "grey":
|
||||
style = newGreyStyle()
|
||||
case "navy":
|
||||
style = newNavyBlueStyle()
|
||||
case "black":
|
||||
style = newBlackStyle()
|
||||
default:
|
||||
err := os.Setenv("NO_COLOR", "1") // nolint: misspell
|
||||
if err != nil {
|
||||
// If we can't set NO_COLOR, we just log the error and continue
|
||||
// This is a fallback to ensure that the application can still run
|
||||
fmt.Fprintf(os.Stderr, "Error setting NO_COLOR: %v\n", err)
|
||||
}
|
||||
}
|
||||
|
||||
// If noBorder is true, we disable the border styling
|
||||
if cfg.NoBorder {
|
||||
style.border = ""
|
||||
}
|
||||
|
||||
return &style
|
||||
}
|
||||
85
text.go
Normal file
85
text.go
Normal file
@@ -0,0 +1,85 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"strings"
|
||||
|
||||
"github.com/andreykaipov/goobs/api/requests/inputs"
|
||||
)
|
||||
|
||||
// TextCmd provides commands for managing text inputs in OBS.
|
||||
type TextCmd struct {
|
||||
Current TextCurrentCmd `cmd:"current" help:"Display current text for a text input." aliases:"c"`
|
||||
Update TextUpdateCmd `cmd:"update" help:"Update the text of a text input." aliases:"u"`
|
||||
}
|
||||
|
||||
// TextCurrentCmd provides a command to display the current text of a text input.
|
||||
type TextCurrentCmd struct {
|
||||
InputName string `arg:"" help:"Name of the text source."`
|
||||
}
|
||||
|
||||
// Run executes the command to display the current text of a text input.
|
||||
func (cmd *TextCurrentCmd) Run(ctx *context) error {
|
||||
resp, err := ctx.Client.Inputs.GetInputSettings(
|
||||
inputs.NewGetInputSettingsParams().WithInputName(cmd.InputName),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get input settings: %w", err)
|
||||
}
|
||||
|
||||
// Check if the input is a text input
|
||||
kind := resp.InputKind
|
||||
if !strings.HasPrefix(kind, "text_") {
|
||||
return fmt.Errorf("input %s is of %s", cmd.InputName, kind)
|
||||
}
|
||||
|
||||
currentText, ok := resp.InputSettings["text"]
|
||||
if !ok {
|
||||
return fmt.Errorf("input %s does not have a 'text' setting", cmd.InputName)
|
||||
}
|
||||
if currentText == "" {
|
||||
currentText = "(empty)"
|
||||
}
|
||||
fmt.Fprintf(
|
||||
ctx.Out,
|
||||
"Current text for source %s: %s\n",
|
||||
ctx.Style.Highlight(cmd.InputName),
|
||||
currentText,
|
||||
)
|
||||
return nil
|
||||
}
|
||||
|
||||
// TextUpdateCmd provides a command to update the text of a text input.
|
||||
type TextUpdateCmd struct {
|
||||
InputName string `arg:"" help:"Name of the text source."`
|
||||
NewText string `arg:"" help:"New text to set for the source." default:""`
|
||||
}
|
||||
|
||||
// Run executes the command to update the text of a text input.
|
||||
func (cmd *TextUpdateCmd) Run(ctx *context) error {
|
||||
resp, err := ctx.Client.Inputs.GetInputSettings(
|
||||
inputs.NewGetInputSettingsParams().WithInputName(cmd.InputName),
|
||||
)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get input settings: %w", err)
|
||||
}
|
||||
|
||||
// Check if the input is a text input
|
||||
kind := resp.InputKind
|
||||
if !strings.HasPrefix(kind, "text_") {
|
||||
return fmt.Errorf("input %s is of %s", cmd.InputName, kind)
|
||||
}
|
||||
|
||||
if _, err := ctx.Client.Inputs.SetInputSettings(&inputs.SetInputSettingsParams{
|
||||
InputName: &cmd.InputName,
|
||||
InputSettings: map[string]any{"text": &cmd.NewText},
|
||||
}); err != nil {
|
||||
return fmt.Errorf("failed to update text for source %s: %w", cmd.InputName, err)
|
||||
}
|
||||
|
||||
if cmd.NewText == "" {
|
||||
cmd.NewText = "(empty)"
|
||||
}
|
||||
fmt.Fprintf(ctx.Out, "Updated text for source %s to: %s\n", ctx.Style.Highlight(cmd.InputName), cmd.NewText)
|
||||
return nil
|
||||
}
|
||||
55
util.go
55
util.go
@@ -2,7 +2,12 @@
