fix patch number...

- print help on error
- print in compact mode

move version + VersionFlag into main
store version in kong.Vars

add 0.13.3 to CHANGELOG

CHANGELOG.md

@@ -5,6 +5,20 @@ All notable changes to this project will be documented in this file.
 The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
 and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
 
+# [0.13.2] - 2025-06-26
+
+### Changed
+
+-   usage is now printed on errors.
+-   help is printed in compact mode. This should make it easier to page through help on the root command.
+
+# [0.13.0] - 2025-06-23
+
+### Added
+
+-   record split and record chapter commands, see [RecordCmd](https://github.com/onyx-and-iris/gobs-cli?tab=readme-ov-file#recordcmd)
+    -   As of OBS 30.2.0, the only file format supporting *record chapter* is Hybrid MP4.
+
 # [0.12.1] - 2025-06-21
 
 ### Added

README.md

@@ -313,6 +313,21 @@ gobs-cli record directory "/home/me/obs-vids/"
 gobs-cli record directory "C:/Users/me/Videos"
 ```
 
+-   split: Split recording.
+
+```console
+gobs-cli record split
+```
+
+-   chapter: Create a chapter in the recording.
+
+    *optional*
+    -   arg: ChapterName
+
+```console
+gobs-cli record chapter "Chapter Name"
+```
+
 ### StreamCmd
 
 -   start: Start streaming.

main.go

@@ -8,6 +8,8 @@ import (
 	"io"
 	"os"
 	"path/filepath"
+	"runtime/debug"
+	"strings"
 	"time"
 
 	"github.com/alecthomas/kong"
@@ -16,6 +18,19 @@ import (
 	kongdotenv "github.com/titusjaka/kong-dotenv-go"
 )
 
+var version string // Version of the CLI, set at build time.
+
+// VersionFlag is a custom flag type that prints the version and exits.
+type VersionFlag string
+
+func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil }  // nolint: revive
+func (v VersionFlag) IsBool() bool                       { return true } // nolint: revive
+func (v VersionFlag) BeforeApply(app *kong.Kong, vars kong.Vars) error { // nolint: revive, unparam
+	fmt.Printf("gobs-cli version: %s\n", vars["version"])
+	app.Exit(0)
+	return nil
+}
+
 // ObsConfig holds the configuration for connecting to the OBS WebSocket server.
 type ObsConfig struct {
 	Host     string `flag:"host"     help:"Host to connect to."          default:"localhost" env:"OBS_HOST"     short:"H"`
@@ -31,7 +46,7 @@ type StyleConfig struct {
 }
 
 // CLI is the main command line interface structure.
-// It embeds the ObsConfig struct to inherit its fields and flags.
+// It embeds ObsConfig and StyleConfig to provide configuration options.
 type CLI struct {
 	ObsConfig   `embed:"" help:"OBS WebSocket configuration."`
 	StyleConfig `embed:"" help:"Style configuration."`
@@ -81,10 +96,25 @@ func main() {
 	var cli CLI
 	ctx := kong.Parse(
 		&cli,
-		kong.Name("GOBS-CLI"),
+		kong.Name("gobs-cli"),
 		kong.Description("A command line tool to interact with OBS Websocket."),
 		kong.Configuration(kongdotenv.ENVFileReader, ".env", filepath.Join(userConfigDir, "gobs-cli", "config.env")),
-	)
+		kong.UsageOnError(),
+		kong.ConfigureHelp(kong.HelpOptions{
+			Compact: true,
+		}),
+		kong.Vars{
+			"version": func() string {
+				if version == "" {
+					info, ok := debug.ReadBuildInfo()
+					if !ok {
+						return "(unable to read build info)"
+					}
+					version = strings.Split(info.Main.Version, "-")[0]
+				}
+				return version
+			}(),
+		})
 
 	client, err := connectObs(cli.ObsConfig)
 	ctx.FatalIfErrorf(err)

record.go

@@ -4,17 +4,20 @@ import (
 	"fmt"
 
 	"github.com/andreykaipov/goobs/api/requests/config"
+	"github.com/andreykaipov/goobs/api/requests/record"
 )
 
 // RecordCmd handles the recording commands.
 type RecordCmd struct {
-	Start     RecordStartCmd     `cmd:"" help:"Start recording."             aliases:"s"`
-	Stop      RecordStopCmd      `cmd:"" help:"Stop recording."              aliases:"st"`
-	Toggle    RecordToggleCmd    `cmd:"" help:"Toggle recording."            aliases:"tg"`
-	Status    RecordStatusCmd    `cmd:"" help:"Show recording status."       aliases:"ss"`
-	Pause     RecordPauseCmd     `cmd:"" help:"Pause recording."             aliases:"p"`
-	Resume    RecordResumeCmd    `cmd:"" help:"Resume recording."            aliases:"r"`
-	Directory RecordDirectoryCmd `cmd:"" help:"Get/Set recording directory." aliases:"d"`
+	Start     RecordStartCmd     `cmd:"" help:"Start recording."                   aliases:"s"`
+	Stop      RecordStopCmd      `cmd:"" help:"Stop recording."                    aliases:"st"`
+	Toggle    RecordToggleCmd    `cmd:"" help:"Toggle recording."                  aliases:"tg"`
+	Status    RecordStatusCmd    `cmd:"" help:"Show recording status."             aliases:"ss"`
+	Pause     RecordPauseCmd     `cmd:"" help:"Pause recording."                   aliases:"p"`
+	Resume    RecordResumeCmd    `cmd:"" help:"Resume recording."                  aliases:"r"`
+	Directory RecordDirectoryCmd `cmd:"" help:"Get/Set recording directory."       aliases:"d"`
+	Split     RecordSplitCmd     `cmd:"" help:"Split recording."                   aliases:"sp"`
+	Chapter   RecordChapterCmd   `cmd:"" help:"Create a chapter in the recording." aliases:"c"`
 }
 
 // RecordStartCmd starts the recording.
@@ -187,3 +190,68 @@ func (cmd *RecordDirectoryCmd) Run(ctx *context) error {
 	fmt.Fprintf(ctx.Out, "Recording directory set to: %s\n", ctx.Style.Highlight(cmd.RecordDirectory))
 	return nil
 }
+
+// RecordSplitCmd splits the current recording.
+type RecordSplitCmd struct{} // size = 0x0
+
+// Run executes the command to split the recording.
+func (cmd *RecordSplitCmd) Run(ctx *context) error {
+	status, err := ctx.Client.Record.GetRecordStatus()
+	if err != nil {
+		return err
+	}
+
+	if !status.OutputActive {
+		return fmt.Errorf("recording is not in progress")
+	}
+	if status.OutputPaused {
+		return fmt.Errorf("recording is paused, cannot split")
+	}
+
+	_, err = ctx.Client.Record.SplitRecordFile()
+	if err != nil {
+		return err
+	}
+
+	fmt.Fprintln(ctx.Out, "Recording split successfully.")
+	return nil
+}
+
+// RecordChapterCmd creates a chapter in the recording.
+type RecordChapterCmd struct {
+	ChapterName string `arg:"" help:"Name of the chapter to create." default:""`
+}
+
+// Run executes the command to create a chapter in the recording.
+func (cmd *RecordChapterCmd) Run(ctx *context) error {
+	status, err := ctx.Client.Record.GetRecordStatus()
+	if err != nil {
+		return err
+	}
+
+	if !status.OutputActive {
+		return fmt.Errorf("recording is not in progress")
+	}
+	if status.OutputPaused {
+		return fmt.Errorf("recording is paused, cannot create chapter")
+	}
+
+	var params *record.CreateRecordChapterParams
+	if cmd.ChapterName == "" {
+		params = record.NewCreateRecordChapterParams()
+	} else {
+		params = record.NewCreateRecordChapterParams().WithChapterName(cmd.ChapterName)
+	}
+
+	_, err = ctx.Client.Record.CreateRecordChapter(params)
+	if err != nil {
+		return err
+	}
+
+	if cmd.ChapterName == "" {
+		cmd.ChapterName = "unnamed"
+	}
+
+	fmt.Fprintf(ctx.Out, "Chapter %s created successfully.\n", ctx.Style.Highlight(cmd.ChapterName))
+	return nil
+}

version.go

@@ -2,38 +2,8 @@ package main
 
 import (
 	"fmt"
-	"runtime/debug"
-	"strings"
-
-	"github.com/alecthomas/kong"
 )
 
-var version string
-
-// VersionFlag is a custom flag type for displaying version information.
-type VersionFlag string
-
-// Decode implements the kong.Flag interface.
-func (v VersionFlag) Decode(_ *kong.DecodeContext) error { return nil }
-
-// IsBool implements the kong.Flag interface.
-func (v VersionFlag) IsBool() bool { return true }
-
-// BeforeApply implements the kong.Flag interface.
-func (v VersionFlag) BeforeApply(app *kong.Kong, _ kong.Vars) error { // nolint: unparam
-	if version == "" {
-		info, ok := debug.ReadBuildInfo()
-		if !ok {
-			return fmt.Errorf("failed to read build info")
-		}
-		version = strings.Split(info.Main.Version, "-")[0]
-	}
-
-	fmt.Printf("gobs-cli version: %s\n", version)
-	app.Exit(0) // Exit the application after printing the version
-	return nil
-}
-
 // ObsVersionCmd handles the version command.
 type ObsVersionCmd struct{} // size = 0x0