|
||||
|
||||
package main
|
||||
|
||||
import "strings"
|
||||
import (
|
||||
"fmt"
|
||||
"os"
|
||||
"strings"
|
||||
"time"
|
||||
)
|
||||
|
||||
func snakeCaseToTitleCase(snake string) string {
|
||||
words := strings.Split(snake, "_")
|
||||
@@ -16,9 +21,15 @@ func snakeCaseToTitleCase(snake string) string {
|
||||
|
||||
func getEnabledMark(enabled bool) string {
|
||||
if enabled {
|
||||
return "\u2713" // green check mark
|
||||
if os.Getenv("NO_COLOR") != "" { // nolint: misspell
|
||||
return "✓"
|
||||
}
|
||||
return "●"
|
||||
}
|
||||
return "\u274c" // red cross mark
|
||||
if os.Getenv("NO_COLOR") != "" { // nolint: misspell
|
||||
return "✗"
|
||||
}
|
||||
return "○"
|
||||
}
|
||||
|
||||
func trimPrefix(s, prefix string) string {
|
||||
@@ -27,3 +38,41 @@ func trimPrefix(s, prefix string) string {
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
func parseTimeStringToMilliseconds(timeStr string) (float64, error) {
|
||||
parts := strings.Split(timeStr, ":")
|
||||
var durationStr string
|
||||
|
||||
switch len(parts) {
|
||||
case 1:
|
||||
// Format: SS -> "SSs"
|
||||
durationStr = parts[0] + "s"
|
||||
case 2:
|
||||
// Format: MM:SS -> "MMmSSs"
|
||||
durationStr = parts[0] + "m" + parts[1] + "s"
|
||||
case 3:
|
||||
// Format: HH:MM:SS -> "HHhMMmSSs"
|
||||
durationStr = parts[0] + "h" + parts[1] + "m" + parts[2] + "s"
|
||||
default:
|
||||
return 0, fmt.Errorf("invalid time format: %s", timeStr)
|
||||
}
|
||||
|
||||
duration, err := time.ParseDuration(durationStr)
|
||||
if err != nil {
|
||||
return 0, fmt.Errorf("failed to parse duration: %w", err)
|
||||
}
|
||||
|
||||
return duration.Seconds() * 1000, nil
|
||||
}
|
||||
|
||||
func formatMillisecondsToTimeString(ms float64) string {
|
||||
totalSeconds := int(ms / 1000)
|
||||
hours := totalSeconds / 3600
|
||||
minutes := (totalSeconds % 3600) / 60
|
||||
seconds := totalSeconds % 60
|
||||
|
||||
if hours > 0 {
|
||||
return fmt.Sprintf("%02d:%02d:%02d", hours, minutes, seconds)
|
||||
}
|
||||
return fmt.Sprintf("%02d:%02d", minutes, seconds)
|
||||
}
|
||||
|
||||
30
version.go
30
version.go
@@ -2,38 +2,8 @@ package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"runtime/debug"
|
||||
"strings"
|
||||
|
||||
"github.com/alecthomas/kong"
|
||||
)
|
||||
|
||||
var version string
|
||||
|
||||
// VersionFlag is a custom flag type for displaying version information.
|
||||
type VersionFlag string
|
||||
|
||||
// Decode implements the kong.Flag interface for VersionFlag.
|
||||
func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil }
|
||||
|
||||
// IsBool implements the kong.Flag interface for VersionFlag.
|
||||
func (v VersionFlag) IsBool() bool { return true }
|
||||
|
||||
// BeforeApply implements the kong.Flag interface for VersionFlag.
|
||||
func (v VersionFlag) BeforeApply(app *kong.Kong, _ kong.Vars) error { // nolint: unparam
|
||||
if version == "" {
|
||||
info, ok := debug.ReadBuildInfo()
|
||||
if !ok {
|
||||
return fmt.Errorf("failed to read build info")
|
||||
}
|
||||
version = strings.Split(info.Main.Version, "-")[0]
|
||||
}
|
||||
|
||||
fmt.Printf("gobs-cli version: %s\n", version)
|
||||
app.Exit(0) // Exit the application after printing the version
|
||||
return nil
|
||||
}
|
||||
|
||||
// ObsVersionCmd handles the version command.
|
||||
type ObsVersionCmd struct{} // size = 0x0
|
||||
|
||||
|
||||
@@ -11,10 +11,7 @@ func TestVersion(t *testing.T) {
|
||||
defer disconnect()
|
||||
|
||||
var out bytes.Buffer
|
||||
context := &context{
|
||||
Client: client,
|
||||
Out: &out,
|
||||
}
|
||||
context := newContext(client, &out, StyleConfig{})
|
||||
|
||||
cmd := &ObsVersionCmd{}
|
||||
err := cmd.Run(context)
|
||||
|
||||
Reference in New Issue
Block a user